diff --git a/py/README.md b/py/README.md
new file mode 100644
index 0000000..2ff91f4
--- /dev/null
+++ b/py/README.md
@@ -0,0 +1,60 @@
+# Game Jam Kit
+A simple framework for making small games with [raylib](https://www.raylib.com/), [box2d](https://box2d.org/), and [LDtk](https://ldtk.io/).
+
+Python version of the [C++ Game Jam Kit](https://github.com/davabase/game_jam_kit).
+
+## Introduction
+The framework in setup as a series of classes that manage the lifecycle of each other.
+
+`Game` manages `Manager`s and `Scene`s.
+
+A `Manager` holds resources that are used across scenes. The resources are loaded at `Game::init()`.
+
+`Scene` manages `Service`s and `GameObject`s.
+
+`Scene`s also perform game logic for each level.
+
+A `Service` holds resources that are used in a single scene. The resources are loaded during init and disposed when the scene is disposed.
+
+`GameObject` manages `Component`s
+
+`GameObject`s also perform game logic for individual game entities.
+
+A `Component` is a reusable tool for creating `GameObject` behavior.
+
+Each of these pieces has lifecycle functions for `init()`, `update()`, and `draw()` that can be overridden when creating your own subclasses. These functions are called by the containing manager. If you do not wish for your class to be managed you shouldn't inherit from these base classes.
+
+The managers also have larger overridable functions, `init_*()`, `update_*()`, and `draw_*()` that give you increased control over how the manager is used.
+
+See `engine/prefabs` for prebuilt managers, services, game objects, and components.
+
+See `samples` for examples on how to build a `Scene`.
+
+See `main.py` for how to build a `Game`.
+
+## Running
+Create a python 3 venv:
+```
+python -m venv venv
+```
+
+Initialize it:
+
+on Windows:
+```
+venv\Scripts\activate
+```
+on the other ones:
+```
+source venv/bin/activate
+```
+
+Install requirements:
+```
+pip install -r requirements.txt
+```
+
+Run the main file:
+```
+python main.py
+```
diff --git a/py/assets/fonts/Roboto.ttf b/py/assets/fonts/Roboto.ttf
new file mode 100644
index 0000000..7e3bb2f
Binary files /dev/null and b/py/assets/fonts/Roboto.ttf differ
diff --git a/py/assets/fonts/RobotoMono.ttf b/py/assets/fonts/RobotoMono.ttf
new file mode 100644
index 0000000..3806bfb
Binary files /dev/null and b/py/assets/fonts/RobotoMono.ttf differ
diff --git a/py/assets/fonts/Tiny5.ttf b/py/assets/fonts/Tiny5.ttf
new file mode 100644
index 0000000..635fe07
Binary files /dev/null and b/py/assets/fonts/Tiny5.ttf differ
diff --git a/py/assets/gamecontrollerdb.txt b/py/assets/gamecontrollerdb.txt
new file mode 100644
index 0000000..394156d
--- /dev/null
+++ b/py/assets/gamecontrollerdb.txt
@@ -0,0 +1,2212 @@
+# Game Controller DB for SDL in 2.0.16 format
+# Source: https://github.com/mdqinc/SDL_GameControllerDB
+
+# Windows
+03000000300f00000a01000000000000,3 In 1 Conversion Box,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b8,x:b3,y:b0,platform:Windows,
+03000000fa190000918d000000000000,3 In 1 Conversion Box,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b8,x:b3,y:b0,platform:Windows,
+03000000fa2d00000100000000000000,3dRudder Foot Motion Controller,leftx:a0,lefty:a1,rightx:a5,righty:a2,platform:Windows,
+03000000d0160000040d000000000000,4Play Adapter,a:b1,b:b3,back:b4,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b6,leftstick:b14,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b15,righttrigger:b9,rightx:a3,righty:a4,start:b5,x:b0,y:b2,platform:Windows,
+03000000d0160000050d000000000000,4Play Adapter,a:b1,b:b3,back:b4,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b6,leftstick:b14,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b15,righttrigger:b9,rightx:a3,righty:a4,start:b5,x:b0,y:b2,platform:Windows,
+03000000d0160000060d000000000000,4Play Adapter,a:b1,b:b3,back:b4,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b6,leftstick:b14,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b15,righttrigger:b9,rightx:a3,righty:a4,start:b5,x:b0,y:b2,platform:Windows,
+03000000d0160000070d000000000000,4Play Adapter,a:b1,b:b3,back:b4,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b6,leftstick:b14,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b15,righttrigger:b9,rightx:a3,righty:a4,start:b5,x:b0,y:b2,platform:Windows,
+03000000d0160000600a000000000000,4Play Adapter,a:b1,b:b3,back:b4,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b6,leftstick:b14,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b15,righttrigger:b9,rightx:a3,righty:a4,start:b5,x:b0,y:b2,platform:Windows,
+03000000c82d00001930000000000000,8BitDo 64,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a4,start:b11,platform:Windows,
+03000000c82d00000031000000000000,8BitDo Adapter,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000531000000000000,8BitDo Adapter 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000951000000000000,8BitDo Dogbone,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a2,rightx:a3,righty:a5,start:b11,platform:Windows,
+03000000008000000210000000000000,8BitDo F30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+030000003512000011ab000000000000,8BitDo F30 Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000c82d00001028000000000000,8BitDo F30 Arcade Joystick,a:b0,b:b1,back:b10,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d000011ab000000000000,8BitDo F30 Arcade Joystick,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000801000000900000000000000,8BitDo F30 Arcade Stick,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001038000000000000,8BitDo F30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000090000000000000,8BitDo FC30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00006a28000000000000,8BitDo GameCube,a:b0,b:b3,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b9,paddle2:b8,rightshoulder:b10,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b1,y:b4,platform:Windows,
+03000000c82d00001251000000000000,8BitDo Lite 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00001151000000000000,8BitDo Lite SE,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000150000000000000,8BitDo M30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a3,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000151000000000000,8BitDo M30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a2,rightshoulder:b6,righttrigger:b7,rightx:a3,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000650000000000000,8BitDo M30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b8,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00005106000000000000,8BitDo M30,a:b0,b:b1,back:b10,dpdown:+a2,dpleft:-a0,dpright:+a0,dpup:-a2,guide:b2,leftshoulder:b8,lefttrigger:b9,rightshoulder:b6,righttrigger:b7,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00002090000000000000,8BitDo Micro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000310000000000000,8BitDo N30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000451000000000000,8BitDo N30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a2,rightx:a3,righty:a5,start:b11,platform:Windows,
+03000000c82d00002028000000000000,8BitDo N30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00008010000000000000,8BitDo N30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d0000e002000000000000,8BitDo N30,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,start:b6,platform:Windows,
+03000000c82d00000190000000000000,8BitDo N30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00001590000000000000,8BitDo N30 Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00006528000000000000,8BitDo N30 Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000290000000000000,8BitDo N64,+rightx:b9,+righty:b3,-rightx:b4,-righty:b8,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b7,start:b11,platform:Windows,
+03000000c82d00003038000000000000,8BitDo N64,+rightx:b9,+righty:b3,-rightx:b4,-righty:b8,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b7,start:b11,platform:Windows,
+03000000c82d00006928000000000000,8BitDo N64,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a4,start:b11,platform:Windows,
+03000000c82d00002590000000000000,8BitDo NEOGEO,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+030000003512000012ab000000000000,8BitDo NES30,a:b2,b:b1,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b7,x:b3,y:b0,platform:Windows,
+03000000c82d000012ab000000000000,8BitDo NES30,a:b1,b:b0,back:b10,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000022000000090000000000000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000203800000900000000000000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00002038000000000000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000751000000000000,8BitDo P30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a2,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000851000000000000,8BitDo P30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a2,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000360000000000000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000361000000000000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000660000000000000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000960000000000000,8BitDo Pro 3,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b17,paddle2:b16,paddle3:b2,paddle4:b5,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000131000000000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000231000000000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000331000000000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000431000000000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00002867000000000000,8BitDo S30,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,lefttrigger:b9,leftx:a0,lefty:a2,rightshoulder:b6,righttrigger:b7,rightx:a3,righty:a5,start:b10,x:b3,y:b4,platform:Windows,
+03000000c82d00000130000000000000,8BitDo SF30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000060000000000000,8BitDo SF30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000061000000000000,8BitDo SF30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Windows,
+03000000102800000900000000000000,8BitDo SFC30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d000021ab000000000000,8BitDo SFC30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00003028000000000000,8BitDo SFC30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+030000003512000020ab000000000000,8BitDo SN30,a:b0,b:b1,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000030000000000000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000351000000000000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a2,rightshoulder:b7,rightx:a3,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00001290000000000000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d000020ab000000000000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00004028000000000000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00006228000000000000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000021000000000000,8BitDo SN30 Pro,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000160000000000000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000161000000000000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000260000000000000,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00000261000000000000,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00001230000000000000,8BitDo Ultimate,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b2,paddle2:b5,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001260000000000000,8BitDo Ultimate 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b17,paddle2:b16,paddle3:b2,paddle4:b5,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001b30000000000000,8BitDo Ultimate 2C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b5,paddle2:b2,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001c30000000000000,8BitDo Ultimate 2C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b2,paddle2:b5,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001d30000000000000,8BitDo Ultimate 2C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b5,paddle2:b2,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001530000000000000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001630000000000000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001730000000000000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001130000000000000,8BitDo Ultimate Wired,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b26,paddle1:b24,paddle2:b25,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001330000000000000,8BitDo Ultimate Wireless,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b26,paddle1:b23,paddle2:b19,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00000121000000000000,8BitDo Xbox One SN30 Pro,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000a00500003232000000000000,8BitDo Zero,a:b0,b:b1,back:b10,dpdown:+a2,dpleft:-a0,dpright:+a0,dpup:-a2,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Windows,
+03000000c82d00001890000000000000,8BitDo Zero 2,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Windows,
+03000000c82d00003032000000000000,8BitDo Zero 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Windows,
+030000008f0e00001200000000000000,Acme GA02,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+03000000c01100000355000000000000,Acrux,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000fa190000f0ff000000000000,Acteck AGJ 3200,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000d1180000402c000000000000,ADT1,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a3,rightx:a2,righty:a5,x:b3,y:b4,platform:Windows,
+030000006f0e00008801000000000000,Afterglow Deluxe Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000341a00003608000000000000,Afterglow PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00000263000000000000,Afterglow PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001101000000000000,Afterglow PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001401000000000000,Afterglow PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001402000000000000,Afterglow PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001901000000000000,Afterglow PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001a01000000000000,Afterglow PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001301000000000000,Afterglow Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e00001302000000000000,Afterglow Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e00001304000000000000,Afterglow Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e00001413000000000000,Afterglow Xbox Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00003901000000000000,Afterglow Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ab1200000103000000000000,Afterglow Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b000000f9000000000000,Afterglow Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000100000008200000000000000,Akishop Customs PS360,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000007c1800000006000000000000,Alienware Dual Compatible PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b3,platform:Windows,
+03000000491900001904000000000000,Amazon Luna Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b9,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Windows,
+03000000710100001904000000000000,Amazon Luna Controller,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b5,leftstick:b8,leftx:a0,lefty:a1,misc1:b9,rightshoulder:b4,rightstick:b7,rightx:a3,righty:a4,start:b6,x:b3,y:b2,platform:Windows,
+0300000008100000e501000000000000,Anbernic Game Pad,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000020500000913000000000000,Anbernic RG P01,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000373500000710000000000000,Anbernic RG P01,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000373500004610000000000000,Anbernic RG P01,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000190e00000110000000000000,Aquaplus Piece,a:b1,b:b0,back:b3,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b2,platform:Windows,
+03000000830500000160000000000000,Arcade,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b3,x:b4,y:b4,platform:Windows,
+03000000120c0000100e000000000000,Armor 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000490b00004406000000000000,ASCII Seamic Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+03000000869800002500000000000000,Astro C40 TR PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000a30c00002700000000000000,Astro City Mini,a:b2,b:b1,back:b8,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,rightshoulder:b4,righttrigger:b5,start:b9,x:b3,y:b0,platform:Windows,
+03000000a30c00002800000000000000,Astro City Mini,a:b2,b:b1,back:b8,leftx:a3,lefty:a4,rightshoulder:b4,righttrigger:b5,start:b9,x:b3,y:b0,platform:Windows,
+03000000050b00000579000000000000,ASUS ROG Kunai 3,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000050b00000679000000000000,ASUS ROG Kunai 3,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000503200000110000000000000,Atari VCS Classic Controller,a:b0,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,start:b3,platform:Windows,
+03000000503200000210000000000000,Atari VCS Modern Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:Windows,
+03000000380800001889000000000000,AtGames Legends Gamer Pro,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b13,lefttrigger:b14,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000008a3500000102000000000000,Backbone One,a:b4,b:b5,back:b14,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b16,leftshoulder:b10,leftstick:b17,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b18,righttrigger:b13,rightx:a3,righty:a4,start:b15,x:b7,y:b8,platform:Windows,
+030000008a3500000201000000000000,Backbone One,a:b4,b:b5,back:b14,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b16,leftshoulder:b10,leftstick:b17,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b18,righttrigger:b13,rightx:a3,righty:a4,start:b15,x:b7,y:b8,platform:Windows,
+030000008a3500000302000000000000,Backbone One,a:b4,b:b5,back:b14,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b16,leftshoulder:b10,leftstick:b17,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b18,righttrigger:b13,rightx:a3,righty:a4,start:b15,x:b7,y:b8,platform:Windows,
+030000008a3500000402000000000000,Backbone One,a:b4,b:b5,back:b14,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b16,leftshoulder:b10,leftstick:b17,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b18,righttrigger:b13,rightx:a3,righty:a4,start:b15,x:b7,y:b8,platform:Windows,
+03000000e4150000103f000000000000,Batarang,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000d6200000e557000000000000,Batarang PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000c01100001352000000000000,Battalife Joystick,a:b6,b:b7,back:b2,leftshoulder:b0,leftx:a0,lefty:a1,rightshoulder:b1,start:b3,x:b4,y:b5,platform:Windows,
+030000006f0e00003201000000000000,Battlefield 4 PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000ad1b000001f9000000000000,BB 070,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000d62000002a79000000000000,BDA PS4 Fightpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000bc2000005250000000000000,Beitong G3,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b5,righttrigger:b9,rightx:a3,righty:a4,start:b15,x:b3,y:b4,platform:Windows,
+030000000d0500000208000000000000,Belkin Nostromo N40,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+03000000bc2000006012000000000000,Betop 2126F,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000bc2000000055000000000000,Betop BFM,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000790000000700000000000000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b3,y:b0,platform:Windows,
+03000000808300000300000000000000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b3,y:b0,platform:Windows,
+03000000bc2000006312000000000000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000bc2000006321000000000000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000bc2000006412000000000000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000c01100000555000000000000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000c01100000655000000000000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000006f0e00006401000000000000,BF One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Windows,
+03000000300f00000202000000000000,Bigben,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a5,righty:a2,start:b7,x:b2,y:b3,platform:Windows,
+030000006b1400000209000000000000,Bigben,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006b1400000055000000000000,Bigben PS3 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000006b1400000103000000000000,Bigben PS3 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Windows,
+03000000120c0000200e000000000000,Brook Mars PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000210e000000000000,Brook Mars PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000f10e000000000000,Brook PS2 Adapter,a:b1,b:b2,back:b13,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000120c0000310c000000000000,Brook Super Converter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,start:b9,x:b3,y:b0,platform:Windows,
+03000000d81d00000b00000000000000,Buffalo BSGP1601 Series,a:b5,b:b3,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b9,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b13,x:b4,y:b2,platform:Windows,
+030000005a1c00002400000000000000,Capcom Home Arcade Controller,a:b3,b:b4,back:b7,leftshoulder:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b6,x:b0,y:b1,platform:Windows,
+030000005b1c00002400000000000000,Capcom Home Arcade Controller,a:b3,b:b4,back:b7,leftshoulder:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b6,x:b0,y:b1,platform:Windows,
+030000005b1c00002500000000000000,Capcom Home Arcade Controller,a:b3,b:b4,back:b7,leftshoulder:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b6,x:b0,y:b1,platform:Windows,
+030000006d04000042c2000000000000,ChillStream,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000e82000006058000000000000,Cideko AK08b,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000457500000401000000000000,Cobra,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000b0400003365000000000000,Competition Pro,a:b0,b:b1,back:b2,leftx:a0,lefty:a1,start:b3,platform:Windows,
+030000004c050000c505000000000000,CronusMax Adapter,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000d814000007cd000000000000,Cthulhu,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000d8140000cefa000000000000,Cthulhu,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000260900008888000000000000,Cyber Gadget GameCube Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:a4,rightx:a2,righty:a3~,start:b7,x:b2,y:b3,platform:Windows,
+030000003807000002cb000000000000,Cyborg,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000a306000022f6000000000000,Cyborg V.3 Rumble,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:+a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:-a3,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000f806000000a3000000000000,DA Leader,a:b7,b:b6,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b0,leftstick:b8,lefttrigger:b1,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b9,righttrigger:b3,rightx:a2,righty:a3,start:b12,x:b4,y:b5,platform:Windows,
+030000001a1c00000001000000000000,Datel Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000451300000830000000000000,Defender Game Racer X7,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000791d00000103000000000000,Dual Box Wii,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000004f040000070f000000000000,Dual Power,a:b8,b:b9,back:b4,dpdown:b1,dpleft:b2,dpright:b3,dpup:b0,leftshoulder:b13,leftstick:b6,lefttrigger:b14,leftx:a0,lefty:a1,rightshoulder:b12,rightstick:b7,righttrigger:b15,start:b5,x:b10,y:b11,platform:Windows,
+030000004f04000012b3000000000000,Dual Power 3,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Windows,
+030000004f04000020b3000000000000,Dual Trigger,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Windows,
+03000000bd12000002e0000000000000,Dual Vibration Joystick,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b10,righttrigger:b5,rightx:a3,righty:a2,start:b11,x:b3,y:b0,platform:Windows,
+03000000ff1100003133000000000000,DualForce,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b0,y:b1,platform:Windows,
+030000006f0e00003001000000000000,EA Sports PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000fc0400000250000000000000,Easy Grip,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+03000000bc2000000091000000000000,EasySMX Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000006e0500000a20000000000000,Elecom DUX60 MMO,a:b2,b:b3,back:b17,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,leftstick:b14,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b15,righttrigger:b13,rightx:a3,righty:a4,start:b20,x:b0,y:b1,platform:Windows,
+03000000b80500000410000000000000,Elecom Gamepad,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Windows,
+03000000b80500000610000000000000,Elecom Gamepad,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Windows,
+03000095090000010000000000000000,Elecom JC-U609,a:b0,b:b1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,start:b8,x:b3,y:b4,platform:Windows,
+0300004112000000e500000000000000,Elecom JC-U909Z,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b7,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,start:b8,x:b3,y:b4,platform:Windows,
+03000041120000001050000000000000,Elecom JC-U911,a:b1,b:b2,back:b3,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,start:b0,x:b4,y:b5,platform:Windows,
+030000006e0500000520000000000000,Elecom P301U PlayStation Controller Adapter,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Windows,
+03000000250900000218000000000000,Elecom PlayStation Adapter,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000411200004450000000000000,Elecom U1012,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Windows,
+030000006e0500000320000000000000,Elecom U3613M,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Windows,
+030000006e0500000e20000000000000,Elecom U3912T,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Windows,
+030000006e0500000f20000000000000,Elecom U4013S,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Windows,
+030000006e0500001320000000000000,Elecom U4113,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006e0500001020000000000000,Elecom U4113S,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,start:b11,x:b0,y:b1,platform:Windows,
+030000006e0500000720000000000000,Elecom W01U,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Windows,
+030000007d0400000640000000000000,Eliminator AfterShock,a:b1,b:b2,back:b9,dpdown:+a3,dpleft:-a5,dpright:+a5,dpup:-a3,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a4,righty:a2,start:b8,x:b0,y:b3,platform:Windows,
+03000000120c0000f61c000000000000,Elite,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000430b00000300000000000000,EMS Production PS2 Adapter,a:b2,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000062000001801000000000000,EMS TrioLinker Plus II,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b2,y:b3,platform:Windows,
+03000000242f000000b7000000000000,ESM 9110,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Windows,
+03000000101c0000181c000000000000,Essential,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b4,leftx:a1,lefty:a0,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+030000008f0e00000f31000000000000,EXEQ,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Windows,
+03000000341a00000108000000000000,EXEQ RF Gamepad,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000006f0e00008401000000000000,Faceoff Deluxe Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00008101000000000000,Faceoff Deluxe Pro Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00008001000000000000,Faceoff Pro Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000021000000090000000000000,FC30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,leftstick:b13,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b9,rightstick:b14,righttrigger:b7,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Windows,
+0300000011040000c600000000000000,FC801,a:b0,b:b1,back:b6,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Windows,
+03000000852100000201000000000000,FF GP1,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000ad1b000028f0000000000000,Fightpad,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b00002ef0000000000000,Fightpad,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b000038f0000000000000,Fightpad TE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b8,rightshoulder:b5,righttrigger:b9,start:b7,x:b2,y:b3,platform:Windows,
+03005036852100000000000000000000,Final Fantasy XIV Online Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000f806000001a3000000000000,Firestorm,a:b9,b:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b0,leftstick:b10,lefttrigger:b1,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b11,righttrigger:b3,start:b12,x:b8,y:b4,platform:Windows,
+03000000b50700000399000000000000,Firestorm 2,a:b2,b:b4,back:b10,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b8,righttrigger:b9,start:b11,x:b3,y:b5,platform:Windows,
+03000000b50700001302000000000000,Firestorm D3,a:b0,b:b2,leftshoulder:b4,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,x:b1,y:b3,platform:Windows,
+03000000b40400001024000000000000,Flydigi Apex,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000151900004000000000000000,Flydigi Vader 2,a:b27,b:b26,back:b19,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,leftshoulder:b23,leftstick:b17,lefttrigger:b21,leftx:a0,lefty:a1,rightshoulder:b22,rightstick:b16,righttrigger:b20,rightx:a3,righty:a4,start:b18,x:b25,y:b24,platform:Windows,
+03000000b40400001124000000000000,Flydigi Vader 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b12,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b14,paddle1:b4,paddle2:b5,paddle3:b16,paddle4:b17,rightshoulder:b7,rightstick:b13,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b2,y:b3,platform:Windows,
+03000000b40400001224000000000000,Flydigi Vader 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b12,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b2,paddle1:b16,paddle2:b17,paddle3:b14,paddle4:b15,rightshoulder:b7,rightstick:b13,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+030000008305000000a0000000000000,G08XU,a:b0,b:b1,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b5,x:b2,y:b3,platform:Windows,
+0300000066f700000100000000000000,Game VIB Joystick,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,start:b11,x:b0,y:b1,platform:Windows,
+03000000260900002625000000000000,GameCube Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,lefttrigger:a4,leftx:a0,lefty:a1,righttrigger:a5,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Windows,
+03000000341a000005f7000000000000,GameCube Controller,a:b2,b:b3,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b1,y:b0,platform:Windows,
+03000000430b00000500000000000000,GameCube Controller,a:b0,b:b2,dpdown:b10,dpleft:b8,dpright:b9,dpup:b11,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:a3,rightx:a5,righty:a2,start:b7,x:b1,y:b3,platform:Windows,
+03000000790000004718000000000000,GameCube Controller,a:b1,b:b0,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+03000000790000004618000000000000,GameCube Controller Adapter,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+030000008f0e00000d31000000000000,Gamepad 3 Turbo,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000ac0500003d03000000000000,GameSir G3,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000ac0500005b05000000000000,GameSir G3w,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000ac0500002d02000000000000,GameSir G4,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000ac0500004d04000000000000,GameSir G4,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000ac0500001a06000000000000,GameSir T3 2.02,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000373500009410000000000000,GameSir Tegenaria Lite,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+030000004c0e00001035000000000000,Gamester,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+030000000d0f00001110000000000000,GameStick Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+0300000047530000616d000000000000,GameStop,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000c01100000140000000000000,GameStop PS4 Fun Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000b62500000100000000000000,Gametel GT004 01,a:b3,b:b0,dpdown:b10,dpleft:b9,dpright:b8,dpup:b11,leftshoulder:b4,rightshoulder:b5,start:b7,x:b1,y:b2,platform:Windows,
+030000008f0e00001411000000000000,Gamo2 Divaller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000120c0000a857000000000000,Gator Claw,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000c21100000791000000000000,Be1 GC101 Controller 1.03,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000c9110000f055000000000000,Be1 GC100XF Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000008305000009a0000000000000,Genius,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000008305000031b0000000000000,Genius Maxfire Blaze 3,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000451300000010000000000000,Genius Maxfire Grandias 12,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000005c1a00003330000000000000,Genius MaxFire Grandias 12V,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+03000000300f00000b01000000000000,GGE909 Recoil,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000f0250000c283000000000000,Gioteck PlayStation Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000f025000021c1000000000000,Gioteck PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000f025000031c1000000000000,Gioteck PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000f0250000c383000000000000,Gioteck VX2 PlayStation Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000f0250000c483000000000000,Gioteck VX2 PlayStation Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000d11800000094000000000000,Google Stadia Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:b11,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:Windows,
+030000004f04000026b3000000000000,GP XID,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+0300000079000000d418000000000000,GPD Win,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000c6240000025b000000000000,GPX,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000007d0400000840000000000000,Gravis Destroyer Tilt,+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b1,b:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,x:b0,y:b3,platform:Windows,
+030000007d0400000540000000000000,Gravis Eliminator Pro,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+03000000280400000140000000000000,Gravis GamePad Pro,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a3,dpup:-a4,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000008f0e00000610000000000000,GreenAsia,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b10,righttrigger:b5,rightx:a5,righty:a2,start:b11,x:b3,y:b0,platform:Windows,
+03000000ac0500006b05000000000000,GT2a,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000341a00000302000000000000,Hama Scorpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000008a2e0000dd10000000000000,Hand Held Legend GC Ultimate,a:b0,b:b2,back:b17,dpdown:b5,dpleft:b6,dpright:b7,dpup:b4,guide:b18,leftshoulder:b10,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b19,misc2:b24,paddle1:b13,paddle2:b12,rightshoulder:b11,rightstick:b9,righttrigger:a4,rightx:a2,righty:a5,start:b16,x:b1,y:b3,platform:Windows,
+030000008a2e0000df10000000000000,Hand Held Legend ProGCC,a:b1,b:b0,back:b17,dpdown:b5,dpleft:b6,dpright:b7,dpup:b4,guide:b18,leftshoulder:b10,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b19,paddle1:b13,paddle2:b12,rightshoulder:b11,rightstick:b9,righttrigger:a4,rightx:a2,righty:a5,start:b16,x:b3,y:b2,platform:Windows,
+030000000d0f00004900000000000000,Hatsune Miku Sho PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000001008000001e1000000000000,Havit HV G60,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b3,y:b0,platform:Windows,
+030000000d0f00000c00000000000000,HEXT,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000d81400000862000000000000,HitBox Edition Cthulhu,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b5,lefttrigger:b4,rightshoulder:b7,righttrigger:b6,start:b9,x:b0,y:b3,platform:Windows,
+03000000632500002605000000000000,HJD X,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+030000000d0f00000a00000000000000,Hori DOA,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f00008500000000000000,Hori Fighting Commander 2016 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00002500000000000000,Hori Fighting Commander 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00002d00000000000000,Hori Fighting Commander 3 Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00005f00000000000000,Hori Fighting Commander 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00005e00000000000000,Hori Fighting Commander 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000000d0f00008400000000000000,Hori Fighting Commander 5,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006201000000000000,Hori Fighting Commander Octa,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006401000000000000,Hori Fighting Commander Octa,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f00005100000000000000,Hori Fighting Commander PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00008600000000000000,Hori Fighting Commander Xbox 360,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f0000ba00000000000000,Hori Fighting Commander Xbox 360,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f00008800000000000000,Hori Fighting Stick mini 4 PS3,a:b1,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b8,x:b0,y:b3,platform:Windows,
+030000000d0f00008700000000000000,Hori Fighting Stick mini 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000000d0f00001000000000000000,Hori Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00003200000000000000,Hori Fightstick 3W,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000c000000000000000,Hori Fightstick 4,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f00000d00000000000000,Hori Fightstick EX2,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+030000000d0f00003701000000000000,Hori Fightstick Mini,a:b1,b:b0,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b3,y:b2,platform:Windows,
+030000000d0f00004000000000000000,Hori Fightstick Mini 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b5,lefttrigger:b4,rightshoulder:b7,righttrigger:b6,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00002100000000000000,Hori Fightstick V3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00002700000000000000,Hori Fightstick V3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000a000000000000000,Hori Grip TAC4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b13,x:b0,y:b3,platform:Windows,
+030000000d0f0000a500000000000000,Hori Miku Project Diva X HD PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000000d0f0000a600000000000000,Hori Miku Project Diva X HD PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000000d0f00000101000000000000,Hori Mini Hatsune Miku FT,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00005400000000000000,Hori Pad 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00000900000000000000,Hori Pad 3 Turbo,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00004d00000000000000,Hori Pad A,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00003801000000000000,Hori PC Engine Mini Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b9,platform:Windows,
+030000000d0f00009200000000000000,Hori Pokken Tournament DX Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00002301000000000000,Hori PS4 Controller Light,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+030000000d0f00001100000000000000,Hori Real Arcade Pro 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00002600000000000000,Hori Real Arcade Pro 3P,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00004b00000000000000,Hori Real Arcade Pro 3W,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006a00000000000000,Hori Real Arcade Pro 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006b00000000000000,Hori Real Arcade Pro 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00008a00000000000000,Hori Real Arcade Pro 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00008b00000000000000,Hori Real Arcade Pro 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006f00000000000000,Hori Real Arcade Pro 4 VLX,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00007000000000000000,Hori Real Arcade Pro 4 VLX,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00003d00000000000000,Hori Real Arcade Pro N3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b10,leftstick:b4,lefttrigger:b11,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b6,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000ae00000000000000,Hori Real Arcade Pro N4,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f00008c00000000000000,Hori Real Arcade Pro P4,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f0000aa00000000000000,Hori Real Arcade Pro S,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000d800000000000000,Hori Real Arcade Pro S,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Windows,
+030000000d0f00002200000000000000,Hori Real Arcade Pro V3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00005b00000000000000,Hori Real Arcade Pro V4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00005c00000000000000,Hori Real Arcade Pro V4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000af00000000000000,Hori Real Arcade Pro VHS,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00001b00000000000000,Hori Real Arcade Pro VX,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b000002f5000000000000,Hori Real Arcade Pro VX,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b11,rightx:a2,righty:a5,start:b6,x:b2,y:b3,platform:Windows,
+030000000d0f00009c00000000000000,Hori TAC Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000c900000000000000,Hori Taiko Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006400000000000000,Horipad 3TP,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00001300000000000000,Horipad 3W,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00005500000000000000,Horipad 4 FPS,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006e00000000000000,Horipad 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f00006600000000000000,Horipad 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000000d0f00004200000000000000,Horipad A,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000ad1b000001f5000000000000,Horipad EXT2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f0000ee00000000000000,Horipad Mini 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000c100000000000000,Horipad Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000000d0f0000f600000000000000,Horipad Nintendo Switch Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000000d0f00000202000000000000,Horipad O Nintendo Switch 2 Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,misc2:b14,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Windows,
+030000000d0f00006700000000000000,Horipad One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000000d0f00009601000000000000,Horipad Steam,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,misc2:b2,paddle1:b5,paddle2:b15,paddle3:b18,paddle4:b19,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+030000000d0f0000dc00000000000000,Horipad Switch,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000242e00000b20000000000000,Hyperkin Admiral N64 Controller,+rightx:b11,+righty:b13,-rightx:b8,-righty:b12,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b14,leftx:a0,lefty:a1,rightshoulder:b5,start:b9,platform:Windows,
+03000000242e0000ff0b000000000000,Hyperkin N64 Adapter,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a2,righty:a3,start:b9,platform:Windows,
+03000000790000004e95000000000000,Hyperkin N64 Controller Adapter,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b7,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a5,righty:a2,start:b9,platform:Windows,
+03000000242e00006a48000000000000,Hyperkin RetroN Sq,a:b3,b:b7,back:b5,dpdown:+a4,dpleft:-a0,dpright:+a0,dpup:-a4,leftshoulder:b0,rightshoulder:b1,start:b4,x:b2,y:b6,platform:Windows,
+03000000242f00000a20000000000000,Hyperkin Scout,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b2,y:b3,platform:Windows,
+03000000242e00000a20000000000000,Hyperkin Scout Premium SNES Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b2,y:b3,platform:Windows,
+03000000242e00006a38000000000000,Hyperkin Trooper 2,a:b0,b:b1,back:b4,leftshoulder:b2,leftx:a0,lefty:a1,rightshoulder:b3,start:b5,platform:Windows,
+03000000f00300008d04000000000000,HyperX Clutch,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:-a2,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:+a5,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000d81d00000e00000000000000,iBuffalo AC02 Arcade Joystick,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b11,righttrigger:b3,rightx:a2,righty:a5,start:b8,x:b4,y:b5,platform:Windows,
+03000000d81d00000f00000000000000,iBuffalo BSGP1204 Series,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000d81d00001000000000000000,iBuffalo BSGP1204P Series,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000005c0a00000285000000000000,iDroidCon,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b4,y:b6,platform:Windows,
+03000000696400006964000000000000,iDroidCon Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000511d00000230000000000000,iGUGU Gamecore,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b1,leftstick:b4,lefttrigger:b3,leftx:a0,lefty:a1,rightshoulder:b0,righttrigger:b2,platform:Windows,
+03000000b50700001403000000000000,Impact Black,a:b2,b:b3,back:b8,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Windows,
+030000006f0e00002401000000000000,Injustice Fightstick PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+03000000830500005130000000000000,InterAct ActionPad,a:b0,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+03000000ef0500000300000000000000,InterAct AxisPad,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,start:b11,x:b0,y:b1,platform:Windows,
+03000000fd0500000230000000000000,InterAct AxisPad,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a5,start:b11,x:b0,y:b1,platform:Windows,
+03000000fd0500000030000000000000,Interact GoPad,a:b3,b:b4,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,x:b0,y:b1,platform:Windows,
+03000000fd0500003902000000000000,InterAct Hammerhead,a:b3,b:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b2,lefttrigger:b8,rightshoulder:b7,rightstick:b5,righttrigger:b9,start:b10,x:b0,y:b1,platform:Windows,
+03000000fd0500002a26000000000000,InterAct Hammerhead FX,a:b3,b:b4,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b0,y:b1,platform:Windows,
+03000000fd0500002f26000000000000,InterAct Hammerhead FX,a:b4,b:b5,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b1,y:b2,platform:Windows,
+03000000fd0500005302000000000000,InterAct ProPad,a:b3,b:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,x:b0,y:b1,platform:Windows,
+03000000ac0500002c02000000000000,Ipega Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,leftstick:b13,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b9,rightstick:b14,righttrigger:b7,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000491900000204000000000000,Ipega PG9023,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000491900000304000000000000,Ipega PG9087,+righty:+a5,-righty:-a4,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,start:b11,x:b3,y:b4,platform:Windows,
+030000007e0500000620000000000000,Joy-Con (L),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b13,leftshoulder:b4,leftstick:b10,rightshoulder:b5,start:b8,x:b2,y:b3,platform:Windows,
+030000007e0500000720000000000000,Joy-Con (R),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b12,leftshoulder:b4,leftstick:b11,rightshoulder:b5,start:b9,x:b2,y:b3,platform:Windows,
+03000000250900000017000000000000,Joypad Adapter,a:b2,b:b1,back:b9,leftshoulder:b5,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b6,start:b8,x:b3,y:b0,platform:Windows,
+03000000bd12000003c0000000000000,Joypad Alpha Shock,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000ff1100004033000000000000,JPD FFB,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a2,start:b15,x:b3,y:b0,platform:Windows,
+03000000242f00002d00000000000000,JYS Adapter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000242f00008a00000000000000,JYS Adapter,a:b1,b:b4,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b0,y:b3,platform:Windows,
+03000000c4100000c082000000000000,KADE,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000828200000180000000000000,Keio,a:b4,b:b5,back:b8,leftshoulder:b2,lefttrigger:b3,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,start:b9,x:b0,y:b1,platform:Windows,
+03000000790000000200000000000000,King PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b3,y:b0,platform:Windows,
+03000000bd12000001e0000000000000,Leadership,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+030000006f0e00000103000000000000,Logic3,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e00000104000000000000,Logic3,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000008f0e00001300000000000000,Logic3,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000006d040000d1ca000000000000,Logitech ChillStream,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006d040000d2ca000000000000,Logitech Cordless Precision,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006d04000011c2000000000000,Logitech Cordless Wingman,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b9,leftstick:b5,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b2,righttrigger:b7,rightx:a3,righty:a4,x:b4,platform:Windows,
+030000006d04000016c2000000000000,Logitech Dual Action,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006d0400001dc2000000000000,Logitech F310,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006d04000018c2000000000000,Logitech F510,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006d0400001ec2000000000000,Logitech F510,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006d04000019c2000000000000,Logitech F710,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006d0400001fc2000000000000,Logitech F710,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006d0400001ac2000000000000,Logitech Precision,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000006d04000009c2000000000000,Logitech WingMan,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Windows,
+030000006d0400000bc2000000000000,Logitech WingMan Action Pad,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b8,lefttrigger:a5~,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b5,righttrigger:a2~,start:b8,x:b3,y:b4,platform:Windows,
+030000006d0400000ac2000000000000,Logitech WingMan RumblePad,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,rightx:a3,righty:a4,x:b3,y:b4,platform:Windows,
+03000000380700005645000000000000,Lynx,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000222200006000000000000000,Macally,a:b1,b:b2,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b33,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700003888000000000000,Mad Catz Arcade Fightstick TE S Plus PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700008532000000000000,Mad Catz Arcade Fightstick TE S PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700006352000000000000,Mad Catz CTRLR,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700006652000000000000,Mad Catz CTRLR,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700005032000000000000,Mad Catz Fightpad Pro PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700005082000000000000,Mad Catz Fightpad Pro PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000380700008031000000000000,Mad Catz FightStick Alpha PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000003807000038b7000000000000,Mad Catz Fightstick TE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b8,rightshoulder:b5,righttrigger:b9,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700008433000000000000,Mad Catz Fightstick TE S PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700008483000000000000,Mad Catz Fightstick TE S PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000380700008134000000000000,Mad Catz Fightstick TE2 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b7,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b4,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700008184000000000000,Mad Catz Fightstick TE2 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b5,leftstick:b10,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000380700006252000000000000,Mad Catz Micro CTRLR,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700008232000000000000,Mad Catz PlayStation Brawlpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700008731000000000000,Mad Catz PlayStation Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000003807000056a8000000000000,Mad Catz PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700001888000000000000,Mad Catz SFIV Fightstick PS3,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b5,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b4,righttrigger:b6,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000380700008081000000000000,Mad Catz SFV Arcade Fightstick Alpha PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000380700001847000000000000,Mad Catz Street Fighter 4 Xbox 360 FightStick,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b8,rightshoulder:b5,righttrigger:b9,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700008034000000000000,Mad Catz TE2 PS3 Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700008084000000000000,Mad Catz TE2 PS4 Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000002a0600001024000000000000,Matricom,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:Windows,
+030000009f000000adbb000000000000,MaxJoypad Virtual Controller,a:b1,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000250900000128000000000000,Mayflash Arcade Stick,a:b1,b:b2,back:b8,leftshoulder:b0,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b3,righttrigger:b7,start:b9,x:b5,y:b6,platform:Windows,
+030000008f0e00001330000000000000,Mayflash Controller Adapter,a:b1,b:b2,back:b8,dpdown:h0.8,dpleft:h0.2,dpright:h0.1,dpup:h0.4,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a3~,righty:a2,start:b9,x:b0,y:b3,platform:Windows,
+03000000242f00003700000000000000,Mayflash F101,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+03000000790000003018000000000000,Mayflash F300 Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+03000000242f00003900000000000000,Mayflash F300 Elite Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000790000004418000000000000,Mayflash GameCube Controller,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b0,y:b3,platform:Windows,
+03000000790000004318000000000000,Mayflash GameCube Controller Adapter,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b0,y:b3,platform:Windows,
+03000000242f00007300000000000000,Mayflash Magic NS,a:b1,b:b4,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b0,y:b3,platform:Windows,
+0300000079000000d218000000000000,Mayflash Magic NS,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000d620000010a7000000000000,Mayflash Magic NS,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000242f0000f500000000000000,Mayflash N64 Adapter,a:b2,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a2,righty:a5,start:b9,platform:Windows,
+03000000242f0000f400000000000000,Mayflash N64 Controller Adapter,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a2,righty:a5,start:b9,platform:Windows,
+03000000790000007918000000000000,Mayflash N64 Controller Adapter,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b9,leftx:a0,lefty:a1,righttrigger:b7,rightx:a3,righty:a2,start:b8,platform:Windows,
+030000008f0e00001030000000000000,Mayflash Saturn Adapter,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,lefttrigger:b7,rightshoulder:b6,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+0300000025090000e803000000000000,Mayflash Wii Classic Adapter,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:a4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:a5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Windows,
+03000000790000000318000000000000,Mayflash Wii DolphinBar,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Windows,
+03000000790000000018000000000000,Mayflash Wii U Pro Adapter,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000790000002418000000000000,Mega Drive Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,rightshoulder:b2,start:b9,x:b3,y:b4,platform:Windows,
+0300000079000000ae18000000000000,Mega Drive Controller,a:b0,b:b1,back:b7,dpdown:b14,dpleft:b15,dpright:b13,dpup:b2,rightshoulder:b6,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+03000000c0160000990a000000000000,Mega Drive Controller,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,righttrigger:b2,start:b3,platform:Windows,
+030000005e0400002800000000000000,Microsoft Dual Strike,a:b3,b:b2,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,rightshoulder:b7,rightx:a0,righty:a1~,start:b5,x:b1,y:b0,platform:Windows,
+030000005e0400000300000000000000,Microsoft SideWinder,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Windows,
+030000005e0400000700000000000000,Microsoft SideWinder,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+030000005e0400000e00000000000000,Microsoft SideWinder Freestyle Pro,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,start:b8,x:b3,y:b4,platform:Windows,
+030000005e0400002700000000000000,Microsoft SideWinder Plug and Play,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,lefttrigger:b4,righttrigger:b5,x:b2,y:b3,platform:Windows,
+03000000280d00000202000000000000,Miller Lite Cantroller,a:b0,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,start:b5,x:b2,y:b3,platform:Windows,
+03000000ad1b000023f0000000000000,MLG,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a6,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+03000000ad1b00003ef0000000000000,MLG Fightstick TE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b8,rightshoulder:b5,righttrigger:b9,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700006382000000000000,MLG PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000004523000015e0000000000000,Mobapad Chitu HD,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000491900000904000000000000,Mobapad Chitu HD,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000ffff00000000000000000000,Mocute M053,a:b3,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b11,leftstick:b7,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b6,righttrigger:b4,rightx:a3,righty:a4,start:b8,x:b1,y:b0,platform:Windows,
+03000000d6200000e589000000000000,Moga 2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Windows,
+03000000d62000007162000000000000,Moga Pro,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Windows,
+03000000d6200000ad0d000000000000,Moga Pro,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000c62400002a89000000000000,Moga XP5A Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c62400002b89000000000000,Moga XP5A Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c62400001a89000000000000,Moga XP5X Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c62400001b89000000000000,Moga XP5X Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000250900006688000000000000,MP-8866 Super Dual Box,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000091200004488000000000000,MUSIA PlayStation 2 Input Display,a:b0,b:b2,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,leftstick:b6,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b9,rightstick:b7,righttrigger:b11,rightx:a2,righty:a3,start:b5,x:b1,y:b3,platform:Windows,
+03000000f70600000100000000000000,N64 Adaptoid,+rightx:b2,+righty:b1,-rightx:b4,-righty:b5,a:b0,b:b3,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b6,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b7,start:b8,platform:Windows,
+030000006b140000010c000000000000,Nacon GC 400ES,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000006b1400001106000000000000,Nacon Revolution 3 PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+0300000085320000170d000000000000,Nacon Revolution 5 Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+0300000085320000190d000000000000,Nacon Revolution 5 Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000006b140000100d000000000000,Nacon Revolution Infinity PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000006b140000080d000000000000,Nacon Revolution Unlimited Pro Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000bd12000001c0000000000000,Nebular,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a5,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000eb0300000000000000000000,NeGcon Adapter,a:a2,b:b13,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,lefttrigger:a4,leftx:a1,righttrigger:b11,start:b3,x:a3,y:b12,platform:Windows,
+0300000038070000efbe000000000000,NEO SE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+0300000092120000474e000000000000,NeoGeo X Arcade Stick,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b9,x:b3,y:b2,platform:Windows,
+03000000921200004b46000000000000,NES 2 port Adapter,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b11,platform:Windows,
+03000000000f00000100000000000000,NES Controller,a:b1,b:b0,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b3,platform:Windows,
+03000000921200004346000000000000,NES Controller,a:b0,b:b1,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b3,platform:Windows,
+03000000790000004518000000000000,NEXILUX GameCube Controller Adapter,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+030000001008000001e5000000000000,NEXT SNES Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,righttrigger:b6,start:b9,x:b3,y:b0,platform:Windows,
+03000000050b00000045000000000000,Nexus,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b10,x:b2,y:b3,platform:Windows,
+03000000152000000182000000000000,NGDS,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b3,y:b0,platform:Windows,
+03000000ec110000e1a7000000000000,Nintendo Switch,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000007e0500006920000000000000,Nintendo Switch 2 Pro Controller,a:b0,b:b1,back:b14,dpdown:b8,dpleft:b10,dpright:b9,dpup:b11,guide:b16,leftshoulder:b12,leftstick:b15,lefttrigger:b13,leftx:a0,lefty:a1~,misc1:b17,misc2:b20,paddle1:b18,paddle2:b19,rightshoulder:b4,rightstick:b7,righttrigger:b5,rightx:a2,righty:a3~,start:b6,x:b2,y:b3,platform:Windows,
+030000007e0500000920000000000000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000000d0500000308000000000000,Nostromo N45,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b12,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b10,x:b2,y:b3,platform:Windows,
+030000007e0500007320000000000000,NSO GameCube Controller,a:b1,b:b3,dpdown:b8,dpleft:b10,dpright:b9,dpup:b11,guide:b16,leftshoulder:b13,lefttrigger:b12,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b4,rightx:a2,righty:a3~,start:b6,x:b0,y:b2,platform:Windows,
+030000007e0500001920000000000000,NSO N64 Controller,+rightx:b8,+righty:b2,-rightx:b3,-righty:b7,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,righttrigger:b10,start:b9,platform:Windows,
+030000007e0500001720000000000000,NSO SNES Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b15,start:b9,x:b2,y:b3,platform:Windows,
+03000000550900001472000000000000,NVIDIA Controller,a:b11,b:b10,back:b13,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b7,leftstick:b5,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b4,righttrigger:a5,rightx:a3,righty:a6,start:b3,x:b9,y:b8,platform:Windows,
+03000000550900001072000000000000,NVIDIA Shield,a:b9,b:b8,back:b11,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b3,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b2,righttrigger:a4,rightx:a2,righty:a5,start:b0,x:b7,y:b6,platform:Windows,
+030000005509000000b4000000000000,NVIDIA Virtual,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000120c00000288000000000000,Nyko Air Flo Xbox Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+030000004b120000014d000000000000,NYKO Airflo EX,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+03000000d62000001d57000000000000,Nyko Airflo PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000791d00000900000000000000,Nyko Playpad,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000782300000a10000000000000,Onlive Controller,a:b15,b:b14,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b5,leftshoulder:b11,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b13,y:b12,platform:Windows,
+030000000d0f00000401000000000000,Onyx,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000008916000001fd000000000000,Onza CE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a3,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000008916000000fd000000000000,Onza TE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000d62000006d57000000000000,OPP PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006b14000001a1000000000000,Orange Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Windows,
+0300000009120000072f000000000000,OrangeFox86 DreamPicoPort,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:-a2,leftx:a0,lefty:a1,righttrigger:-a5,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000362800000100000000000000,OUYA Controller,a:b0,b:b3,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,guide:b14,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,x:b1,y:b2,platform:Windows,
+03000000120c0000f60e000000000000,P4 Gamepad,a:b1,b:b2,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b5,lefttrigger:b7,rightshoulder:b4,righttrigger:b6,start:b9,x:b0,y:b3,platform:Windows,
+03000000790000002201000000000000,PC Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000006f0e00008501000000000000,PDP Fightpad Pro GameCube Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000006f0e00000901000000000000,PDP PS3 Versus Fighting,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00008901000000000000,PDP Realmz Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000008f0e00004100000000000000,PlaySega,a:b1,b:b0,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b5,righttrigger:b2,start:b8,x:b4,y:b3,platform:Windows,
+03000000d620000011a7000000000000,PowerA Core Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000dd62000015a7000000000000,PowerA Fusion Nintendo Switch Arcade Stick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000d620000012a7000000000000,PowerA Fusion Nintendo Switch Fight Pad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000dd62000016a7000000000000,PowerA Fusion Pro Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000d620000013a7000000000000,PowerA Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000d62000003340000000000000,PowerA OPS Pro Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000d62000002640000000000000,PowerA OPS Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000d62000006dca000000000000,PowerA Pro Ex,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+0300000062060000d570000000000000,PowerA PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000d620000014a7000000000000,PowerA Spectra Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006d04000084ca000000000000,Precision,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+03000000d62000009557000000000000,Pro Elite PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000c62400001a53000000000000,Pro Ex Mini,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000d62000009f31000000000000,Pro Ex mini PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000d6200000c757000000000000,Pro Ex mini PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000120c0000110e000000000000,Pro5,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000100800000100000000000000,PS1 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+030000008f0e00007530000000000000,PS1 Controller,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b1,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000100800000300000000000000,PS2 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a4,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000250900000088000000000000,PS2 Controller,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000250900006888000000000000,PS2 Controller,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b6,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000250900008888000000000000,PS2 Controller,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+030000006b1400000303000000000000,PS2 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000009d0d00001330000000000000,PS2 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000151a00006222000000000000,PS2 Dual Plus Adapter,a:b2,b:b1,back:b9,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000120a00000100000000000000,PS3 Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000120c00001307000000000000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000120c00001cf1000000000000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000120c0000f90e000000000000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000250900000118000000000000,PS3 Controller,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000250900000500000000000000,PS3 Controller,a:b2,b:b1,back:b9,dpdown:h0.8,dpleft:h0.4,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b0,y:b3,platform:Windows,
+030000004c0500006802000000000000,PS3 Controller,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b10,lefttrigger:a3~,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:a4~,rightx:a2,righty:a5,start:b8,x:b3,y:b0,platform:Windows,
+030000004f1f00000800000000000000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+03000000632500007505000000000000,PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000888800000803000000000000,PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b9,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:b7,rightx:a3,righty:a4,start:b11,x:b3,y:b0,platform:Windows,
+03000000888800000804000000000000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Windows,
+030000008f0e00000300000000000000,PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b3,y:b0,platform:Windows,
+030000008f0e00001431000000000000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000ba2200002010000000000000,PS3 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a5,righty:a2,start:b9,x:b3,y:b2,platform:Windows,
+03000000120c00000807000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000111e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000121e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000130e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000150e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000180e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000181e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000191e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c00001e0e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000a957000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000aa57000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000f21c000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000f31c000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000f41c000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000f51c000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120c0000f70e000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000120e0000120c000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000160e0000120c000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000001a1e0000120c000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000004c050000a00b000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000004c050000c405000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000004c050000cc09000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000004c0500005f0e000000000000,PS5 Access Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000004c050000e60c000000000000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000004c050000f20d000000000000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000830500005020000000000000,PSX,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b2,y:b3,platform:Windows,
+03000000300f00000111000000000000,Qanba 2,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000300f00000211000000000000,Qanba 2P,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000300f00000011000000000000,Qanba Arcade Stick 1008,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b10,x:b0,y:b3,platform:Windows,
+03000000300f00001611000000000000,Qanba Arcade Stick 4018,a:b1,b:b2,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b8,x:b0,y:b3,platform:Windows,
+03000000222c00000025000000000000,Qanba Dragon Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000222c00000020000000000000,Qanba Drone Arcade Stick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:a3,rightshoulder:b5,righttrigger:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000300f00001211000000000000,Qanba Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000300f00001210000000000000,Qanba Joystick Plus,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b2,y:b3,platform:Windows,
+03000000341a00000104000000000000,Qanba Joystick Q4RAF,a:b5,b:b6,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b0,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b3,righttrigger:b7,start:b9,x:b1,y:b2,platform:Windows,
+03000000222c00000223000000000000,Qanba Obsidian Arcade Stick PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000222c00000023000000000000,Qanba Obsidian Arcade Stick PS4,a:b1,b:b2,back:b13,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000008a2400006682000000000000,R1 Mobile Controller,a:b3,b:b1,back:b7,leftx:a0,lefty:a1,start:b6,x:b4,y:b0,platform:Windows,
+03000000086700006626000000000000,RadioShack,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b3,y:b0,platform:Windows,
+03000000ff1100004733000000000000,Ramox FPS Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b9,x:b3,y:b0,platform:Windows,
+030000009b2800002300000000000000,Raphnet 3DO Adapter,a:b0,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b2,start:b3,platform:Windows,
+030000009b2800006900000000000000,Raphnet 3DO Adapter,a:b0,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b2,start:b3,platform:Windows,
+030000009b2800000800000000000000,Raphnet Dreamcast Adapter,a:b2,b:b1,dpdown:b5,dpleft:b6,dpright:b7,dpup:b4,lefttrigger:a2,leftx:a0,righttrigger:a3,righty:a1,start:b3,x:b10,y:b9,platform:Windows,
+030000009b280000d000000000000000,Raphnet Dreamcast Adapter,a:b1,b:b0,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,lefttrigger:+a5,leftx:a0,lefty:a1,righttrigger:+a2,start:b3,x:b5,y:b4,platform:Windows,
+030000009b2800006200000000000000,Raphnet GameCube Adapter,a:b0,b:b7,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,rightx:a3,righty:a4,start:b3,x:b1,y:b8,platform:Windows,
+030000009b2800003200000000000000,Raphnet GC and N64 Adapter,a:b0,b:b7,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,lefttrigger:+a5,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:+a2,rightx:a3,righty:a4,start:b3,x:b1,y:b8,platform:Windows,
+030000009b2800006000000000000000,Raphnet GC and N64 Adapter,a:b0,b:b7,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,lefttrigger:+a5,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:+a2,rightx:a3,righty:a4,start:b3,x:b1,y:b8,platform:Windows,
+030000009b2800001800000000000000,Raphnet Jaguar Adapter,a:b2,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b0,righttrigger:b10,start:b3,x:b11,y:b12,platform:Windows,
+030000009b2800003c00000000000000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Windows,
+030000009b2800006100000000000000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Windows,
+030000009b2800006300000000000000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Windows,
+030000009b2800006400000000000000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Windows,
+030000009b2800000200000000000000,Raphnet NES Adapter,a:b7,b:b6,back:b5,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,start:b4,platform:Windows,
+030000009b2800004400000000000000,Raphnet PS1 and PS2 Adapter,a:b1,b:b2,back:b5,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,leftshoulder:b6,leftstick:b10,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b9,rightx:a3,righty:a4,start:b4,x:b0,y:b3,platform:Windows,
+030000009b2800004300000000000000,Raphnet Saturn,a:b0,b:b1,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Windows,
+030000009b2800000500000000000000,Raphnet Saturn Adapter 2.0,a:b1,b:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b4,rightshoulder:b7,righttrigger:b5,start:b9,x:b0,y:b3,platform:Windows,
+030000009b2800000300000000000000,Raphnet SNES Adapter,a:b0,b:b4,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Windows,
+030000009b2800002600000000000000,Raphnet SNES Adapter,a:b1,b:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Windows,
+030000009b2800002e00000000000000,Raphnet SNES Adapter,a:b1,b:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Windows,
+030000009b2800002f00000000000000,Raphnet SNES Adapter,a:b1,b:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Windows,
+030000009b2800005600000000000000,Raphnet SNES Adapter,a:b1,b:b4,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Windows,
+030000009b2800005700000000000000,Raphnet SNES Adapter,a:b1,b:b4,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Windows,
+030000009b2800001e00000000000000,Raphnet Vectrex Adapter,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a1,lefty:a2,x:b2,y:b3,platform:Windows,
+030000009b2800002b00000000000000,Raphnet Wii Classic Adapter,a:b1,b:b4,back:b2,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,guide:b10,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a4,start:b3,x:b0,y:b5,platform:Windows,
+030000009b2800002c00000000000000,Raphnet Wii Classic Adapter,a:b1,b:b4,back:b2,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,guide:b10,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a4,start:b3,x:b0,y:b5,platform:Windows,
+030000009b2800008000000000000000,Raphnet Wii Classic Adapter,a:b1,b:b4,back:b2,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,guide:b10,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a4,start:b3,x:b0,y:b5,platform:Windows,
+03000000790000008f18000000000000,Rapoo Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b3,y:b0,platform:Windows,
+0300000032150000a602000000000000,Razer Huntsman V3 Pro,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b12,dpright:b13,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000321500000003000000000000,Razer Hydra,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000f8270000bf0b000000000000,Razer Kishi,a:b6,b:b7,back:b16,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b18,leftshoulder:b12,leftstick:b19,lefttrigger:b14,leftx:a0,lefty:a1,rightshoulder:b13,rightstick:b20,righttrigger:b15,rightx:a3,righty:a4,start:b17,x:b9,y:b10,platform:Windows,
+03000000321500000204000000000000,Razer Panthera PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000321500000104000000000000,Razer Panthera PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000321500000010000000000000,Razer Raiju,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000321500000507000000000000,Razer Raiju Mobile,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000321500000707000000000000,Razer Raiju Mobile,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000321500000710000000000000,Razer Raiju TE,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000321500000a10000000000000,Razer Raiju TE,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000321500000410000000000000,Razer Raiju UE,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000321500000910000000000000,Razer Raiju UE,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000321500000011000000000000,Razer Raion PS4 Fightpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000321500000009000000000000,Razer Serval,+lefty:+a2,-lefty:-a1,a:b0,b:b1,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,leftx:a0,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000921200004547000000000000,Retro Bit Sega Genesis Controller Adapter,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,lefttrigger:b7,rightshoulder:b5,righttrigger:b2,start:b6,x:b3,y:b4,platform:Windows,
+03000000790000001100000000000000,Retro Controller,a:b1,b:b2,back:b8,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,leftshoulder:b6,lefttrigger:b7,rightshoulder:b4,righttrigger:b5,start:b9,x:b0,y:b3,platform:Windows,
+03000000830500006020000000000000,Retro Controller,a:b0,b:b1,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b5,rightshoulder:b8,righttrigger:b9,start:b7,x:b2,y:b3,platform:Windows,
+03000000632500007805000000000000,Retro Fighters Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+0300000003040000c197000000000000,Retrode Adapter,a:b0,b:b4,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Windows,
+03000000bd12000013d0000000000000,Retrolink Sega Saturn Classic Controller,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b5,lefttrigger:b6,rightshoulder:b2,righttrigger:b7,start:b8,x:b3,y:b4,platform:Windows,
+03000000bd12000015d0000000000000,Retrolink SNES Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b3,y:b0,platform:Windows,
+03000000341200000400000000000000,RetroUSB N64 RetroPort,+rightx:b8,+righty:b10,-rightx:b9,-righty:b11,a:b7,b:b6,dpdown:b2,dpleft:b1,dpright:b0,dpup:b3,leftshoulder:b13,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b12,start:b4,platform:Windows,
+0300000000f000000300000000000000,RetroUSB RetroPad,a:b1,b:b5,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b4,platform:Windows,
+0300000000f00000f100000000000000,RetroUSB Super RetroPort,a:b1,b:b5,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b4,platform:Windows,
+03000000830500000960000000000000,Revenger,a:b0,b:b1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b3,x:b4,y:b5,platform:Windows,
+030000006b140000010d000000000000,Revolution Pro Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000006b140000020d000000000000,Revolution Pro Controller 2,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000006b140000130d000000000000,Revolution Pro Controller 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001f01000000000000,Rock Candy,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e00004601000000000000,Rock Candy,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000c6240000fefa000000000000,Rock Candy Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e00008701000000000000,Rock Candy Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00001e01000000000000,Rock Candy PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00002801000000000000,Rock Candy PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00002f01000000000000,Rock Candy PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000830500007030000000000000,Rockfire Space Ranger,a:b0,b:b1,back:b5,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b9,righttrigger:b8,start:b2,x:b3,y:b4,platform:Windows,
+03000000050b0000e318000000000000,ROG Chakram,a:b1,b:b0,leftx:a0,lefty:a1,x:b2,y:b3,platform:Windows,
+03000000050b0000e518000000000000,ROG Chakram,a:b1,b:b0,leftx:a0,lefty:a1,x:b2,y:b3,platform:Windows,
+03000000050b00005819000000000000,ROG Chakram Core,a:b1,b:b0,leftx:a0,lefty:a1,x:b2,y:b3,platform:Windows,
+03000000050b0000181a000000000000,ROG Chakram X,a:b1,b:b0,leftx:a0,lefty:a1,x:b2,y:b3,platform:Windows,
+03000000050b00001a1a000000000000,ROG Chakram X,a:b1,b:b0,leftx:a0,lefty:a1,x:b2,y:b3,platform:Windows,
+03000000050b00001c1a000000000000,ROG Chakram X,a:b1,b:b0,leftx:a0,lefty:a1,x:b2,y:b3,platform:Windows,
+030000004f04000001d0000000000000,Rumble Force,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Windows,
+030000000d0f0000ad00000000000000,RX Gamepad,a:b0,b:b4,back:b11,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b3,rightshoulder:b6,start:b9,x:b2,y:b1,platform:Windows,
+030000008916000000fe000000000000,Sabertooth,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000c6240000045d000000000000,Sabertooth,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e00001311000000000000,Saffun Controller,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b0,platform:Windows,
+03000000a30600001af5000000000000,Saitek Cyborg,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000a306000023f6000000000000,Saitek Cyborg,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000300f00001201000000000000,Saitek Dual Analog,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Windows,
+03000000a30600000701000000000000,Saitek P220,a:b2,b:b3,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b4,righttrigger:b5,x:b0,y:b1,platform:Windows,
+03000000a30600000cff000000000000,Saitek P2500 Force Rumble,a:b2,b:b3,back:b11,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b10,x:b0,y:b1,platform:Windows,
+03000000a30600000d5f000000000000,Saitek P2600,a:b1,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a3,righty:a2,start:b8,x:b0,y:b3,platform:Windows,
+03000000a30600000dff000000000000,Saitek P2600,a:b1,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a5,righty:a2,start:b8,x:b0,y:b3,platform:Windows,
+03000000a30600000c04000000000000,Saitek P2900,a:b1,b:b2,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b3,platform:Windows,
+03000000a306000018f5000000000000,Saitek P3200,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000300f00001001000000000000,Saitek P480 Rumble,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Windows,
+03000000a30600000901000000000000,Saitek P880,a:b2,b:b3,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b8,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b9,righttrigger:b5,rightx:a3,righty:a2,x:b0,y:b1,platform:Windows,
+03000000a30600000b04000000000000,Saitek P990,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b3,platform:Windows,
+03000000a30600002106000000000000,Saitek PS1000 PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000a306000020f6000000000000,Saitek PS2700 PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000300f00001101000000000000,Saitek Rumble,a:b2,b:b3,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Windows,
+03000000e804000000a0000000000000,Samsung EIGP20,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000c01100000252000000000000,Sanwa Easy Grip,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+03000000c01100004350000000000000,Sanwa Micro Grip P3,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,x:b3,y:b2,platform:Windows,
+03000000411200004550000000000000,Sanwa Micro Grip Pro,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a1,righty:a2,start:b9,x:b1,y:b3,platform:Windows,
+03000000c01100004150000000000000,Sanwa Micro Grip Pro,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Windows,
+03000000c01100004450000000000000,Sanwa Online Grip,a:b0,b:b1,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b8,rightstick:b11,righttrigger:b9,rightx:a3,righty:a2,start:b14,x:b3,y:b4,platform:Windows,
+03000000730700000401000000000000,Sanwa PlayOnline Mobile,a:b0,b:b1,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b3,platform:Windows,
+030000009d0d00001130000000000000,Sanwa PlayStation Adapter,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000830500006120000000000000,Sanwa Smart Grip II,a:b0,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,x:b1,y:b3,platform:Windows,
+03000000c01100000051000000000000,Satechi Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+030000004f04000028b3000000000000,Score A,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000952e00002577000000000000,Scuf PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000a30c00002500000000000000,Sega Genesis Mini 3B Controller,a:b2,b:b1,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,righttrigger:b5,start:b9,platform:Windows,
+03000000a30c00002400000000000000,Sega Mega Drive Mini 6B Controller,a:b2,b:b1,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,rightshoulder:b4,righttrigger:b5,start:b9,x:b3,y:b0,platform:Windows,
+03000000d804000086e6000000000000,Sega Multi Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:a2,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Windows,
+0300000000050000289b000000000000,Sega Saturn Adapter,a:b1,b:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b4,rightshoulder:b7,righttrigger:b5,start:b9,x:b0,y:b3,platform:Windows,
+0300000000f000000800000000000000,Sega Saturn Controller,a:b1,b:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,rightshoulder:b7,righttrigger:b3,start:b0,x:b5,y:b6,platform:Windows,
+03000000730700000601000000000000,Sega Saturn Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Windows,
+03000000b40400000a01000000000000,Sega Saturn Controller,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Windows,
+030000003b07000004a1000000000000,SFX,a:b0,b:b2,back:b7,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b9,righttrigger:b5,start:b8,x:b1,y:b3,platform:Windows,
+03000000632500002705000000000000,ShanWan Q36,a:b0,b:b1,x:b3,y:b4,leftshoulder:b6,rightshoulder:b7,lefttrigger:b8,righttrigger:b9,back:b10,start:b11,dpup:h0.1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,platform:Windows,
+03000000f82100001900000000000000,Shogun Bros Chameleon X1,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000120c00001c1e000000000000,SnakeByte 4S PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000140300000918000000000000,SNES Controller,a:b0,b:b1,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Windows,
+0300000081170000960a000000000000,SNES Controller,a:b4,b:b0,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b5,y:b1,platform:Windows,
+03000000811700009d0a000000000000,SNES Controller,a:b0,b:b4,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Windows,
+030000008b2800000300000000000000,SNES Controller,a:b0,b:b4,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Windows,
+03000000921200004653000000000000,SNES Controller,a:b0,b:b4,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Windows,
+030000008f0e00000910000000000000,Sony DualShock 2,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b10,righttrigger:b5,rightx:a3,righty:a2,start:b11,x:b3,y:b0,platform:Windows,
+03000000317300000100000000000000,Sony DualShock 3,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000666600006706000000000000,Sony PlayStation Adapter,a:b2,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b10,righttrigger:b5,rightx:a2,righty:a3,start:b11,x:b3,y:b0,platform:Windows,
+03000000e30500009605000000000000,Sony PlayStation Adapter,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000fe1400002a23000000000000,Sony PlayStation Adapter,a:b0,b:b1,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,x:b2,y:b3,platform:Windows,
+030000004c050000da0c000000000000,Sony PlayStation Classic Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b4,rightshoulder:b7,righttrigger:b5,start:b9,x:b3,y:b0,platform:Windows,
+03000000632500002306000000000000,Sony PlayStation Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Windows,
+03000000f0250000c183000000000000,Sony PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000d9040000160f000000000000,Sony PlayStation Controller Adapter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000ff000000cb01000000000000,Sony PlayStation Portable,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Windows,
+030000004c0500003713000000000000,Sony PlayStation Vita,a:b1,b:b2,back:b8,dpdown:b13,dpleft:b15,dpright:b14,dpup:b12,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Windows,
+03000000341a00000208000000000000,Speedlink 6555,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:-a4,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a4,rightx:a3,righty:a2,start:b7,x:b2,y:b3,platform:Windows,
+03000000341a00000908000000000000,Speedlink 6566,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000380700001722000000000000,Speedlink Competition Pro,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,x:b2,y:b3,platform:Windows,
+030000008f0e00000800000000000000,Speedlink Strike FX,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000c01100000591000000000000,Speedlink Torid,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000de280000fc11000000000000,Steam Virtual Gamepad,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000de280000ff11000000000000,Steam Virtual Gamepad,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000120c0000160e000000000000,Steel Play Metaltech PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+03000000110100001914000000000000,SteelSeries,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftstick:b13,lefttrigger:b6,leftx:a0,lefty:a1,rightstick:b14,righttrigger:b7,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000381000001214000000000000,SteelSeries Free,a:b0,b:b1,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Windows,
+03000000110100003114000000000000,SteelSeries Stratus Duo,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000381000003014000000000000,SteelSeries Stratus Duo,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000381000003114000000000000,SteelSeries Stratus Duo,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000381000001814000000000000,SteelSeries Stratus XL,a:b0,b:b1,back:b18,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,guide:b19,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b2,y:b3,platform:Windows,
+03000000380700003847000000000000,Street Fighter Fightstick TE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b11,start:b7,x:b2,y:b3,platform:Windows,
+030000001f08000001e4000000000000,Super Famicom Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b3,y:b0,platform:Windows,
+03000000790000000418000000000000,Super Famicom Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b33,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Windows,
+03000000341200001300000000000000,Super Racer,a:b2,b:b3,back:b8,leftshoulder:b5,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b4,righttrigger:b7,x:b0,y:b1,platform:Windows,
+03000000457500002211000000000000,Szmy Power PC Gamepad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000004f0400000ab1000000000000,T16000M,a:b0,b:b1,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b4,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,start:b10,x:b2,y:b3,platform:Windows,
+030000000d0f00007b00000000000000,TAC GEAR,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000e40a00000307000000000000,Taito Egret II Mini Control Panel,a:b4,b:b2,back:b6,guide:b9,leftx:a0,lefty:a1,rightshoulder:b0,righttrigger:b1,start:b7,x:b8,y:b3,platform:Windows,
+03000000e40a00000207000000000000,Taito Egret II Mini Controller,a:b4,b:b2,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b9,rightshoulder:b0,righttrigger:b1,start:b7,x:b8,y:b3,platform:Windows,
+03000000d814000001a0000000000000,TE Kitty,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000fa1900000706000000000000,Team 5,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000b50700001203000000000000,Techmobility X6-38V,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Windows,
+03000000ba2200000701000000000000,Technology Innovation PS2 Adapter,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b3,y:b2,platform:Windows,
+03000000c61100001000000000000000,Tencent Xianyou Gamepad,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,x:b3,y:b4,platform:Windows,
+03000000790000001c18000000000000,TGZ Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000790000002601000000000000,TGZ Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b3,y:b0,platform:Windows,
+03000000591c00002400000000000000,THEC64 Joystick,a:b0,b:b1,back:b6,leftshoulder:b4,leftx:a0,lefty:a4,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Windows,
+03000000591c00002600000000000000,THEGamepad,a:b2,b:b1,back:b6,leftx:a0,lefty:a1,start:b7,x:b3,y:b0,platform:Windows,
+030000004f04000015b3000000000000,Thrustmaster Dual Analog 4,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Windows,
+030000004f04000023b3000000000000,Thrustmaster Dual Trigger PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000004f0400000ed0000000000000,Thrustmaster eSwap Pro Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000004f04000008d0000000000000,Thrustmaster Ferrari 150 PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000004f04000000b3000000000000,Thrustmaster Firestorm Dual Power,a:b0,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b11,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b10,x:b1,y:b3,platform:Windows,
+030000004f04000004b3000000000000,Thrustmaster Firestorm Dual Power,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Windows,
+030000004f04000003d0000000000000,Thrustmaster Run N Drive PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b7,leftshoulder:a3,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:a4,rightstick:b11,righttrigger:b5,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000004f04000009d0000000000000,Thrustmaster Run N Drive PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+030000006d04000088ca000000000000,Thunderpad,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+03000000666600000288000000000000,TigerGame PlayStation Adapter,a:b2,b:b1,back:b9,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+03000000666600000488000000000000,TigerGame PlayStation Adapter,a:b2,b:b1,back:b9,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+030000004f04000007d0000000000000,TMini,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000571d00002100000000000000,Tomee NES Controller Adapter,a:b1,b:b0,back:b2,dpdown:+a4,dpleft:-a0,dpright:+a0,dpup:-a4,start:b3,platform:Windows,
+03000000571d00002000000000000000,Tomee SNES Controller Adapter,a:b0,b:b1,back:b6,dpdown:+a4,dpleft:-a0,dpright:+a0,dpup:-a4,leftshoulder:b4,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Windows,
+03000000d62000006000000000000000,Tournament PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000c01100000055000000000000,Tronsmart,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000005f140000c501000000000000,Trust Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000b80500000210000000000000,Trust Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000004f04000087b6000000000000,TWCS Throttle,dpdown:b8,dpleft:b9,dpright:b7,dpup:b6,leftstick:b5,lefttrigger:-a5,leftx:a0,lefty:a1,righttrigger:+a5,platform:Windows,
+03000000411200000450000000000000,Twin Shock,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b10,righttrigger:b5,rightx:a3,righty:a4,start:b11,x:b3,y:b0,platform:Windows,
+03000000d90400000200000000000000,TwinShock PS2 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000151900005678000000000000,Uniplay U6,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000101c0000171c000000000000,uRage Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+030000000b0400003065000000000000,USB Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b3,y:b0,platform:Windows,
+03000000242f00006e00000000000000,USB Controller,a:b1,b:b4,back:b10,leftshoulder:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b9,righttrigger:b7,rightx:a2,righty:a5,start:b11,x:b0,y:b3,platform:Windows,
+03000000300f00000701000000000000,USB Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000341a00002308000000000000,USB Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000666600000188000000000000,USB Controller,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Windows,
+030000006b1400000203000000000000,USB Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000790000000a00000000000000,USB Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b3,y:b0,platform:Windows,
+03000000b404000081c6000000000000,USB Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b3,y:b0,platform:Windows,
+03000000b50700001503000000000000,USB Controller,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a5,righty:a2,start:b9,x:b0,y:b1,platform:Windows,
+03000000bd12000012d0000000000000,USB Controller,a:b0,b:b1,back:b6,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Windows,
+03000000ff1100004133000000000000,USB Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a4,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000632500002305000000000000,USB Vibration Joystick,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Windows,
+03000000882800000305000000000000,V5 Game Pad,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,x:b2,y:b3,platform:Windows,
+03000000790000001a18000000000000,Venom PS4 Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Windows,
+03000000790000001b18000000000000,Venom PS4 Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000006f0e00000302000000000000,Victrix PS4 Pro Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+030000006f0e00000702000000000000,Victrix PS4 Pro Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Windows,
+0300000034120000adbe000000000000,vJoy Device,a:b0,b:b1,back:b15,dpdown:b6,dpleft:b7,dpright:b8,dpup:b5,guide:b16,leftshoulder:b9,leftstick:b13,lefttrigger:b11,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b14,righttrigger:b12,rightx:a3,righty:a4,start:b4,x:b2,y:b3,platform:Windows,
+03000000120c0000ab57000000000000,Warrior Joypad JS083,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+030000007e0500003003000000000000,Wii U Pro,a:b0,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b16,dpup:b13,leftshoulder:b6,leftstick:b11,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b12,righttrigger:b5,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Windows,
+0300000032150000030a000000000000,Wildcat,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+0300000032150000140a000000000000,Wolverine,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000002e160000efbe000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b10,rightshoulder:b5,righttrigger:b11,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700001647000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700002045000000000000,Xbox 360 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+03000000380700002644000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b7,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a2,righty:a5,start:b8,x:b2,y:b3,platform:Windows,
+03000000380700002647000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000003807000026b7000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700003647000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a7,righty:a5,start:b7,x:b2,y:b3,platform:Windows,
+030000005e0400001907000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e0400008e02000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e0400009102000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b000000fd000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b000001fd000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b000016f0000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000ad1b00008e02000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000c62400000053000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000c6240000fdfa000000000000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700002847000000000000,Xbox 360 Fightpad,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000a102000000000000,Xbox 360 Wireless Receiver,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e0400000a0b000000000000,Xbox Adaptive Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000120c00000a88000000000000,Xbox Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a2,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+03000000120c00001088000000000000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2~,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5~,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000002a0600002000000000000000,Xbox Controller,a:b0,b:b1,back:b13,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,leftshoulder:b5,leftstick:b14,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b15,righttrigger:b7,rightx:a2,righty:a5,start:b12,x:b2,y:b3,platform:Windows,
+03000000380700001645000000000000,Xbox Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+03000000380700002645000000000000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000380700003645000000000000,Xbox Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+03000000380700008645000000000000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e0400000202000000000000,Xbox Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b9,righttrigger:b11,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+030000005e0400008502000000000000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e0400008702000000000000,Xbox Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b9,righttrigger:b7,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+030000005e0400008902000000000000,Xbox Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b10,leftstick:b8,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b9,righttrigger:b4,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Windows,
+030000005e0400000c0b000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000d102000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000dd02000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000e002000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000e302000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000ea02000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:-a2,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000fd02000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000ff02000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e0000a802000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000006f0e0000c802000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000c62400003a54000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000005e040000130b000000000000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+03000000341a00000608000000000000,Xeox,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+03000000450c00002043000000000000,Xeox SL6556BK,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Windows,
+030000006f0e00000300000000000000,XGear,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a5,righty:a2,start:b9,x:b3,y:b0,platform:Windows,
+03000000e0ff00000201000000000000,Xiaomi Black Shark (L),back:b0,dpdown:b11,dpleft:b9,dpright:b10,dpup:b8,leftshoulder:b5,lefttrigger:b7,leftx:a0,lefty:a1,platform:Windows,
+03000000172700004431000000000000,Xiaomi Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b20,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a7,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Windows,
+03000000172700003350000000000000,Xiaomi XMGP01YM,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000bc2000005060000000000000,Xiaomi XMGP01YM,+lefty:+a2,+righty:+a5,-lefty:-a1,-righty:-a4,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,start:b11,x:b3,y:b4,platform:Windows,
+03000000c0160000e105000000000000,XinMo Dual Arcade,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+xinput,XInput Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Windows,
+030000007d0400000340000000000000,Xterminator Digital Gamepad,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:-a4,lefttrigger:+a4,leftx:a0,lefty:a1,paddle1:b7,paddle2:b6,rightshoulder:b5,rightstick:b9,righttrigger:b2,rightx:a3,righty:a5,start:b8,x:b3,y:b4,platform:Windows,
+030000002c3600000100000000000000,Yawman Arrow,+rightx:h0.2,+righty:h0.4,-rightx:h0.8,-righty:h0.1,a:b4,b:b5,back:b6,dpdown:b15,dpleft:b14,dpright:b16,dpup:b13,leftshoulder:b10,leftstick:b0,lefttrigger:-a4,leftx:a0,lefty:a1,paddle1:b11,paddle2:b12,rightshoulder:b8,rightstick:b9,righttrigger:+a4,start:b3,x:b1,y:b2,platform:Windows,
+03000000790000004f18000000000000,ZDT Android Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Windows,
+03000000073500000400000000000000,Zenaim Arcade Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,x:b0,y:b3,platform:Windows,
+03000000120c00000500000000000000,Zeroplus Adapter,a:b2,b:b1,back:b11,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b0,righttrigger:b5,rightx:a3,righty:a2,start:b8,x:b3,y:b0,platform:Windows,
+03000000120c0000101e000000000000,Zeroplus P4 Gamepad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Windows,
+
+# Mac OS X
+030000008f0e00000300000009010000,2 In 1 Joystick,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000c82d00001930000000000000,8BitDo 64,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Mac OS X,
+03000000c82d00001930000000020000,8BitDo 64,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Mac OS X,
+03000000c82d00001930000001000000,8BitDo 64,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Mac OS X,
+03000000c82d00000031000001000000,8BitDo Adapter,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00000531000000020000,8BitDo Adapter 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00000951000000010000,8BitDo Dogbone,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b11,platform:Mac OS X,
+03000000c82d00000090000001000000,8BitDo FC30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00001038000000010000,8BitDo FC30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00006a28000000010000,8BitDo GameCube,a:b0,b:b3,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b9,paddle2:b8,rightshoulder:b10,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b1,y:b4,platform:Mac OS X,
+03000000c82d00001251000000010000,8BitDo Lite 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00001251000000020000,8BitDo Lite 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00001151000000010000,8BitDo Lite SE,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00001151000000020000,8BitDo Lite SE,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000a30c00002400000006020000,8BitDo M30,a:b2,b:b1,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,guide:b9,leftshoulder:b6,lefttrigger:b5,rightshoulder:b4,righttrigger:b7,start:b8,x:b3,y:b0,platform:Mac OS X,
+03000000c82d00000151000000010000,8BitDo M30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00000650000001000000,8BitDo M30,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b8,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00005106000000010000,8BitDo M30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b2,leftshoulder:b6,lefttrigger:a5,rightshoulder:b7,righttrigger:a4,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00002090000000010000,8BitDo Micro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000451000000010000,8BitDo N30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b11,platform:Mac OS X,
+03000000c82d00001590000001000000,8BitDo N30 Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00006528000000010000,8BitDo N30 Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00006928000000010000,8BitDo N64,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Mac OS X,
+03000000c82d00002590000000010000,8BitDo NEOGEO,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00002590000001000000,8BitDo NEOGEO,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00002690000000010000,8BitDo NEOGEO,+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b10,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000003512000012ab000001000000,8BitDo NES30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d000012ab000001000000,8BitDo NES30,a:b0,b:b1,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00002028000000010000,8BitDo NES30,a:b0,b:b1,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000022000000090000001000000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000203800000900000000010000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000190000001000000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000751000000010000,8BitDo P30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00000851000000010000,8BitDo P30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00000660000000010000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000660000000020000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000131000001000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000231000001000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000331000001000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000431000001000000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00002867000000010000,8BitDo S30,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a2,righty:a3,start:b10,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00003028000000010000,8Bitdo SFC30 Gamepad,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000102800000900000000000000,8BitDo SFC30 Joystick,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000351000000010000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00001290000001000000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00004028000000010000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000160000001000000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000161000000010000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000260000001000000,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00000261000000010000,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00001230000000010000,8BitDo Ultimate,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b2,paddle2:b5,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001b30000001000000,8BitDo Ultimate 2C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b5,paddle2:b2,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001d30000001000000,8BitDo Ultimate 2C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b5,paddle2:b2,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001c30000001000000,8BitDo Ultimate 2C Wireless Controller,a:b0,b:b1,x:b3,y:b4,back:b10,guide:b12,start:b11,leftstick:b13,rightstick:b14,leftshoulder:b6,rightshoulder:b7,dpup:h0.1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,leftx:a0,lefty:a1,rightx:a2,righty:a3,lefttrigger:a5,righttrigger:a4,platform:Mac OS X,
+03000000c82d00001530000001000000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001630000001000000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001730000001000000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001130000000020000,8BitDo Ultimate Wired,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b26,paddle1:b24,paddle2:b25,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001330000000020000,8BitDo Ultimate Wireless,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b26,paddle1:b23,paddle2:b19,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001330000001000000,8BitDo Ultimate Wireless,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b26,paddle1:b23,paddle2:b19,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000a00500003232000008010000,8BitDo Zero,a:b0,b:b1,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000a00500003232000009010000,8BitDo Zero,a:b0,b:b1,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c82d00001890000001000000,8BitDo Zero 2,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c82d00003032000000010000,8BitDo Zero 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a31,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000491900001904000001010000,Amazon Luna Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b9,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Mac OS X,
+03000000710100001904000000010000,Amazon Luna Controller,a:b0,b:b1,back:b11,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b9,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Mac OS X,
+0300000008100000e501000019040000,Anbernic Handheld,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a4,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000373500004610000001000000,Anbernic RG P01,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000a30c00002700000003030000,Astro City Mini,a:b2,b:b1,back:b8,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,rightshoulder:b4,righttrigger:b5,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000a30c00002800000003030000,Astro City Mini,a:b2,b:b1,back:b8,leftx:a3,lefty:a4,rightshoulder:b4,righttrigger:b5,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000050b00000045000031000000,ASUS Gamepad,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000050b00000579000000010000,ASUS ROG Kunai 3,a:b0,b:b1,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b14,leftshoulder:b6,leftstick:b15,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b42,paddle1:b9,paddle2:b11,rightshoulder:b7,rightstick:b16,righttrigger:a4,rightx:a2,righty:a3,start:b13,x:b3,y:b4,platform:Mac OS X,
+03000000050b00000679000000010000,ASUS ROG Kunai 3,a:b0,b:b1,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b14,leftshoulder:b6,leftstick:b15,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b23,rightshoulder:b7,rightstick:b16,righttrigger:a4,rightx:a2,righty:a3,start:b13,x:b3,y:b4,platform:Mac OS X,
+03000000503200000110000045010000,Atari VCS Classic,a:b0,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b3,start:b2,platform:Mac OS X,
+03000000503200000110000047010000,Atari VCS Classic Controller,a:b0,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b3,start:b2,platform:Mac OS X,
+03000000503200000210000047010000,Atari VCS Modern Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a4,rightx:a2,righty:a3,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000008a3500000102000000010000,Backbone One,a:b0,b:b1,back:b16,dpdown:b11,dpleft:b13,dpright:b12,dpup:b10,guide:b17,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3~,start:b15,x:b2,y:b3,platform:Mac OS X,
+030000008a3500000201000000010000,Backbone One,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000008a3500000202000000010000,Backbone One,a:b0,b:b1,back:b16,dpdown:b11,dpleft:b13,dpright:b12,dpup:b10,guide:b17,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3~,start:b15,x:b2,y:b3,platform:Mac OS X,
+030000008a3500000402000000010000,Backbone One,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000008a3500000302000000010000,Backbone One PlayStation Edition,a:b0,b:b1,back:b16,dpdown:b11,dpleft:b13,dpright:b12,dpup:b10,guide:b17,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3~,start:b15,x:b2,y:b3,platform:Mac OS X,
+03000000c62400001a89000000010000,BDA MOGA XP5-X Plus,a:b0,b:b1,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b14,leftshoulder:b6,leftstick:b15,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b16,righttrigger:a4,rightx:a2,righty:a3,start:b13,x:b3,y:b4,platform:Mac OS X,
+03000000c62400001b89000000010000,BDA MOGA XP5-X Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000d62000002a79000000010000,BDA PS4 Fightpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+03000000120c0000200e000000010000,Brook Mars PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+03000000120c0000210e000000010000,Brook Mars PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000008305000031b0000000000000,Cideko AK08b,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000d8140000cecf000000000000,Cthulhu,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000260900008888000088020000,Cyber Gadget GameCube Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:a5,rightx:a2,righty:a3~,start:b7,x:b2,y:b3,platform:Mac OS X,
+03000000a306000022f6000001030000,Cyborg V3 Rumble Pad PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:+a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:-a3,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000791d00000103000009010000,Dual Box Wii Classic Adapter,a:b2,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,guide:b10,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+030000006e0500000720000010020000,Elecom JC-W01U,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Mac OS X,
+030000006f0e00008401000003010000,Faceoff Deluxe Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b13,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000151900004000000001000000,Flydigi Vader 2,a:b14,b:b15,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b21,leftshoulder:b6,leftstick:b12,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b2,paddle2:b5,paddle3:b16,paddle4:b17,rightshoulder:b7,rightstick:b13,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Mac OS X,
+03000000b40400001124000001040000,Flydigi Vader 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b12,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b14,paddle1:b2,paddle2:b5,paddle3:b16,paddle4:b17,rightshoulder:b7,rightstick:b13,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000b40400001224000003030000,Flydigi Vader 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b12,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b2,paddle1:b16,paddle2:b17,paddle3:b14,paddle4:b15,rightshoulder:b7,rightstick:b13,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000790000004618000000010000,GameCube Controller Adapter,a:b4,b:b0,dpdown:b56,dpleft:b60,dpright:b52,dpup:b48,lefttrigger:a12,leftx:a0,lefty:a4,rightshoulder:b28,righttrigger:a16,rightx:a20,righty:a8,start:b36,x:b8,y:b12,platform:Mac OS X,
+03000000ac0500001a06000002020000,GameSir T3 2.02,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000373500000411000023000000,GameSir X4A Xbox Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000ad1b000001f9000000000000,Gamestop BB070 X360 Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+0500000047532047616d657061640000,GameStop Gamepad,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000c01100000140000000010000,GameStop PS4 Fun Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000006f0e00000102000000000000,GameStop Xbox 360 Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000ff1100003133000007010000,GameWare PC Control Pad,a:b2,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a4,start:b11,x:b3,y:b0,platform:Mac OS X,
+03000000d11800000094000000010000,Google Stadia Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Mac OS X,
+030000007d0400000540000001010000,Gravis Eliminator Pro,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000280400000140000000020000,Gravis GamePad Pro,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000008f0e00000300000007010000,GreenAsia Joystick,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Mac OS X,
+030000000d0f00002d00000000100000,Hori Fighting Commander 3 Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00005f00000000000000,Hori Fighting Commander 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00005f00000000010000,Hori Fighting Commander 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00005e00000000000000,Hori Fighting Commander 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00005e00000000010000,Hori Fighting Commander 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00008400000000010000,Hori Fighting Commander PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00008500000000010000,Hori Fighting Commander PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000341a00000302000014010000,Hori Fighting Stick Mini,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00008800000000010000,Hori Fighting Stick mini 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00008700000000010000,Hori Fighting Stick mini 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00004d00000000000000,Hori Gem Pad 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00003801000008010000,Hori PC Engine Mini Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b9,platform:Mac OS X,
+030000000d0f00009200000000010000,Hori Pokken Tournament DX Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f0000aa00000072050000,Hori Real Arcade Pro for Nintendo Switch,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+030000000d0f00000002000017010000,Hori Split Pad Fit,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00000002000015010000,Hori Switch Split Pad Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00006e00000000010000,Horipad 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00006600000000010000,Horipad 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000000d0f00006600000000000000,Horipad FPS Plus 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f0000ee00000000010000,Horipad Mini 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000000d0f0000c100000072050000,Horipad Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000242e0000ff0b000000010000,Hyperkin N64 Adapter,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a2,righty:a3,start:b9,platform:Mac OS X,
+03000000790000004e95000000010000,Hyperkin N64 Controller Adapter,a:b1,b:b2,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b7,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a5,righty:a2,start:b9,platform:Mac OS X,
+03000000830500006020000000000000,iBuffalo Super Famicom Controller,a:b1,b:b0,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b7,x:b3,y:b2,platform:Mac OS X,
+03000000ef0500000300000000020000,InterAct AxisPad,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,start:b11,x:b0,y:b1,platform:Mac OS X,
+03000000fd0500000030000010010000,Interact GoPad,a:b3,b:b4,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,x:b0,y:b1,platform:Mac OS X,
+030000007e0500000620000001000000,Joy-Con (L),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b13,leftshoulder:b4,leftstick:b10,rightshoulder:b5,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000007e0500000720000001000000,Joy-Con (R),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b12,leftshoulder:b4,leftstick:b11,rightshoulder:b5,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000242f00002d00000007010000,JYS Adapter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+030000006d04000019c2000000000000,Logitech Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d04000019c2000000020000,Logitech Cordless RumblePad 2,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3~,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d04000016c2000000020000,Logitech Dual Action,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d04000016c2000000030000,Logitech Dual Action,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d04000016c2000014040000,Logitech Dual Action,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d04000016c2000000000000,Logitech F310,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d04000018c2000000000000,Logitech F510,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d04000019c2000005030000,Logitech F710,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006d0400001fc2000000000000,Logitech F710,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000006d04000018c2000000010000,Logitech RumblePad 2,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3~,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000380700005032000000010000,Mad Catz PS3 Fightpad Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000380700008433000000010000,Mad Catz PS3 Fightstick TE S Plus,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000380700005082000000010000,Mad Catz PS4 Fightpad Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+03000000380700008483000000010000,Mad Catz PS4 Fightstick TE S Plus,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+0300000049190000020400001b010000,Manba One,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b22,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000790000000600000007010000,Marvo GT-004,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+030000008f0e00001330000011010000,Mayflash Controller Adapter,a:b2,b:b4,back:b16,dpdown:h0.8,dpleft:h0.2,dpright:h0.1,dpup:h0.4,leftshoulder:b12,lefttrigger:b16,leftx:a0,lefty:a2,rightshoulder:b14,rightx:a6~,righty:a4,start:b18,x:b0,y:b6,platform:Mac OS X,
+03000000790000004318000000010000,Mayflash GameCube Adapter,a:b4,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a12,leftx:a0,lefty:a4,rightshoulder:b28,righttrigger:a16,rightx:a20,righty:a8,start:b36,x:b8,y:b12,platform:Mac OS X,
+03000000790000004418000000010000,Mayflash GameCube Controller,a:b1,b:b2,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000242f00007300000000020000,Mayflash Magic NS,a:b1,b:b4,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b0,y:b3,platform:Mac OS X,
+0300000079000000d218000026010000,Mayflash Magic NS,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000d620000010a7000003010000,Mayflash Magic NS,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000008f0e00001030000011010000,Mayflash Saturn Adapter,a:b0,b:b2,dpdown:b28,dpleft:b30,dpright:b26,dpup:b24,leftshoulder:b10,lefttrigger:b14,rightshoulder:b12,righttrigger:b4,start:b18,x:b6,y:b8,platform:Mac OS X,
+0300000025090000e803000000000000,Mayflash Wii Classic Adapter,a:b1,b:b0,back:b8,dpdown:b13,dpleft:b12,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Mac OS X,
+03000000790000000318000000010000,Mayflash Wii DolphinBar,a:b8,b:b12,back:b32,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b44,leftshoulder:b16,lefttrigger:b24,leftx:a0,lefty:a4,rightshoulder:b20,righttrigger:b28,rightx:a8,righty:a12,start:b36,x:b0,y:b4,platform:Mac OS X,
+03000000790000000018000000000000,Mayflash Wii U Pro Adapter,a:b4,b:b8,back:b32,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b16,leftstick:b40,lefttrigger:b24,leftx:a0,lefty:a4,rightshoulder:b20,rightstick:b44,righttrigger:b28,rightx:a8,righty:a12,start:b36,x:b0,y:b12,platform:Mac OS X,
+03000000790000000018000000010000,Mayflash Wii U Pro Adapter,a:b4,b:b8,back:b32,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b16,leftstick:b40,lefttrigger:b24,leftx:a0,lefty:a4,rightshoulder:b20,rightstick:b44,righttrigger:b28,rightx:a8,righty:a12,start:b36,x:b0,y:b12,platform:Mac OS X,
+030000005e0400002800000002010000,Microsoft Dual Strike,a:b3,b:b2,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,rightshoulder:b7,rightx:a0,righty:a1~,start:b5,x:b1,y:b0,platform:Mac OS X,
+030000005e0400000300000006010000,Microsoft SideWinder,a:b0,b:b1,back:b9,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Mac OS X,
+030000005e0400000700000006010000,Microsoft SideWinder,a:b0,b:b1,back:b8,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Mac OS X,
+030000005e0400002700000001010000,Microsoft SideWinder Plug and Play,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,lefttrigger:b4,righttrigger:b5,x:b2,y:b3,platform:Mac OS X,
+030000004523000015e0000072050000,Mobapad Chitu HD,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000d62000007162000001000000,Moga Pro 2,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Mac OS X,
+03000000c62400002a89000000010000,MOGA XP5A Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b21,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c62400002b89000000010000,MOGA XP5A Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000853200008906000000010000,Nacon Revolution X Unlimited,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000632500007505000000020000,NeoGeo mini PAD Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000921200004b46000003020000,NES 2-port Adapter,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b11,platform:Mac OS X,
+030000001008000001e5000006010000,NEXT SNES Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,righttrigger:b6,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000ec110000e1a7000001010000,Nintendo Switch,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+030000007e0500006920000001010000,Nintendo Switch 2 Pro Controller,a:b0,b:b1,back:b14,dpdown:b8,dpleft:b10,dpright:b9,dpup:b11,guide:b16,leftshoulder:b12,leftstick:b15,lefttrigger:b13,leftx:a0,lefty:a1~,misc1:b17,misc2:b20,paddle1:b18,paddle2:b19,rightshoulder:b4,rightstick:b7,righttrigger:b5,rightx:a2,righty:a3~,start:b6,x:b2,y:b3,platform:Mac OS X,
+030000007e0500000920000000000000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+030000007e0500000920000001000000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+030000007e0500000920000010020000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:Mac OS X,
+050000007e05000009200000ff070000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:Mac OS X,
+030000007e0500007320000001010000,NSO GameCube Controller,a:b1,b:b3,dpdown:b8,dpleft:b10,dpright:b9,dpup:b11,guide:b16,leftshoulder:b13,lefttrigger:b12,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b4,rightx:a2,righty:a3~,start:b6,x:b0,y:b2,platform:Mac OS X,
+030000007e0500001920000001000000,NSO N64 Controller,+rightx:b8,+righty:b7,-rightx:b3,-righty:b2,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,righttrigger:b10,start:b9,platform:Mac OS X,
+030000007e0500001720000001000000,NSO SNES Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b15,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000550900001472000025050000,NVIDIA Controller,a:b0,b:b1,back:b17,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b4,leftstick:b7,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a5,start:b6,x:b2,y:b3,platform:Mac OS X,
+030000004b120000014d000000010000,Nyko Airflo EX,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Mac OS X,
+0300000009120000072f000000010000,OrangeFox86 DreamPicoPort,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a2,leftx:a0,lefty:a1,righttrigger:a5,rightx:a3,righty:a4,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000006f0e00000901000002010000,PDP PS3 Versus Fighting,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000008f0e00000300000000000000,Piranha Xtreme PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000d620000011a7000000020000,PowerA Core Plus Gamecube Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000d620000011a7000010050000,PowerA Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000d62000006dca000000010000,PowerA Pro Ex,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000100800000300000006010000,PS2 Adapter,a:b2,b:b1,back:b8,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a4,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+030000004c0500006802000000000000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Mac OS X,
+030000004c0500006802000000010000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Mac OS X,
+030000004c0500006802000072050000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Mac OS X,
+030000004c050000a00b000000010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000004c050000c405000000000000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000004c050000c405000000010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000004c050000cc09000000010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+0300004b4c0500005f0e000000010000,PS5 Access Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000004c050000e60c000000010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000004c050000f20d000000010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+050000004c050000e60c000000010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+050000004c050000f20d000000010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000005e040000e002000001000000,PXN P30 Pro Mobile,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Mac OS X,
+03000000222c00000225000000010000,Qanba Dragon Arcade Joystick PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000222c00000020000000010000,Qanba Drone Arcade Stick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000009b2800005600000020020000,Raphnet SNES Adapter,a:b1,b:b4,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Mac OS X,
+030000009b2800008000000022020000,Raphnet Wii Classic Adapter,a:b1,b:b4,back:b2,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,guide:b10,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a3,righty:a4,start:b3,x:b0,y:b5,platform:Mac OS X,
+030000008916000000fd000000000000,Razer Onza TE,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000321500000204000000010000,Razer Panthera PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000321500000104000000010000,Razer Panthera PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+03000000321500000010000000010000,Razer Raiju,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000321500000507000001010000,Razer Raiju Mobile,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b21,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000321500000011000000010000,Razer Raion PS4 Fightpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+03000000321500000009000000020000,Razer Serval,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Mac OS X,
+030000003215000000090000163a0000,Razer Serval,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Mac OS X,
+0300000032150000030a000000000000,Razer Wildcat,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000632500008005000000010000,Redgear,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000632500002305000000010000,Redragon Saturn,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000921200004547000000020000,Retro Bit Sega Genesis Controller Adapter,a:b0,b:b2,dpdown:+a2,dpleft:-a0,dpright:+a0,dpup:-a2,lefttrigger:b14,rightshoulder:b10,righttrigger:b4,start:b12,x:b6,y:b8,platform:Mac OS X,
+03000000790000001100000000000000,Retro Controller,a:b1,b:b2,back:b8,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,leftshoulder:b6,lefttrigger:b7,rightshoulder:b4,righttrigger:b5,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000790000001100000005010000,Retro Controller,a:b1,b:b2,back:b8,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,leftshoulder:b6,lefttrigger:b7,rightshoulder:b5,righttrigger:b4,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000830500006020000000010000,Retro Controller,a:b0,b:b1,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b5,rightshoulder:b8,righttrigger:b9,start:b7,x:b2,y:b3,platform:Mac OS X,
+0300000003040000c197000000000000,Retrode Adapter,a:b0,b:b4,back:b2,dpdown:+a4,dpleft:-a0,dpright:+a0,dpup:-a4,leftshoulder:b6,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Mac OS X,
+03000000790000001100000006010000,Retrolink SNES Controller,a:b2,b:b1,back:b8,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,leftshoulder:b4,rightshoulder:b5,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000341200000400000000000000,RetroUSB N64 RetroPort,+rightx:b8,+righty:b10,-rightx:b9,-righty:b11,a:b7,b:b6,dpdown:b2,dpleft:b1,dpright:b0,dpup:b3,leftshoulder:b13,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b12,start:b4,platform:Mac OS X,
+030000006b140000010d000000010000,Revolution Pro Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000006b140000130d000000010000,Revolution Pro Controller 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000004c0500006802000002100000,Rii RK707,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b2,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b3,righttrigger:b9,rightx:a2,righty:a3,start:b1,x:b15,y:b12,platform:Mac OS X,
+030000006f0e00008701000005010000,Rock Candy Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000c6240000fefa000000000000,Rock Candy PS3,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000e804000000a000001b010000,Samsung EIGP20,a:b1,b:b3,back:b15,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b20,leftshoulder:b11,leftx:a1,lefty:a3,rightshoulder:b12,rightx:a4,righty:a5,start:b16,x:b7,y:b9,platform:Mac OS X,
+03000000730700000401000000010000,Sanwa PlayOnline Mobile,a:b0,b:b1,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b3,platform:Mac OS X,
+03000000a30c00002500000006020000,Sega Genesis Mini 3B Controller,a:b2,b:b1,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,righttrigger:b5,start:b9,platform:Mac OS X,
+03000000811700007e05000000000000,Sega Saturn,a:b2,b:b4,dpdown:b16,dpleft:b15,dpright:b14,dpup:b17,leftshoulder:b8,lefttrigger:a5,leftx:a0,lefty:a2,rightshoulder:b9,righttrigger:a4,start:b13,x:b0,y:b6,platform:Mac OS X,
+03000000b40400000a01000000000000,Sega Saturn,a:b0,b:b1,back:b5,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b2,leftshoulder:b6,rightshoulder:b7,start:b8,x:b3,y:b4,platform:Mac OS X,
+030000003512000021ab000000000000,SFC30 Joystick,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Mac OS X,
+0300000000f00000f100000000000000,SNES RetroPort,a:b2,b:b3,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b5,rightshoulder:b7,start:b6,x:b0,y:b1,platform:Mac OS X,
+030000004c050000a00b000000000000,Sony DualShock 4 Adapter,a:b1,b:b2,back:b13,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000004c050000cc09000000000000,Sony DualShock 4 V2,a:b1,b:b2,back:b13,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+03000000666600006706000088020000,Sony PlayStation Adapter,a:b2,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,rightx:a2,righty:a3,start:b11,x:b3,y:b0,platform:Mac OS X,
+030000004c050000da0c000000010000,Sony PlayStation Classic Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b4,rightshoulder:b7,righttrigger:b5,start:b9,x:b3,y:b0,platform:Mac OS X,
+030000004c0500003713000000010000,Sony PlayStation Vita,a:b1,b:b2,back:b8,dpdown:b13,dpleft:b15,dpright:b14,dpup:b12,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000005e0400008e02000001000000,Steam Virtual Gamepad,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000110100002014000000000000,SteelSeries Nimbus,a:b0,b:b1,dpdown:b9,dpleft:b11,dpright:b10,dpup:b8,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3~,x:b2,y:b3,platform:Mac OS X,
+03000000110100002014000001000000,SteelSeries Nimbus,a:b0,b:b1,dpdown:b9,dpleft:b11,dpright:b10,dpup:b8,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3~,x:b2,y:b3,platform:Mac OS X,
+03000000381000002014000001000000,SteelSeries Nimbus,a:b0,b:b1,dpdown:b9,dpleft:b11,dpright:b10,dpup:b8,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3~,x:b2,y:b3,platform:Mac OS X,
+05000000484944204465766963650000,SteelSeries Nimbus Plus,a:b0,b:b1,back:b15,dpdown:b11,dpleft:b13,dpright:b12,dpup:b10,guide:b16,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3~,start:b14,x:b2,y:b3,platform:Mac OS X,
+050000004e696d6275732b0000000000,SteelSeries Nimbus Plus,a:b0,b:b1,back:b15,dpdown:b11,dpleft:b13,dpright:b12,dpup:b10,guide:b16,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3~,start:b14,x:b2,y:b3,platform:Mac OS X,
+03000000381000003014000000000000,SteelSeries Stratus Duo,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000381000003114000000000000,SteelSeries Stratus Duo,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000110100001714000000000000,SteelSeries Stratus XL,a:b0,b:b1,dpdown:b9,dpleft:b11,dpright:b10,dpup:b8,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3~,start:b12,x:b2,y:b3,platform:Mac OS X,
+03000000110100001714000020010000,SteelSeries Stratus XL,a:b0,b:b1,dpdown:b9,dpleft:b11,dpright:b10,dpup:b8,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3~,start:b12,x:b2,y:b3,platform:Mac OS X,
+030000000d0f0000f600000000010000,Switch Hori Pad,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Mac OS X,
+03000000457500002211000000010000,SZMY Power PC Gamepad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000e40a00000307000001000000,Taito Egret II Mini Control Panel,a:b4,b:b2,back:b6,guide:b9,leftx:a0,lefty:a1,rightshoulder:b0,righttrigger:b1,start:b7,x:b8,y:b3,platform:Mac OS X,
+03000000e40a00000207000001000000,Taito Egret II Mini Controller,a:b4,b:b2,back:b6,guide:b9,leftx:a0,lefty:a1,rightshoulder:b0,righttrigger:b1,start:b7,x:b8,y:b3,platform:Mac OS X,
+03000000790000001c18000000010000,TGZ Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000790000001c18000003100000,TGZ Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000591c00002400000021000000,THEC64 Joystick,a:b0,b:b1,back:b6,leftshoulder:b4,leftx:a0,lefty:a4,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Mac OS X,
+03000000591c00002600000021000000,THEGamepad,a:b2,b:b1,back:b6,dpdown:+a4,dpleft:-a0,dpright:+a0,dpup:-a4,leftshoulder:b4,rightshoulder:b5,start:b7,x:b3,y:b0,platform:Mac OS X,
+030000004f04000015b3000000000000,Thrustmaster Dual Analog 3.2,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Mac OS X,
+030000004f0400000ed0000000020000,Thrustmaster eSwap Pro Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+030000004f04000000b3000000000000,Thrustmaster Firestorm Dual Power,a:b0,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b11,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a2,righty:a3,start:b10,x:b1,y:b3,platform:Mac OS X,
+03000000571d00002100000021000000,Tomee NES Controller Adapter,a:b1,b:b0,back:b2,dpdown:+a4,dpleft:-a0,dpright:+a0,dpup:-a4,start:b3,platform:Mac OS X,
+03000000bd12000015d0000000010000,Tomee Retro Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000bd12000015d0000000000000,Tomee SNES Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000571d00002000000021000000,Tomee SNES Controller Adapter,a:b0,b:b1,back:b6,dpdown:+a4,dpleft:-a0,dpright:+a0,dpup:-a4,leftshoulder:b4,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Mac OS X,
+030000005f140000c501000000020000,Trust Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Mac OS X,
+03000000100800000100000000000000,Twin USB Joystick,a:b4,b:b2,back:b16,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b12,leftstick:b20,lefttrigger:b8,leftx:a0,lefty:a2,rightshoulder:b14,rightstick:b22,righttrigger:b10,rightx:a6,righty:a4,start:b18,x:b6,y:b0,platform:Mac OS X,
+03000000632500002605000000010000,Uberwith Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000c0160000e105000000040000,Ultimate Atari Fight Stick,a:b2,b:b4,back:b18,dpdown:+a2,dpleft:-a0,dpright:+a0,dpup:-a2,rightshoulder:b8,righttrigger:b10,start:b16,x:b0,y:b6,platform:Mac OS X,
+03000000151900005678000010010000,Uniplay U6,a:b3,b:b6,back:b25,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b17,leftstick:b31,lefttrigger:b21,leftx:a1,lefty:a3,rightshoulder:b19,rightstick:b33,righttrigger:b23,rightx:a4,righty:a5,start:b27,x:b11,y:b13,platform:Mac OS X,
+030000006f0e00000302000025040000,Victrix PS4 Pro Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+030000006f0e00000702000003060000,Victrix PS4 Pro Fightstick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Mac OS X,
+050000005769696d6f74652028303000,Wii Remote,a:b4,b:b5,back:b7,dpdown:b3,dpleft:b0,dpright:b1,dpup:b2,guide:b8,leftshoulder:b11,lefttrigger:b12,leftx:a0,lefty:a1,start:b6,x:b10,y:b9,platform:Mac OS X,
+050000005769696d6f74652028313800,Wii U Pro Controller,a:b16,b:b15,back:b7,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b8,leftshoulder:b19,leftstick:b23,lefttrigger:b21,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b24,righttrigger:b22,rightx:a2,righty:a3,start:b6,x:b18,y:b17,platform:Mac OS X,
+030000005e0400008e02000000000000,Xbox 360 Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e0400008e02000010010000,Xbox 360 Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1~,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4~,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000006f0e00000104000000000000,Xbox 360 Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+03000000c6240000045d000000000000,Xbox 360 Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e0400000a0b000000000000,Xbox Adaptive Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e040000050b000003090000,Xbox Elite Controller Series 2,a:b0,b:b1,back:b31,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b53,leftshoulder:b6,leftstick:b13,lefttrigger:a6,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000011050000,Xbox One Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000200b000011050000,Xbox One Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000200b000013050000,Xbox One Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000200b000015050000,Xbox One Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000d102000000000000,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e040000dd02000000000000,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e040000e002000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Mac OS X,
+030000005e040000e002000003090000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Mac OS X,
+030000005e040000e302000000000000,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e040000ea02000000000000,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e040000fd02000003090000,Xbox One Controller,a:b0,b:b1,back:b16,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000220b000013050000,Xbox One Elite 2 Controller,a:b0,b:b1,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,paddle1:b11,paddle2:b13,paddle3:b12,paddle4:b14,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Mac OS X,
+03000000c62400003a54000000000000,Xbox One PowerA Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b8,x:b2,y:b3,platform:Mac OS X,
+030000005e040000130b000001050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000005050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000009050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000013050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000015050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000007050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000017050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000130b000022050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000220b000017050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+030000005e040000220b000021050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000172700004431000029010000,XiaoMi Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a6,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Mac OS X,
+03000000120c0000100e000000010000,Zeroplus P4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+03000000120c0000101e000000010000,Zeroplus P4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Mac OS X,
+
+# Linux
+03000000c82d00001930000011010000,8BitDo 64,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Linux,
+05000000c82d00001930000001000000,8BitDo 64,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Linux,
+03000000c82d00000031000011010000,8BitDo Adapter,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00000631000000010000,8BitDo Adapter 2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c82d00000951000000010000,8BitDo Dogbone,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b11,platform:Linux,
+03000000021000000090000011010000,8BitDo FC30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000090000011010000,8BitDo FC30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00001038000000010000,8BitDo FC30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00006a28000000010000,8BitDo GameCube,a:b0,b:b3,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b9,paddle2:b8,rightshoulder:b10,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b1,y:b4,platform:Linux,
+03000000c82d00001251000011010000,8BitDo Lite 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00001251000000010000,8BitDo Lite 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00001151000011010000,8BitDo Lite SE,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00001151000000010000,8BitDo Lite SE,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000151000000010000,8BitDo M30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00000650000011010000,8BitDo M30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000c82d00005106000000010000,8BitDo M30,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00000a20000000020000,8BitDo M30 Xbox,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,start:b7,x:b2,y:b3,platform:Linux,
+03000000c82d00002090000011010000,8BitDo Micro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00002090000000010000,8BitDo Micro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000451000000010000,8BitDo N30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b11,platform:Linux,
+03000000c82d00001590000011010000,8BitDo N30 Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00006528000000010000,8BitDo N30 Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00006928000011010000,8BitDo N64,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Linux,
+05000000c82d00006928000000010000,8BitDo N64,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,platform:Linux,
+05000000c82d00002590000001000000,8BitDo NEOGEO,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000008000000210000011010000,8BitDo NES30,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+03000000c82d00000310000011010000,8BitDo NES30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b7,lefttrigger:b6,rightshoulder:b9,righttrigger:b8,start:b11,x:b3,y:b4,platform:Linux,
+05000000c82d00008010000000010000,8BitDo NES30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b7,lefttrigger:b6,rightshoulder:b9,righttrigger:b8,start:b11,x:b3,y:b4,platform:Linux,
+03000000022000000090000011010000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000190000011010000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000203800000900000000010000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00002038000000010000,8BitDo NES30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000751000000010000,8BitDo P30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:a8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000c82d00000851000000010000,8BitDo P30,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:a8,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00000660000011010000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00001030000011010000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00000660000000010000,8BitDo Pro 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000020000000000000,8BitDo Pro 2 for Xbox,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+06000000c82d00000020000006010000,8BitDo Pro 2 for Xbox,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c82d00000960000011010000,8BitDo Pro 3,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b17,paddle2:b16,paddle3:b2,paddle4:b5,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000131000011010000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000231000011010000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000331000011010000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000431000011010000,8BitDo Receiver,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00002867000000010000,8BitDo S30,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b8,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:b7,rightx:a2,righty:a3,start:b10,x:b3,y:b4,platform:Linux,
+03000000c82d00000060000011010000,8BitDo SF30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00000060000000010000,8BitDo SF30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00000061000000010000,8BitDo SF30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+030000003512000012ab000010010000,8BitDo SFC30,a:b2,b:b1,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b7,x:b3,y:b0,platform:Linux,
+030000003512000021ab000010010000,8BitDo SFC30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d000021ab000010010000,8BitDo SFC30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Linux,
+05000000102800000900000000010000,8BitDo SFC30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00003028000000010000,8BitDo SFC30,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00000351000000010000,8BitDo SN30,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000160000000000000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000160000011010000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000161000000000000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00001290000011010000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00000161000000010000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b2,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00006228000000010000,8BitDo SN30 Pro,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00000260000011010000,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00000261000000010000,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+05000000202800000900000000010000,8BitDo SNES30,a:b1,b:b0,back:b10,dpdown:b122,dpleft:b119,dpright:b120,dpup:b117,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00001230000000010000,8BitDo Ultimate,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00000a31000014010000,8BitDo Ultimate 2C,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c82d00001d30000011010000,8BitDo Ultimate 2C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b5,paddle2:b2,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000c82d00001b30000001000000,8BitDo Ultimate 2C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b5,paddle2:b2,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00001530000011010000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00001630000011010000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00001730000011010000,8BitDo Ultimate C,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00001130000011010000,8BitDo Ultimate Wired,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b26,paddle1:b24,paddle2:b25,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00000631000010010000,8BitDo Ultimate Wireless,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c82d00000631000014010000,8BitDo Ultimate Wireless,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c82d00000760000011010000,8BitDo Ultimate Wireless,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c82d00001230000011010000,8BitDo Ultimate Wireless,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b2,paddle2:b5,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00001330000011010000,8BitDo Ultimate Wireless,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b26,paddle1:b23,paddle2:b19,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00000121000011010000,8BitDo Xbox One SN30 Pro,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000c82d00000121000000010000,8BitDo Xbox One SN30 Pro,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000a00500003232000001000000,8BitDo Zero,a:b0,b:b1,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Linux,
+05000000a00500003232000008010000,8BitDo Zero,a:b0,b:b1,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b3,y:b4,platform:Linux,
+03000000c82d00001890000011010000,8BitDo Zero 2,a:b1,b:b0,back:b10,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b11,x:b4,y:b3,platform:Linux,
+05000000c82d00003032000000010000,8BitDo Zero 2,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b4,y:b3,platform:Linux,
+03000000c01100000355000011010000,Acrux Gamepad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00008801000011010000,Afterglow Deluxe Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00003901000000430000,Afterglow Prismatic Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00003901000013020000,Afterglow Prismatic Controller 048-007-NA,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00001302000000010000,Afterglow Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00003901000020060000,Afterglow Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000100000008200000011010000,Akishop Customs PS360,a:b1,b:b2,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+030000007c1800000006000010010000,Alienware Dual Compatible Game PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b3,platform:Linux,
+05000000491900000204000021000000,Amazon Fire Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b17,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b12,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000491900001904000011010000,Amazon Luna Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b9,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Linux,
+05000000710100001904000000010000,Amazon Luna Controller,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Linux,
+0300000008100000e501000001010000,Anbernic Handheld,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a4,start:b11,x:b3,y:b4,platform:Linux,
+03000000020500000913000010010000,Anbernic RG P01,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000373500000710000010010000,Anbernic RG P01,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000373500004610000001000000,Anbernic RG P01,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000190e00000110000010010000,Aquaplus Piece,a:b1,b:b0,back:b3,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b2,platform:Linux,
+03000000790000003018000011010000,Arcade Fightstick F300,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+03000000a30c00002700000011010000,Astro City Mini,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,rightshoulder:b4,righttrigger:b5,start:b9,x:b3,y:b0,platform:Linux,
+03000000a30c00002800000011010000,Astro City Mini,a:b2,b:b1,back:b8,leftx:a0,lefty:a1,rightshoulder:b4,righttrigger:b5,start:b9,x:b3,y:b0,platform:Linux,
+05000000050b00000045000031000000,ASUS Gamepad,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b10,x:b2,y:b3,platform:Linux,
+05000000050b00000045000040000000,ASUS Gamepad,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b10,x:b2,y:b3,platform:Linux,
+03000000050b00000579000011010000,ASUS ROG Kunai 3,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b36,paddle1:b52,paddle2:b53,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000050b00000679000000010000,ASUS ROG Kunai 3,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b21,paddle1:b22,paddle2:b23,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000503200000110000000000000,Atari VCS Classic Controller,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b4,start:b3,platform:Linux,
+03000000503200000110000011010000,Atari VCS Classic Controller,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b4,start:b3,platform:Linux,
+05000000503200000110000000000000,Atari VCS Classic Controller,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b4,start:b3,platform:Linux,
+05000000503200000110000044010000,Atari VCS Classic Controller,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b4,start:b3,platform:Linux,
+05000000503200000110000046010000,Atari VCS Classic Controller,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b4,start:b3,platform:Linux,
+03000000503200000210000000000000,Atari VCS Modern Controller,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a4,rightx:a2,righty:a3,start:b8,x:b2,y:b3,platform:Linux,
+03000000503200000210000011010000,Atari VCS Modern Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b2,platform:Linux,
+05000000503200000210000000000000,Atari VCS Modern Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b2,platform:Linux,
+05000000503200000210000045010000,Atari VCS Modern Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b2,platform:Linux,
+05000000503200000210000046010000,Atari VCS Modern Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b2,platform:Linux,
+05000000503200000210000047010000,Atari VCS Modern Controller,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b6,lefttrigger:+a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:-a4,rightx:a2,righty:a3,start:b8,x:b2,y:b3,platform:Linux,
+030000008a3500000201000011010000,Backbone One,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000008a3500000202000011010000,Backbone One,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000008a3500000302000011010000,Backbone One,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000008a3500000402000011010000,Backbone One,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000c62400001b89000011010000,BDA MOGA XP5X Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000d62000002a79000011010000,BDA PS4 Fightpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000c21100000791000011010000,Be1 GC101 Controller 1.03,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000c31100000791000011010000,Be1 GC101 Controller 1.03,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000005e0400008e02000003030000,Be1 GC101 Xbox 360,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000bc2000004d50000011010000,Beitong A1T2 BFM,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000bc2000000055000001000000,Betop AX1 BFM,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000bc2000006412000011010000,Betop Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b30,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+030000006b1400000209000011010000,Bigben,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000120c0000300e000011010000,Brook Audio Fighting Board PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000120c0000310e000011010000,Brook Audio Fighting Board PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000120c0000200e000011010000,Brook Mars PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000120c0000210e000011010000,Brook Mars PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000120c0000f70e000011010000,Brook Universal Fighting Board,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+03000000d81d00000b00000010010000,Buffalo BSGP1601,a:b5,b:b3,back:b12,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b8,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b9,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b13,x:b4,y:b2,platform:Linux,
+03000000e82000006058000001010000,Cideko AK08b,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000af1e00002400000010010000,Clockwork Pi DevTerm,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b9,x:b3,y:b0,platform:Linux,
+030000000b0400003365000000010000,Competition Pro,a:b0,b:b1,back:b2,leftx:a0,lefty:a1,start:b3,platform:Linux,
+03000000632500007a05000001020000,Cosmic Byte Ares Wired Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000260900008888000000010000,Cyber Gadget GameCube Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:a5,rightx:a2,righty:a3~,start:b7,x:b2,y:b3,platform:Linux,
+03000000a306000022f6000011010000,Cyborg V3 Rumble,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:+a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:-a3,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Linux,
+030000005e0400008e02000002010000,Data Frog S80,a:b1,b:b0,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b2,platform:Linux,
+03000000791d00000103000010010000,Dual Box Wii Classic Adapter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+030000006f0e00003001000001010000,EA Sports PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000c11100000191000011010000,EasySMX,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000242f00009100000000010000,EasySMX ESM-9101,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006e0500000320000010010000,Elecom U3613M,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Linux,
+030000006e0500000720000010010000,Elecom W01U,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Linux,
+030000007d0400000640000010010000,Eliminator AfterShock,a:b1,b:b2,back:b9,dpdown:+a3,dpleft:-a5,dpright:+a5,dpup:-a3,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a4,righty:a2,start:b8,x:b0,y:b3,platform:Linux,
+03000000430b00000300000000010000,EMS Production PS2 Adapter,a:b2,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a5,righty:a2,start:b9,x:b3,y:b0,platform:Linux,
+030000006f0e00008401000011010000,Faceoff Deluxe Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00008101000011010000,Faceoff Deluxe Pro Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00008001000011010000,Faceoff Pro Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000852100000201000010010000,FF GP1,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+05000000b40400001224000001010000,Flydigi APEX 4,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b14,leftshoulder:b4,leftstick:b10,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b20,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+03000000b40400001124000011010000,Flydigi Vader 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b12,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b14,paddle1:b2,paddle2:b5,paddle3:b16,paddle4:b17,rightshoulder:b7,rightstick:b13,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000b40400001224000011010000,Flydigi Vader 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b12,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b2,paddle1:b16,paddle2:b17,paddle3:b14,paddle4:b15,rightshoulder:b7,rightstick:b13,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000151900004000000001000000,Flydigi Vader 2,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b21,leftshoulder:b6,leftstick:b12,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b14,paddle1:b2,paddle2:b5,paddle3:b16,paddle4:b17,rightshoulder:b7,rightstick:b13,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000007e0500003703000000000000,GameCube Adapter,a:b0,b:b1,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b6,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b2,platform:Linux,
+19000000030000000300000002030000,GameForce Controller,a:b1,b:b0,back:b8,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,guide:b16,leftshoulder:b4,leftstick:b14,lefttrigger:b6,leftx:a1,lefty:a0,rightshoulder:b5,rightstick:b15,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+03000000373500000b10000019010000,GameSir Cyclone 2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000ac0500005b05000010010000,GameSir G3w,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000bc2000000055000011010000,GameSir G3w,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000558500001b06000010010000,GameSir G4 Pro,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000ac0500002d0200001b010000,GameSir G4s,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b33,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000ac0500007a05000011010000,GameSir G5,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b16,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000373500009710000001020000,GameSir Kaleid Flux,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000ac0500001a06000011010000,GameSir T3 2.02,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000bc2000005656000011010000,GameSir T4w,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000373500009410000010010000,GameSir Tegenaria Lite,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+0500000047532047616d657061640000,GameStop Gamepad,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+030000006f0e00000104000000010000,Gamestop Logic3 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000008f0e00000800000010010000,Gasia PlayStation Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000451300000010000010010000,Genius Maxfire Grandias 12,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+03000000f025000021c1000010010000,Gioteck PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000f0250000c283000010010000,Gioteck VX2 PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+190000004b4800000010000000010000,GO-Advance Controller,a:b1,b:b0,back:b10,dpdown:b7,dpleft:b8,dpright:b9,dpup:b6,leftshoulder:b4,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b13,start:b15,x:b2,y:b3,platform:Linux,
+190000004b4800000010000001010000,GO-Advance Controller,a:b1,b:b0,back:b12,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,leftshoulder:b4,leftstick:b13,lefttrigger:b14,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b16,righttrigger:b15,start:b17,x:b2,y:b3,platform:Linux,
+190000004b4800000011000000010000,GO-Super Gamepad,a:b0,b:b1,back:b12,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,guide:b16,leftshoulder:b4,leftstick:b14,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b15,righttrigger:b7,rightx:a2,righty:a3,start:b13,x:b3,y:b2,platform:Linux,
+03000000f0250000c183000010010000,Goodbetterbest Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000d11800000094000011010000,Google Stadia Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Linux,
+05000000d11800000094000000010000,Google Stadia Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Linux,
+0300000079000000d418000000010000,GPD Win 2 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000001010000,GPD Win Max 2 6800U Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000007d0400000540000000010000,Gravis Eliminator Pro,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+03000000280400000140000000010000,Gravis GamePad Pro,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+030000008f0e00000610000000010000,GreenAsia Electronics Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b10,righttrigger:b5,rightx:a3,righty:a2,start:b11,x:b3,y:b0,platform:Linux,
+030000008f0e00001200000010010000,GreenAsia Joystick,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+0500000047532067616d657061640000,GS gamepad,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+03000000f0250000c383000010010000,GT VX2,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+030000008a2e0000dd10000011010000,Hand Held Legend GC Ultimate,a:b0,b:b2,back:b17,dpdown:b5,dpleft:b6,dpright:b7,dpup:b4,guide:b18,leftshoulder:b10,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b19,misc2:b24,paddle1:b13,paddle2:b12,rightshoulder:b11,rightstick:b9,righttrigger:a4,rightx:a2,righty:a5,start:b16,x:b1,y:b3,platform:Linux,
+030000008a2e0000df10000011010000,Hand Held Legend ProGCC,a:b1,b:b0,back:b17,dpdown:b5,dpleft:b6,dpright:b7,dpup:b4,guide:b18,leftshoulder:b10,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b19,paddle1:b13,paddle2:b12,rightshoulder:b11,rightstick:b9,righttrigger:a4,rightx:a2,righty:a5,start:b16,x:b3,y:b2,platform:Linux,
+06000000adde0000efbe000002010000,Hidromancer Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d81400000862000011010000,HitBox PS3 PC Analog Mode,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b9,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b12,x:b0,y:b3,platform:Linux,
+03000000c9110000f055000011010000,HJC Gamepad,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+030000000d0f00006d00000020010000,Hori EDGE 301,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:+a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000000d0f00008400000011010000,Hori Fighting Commander,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00005f00000011010000,Hori Fighting Commander 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00005e00000011010000,Hori Fighting Commander 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000000d0f00005001000009040000,Hori Fighting Commander Octa Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000000d0f00008500000010010000,Hori Fighting Commander PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00008600000002010000,Hori Fighting Commander Xbox 360,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+030000000d0f00003701000013010000,Hori Fighting Stick Mini,a:b1,b:b0,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,lefttrigger:a2,rightshoulder:b5,righttrigger:a5,start:b7,x:b3,y:b2,platform:Linux,
+030000000d0f00008800000011010000,Hori Fighting Stick mini 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,rightstick:b11,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00008700000011010000,Hori Fighting Stick mini 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,rightshoulder:b5,rightstick:b11,righttrigger:a4,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000000d0f00001000000011010000,Hori Fightstick 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+03000000ad1b000003f5000033050000,Hori Fightstick VX,+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b8,guide:b10,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b2,y:b3,platform:Linux,
+030000000d0f00004d00000011010000,Hori Gem Pad 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000ad1b000001f5000033050000,Hori Pad EX Turbo 2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000000d0f00003801000011010000,Hori PC Engine Mini Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b9,platform:Linux,
+030000000d0f00009200000011010000,Hori Pokken Tournament DX Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00001100000011010000,Hori Real Arcade Pro 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00002200000011010000,Hori Real Arcade Pro 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00006a00000011010000,Hori Real Arcade Pro 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00006b00000011010000,Hori Real Arcade Pro 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00001600000000010000,Hori Real Arcade Pro EXSE,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b2,y:b3,platform:Linux,
+030000000d0f0000aa00000011010000,Hori Real Arcade Pro for Nintendo Switch,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+030000000d0f00008501000017010000,Hori Split Pad Fit,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000000d0f00008501000015010000,Hori Switch Split Pad Pro,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000000d0f00006e00000011010000,Horipad 4 PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00006600000011010000,Horipad 4 PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000000d0f0000ee00000011010000,Horipad Mini 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b13,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f0000c100000011010000,Horipad Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000000d0f00006700000001010000,Horipad One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000000d0f0000ab01000011010000,Horipad Steam,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc2:b2,paddle1:b19,paddle2:b18,paddle3:b15,paddle4:b5,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000000d0f00009601000091000000,Horipad Steam,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc2:b2,paddle1:b19,paddle2:b18,paddle3:b15,paddle4:b5,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000000d0f0000f600000001000000,Horipad Switch Pro Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+03000000341a000005f7000010010000,HuiJia GameCube Controller Adapter,a:b1,b:b2,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b0,y:b3,platform:Linux,
+05000000242e00000b20000001000000,Hyperkin Admiral N64 Controller,+rightx:b11,+righty:b13,-rightx:b8,-righty:b12,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b14,leftx:a0,lefty:a1,rightshoulder:b5,start:b9,platform:Linux,
+03000000242e0000ff0b000011010000,Hyperkin N64 Adapter,a:b1,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a2,righty:a3,start:b9,platform:Linux,
+03000000242e00006a38000010010000,Hyperkin Trooper 2,a:b0,b:b1,back:b4,leftshoulder:b2,leftx:a0,lefty:a1,rightshoulder:b3,start:b5,platform:Linux,
+03000000242e00008816000001010000,Hyperkin X91,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000f00300008d03000011010000,HyperX Clutch,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000830500006020000010010000,iBuffalo Super Famicom Controller,a:b1,b:b0,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b7,x:b3,y:b2,platform:Linux,
+03000000d80400004bea000011010000,icedragon.io STAC Dance Pad,a:b0,b:b1,x:b2,y:b3,back:b4,platform:Linux,
+03000000d80400004aea000011010000,icedragon.io STAC Dance Pad,a:b0,b:b1,x:b2,y:b3,back:b4,platform:Linux,
+030000008a2e0000d910000011010000,icedragon.io STAC2 Dance Pad,a:b0,b:b1,x:b2,y:b3,back:b4,platform:Linux,
+030000008a2e0000e910000011010000,icedragon.io STAC2 Dance Pad,a:b8,b:b9,x:b10,y:b11,back:b12,platform:Linux,
+030000008f0e00001330000001010000,iCode Retro Adapter,b:b3,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b9,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b1,start:b7,x:b2,y:b0,platform:Linux,
+050000006964726f69643a636f6e0000,idroidcon Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000b50700001503000010010000,Impact,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Linux,
+03000000d80400008200000003000000,IMS PCU0,a:b1,b:b0,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b5,x:b3,y:b2,platform:Linux,
+03000000120c00000500000010010000,InterAct AxisPad,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,start:b11,x:b0,y:b1,platform:Linux,
+03000000ef0500000300000000010000,InterAct AxisPad,a:b2,b:b3,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,start:b11,x:b0,y:b1,platform:Linux,
+03000000fd0500000030000000010000,InterAct GoPad,a:b3,b:b4,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,x:b0,y:b1,platform:Linux,
+03000000fd0500002a26000000010000,InterAct HammerHead FX,a:b3,b:b4,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b2,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b5,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b0,y:b1,platform:Linux,
+0500000049190000020400001b010000,Ipega PG 9069,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b161,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000632500007505000011010000,Ipega PG 9099,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+0500000049190000030400001b010000,Ipega PG9099,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000491900000204000000000000,Ipega PG9118,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000300f00001101000010010000,Jess Tech Colour Rumble Pad,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Linux,
+03000000300f00001001000010010000,Jess Tech Dual Analog Rumble,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Linux,
+03000000300f00000b01000010010000,Jess Tech GGE909 PC Recoil,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Linux,
+03000000ba2200002010000001010000,Jess Technology Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Linux,
+030000007e0500000620000001000000,Joy-Con (L),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b13,leftshoulder:b4,leftstick:b10,rightshoulder:b5,start:b8,x:b2,y:b3,platform:Linux,
+050000007e0500000620000001000000,Joy-Con (L),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b13,leftshoulder:b4,leftstick:b10,rightshoulder:b5,start:b8,x:b2,y:b3,platform:Linux,
+030000007e0500000720000001000000,Joy-Con (R),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b12,leftshoulder:b4,leftstick:b11,rightshoulder:b5,start:b9,x:b2,y:b3,platform:Linux,
+050000007e0500000720000001000000,Joy-Con (R),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b1,back:b12,leftshoulder:b4,leftstick:b11,rightshoulder:b5,start:b9,x:b2,y:b3,platform:Linux,
+03000000bd12000003c0000010010000,Joypad Alpha Shock,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000242f00002d00000011010000,JYS Adapter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000242f00008a00000011010000,JYS Adapter,a:b1,b:b4,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b0,y:b3,platform:Linux,
+030000006f0e00000103000000020000,Logic3 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006d040000d1ca000000000000,Logitech Chillstream,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006d040000d1ca000011010000,Logitech Chillstream,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006d04000019c2000010010000,Logitech Cordless RumblePad 2,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006d04000016c2000010010000,Logitech Dual Action,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006d04000016c2000011010000,Logitech Dual Action,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006d0400001dc2000014400000,Logitech F310,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006d0400001ec2000019200000,Logitech F510,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006d0400001ec2000020200000,Logitech F510,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006d04000019c2000011010000,Logitech F710,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006d0400001fc2000005030000,Logitech F710,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006d04000018c2000010010000,Logitech RumblePad 2,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006d04000011c2000010010000,Logitech WingMan Cordless RumblePad,a:b0,b:b1,back:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b5,leftshoulder:b6,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b10,rightx:a3,righty:a4,start:b8,x:b3,y:b4,platform:Linux,
+030000006d0400000ac2000010010000,Logitech WingMan RumblePad,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,rightx:a3,righty:a4,x:b3,y:b4,platform:Linux,
+05000000380700006652000025010000,Mad Catz CTRLR,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700008532000010010000,Mad Catz Fightpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b5,rightshoulder:b6,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700005032000011010000,Mad Catz Fightpad Pro PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700005082000011010000,Mad Catz Fightpad Pro PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000ad1b00002ef0000090040000,Mad Catz Fightpad SFxT,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,lefttrigger:a2,rightshoulder:b5,righttrigger:a5,start:b7,x:b2,y:b3,platform:Linux,
+03000000380700008031000011010000,Mad Catz FightStick Alpha PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700008081000011010000,Mad Catz FightStick Alpha PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700008034000011010000,Mad Catz Fightstick PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700008084000011010000,Mad Catz Fightstick PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000380700008433000011010000,Mad Catz Fightstick TE S PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700008483000011010000,Mad Catz Fightstick TE S PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000380700001888000010010000,Mad Catz Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700003888000010010000,Mad Catz Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:a0,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000380700001647000010040000,Mad Catz Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000380700003847000090040000,Mad Catz Xbox 360 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+03000000ad1b000016f0000090040000,Mad Catz Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000120c00000500000000010000,Manta DualShock 2,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+030000008f0e00001330000010010000,Mayflash Controller Adapter,a:b1,b:b2,back:b8,dpdown:h0.8,dpleft:h0.2,dpright:h0.1,dpup:h0.4,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a3~,righty:a2,start:b9,x:b0,y:b3,platform:Linux,
+03000000790000004318000010010000,Mayflash GameCube Adapter,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+03000000790000004418000010010000,Mayflash GameCube Controller,a:b1,b:b0,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+03000000242f00007300000011010000,Mayflash Magic NS,a:b1,b:b4,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b0,y:b3,platform:Linux,
+0300000079000000d218000011010000,Mayflash Magic NS,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000d620000010a7000011010000,Mayflash Magic NS,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000242f0000f700000001010000,Mayflash Magic S Pro,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000008f0e00001030000010010000,Mayflash Saturn Adapter,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,lefttrigger:b7,rightshoulder:b6,righttrigger:b2,start:b9,x:b3,y:b4,platform:Linux,
+0300000025090000e803000001010000,Mayflash Wii Classic Adapter,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:a4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:a5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Linux,
+03000000790000000318000011010000,Mayflash Wii DolphinBar,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Linux,
+03000000790000000018000011010000,Mayflash Wii U Pro Adapter,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000b50700001203000010010000,Mega World Logic 3 Controller,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Linux,
+03000000b50700004f00000000010000,Mega World Logic 3 Controller,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b1,platform:Linux,
+03000000780000000600000010010000,Microntek Joystick,a:b2,b:b1,back:b8,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,start:b9,x:b3,y:b0,platform:Linux,
+030000005e0400002800000000010000,Microsoft Dual Strike,a:b3,b:b2,back:b4,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,lefttrigger:b8,rightshoulder:b7,rightx:a0,righty:a1~,start:b5,x:b1,y:b0,platform:Linux,
+030000005e0400000300000000010000,Microsoft SideWinder,a:b0,b:b1,back:b9,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Linux,
+030000005e0400000700000000010000,Microsoft SideWinder,a:b0,b:b1,back:b8,leftshoulder:b6,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b2,start:b9,x:b3,y:b4,platform:Linux,
+030000005e0400000e00000000010000,Microsoft SideWinder Freestyle Pro,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,rightshoulder:b7,start:b8,x:b3,y:b4,platform:Linux,
+030000005e0400002700000000010000,Microsoft SideWinder Plug and Play,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,lefttrigger:b4,righttrigger:b5,x:b2,y:b3,platform:Linux,
+030000005e0400008502000000010000,Microsoft Xbox,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b4,platform:Linux,
+030000005e0400008902000021010000,Microsoft Xbox,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b4,platform:Linux,
+030000005e0400008e02000001000000,Microsoft Xbox 360,a:b0,b:b1,back:b6,dpdown:h0.1,dpleft:h0.2,dpright:h0.8,dpup:h0.4,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000004010000,Microsoft Xbox 360,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000056210000,Microsoft Xbox 360,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000062230000,Microsoft Xbox 360,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000d102000001010000,Microsoft Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000d102000003020000,Microsoft Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000dd02000003020000,Microsoft Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000ea02000008040000,Microsoft Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000ea0200000f050000,Microsoft Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000120b000009050000,Microsoft Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000e302000003020000,Microsoft Xbox One Elite,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000000b000007040000,Microsoft Xbox One Elite 2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b12,paddle2:b14,paddle3:b13,paddle4:b15,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000000b000008040000,Microsoft Xbox One Elite 2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b12,paddle2:b14,paddle3:b13,paddle4:b15,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000005e040000050b000003090000,Microsoft Xbox One Elite 2,a:b0,b:b1,back:b17,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a6,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e0400008e02000030110000,Microsoft Xbox One Elite 2,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b13,paddle3:b12,paddle4:b14,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b00000b050000,Microsoft Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000016050000,Microsoft Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000017050000,Microsoft Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000120b000001050000,Microsoft Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000030000000300000002000000,Miroof,a:b1,b:b0,back:b6,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b3,y:b2,platform:Linux,
+03000000790000001c18000010010000,Mobapad Chitu HD,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000004d4f435554452d3035335800,Mocute 053X,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+05000000e80400006e0400001b010000,Mocute 053X M59,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000004d4f435554452d3035305800,Mocute 054X,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000d6200000e589000001000000,Moga 2,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Linux,
+05000000d6200000ad0d000001000000,Moga Pro,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Linux,
+05000000d62000007162000001000000,Moga Pro 2,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Linux,
+03000000c82d00000960000000000000,8BitDo Pro 3,a:b1,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b17,paddle2:b16,paddle3:b2,paddle4:b5,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a3,righty:a4,start:b11,x:b4,y:b3,platform:Mac OS X,
+03000000c62400002b89000011010000,MOGA XP5A Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000c62400002a89000000010000,MOGA XP5A Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b22,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000c62400001a89000000010000,MOGA XP5X Plus,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000250900006688000000010000,MP8866 Super Dual Box,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Linux,
+030000005e0400008e02000010020000,MSI GC20 V2,a:b0,b:b1,back:b6,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000f70600000100000000010000,N64 Adaptoid,+rightx:b2,+righty:b1,-rightx:b4,-righty:b5,a:b0,b:b3,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b6,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b7,start:b8,platform:Linux,
+030000006b1400000906000014010000,Nacon Asymmetric Wireless PS4 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006b140000010c000010010000,Nacon GC 400ES,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+03000000853200000706000012010000,Nacon GC-100,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+05000000853200000503000000010000,Nacon MG-X Pro,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+0300000085320000170d000011010000,Nacon Revolution 5 Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+0300000085320000190d000011010000,Nacon Revolution 5 Pro,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000000d0f00000900000010010000,Natec Genesis P44,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000004f1f00000800000011010000,NeoGeo PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+0300000092120000474e000000010000,NeoGeo X Arcade Stick,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,start:b9,x:b3,y:b2,platform:Linux,
+03000000790000004518000010010000,Nexilux GameCube Controller Adapter,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:a4,rightx:a5,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+030000001008000001e5000010010000,NEXT SNES Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,righttrigger:b6,start:b9,x:b3,y:b0,platform:Linux,
+060000007e0500003713000000000000,Nintendo 3DS,a:b0,b:b1,back:b8,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Linux,
+03000000790000004618000010010000,Nintendo GameCube Controller Adapter,a:b1,b:b0,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,rightx:a5~,righty:a2~,start:b9,x:b2,y:b3,platform:Linux,
+03000000ec110000e1a7000010010000,Nintendo Switch,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+030000007e0500006920000011010000,Nintendo Switch 2 Pro Controller,a:b0,b:b1,back:b14,dpdown:b8,dpleft:b10,dpright:b9,dpup:b11,guide:b16,leftshoulder:b12,leftstick:b15,lefttrigger:b13,leftx:a0,lefty:a1~,misc1:b17,misc2:b20,paddle1:b18,paddle2:b19,rightshoulder:b4,rightstick:b7,righttrigger:b5,rightx:a2,righty:a3~,start:b6,x:b2,y:b3,platform:Linux,
+060000004e696e74656e646f20537700,Nintendo Switch Combined Joy-Cons,a:b0,b:b1,back:b9,dpdown:b15,dpleft:b16,dpright:b17,dpup:b14,guide:b11,leftshoulder:b5,leftstick:b12,lefttrigger:b7,leftx:a0,lefty:a1,misc1:b4,rightshoulder:b6,rightstick:b13,righttrigger:b8,rightx:a2,righty:a3,start:b10,x:b3,y:b2,platform:Linux,
+060000007e0500000620000000000000,Nintendo Switch Combined Joy-Cons,a:b0,b:b1,back:b9,dpdown:b15,dpleft:b16,dpright:b17,dpup:b14,guide:b11,leftshoulder:b5,leftstick:b12,lefttrigger:b7,leftx:a0,lefty:a1,misc1:b4,rightshoulder:b6,rightstick:b13,righttrigger:b8,rightx:a2,righty:a3,start:b10,x:b3,y:b2,platform:Linux,
+060000007e0500000820000000000000,Nintendo Switch Combined Joy-Cons,a:b0,b:b1,back:b9,dpdown:b15,dpleft:b16,dpright:b17,dpup:b14,guide:b11,leftshoulder:b5,leftstick:b12,lefttrigger:b7,leftx:a0,lefty:a1,misc1:b4,rightshoulder:b6,rightstick:b13,righttrigger:b8,rightx:a2,righty:a3,start:b10,x:b3,y:b2,platform:Linux,
+050000004c69632050726f20436f6e00,Nintendo Switch Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+050000007e0500000620000001800000,Nintendo Switch Left Joy-Con,a:b16,b:b15,back:b4,leftshoulder:b6,leftstick:b12,leftx:a1,lefty:a0~,rightshoulder:b8,start:b9,x:b14,y:b17,platform:Linux,
+030000007e0500000920000000026803,Nintendo Switch Pro Controller,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Linux,
+030000007e0500000920000011810000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b5,leftstick:b12,lefttrigger:b7,leftx:a0,lefty:a1,misc1:b4,rightshoulder:b6,rightstick:b13,righttrigger:b8,rightx:a2,righty:a3,start:b10,x:b3,y:b2,platform:Linux,
+050000007e0500000920000001000000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+050000007e0500000920000001800000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b5,leftstick:b12,lefttrigger:b7,leftx:a0,lefty:a1,misc1:b4,rightshoulder:b6,rightstick:b13,righttrigger:b8,rightx:a2,righty:a3,start:b10,x:b3,y:b2,platform:Linux,
+050000007e0500000720000001800000,Nintendo Switch Right Joy-Con,a:b1,b:b2,back:b9,leftshoulder:b4,leftstick:b10,leftx:a1~,lefty:a0,rightshoulder:b6,start:b8,x:b0,y:b3,platform:Linux,
+05000000010000000100000003000000,Nintendo Wii Remote,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+050000007e0500003003000001000000,Nintendo Wii U Pro Controller,a:b0,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b16,dpup:b13,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Linux,
+050000005a1d00000218000003000000,Nokia GC 5000,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000000d0500000308000010010000,Nostromo n45 Dual Analog,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b12,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b10,x:b2,y:b3,platform:Linux,
+030000007e0500007320000011010000,NSO GameCube Controller,a:b1,b:b3,dpdown:b8,dpleft:b10,dpright:b9,dpup:b11,guide:b16,leftshoulder:b13,lefttrigger:b12,leftx:a0,lefty:a1~,rightshoulder:b5,righttrigger:b4,rightx:a2,righty:a3~,start:b6,x:b0,y:b2,platform:Linux,
+030000007e0500001920000011810000,NSO N64 Controller,+rightx:b2,+righty:b3,-rightx:b4,-righty:b10,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b5,rightshoulder:b7,righttrigger:b9,start:b11,platform:Linux,
+050000007e0500001920000001000000,NSO N64 Controller,+rightx:b8,+righty:b7,-rightx:b3,-righty:b2,a:b1,b:b0,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,righttrigger:b10,start:b9,platform:Linux,
+050000007e0500001920000001800000,NSO N64 Controller,+rightx:b2,+righty:b3,-rightx:b4,-righty:b10,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,lefttrigger:b8,leftx:a0,lefty:a1,misc1:b5,rightshoulder:b7,righttrigger:b9,start:b11,platform:Linux,
+030000007e0500001e20000011810000,NSO Sega Genesis Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,misc1:b3,rightshoulder:b2,righttrigger:b4,start:b5,platform:Linux,
+030000007e0500001720000011810000,NSO SNES Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b3,y:b2,platform:Linux,
+050000007e0500001720000001000000,NSO SNES Controller,a:b0,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,lefttrigger:b7,rightshoulder:b6,righttrigger:b8,start:b10,x:b3,y:b2,platform:Linux,
+050000007e0500001720000001800000,NSO SNES Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b3,y:b2,platform:Linux,
+03000000550900001072000011010000,NVIDIA Controller,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b13,leftshoulder:b4,leftstick:b8,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Linux,
+03000000550900001472000011010000,NVIDIA Controller,a:b0,b:b1,back:b14,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b16,leftshoulder:b4,leftstick:b7,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b8,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a5,start:b6,x:b2,y:b3,platform:Linux,
+05000000550900001472000001000000,NVIDIA Controller,a:b0,b:b1,back:b14,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b16,leftshoulder:b4,leftstick:b7,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b8,rightshoulder:b5,rightstick:b8,righttrigger:a4,rightx:a2,righty:a5,start:b6,x:b2,y:b3,platform:Linux,
+030000004b120000014d000000010000,NYKO Airflo EX,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+03000000451300000830000010010000,NYKO CORE,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+19000000010000000100000001010000,ODROID Go 2,a:b1,b:b0,dpdown:b7,dpleft:b8,dpright:b9,dpup:b6,guide:b10,leftshoulder:b4,leftstick:b12,lefttrigger:b11,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b13,righttrigger:b14,start:b15,x:b2,y:b3,platform:Linux,
+19000000010000000200000011000000,ODROID Go 2,a:b1,b:b0,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,guide:b12,leftshoulder:b4,leftstick:b14,lefttrigger:b13,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b15,righttrigger:b16,start:b17,x:b2,y:b3,platform:Linux,
+05000000362800000100000002010000,OUYA Controller,a:b0,b:b3,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,guide:b14,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,x:b1,y:b2,platform:Linux,
+05000000362800000100000003010000,OUYA Controller,a:b0,b:b3,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,guide:b14,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,x:b1,y:b2,platform:Linux,
+05000000362800000100000004010000,OUYA Controller,a:b0,b:b3,back:b14,dpdown:b9,dpleft:b10,dpright:b11,dpup:b8,leftshoulder:b4,leftstick:b6,lefttrigger:b12,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:b13,rightx:a3,righty:a4,start:b16,x:b1,y:b2,platform:Linux,
+03000000830500005020000010010000,Padix Rockfire PlayStation Bridge,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b11,x:b2,y:b3,platform:Linux,
+03000000ff1100003133000010010000,PC Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+030000006f0e0000b802000001010000,PDP Afterglow Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e0000b802000013020000,PDP Afterglow Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00006401000001010000,PDP Battlefield One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e0000d702000006640000,PDP Black Camo Wired Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:b13,dpleft:b14,dpright:b13,dpup:b14,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00003101000000010000,PDP EA Sports Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00008501000011010000,PDP Fightpad Pro Gamecube Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+030000006f0e0000c802000012010000,PDP Kingdom Hearts Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00002801000011010000,PDP PS3 Rock Candy Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00000901000011010000,PDP PS3 Versus Fighting,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00002f01000011010000,PDP Wired PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000ad1b000004f9000000010000,PDP Xbox 360 Versus Fighting,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,lefttrigger:a2,rightshoulder:b5,righttrigger:a5,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e0000f102000000000000,PDP Xbox Atomic,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e0000a802000023020000,PDP Xbox One Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+030000006f0e0000a702000023020000,PDP Xbox One Raven Black,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e0000d802000006640000,PDP Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e0000ef02000007640000,PDP Xbox Series Kinetic Wired Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c62400000053000000010000,PowerA,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c62400003a54000001010000,PowerA 1428124-01,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d62000000540000001010000,PowerA Advantage Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d620000011a7000011010000,PowerA Core Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000dd62000015a7000011010000,PowerA Fusion Nintendo Switch Arcade Stick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000d620000012a7000011010000,PowerA Fusion Nintendo Switch Fight Pad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000d62000000140000001010000,PowerA Fusion Pro 2 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000dd62000016a7000000000000,PowerA Fusion Pro Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000c62400001a53000000010000,PowerA Mini Pro Ex,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d620000013a7000011010000,PowerA Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000d62000006dca000011010000,PowerA Pro Ex,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000d620000014a7000011010000,PowerA Spectra Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000c62400001a58000001010000,PowerA Xbox One,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d62000000220000001010000,PowerA Xbox One Controller,a:b0,b:b1,back:b7,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Linux,
+03000000d62000000228000001010000,PowerA Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c62400001a54000001010000,PowerA Xbox One Mini Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d62000000240000001010000,PowerA Xbox One Spectra Infinity,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d62000000520000050010000,PowerA Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d62000000b20000001010000,PowerA Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000d62000000f20000001010000,PowerA Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b7,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006d040000d2ca000011010000,Precision Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000250900000017000010010000,PS/SS/N64 Adapter,a:b1,b:b2,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b5,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2~,righty:a3,start:b8,platform:Linux,
+03000000ff1100004133000010010000,PS2 Controller,a:b2,b:b1,back:b8,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,start:b9,x:b3,y:b0,platform:Linux,
+03000000120c0000160e000011010000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000341a00003608000011010000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000004c0500006802000010010000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Linux,
+030000004c0500006802000010810000,PS3 Controller,a:b0,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b16,dpup:b13,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+030000004c0500006802000011010000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Linux,
+030000004c0500006802000011810000,PS3 Controller,a:b0,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b16,dpup:b13,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+030000005f1400003102000010010000,PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+030000006f0e00001402000011010000,PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000008f0e00000300000010010000,PS3 Controller,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+050000004c0500006802000000000000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Linux,
+050000004c0500006802000000010000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:a12,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:a13,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Linux,
+050000004c0500006802000000800000,PS3 Controller,a:b0,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b16,dpup:b13,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+050000004c0500006802000000810000,PS3 Controller,a:b0,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b16,dpup:b13,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+05000000504c415953544154494f4e00,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Linux,
+060000004c0500006802000000010000,PS3 Controller,a:b14,b:b13,back:b0,dpdown:b6,dpleft:b7,dpright:b5,dpup:b4,guide:b16,leftshoulder:b10,leftstick:b1,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b11,rightstick:b2,righttrigger:b9,rightx:a2,righty:a3,start:b3,x:b15,y:b12,platform:Linux,
+030000004c050000a00b000011010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000004c050000a00b000011810000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+030000004c050000c405000000810000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+030000004c050000c405000011010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000004c050000c405000011810000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+030000004c050000cc09000000010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000004c050000cc09000011010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000004c050000cc09000011810000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+03000000c01100000140000011010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+050000004c050000c405000000010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+050000004c050000c405000000810000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+050000004c050000c405000001800000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+050000004c050000cc09000000010000,PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+050000004c050000cc09000000810000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+050000004c050000cc09000001800000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+0300004b4c0500005f0e000011010000,PS5 Access Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000004c050000e60c000011010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000004c050000e60c000011810000,PS5 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+030000004c050000f20d000011010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b14,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000004c050000f20d000011810000,PS5 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+050000004c050000e60c000000010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+050000004c050000e60c000000810000,PS5 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+050000004c050000f20d000000010000,PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+050000004c050000f20d000000810000,PS5 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b11,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:Linux,
+03000000300f00001211000011010000,Qanba Arcade Joystick,a:b2,b:b0,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b5,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b6,start:b9,x:b1,y:b3,platform:Linux,
+03000000222c00000225000011010000,Qanba Dragon Arcade Joystick PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000222c00000025000011010000,Qanba Dragon Arcade Joystick PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000222c00001220000011010000,Qanba Drone 2 Arcade Joystick PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000222c00001020000011010000,Qanba Drone 2 Arcade Joystick PS5,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000222c00000020000011010000,Qanba Drone Arcade PS4 Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,rightshoulder:b5,righttrigger:a4,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000300f00001210000010010000,Qanba Joystick Plus,a:b0,b:b1,back:b8,leftshoulder:b5,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b4,righttrigger:b6,start:b9,x:b2,y:b3,platform:Linux,
+03000000222c00000223000011010000,Qanba Obsidian Arcade Joystick PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000222c00000023000011010000,Qanba Obsidian Arcade Joystick PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000009b2800000300000001010000,Raphnet 4nes4snes,a:b0,b:b4,back:b2,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Linux,
+030000009b2800004200000001010000,Raphnet Dual NES Adapter,a:b0,b:b1,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b3,platform:Linux,
+0300132d9b2800006500000000000000,Raphnet GameCube Adapter,a:b0,b:b7,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,rightx:a3,righty:a4,start:b3,x:b1,y:b8,platform:Linux,
+0300132d9b2800006500000001010000,Raphnet GameCube Adapter,a:b0,b:b7,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,rightx:a3,righty:a4,start:b3,x:b1,y:b8,platform:Linux,
+030000009b2800003200000001010000,Raphnet GC and N64 Adapter,a:b0,b:b7,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,rightx:a3,righty:a4,start:b3,x:b1,y:b8,platform:Linux,
+030000009b2800006000000001010000,Raphnet GC and N64 Adapter,a:b0,b:b7,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b2,righttrigger:b5,rightx:a3,righty:a4,start:b3,x:b1,y:b8,platform:Linux,
+030000009b2800003c00000001010000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Linux,
+030000009b2800006100000001010000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Linux,
+030000009b2800006300000001010000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Linux,
+030000009b2800006400000001010000,Raphnet N64 Adapter,+rightx:b9,+righty:b7,-rightx:b8,-righty:b6,a:b0,b:b1,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,leftshoulder:b4,lefttrigger:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Linux,
+030000009b2800008000000020020000,Raphnet Wii Classic Adapter,a:b1,b:b4,back:b2,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Linux,
+030000009b2800008000000001010000,Raphnet Wii Classic Adapter V3,a:b1,b:b4,back:b2,dpdown:b13,dpleft:b14,dpright:b15,dpup:b12,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b5,platform:Linux,
+03000000f8270000bf0b000011010000,Razer Kishi,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000008916000001fd000024010000,Razer Onza Classic Edition,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b11,dpright:b12,dpup:b13,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000321500000204000011010000,Razer Panthera PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000321500000104000011010000,Razer Panthera PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000321500000810000011010000,Razer Panthera PS4 Evo Arcade Stick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b13,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000321500000010000011010000,Razer Raiju,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000321500000507000000010000,Razer Raiju Mobile,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b21,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000321500000a10000001000000,Razer Raiju Tournament Edition,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b13,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000321500000011000011010000,Razer Raion PS4 Fightpad,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000008916000000fe000024010000,Razer Sabertooth,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c6240000045d000024010000,Razer Sabertooth,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c6240000045d000025010000,Razer Sabertooth,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000321500000009000011010000,Razer Serval,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Linux,
+050000003215000000090000163a0000,Razer Serval,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Linux,
+0300000032150000030a000001010000,Razer Wildcat,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000321500000b10000011010000,Razer Wolverine PS5 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+0300000032150000140a000001010000,Razer Wolverine Ultimate Xbox,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000000d0f0000c100000010010000,Retro Bit Legacy16,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b12,leftshoulder:b4,lefttrigger:b6,misc1:b13,rightshoulder:b5,righttrigger:b7,start:b9,x:b0,y:b3,platform:Linux,
+03000000790000001100000010010000,Retro Controller,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b4,righttrigger:b5,start:b9,x:b0,y:b3,platform:Linux,
+0300000003040000c197000011010000,Retrode Adapter,a:b0,b:b4,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b1,y:b5,platform:Linux,
+190000004b4800000111000000010000,RetroGame Joypad,a:b1,b:b0,back:b8,dpdown:b14,dpleft:b15,dpright:b16,dpup:b13,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+0300000081170000990a000001010000,Retronic Adapter,a:b0,leftx:a0,lefty:a1,platform:Linux,
+0300000000f000000300000000010000,RetroPad,a:b1,b:b5,back:b2,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,start:b3,x:b0,y:b4,platform:Linux,
+00000000526574726f53746f6e653200,RetroStone 2 Controller,a:b1,b:b0,back:b10,dpdown:b15,dpleft:b16,dpright:b17,dpup:b14,leftshoulder:b6,lefttrigger:b8,rightshoulder:b7,righttrigger:b9,start:b11,x:b4,y:b3,platform:Linux,
+03000000341200000400000000010000,RetroUSB N64 RetroPort,+rightx:b8,+righty:b10,-rightx:b9,-righty:b11,a:b7,b:b6,dpdown:b2,dpleft:b1,dpright:b0,dpup:b3,leftshoulder:b13,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b12,start:b4,platform:Linux,
+030000006b140000010d000011010000,Revolution Pro Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000006b140000130d000011010000,Revolution Pro Controller 3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00001f01000000010000,Rock Candy,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00008701000011010000,Rock Candy Nintendo Switch Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00001e01000011010000,Rock Candy PS3 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000c6240000fefa000000010000,Rock Candy Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00004601000001010000,Rock Candy Xbox One Controller,a:b0,b:b1,back:b6,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00001311000011010000,Saffun Controller,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b0,platform:Linux,
+03000000a306000023f6000011010000,Saitek Cyborg PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Linux,
+03000000a30600001005000000010000,Saitek P150,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b7,lefttrigger:b6,rightshoulder:b2,righttrigger:b5,x:b3,y:b4,platform:Linux,
+03000000a30600000701000000010000,Saitek P220,a:b2,b:b3,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b4,righttrigger:b5,x:b0,y:b1,platform:Linux,
+03000000a30600000cff000010010000,Saitek P2500 Force Rumble,a:b2,b:b3,back:b11,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,start:b10,x:b0,y:b1,platform:Linux,
+03000000a30600000d5f000010010000,Saitek P2600,a:b1,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b11,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,rightx:a3,righty:a2,start:b8,x:b0,y:b3,platform:Linux,
+03000000a30600000c04000011010000,Saitek P2900,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b12,x:b0,y:b3,platform:Linux,
+03000000a306000018f5000010010000,Saitek P3200 Rumble,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Linux,
+03000000300f00001201000010010000,Saitek P380,a:b2,b:b3,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b9,x:b0,y:b1,platform:Linux,
+03000000a30600000901000000010000,Saitek P880,a:b2,b:b3,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a3,righty:a2,x:b0,y:b1,platform:Linux,
+03000000a30600000b04000000010000,Saitek P990 Dual Analog,a:b1,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a2,start:b8,x:b0,y:b3,platform:Linux,
+03000000a306000020f6000011010000,Saitek PS2700 Rumble,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a4,start:b9,x:b0,y:b3,platform:Linux,
+05000000e804000000a000001b010000,Samsung EIGP20,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftx:a0,lefty:a1,rightshoulder:b7,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000d81d00000e00000010010000,Savior,a:b0,b:b1,back:b8,leftshoulder:b6,leftstick:b10,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b11,righttrigger:b3,start:b9,x:b4,y:b5,platform:Linux,
+03000000952e00004b43000011010000,Scuf Envision,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b9,righttrigger:a4,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Linux,
+03000000952e00004d43000011010000,Scuf Envision,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b9,righttrigger:a4,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Linux,
+03000000952e00004e43000011010000,Scuf Envision,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b9,righttrigger:a4,rightx:a2,righty:a5,start:b7,x:b2,y:b3,platform:Linux,
+03000000a30c00002500000011010000,Sega Genesis Mini 3B Controller,a:b2,b:b1,dpdown:+a4,dpleft:-a3,dpright:+a3,dpup:-a4,righttrigger:b5,start:b9,platform:Linux,
+03000000790000001100000011010000,Sega Saturn,a:b1,b:b2,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b5,righttrigger:b4,start:b9,x:b0,y:b3,platform:Linux,
+03000000b40400000a01000000010000,Sega Saturn,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b7,rightshoulder:b5,righttrigger:b2,start:b8,x:b3,y:b4,platform:Linux,
+03000000632500002305000010010000,ShanWan Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000632500002605000010010000,ShanWan Gamepad,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000632500007505000010010000,ShanWan Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000bc2000000055000010010000,ShanWan Gamepad,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000341a00000908000010010000,SL6566,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+030000004b2900000430000011000000,Snakebyte Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000004c050000cc09000001000000,Sony DualShock 4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+03000000666600006706000000010000,Sony PlayStation Adapter,a:b2,b:b1,back:b8,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b9,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b10,righttrigger:b5,rightx:a2,righty:a3,start:b11,x:b3,y:b0,platform:Linux,
+030000004c050000da0c000011010000,Sony PlayStation Controller,a:b2,b:b1,back:b8,leftshoulder:b6,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,righttrigger:b5,start:b9,x:b3,y:b0,platform:Linux,
+03000000d9040000160f000000010000,Sony PlayStation Controller Adapter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Linux,
+03000000ff000000cb01000010010000,Sony PlayStation Portable,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Linux,
+030000004c0500003713000011010000,Sony PlayStation Vita,a:b1,b:b2,back:b8,dpdown:b13,dpleft:b15,dpright:b14,dpup:b12,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,rightx:a3,righty:a4,start:b9,x:b0,y:b3,platform:Linux,
+03000000250900000500000000010000,Sony PS2 pad with SmartJoy Adapter,a:b2,b:b1,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Linux,
+030000005e0400008e02000073050000,Speedlink Torid,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000020200000,SpeedLink Xeox Pro Analog,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000de2800000112000001000000,Steam Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b10,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Linux,
+03000000de2800000112000011010000,Steam Controller,a:b2,b:b3,back:b10,dpdown:+a5,dpleft:-a4,dpright:+a4,dpup:-a5,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a7,leftx:a0,lefty:a1,paddle1:b15,paddle2:b16,rightshoulder:b7,rightstick:b14,righttrigger:a6,rightx:a2,righty:a3,start:b11,x:b4,y:b5,platform:Linux,
+03000000de2800000211000001000000,Steam Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b10,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Linux,
+03000000de2800000211000011010000,Steam Controller,a:b2,b:b3,back:b10,dpdown:b18,dpleft:b19,dpright:b20,dpup:b17,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,paddle1:b16,paddle2:b15,rightshoulder:b7,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b4,y:b5,platform:Linux,
+03000000de2800004211000001000000,Steam Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b10,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Linux,
+03000000de2800004211000011010000,Steam Controller,a:b2,b:b3,back:b10,dpdown:b18,dpleft:b19,dpright:b20,dpup:b17,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a7,leftx:a0,lefty:a1,paddle1:b16,paddle2:b15,rightshoulder:b7,righttrigger:a6,rightx:a2,righty:a3,start:b11,x:b4,y:b5,platform:Linux,
+03000000de280000fc11000001000000,Steam Controller,a:b0,b:b1,back:b6,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+05000000de2800000212000001000000,Steam Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b10,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Linux,
+05000000de2800000511000001000000,Steam Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b10,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Linux,
+05000000de2800000611000001000000,Steam Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b10,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Linux,
+03000000de2800000512000010010000,Steam Deck,a:b3,b:b4,back:b11,dpdown:b17,dpleft:b18,dpright:b19,dpup:b16,guide:b13,leftshoulder:b7,leftstick:b14,lefttrigger:a9,leftx:a0,lefty:a1,rightshoulder:b8,rightstick:b15,righttrigger:a8,rightx:a2,righty:a3,start:b12,x:b5,y:b6,platform:Linux,
+03000000de2800000512000011010000,Steam Deck,a:b3,b:b4,back:b11,dpdown:b17,dpleft:b18,dpright:b19,dpup:b16,guide:b13,leftshoulder:b7,leftstick:b14,lefttrigger:a9,leftx:a0,lefty:a1,misc1:b2,paddle1:b21,paddle2:b20,paddle3:b23,paddle4:b22,rightshoulder:b8,rightstick:b15,righttrigger:a8,rightx:a2,righty:a3,start:b12,x:b5,y:b6,platform:Linux,
+03000000de280000ff11000001000000,Steam Virtual Gamepad,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000004e696d6275732b0000000000,SteelSeries Nimbus Plus,a:b0,b:b1,back:b10,guide:b11,leftshoulder:b4,leftstick:b8,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:b7,rightx:a2,righty:a3,start:b12,x:b2,y:b3,platform:Linux,
+03000000381000003014000075010000,SteelSeries Stratus Duo,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000381000003114000075010000,SteelSeries Stratus Duo,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+0500000011010000311400001b010000,SteelSeries Stratus Duo,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b32,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+05000000110100001914000009010000,SteelSeries Stratus XL,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000ad1b000038f0000090040000,Street Fighter IV Fightstick TE,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000003b07000004a1000000010000,Suncom SFX Plus,a:b0,b:b2,back:b7,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,lefttrigger:b4,rightshoulder:b9,righttrigger:b5,start:b8,x:b1,y:b3,platform:Linux,
+030000001f08000001e4000010010000,Super Famicom Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b3,y:b0,platform:Linux,
+03000000666600000488000000010000,Super Joy Box 5 Pro,a:b2,b:b1,back:b9,dpdown:b14,dpleft:b15,dpright:b13,dpup:b12,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a2,righty:a3,start:b8,x:b3,y:b0,platform:Linux,
+0300000000f00000f100000000010000,Super RetroPort,a:b1,b:b5,back:b2,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b6,rightshoulder:b7,start:b3,x:b0,y:b4,platform:Linux,
+030000008f0e00000d31000010010000,SZMY Power 3 Turbo,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000457500000401000011010000,SZMY Power DS4 Wired Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,misc1:b13,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000457500002211000010010000,SZMY Power Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+030000008f0e00001431000010010000,SZMY Power PS3,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000e40a00000307000011010000,Taito Egret II Mini Control Panel,a:b4,b:b2,back:b6,guide:b9,leftx:a0,lefty:a1,rightshoulder:b0,righttrigger:b1,start:b7,x:b8,y:b3,platform:Linux,
+03000000e40a00000207000011010000,Taito Egret II Mini Controller,a:b4,b:b2,back:b6,guide:b9,leftx:a0,lefty:a1,rightshoulder:b0,righttrigger:b1,start:b7,x:b8,y:b3,platform:Linux,
+03000000ba2200000701000001010000,Technology Innovation PS2 Adapter,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a5,righty:a2,start:b9,x:b3,y:b2,platform:Linux,
+03000000790000001c18000011010000,TGZ Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b15,leftshoulder:b6,leftstick:b13,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:b9,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000591c00002400000010010000,THEC64 Joystick,a:b0,b:b1,back:b6,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Linux,
+03000000591c00002600000010010000,THEGamepad,a:b2,b:b1,back:b6,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b3,y:b0,platform:Linux,
+030000004f04000015b3000001010000,Thrustmaster Dual Analog 3.2,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Linux,
+030000004f04000015b3000010010000,Thrustmaster Dual Analog 4,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Linux,
+030000004f04000020b3000010010000,Thrustmaster Dual Trigger,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Linux,
+030000004f04000023b3000000010000,Thrustmaster Dual Trigger PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000004f0400000ed0000011010000,Thrustmaster eSwap Pro Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000b50700000399000000010000,Thrustmaster Firestorm Digital 2,a:b2,b:b4,back:b11,leftshoulder:b6,leftstick:b10,lefttrigger:b7,leftx:a0,lefty:a1,rightshoulder:b8,rightstick:b0,righttrigger:b9,start:b1,x:b3,y:b5,platform:Linux,
+030000004f04000003b3000010010000,Thrustmaster Firestorm Dual Analog 2,a:b0,b:b2,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b9,rightx:a2,righty:a3,x:b1,y:b3,platform:Linux,
+030000004f04000000b3000010010000,Thrustmaster Firestorm Dual Power,a:b0,b:b2,back:b9,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b11,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b10,x:b1,y:b3,platform:Linux,
+030000004f04000004b3000010010000,Thrustmaster Firestorm Dual Power,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Linux,
+030000004f04000026b3000002040000,Thrustmaster GP XID,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c6240000025b000002020000,Thrustmaster GPX,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000004f04000008d0000000010000,Thrustmaster Run N Drive PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000004f04000009d0000000010000,Thrustmaster Run N Drive PlayStation Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000004f04000007d0000000010000,Thrustmaster T Mini,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+030000004f04000012b3000010010000,Thrustmaster Vibrating Gamepad,a:b0,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b6,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b1,y:b3,platform:Linux,
+03000000571d00002000000010010000,Tomee SNES Adapter,a:b0,b:b1,back:b6,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b7,x:b2,y:b3,platform:Linux,
+03000000bd12000015d0000010010000,Tomee SNES Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,start:b9,x:b3,y:b0,platform:Linux,
+03000000d814000007cd000011010000,Toodles 2008 Chimp PC PS3,a:b0,b:b1,back:b8,leftshoulder:b4,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b7,start:b9,x:b3,y:b2,platform:Linux,
+030000005e0400008e02000070050000,Torid,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000c01100000591000011010000,Torid,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+03000000680a00000300000003000000,TRBot Virtual Joypad,a:b11,b:b12,back:b15,dpdown:b6,dpleft:b3,dpright:b4,dpup:b5,leftshoulder:b17,leftstick:b21,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b22,righttrigger:a2,rightx:a3,righty:a4,start:b16,x:b13,y:b14,platform:Linux,
+03000000780300000300000003000000,TRBot Virtual Joypad,a:b11,b:b12,back:b15,dpdown:b6,dpleft:b3,dpright:b4,dpup:b5,leftshoulder:b17,leftstick:b21,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b22,righttrigger:a2,rightx:a3,righty:a4,start:b16,x:b13,y:b14,platform:Linux,
+03000000e00d00000300000003000000,TRBot Virtual Joypad,a:b11,b:b12,back:b15,dpdown:b6,dpleft:b3,dpright:b4,dpup:b5,leftshoulder:b17,leftstick:b21,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b22,righttrigger:a2,rightx:a3,righty:a4,start:b16,x:b13,y:b14,platform:Linux,
+03000000f00600000300000003000000,TRBot Virtual Joypad,a:b11,b:b12,back:b15,dpdown:b6,dpleft:b3,dpright:b4,dpup:b5,leftshoulder:b17,leftstick:b21,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b22,righttrigger:a2,rightx:a3,righty:a4,start:b16,x:b13,y:b14,platform:Linux,
+030000005f140000c501000010010000,Trust Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b0,platform:Linux,
+06000000f51000000870000003010000,Turtle Beach Recon,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000100800000100000010010000,Twin PS2 Adapter,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Linux,
+03000000c0160000e105000010010000,Ultimate Atari Fight Stick,a:b1,b:b2,back:b9,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,rightshoulder:b4,righttrigger:b5,start:b8,x:b0,y:b3,platform:Linux,
+03000000151900005678000010010000,Uniplay U6,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000100800000300000010010000,USB Gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b3,y:b0,platform:Linux,
+03000000790000000600000007010000,USB gamepad,a:b2,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a3,righty:a4,start:b9,x:b3,y:b0,platform:Linux,
+03000000790000001100000000010000,USB Gamepad,a:b2,b:b1,back:b8,dpdown:a0,dpleft:a1,dpright:a2,dpup:a4,start:b9,platform:Linux,
+03000000790000001a18000011010000,Venom PS4 Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b0,y:b3,platform:Linux,
+03000000790000001b18000011010000,Venom PS4 Arcade Joystick,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+030000006f0e00000302000011010000,Victrix Pro Fightstick PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+030000006f0e00000702000011010000,Victrix Pro Fightstick PS4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:b6,rightshoulder:b5,righttrigger:b7,start:b9,touchpad:b13,x:b0,y:b3,platform:Linux,
+05000000ac0500003232000001000000,VR Box Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b10,lefttrigger:b4,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b11,righttrigger:b5,rightx:a3,righty:a2,start:b9,x:b2,y:b3,platform:Linux,
+05000000434f4d4d414e440000000000,VX Gaming Command Series,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+0000000058626f782033363020576900,Xbox 360 Controller,a:b0,b:b1,back:b14,dpdown:b11,dpleft:b12,dpright:b13,dpup:b10,guide:b7,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Linux,
+030000005e0400001907000000010000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b11,dpright:b12,dpup:b13,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000010010000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000014010000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400009102000007010000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b11,dpright:b12,dpup:b13,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000a102000000010000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b11,dpright:b12,dpup:b13,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000a102000007010000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000a102000030060000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00001503000000020000,Xbox 360 Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400008e02000000010000,Xbox 360 EasySMX,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000a102000014010000,Xbox 360 Receiver,a:b0,b:b1,back:b6,dpdown:b14,dpleft:b11,dpright:b12,dpup:b13,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+0000000058626f782047616d65706100,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a4,rightx:a2,righty:a3,start:b7,x:b2,y:b3,platform:Linux,
+030000005e0400000202000000010000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b4,platform:Linux,
+030000005e0400008e02000072050000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000006f0e00001304000000010000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000ffff0000ffff000000010000,Xbox Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b5,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b2,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b3,y:b4,platform:Linux,
+030000005e0400000a0b000005040000,Xbox One Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b11,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b12,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b3,y:b2,platform:Linux,
+030000005e040000d102000002010000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000ea02000000000000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000ea02000001030000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000005e040000e002000003090000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b10,leftshoulder:b4,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b9,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000005e040000fd02000003090000,Xbox One Controller,a:b0,b:b1,back:b15,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b16,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000fd02000030110000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000dd02000003020000,Xbox One Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000005e040000e302000002090000,Xbox One Elite,a:b0,b:b1,back:b136,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a6,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000220b000013050000,Xbox One Elite 2 Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000050b000002090000,Xbox One Elite Series 2,a:b0,b:b1,back:b136,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b6,leftstick:b13,lefttrigger:a6,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a5,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+030000005e040000ea02000011050000,Xbox One S Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000ea02000015050000,Xbox One S Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000ea02000017050000,Xbox One S Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000ea0200000b050000,Xbox One S Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000ea0200000d050000,Xbox One S Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000ea02000016050000,Xbox One S Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000001050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000005050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000007050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000009050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b00000d050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b00000f050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000011050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000014050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000120b000015050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+030000005e040000130b000005050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000001050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000005050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000007050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000009050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000011050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000013050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000015050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000130b000017050000,Xbox Series Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+060000005e040000120b000007050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000120b00000b050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000120b00000d050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+060000005e040000120b00000f050000,Xbox Series Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000005e040000130b000022050000,Xbox Series X Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,misc1:b15,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+060000005e040000120b000011050000,Xbox Series X Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+050000005e040000200b000013050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000200b000017050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000200b000023050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+050000005e040000220b000017050000,Xbox Wireless Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b6,leftstick:b13,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a4,rightx:a2,righty:a3,start:b11,x:b3,y:b4,platform:Linux,
+03000000450c00002043000010010000,XEOX SL6556 BK,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+05000000172700004431000029010000,XiaoMi Controller,a:b0,b:b1,back:b10,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b20,leftshoulder:b6,leftstick:b13,lefttrigger:a7,leftx:a0,lefty:a1,rightshoulder:b7,rightstick:b14,righttrigger:a6,rightx:a2,righty:a5,start:b11,x:b3,y:b4,platform:Linux,
+03000000c0160000e105000001010000,XinMo Dual Arcade,a:b4,b:b3,back:b6,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b9,leftshoulder:b2,leftx:a0,lefty:a1,rightshoulder:b5,start:b7,x:b1,y:b0,platform:Linux,
+030000005e0400008e02000020010000,XInput Adapter,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+xinput,XInput Controller,a:b0,b:b1,back:b6,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,start:b7,x:b2,y:b3,platform:Linux,
+03000000120c0000100e000011010000,Zeroplus P4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000120c0000101e000011010000,Zeroplus P4,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000120c0000182e000011010000,Zeroplus PS4 Controller,a:b1,b:b2,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b12,leftshoulder:b4,leftstick:b10,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:a4,rightx:a2,righty:a5,start:b9,x:b0,y:b3,platform:Linux,
+03000000790000002201000011010000,ZhiXu GuliKit D,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b10,lefttrigger:b6,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b11,righttrigger:b7,rightx:a2,righty:a3,start:b9,x:b2,y:b3,platform:Linux,
+
+# Android
+38653964633230666463343334313533,8BitDo Adapter,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+36666264316630653965636634386234,8BitDo Adapter 2,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b19,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+38426974446f20417263616465205374,8BitDo Arcade Stick,a:b0,b:b1,back:b15,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b5,leftshoulder:b9,lefttrigger:a4,rightshoulder:b10,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+61393962646434393836356631636132,8BitDo Arcade Stick,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b19,y:b2,platform:Android,
+64323139346131306233636562663738,8BitDo Arcade Stick,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b19,y:b2,platform:Android,
+64643565386136613265663236636564,8BitDo Arcade Stick,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b19,y:b2,platform:Android,
+33313433353539306634656436353432,8BitDo Dogbone,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+38426974446f20446f67626f6e65204d,8BitDo Dogbone,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b6,platform:Android,
+34343439373236623466343934376233,8BitDo FC30 Pro,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b28,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b4,rightstick:b29,righttrigger:b7,start:b5,x:b30,y:b2,platform:Android,
+38426974446f204e4743204d6f646b69,8BitDo GameCube,a:b0,b:b2,back:b4,dpdown:b12,dpleft:b13,dpright:b14,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,paddle1:b18,paddle2:b17,rightshoulder:b15,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b1,y:b3,platform:Android,
+38426974446f2038426974446f204c69,8BitDo Lite,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+30643332373663313263316637356631,8BitDo Lite 2,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974446f204c6974652032000000,8BitDo Lite 2,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+62656331626461363634633735353032,8BitDo Lite 2,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38393936616436383062666232653338,8BitDo Lite SE,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974446f204c6974652053450000,8BitDo Lite SE,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+39356430616562366466646636643435,8BitDo Lite SE,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+05000000c82d000006500000ffff3f00,8BitDo M30,a:b1,b:b0,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b17,leftshoulder:b9,lefttrigger:a5,rightshoulder:b10,righttrigger:a4,start:b6,x:b3,y:b2,platform:Android,
+05000000c82d000051060000ffff3f00,8BitDo M30,a:b1,b:b0,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,guide:b17,leftshoulder:b9,lefttrigger:a4,rightshoulder:b10,righttrigger:a5,start:b6,x:b3,y:b2,platform:Android,
+32323161363037623637326438643634,8BitDo M30,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftx:a0,lefty:a1,rightshoulder:b9,righttrigger:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+33656266353630643966653238646264,8BitDo M30,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:a5,start:b10,x:b19,y:b2,platform:Android,
+38426974446f204d3330204d6f646b69,8BitDo M30,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftx:a0,lefty:a1,rightshoulder:b9,righttrigger:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+39366630663062373237616566353437,8BitDo M30,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:b18,start:b6,x:b2,y:b3,platform:Android,
+64653533313537373934323436343563,8BitDo M30,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:a4,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b9,righttrigger:b10,start:b6,x:b2,y:b3,platform:Android,
+66356438346136366337386437653934,8BitDo M30,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:b10,start:b18,x:b19,y:b2,platform:Android,
+66393064393162303732356665666366,8BitDo M30,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:a5,start:b6,x:b2,y:b3,platform:Android,
+38426974446f204d6963726f2067616d,8BitDo Micro,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,lefttrigger:a4,leftx:b0,lefty:b1,rightshoulder:b10,righttrigger:a5,rightx:b2,righty:b3,start:b6,x:b3,y:b2,platform:Android,
+61653365323561356263373333643266,8BitDo Micro,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,lefttrigger:a4,leftx:b0,lefty:b1,rightshoulder:b10,righttrigger:a5,rightx:b2,righty:b3,start:b6,x:b3,y:b2,platform:Android,
+62613137616239666338343866326336,8BitDo Micro,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,lefttrigger:a4,leftx:b0,lefty:b1,rightshoulder:b10,righttrigger:a5,rightx:b2,righty:b3,start:b6,x:b3,y:b2,platform:Android,
+33663431326134333366393233616633,8BitDo N30,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b6,platform:Android,
+38426974446f204e3330204d6f646b69,8BitDo N30,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftx:a0,lefty:a1,rightx:a2,righty:a3,start:b6,platform:Android,
+05000000c82d000015900000ffff3f00,8BitDo N30 Pro 2,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+05000000c82d000065280000ffff3f00,8BitDo N30 Pro 2,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b17,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38323035343766666239373834336637,8BitDo N64,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:b18,rightx:a2,righty:a3,start:b6,platform:Android,
+38426974446f204e3634204d6f646b69,8BitDo N64,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:b18,rightx:a2,righty:a3,start:b6,platform:Android,
+32363135613966656338666638666237,8BitDo NEOGEO,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+35363534633333373639386466346631,8BitDo NEOGEO,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+38426974446f204e454f47454f204750,8BitDo NEOGEO,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+39383963623932353561633733306334,8BitDo NEOGEO,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000000220000000900000ffff3f00,8BitDo NES30 Pro,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+050000002038000009000000ffff3f00,8BitDo NES30 Pro,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38313433643131656262306631373166,8BitDo P30,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+38326536643339353865323063616339,8BitDo P30,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+38426974446f2050333020636c617373,8BitDo P30,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+35376664343164386333616535333434,8BitDo Pro 2,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b17,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b18,righttrigger:a5,rightx:a3,start:b10,x:b19,y:b2,platform:Android,
+38426974446f2038426974446f205072,8BitDo Pro 2,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974446f2050726f203200000000,8BitDo Pro 2,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+61333362366131643730353063616330,8BitDo Pro 2,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+62373739366537363166326238653463,8BitDo Pro 2,a:b1,b:b0,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,x:b3,y:b2,platform:Android,
+38386464613034326435626130396565,8BitDo Receiver,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b19,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974446f2038426974446f205265,8BitDo Receiver,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b19,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+66303230343038613365623964393766,8BitDo Receiver,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b19,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974446f20533330204d6f646b69,8BitDo S30,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:a4,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b9,righttrigger:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+66316462353561376330346462316137,8BitDo S30,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:a4,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b9,righttrigger:b10,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+05000000c82d000000600000ffff3f00,8BitDo SF30 Pro,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b15,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b16,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+05000000c82d000000610000ffff3f00,8BitDo SF30 Pro,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974646f20534633302050726f00,8BitDo SF30 Pro,a:b1,b:b0,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b16,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b17,platform:Android,
+61623334636338643233383735326439,8BitDo SFC30,a:b0,b:b1,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b3,rightshoulder:b31,start:b5,x:b30,y:b2,platform:Android,
+05000000c82d000012900000ffff3f00,8BitDo SN30,a:b1,b:b0,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b3,y:b2,platform:Android,
+05000000c82d000062280000ffff3f00,8BitDo SN30,a:b1,b:b0,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b3,y:b2,platform:Android,
+38316230613931613964356666353839,8BitDo SN30,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974446f20534e3330204d6f646b,8BitDo SN30,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+65323563303231646531383162646335,8BitDo SN30,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+35383531346263653330306238353131,8BitDo SN30 PP,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+05000000c82d000001600000ffff3f00,8BitDo SN30 Pro,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+05000000c82d000002600000ffff0f00,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b17,leftshoulder:b9,leftstick:b7,lefttrigger:b15,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b16,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+36653638656632326235346264663661,8BitDo SN30 Pro Plus,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b19,y:b2,platform:Android,
+38303232393133383836366330346462,8BitDo SN30 Pro Plus,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b17,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b18,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b19,y:b2,platform:Android,
+38346630346135363335366265656666,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38426974446f20534e33302050726f2b,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b19,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+536f6e7920436f6d707574657220456e,8BitDo SN30 Pro Plus,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+66306331643531333230306437353936,8BitDo SN30 Pro Plus,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+050000002028000009000000ffff3f00,8BitDo SNES30,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+050000003512000020ab000000780f00,8BitDo SNES30,a:b21,b:b20,back:b30,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b26,rightshoulder:b27,start:b31,x:b24,y:b23,platform:Android,
+33666663316164653937326237613331,8BitDo Zero,a:b0,b:b1,back:b15,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b2,y:b3,platform:Android,
+38426974646f205a65726f2047616d65,8BitDo Zero,a:b0,b:b1,back:b15,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b2,y:b3,platform:Android,
+05000000c82d000018900000ffff0f00,8BitDo Zero 2,a:b1,b:b0,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b3,y:b2,platform:Android,
+05000000c82d000030320000ffff0f00,8BitDo Zero 2,a:b1,b:b0,back:b4,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b3,y:b2,platform:Android,
+33663434393362303033616630346337,8BitDo Zero 2,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftx:a0,lefty:a1,rightshoulder:b20,start:b18,x:b19,y:b2,platform:Android,
+34656330626361666438323266633963,8BitDo Zero 2,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b4,leftx:a0,lefty:a1,rightshoulder:b20,start:b10,x:b19,y:b2,platform:Android,
+63396666386564393334393236386630,8BitDo Zero 2,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,start:b6,x:b3,y:b2,platform:Android,
+63633435623263373466343461646430,8BitDo Zero 2,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftx:a0,lefty:a1,rightshoulder:b10,start:b6,x:b2,y:b3,platform:Android,
+32333634613735616163326165323731,Amazon Luna Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,x:b2,y:b3,platform:Android,
+4c696e757820342e31392e3137322077,Anbernic Handheld,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a4,start:b6,x:b2,y:b3,platform:Android,
+417374726f2063697479206d696e6920,Astro City Mini,a:b23,b:b22,back:b29,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,rightshoulder:b25,righttrigger:b26,start:b30,x:b24,y:b21,platform:Android,
+35643263313264386134376362363435,Atari VCS Classic Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,start:b6,platform:Android,
+32353831643566306563643065356239,Atari VCS Modern Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+4f64696e20436f6e74726f6c6c657200,AYN Odin,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b14,dpright:b13,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:+a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:+a4,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+32303165626138343962363666346165,Brook Mars PS4 Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+38383337343564366131323064613561,Brook Mars PS4 Controller,a:b1,b:b19,back:b17,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+34313430343161653665353737323365,Elecom JC-W01U,a:b23,b:b24,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b25,lefttrigger:b27,leftx:a0,lefty:a1,rightshoulder:b26,righttrigger:b28,rightx:a2,righty:a3,start:b30,x:b21,y:b22,platform:Android,
+4875694a6961204a432d573031550000,Elecom JC-W01U,a:b23,b:b24,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b25,lefttrigger:b27,leftx:a0,lefty:a1,rightshoulder:b26,righttrigger:b28,rightx:a2,righty:a3,start:b30,x:b21,y:b22,platform:Android,
+30363230653635633863366338623265,Evo VR,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftx:a0,lefty:a1,x:b2,y:b3,platform:Android,
+05000000b404000011240000dfff3f00,Flydigi Vader 2,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,paddle1:b17,paddle2:b18,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+05000000bc20000000550000ffff3f00,GameSir G3w,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+34323662653333636330306631326233,Google Nexus,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+35383633353935396534393230616564,Google Stadia Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+476f6f676c65204c4c43205374616469,Google Stadia Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+5374616469614e3848532d6532633400,Google Stadia Controller,a:b0,b:b1,back:b15,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+05000000d6020000e5890000dfff3f00,GPD XD Plus,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a5,start:b6,x:b2,y:b3,platform:Android,
+05000000d6020000e5890000dfff3f80,GPD XD Plus,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a3,rightx:a4,righty:a5,start:b6,x:b2,y:b3,platform:Android,
+66633030656131663837396562323935,Hori Battle,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Android,
+35623466343433653739346434636330,Hori Fighting Commander 3 Pro,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+484f524920434f2e2c4c54442e203130,Hori Fighting Commander 3 Pro,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b20,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b3,righttrigger:b9,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+484f524920434f2e2c4c544420205041,Hori Gem Pad 3,a:b1,b:b17,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b4,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b16,x:b0,y:b2,platform:Android,
+65656436646661313232656661616130,Hori PC Engine Mini Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,start:b18,platform:Android,
+31303433326562636431653534636633,Hori Real Arcade Pro 3,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+32656664353964393561366362333636,Hori Switch Split Pad Pro,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Android,
+30306539356238653637313730656134,HORIPAD Switch Pro Controller,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b19,y:b2,platform:Android,
+48797065726b696e2050616400000000,Hyperkin Admiral N64 Controller,+rightx:b6,+righty:b7,-rightx:b17,-righty:b5,a:b1,b:b0,leftshoulder:b3,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b20,start:b18,platform:Android,
+62333331353131353034386136626636,Hyperkin Admiral N64 Controller,+rightx:b6,+righty:b7,-rightx:b17,-righty:b5,a:b1,b:b0,leftshoulder:b3,lefttrigger:b8,leftx:a0,lefty:a1,rightshoulder:b20,start:b18,platform:Android,
+31306635363562663834633739396333,Hyperkin N64 Adapter,a:b1,b:b19,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightx:a2,righty:a3,start:b18,platform:Android,
+5368616e57616e202020202048797065,Hyperkin N64 Adapter,a:b1,b:b19,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightx:a2,righty:a3,start:b18,platform:Android,
+0500000083050000602000000ffe0000,iBuffalo SNES Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b15,rightshoulder:b16,start:b10,x:b2,y:b3,platform:Android,
+5553422c322d6178697320382d627574,iBuffalo Super Famicom Controller,a:b1,b:b0,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b17,rightshoulder:b18,start:b10,x:b3,y:b2,platform:Android,
+64306137363261396266353433303531,InterAct GoPad,a:b24,b:b25,leftshoulder:b23,lefttrigger:b27,leftx:a0,lefty:a1,rightshoulder:b26,righttrigger:b28,x:b21,y:b22,platform:Android,
+532e542e442e20496e74657261637420,InterAct HammerHead FX,a:b23,b:b24,back:b30,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b26,leftstick:b22,lefttrigger:b28,leftx:a0,lefty:a1,rightshoulder:b27,rightstick:b25,righttrigger:b29,rightx:a2,righty:a3,start:b31,x:b20,y:b21,platform:Android,
+65346535636333663931613264643164,Joy-Con,a:b21,b:b22,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b25,lefttrigger:b27,leftx:a0,lefty:a1,rightshoulder:b26,righttrigger:b28,rightx:a2,righty:a3,start:b30,x:b23,y:b24,platform:Android,
+33346566643039343630376565326335,Joy-Con (L),a:b0,b:b1,back:b7,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,rightshoulder:b20,start:b17,x:b19,y:b2,platform:Android,
+35313531613435623366313835326238,Joy-Con (L),a:b0,b:b1,back:b7,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,rightshoulder:b20,start:b17,x:b19,y:b2,platform:Android,
+4a6f792d436f6e20284c290000000000,Joy-Con (L),a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,rightshoulder:b20,start:b17,x:b19,y:b2,platform:Android,
+38383665633039363066383334653465,Joy-Con (R),a:b0,b:b1,back:b5,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,rightshoulder:b20,start:b18,x:b19,y:b2,platform:Android,
+39363561613936303237333537383931,Joy-Con (R),a:b0,b:b1,back:b5,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,rightshoulder:b20,start:b18,x:b19,y:b2,platform:Android,
+39373064396565646338333134303131,Joy-Con (R),a:b1,b:b2,back:b5,leftstick:b8,leftx:a1~,lefty:a0,start:b6,x:b0,y:b3,platform:Android,
+4a6f792d436f6e202852290000000000,Joy-Con (R),a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,rightshoulder:b20,start:b18,x:b19,y:b2,platform:Android,
+39656136363638323036303865326464,JYS Aapter,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+63316564383539663166353034616434,JYS Adapter,a:b1,b:b3,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b0,y:b2,platform:Android,
+64623163333561643339623235373232,Logitech F310,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+35623364393661626231343866613337,Logitech F710,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+4c6f6769746563682047616d65706164,Logitech F710,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+64396331333230326333313330336533,Logitech F710,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+39653365373864633935383236363438,Logitech G Cloud,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+416d617a6f6e2047616d6520436f6e74,Luna Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Android,
+4c756e612047616d6570616400000000,Luna Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+30363066623539323534363639323363,Magic NS,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+31353762393935386662336365626334,Magic NS,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+39623565346366623931666633323530,Magic NS,a:b1,b:b3,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b0,y:b2,platform:Android,
+6d6179666c617368206c696d69746564,Mayflash GameCube Adapter,a:b22,b:b21,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,lefttrigger:b25,leftx:a0,lefty:a1,rightshoulder:b28,righttrigger:b26,rightx:a5,righty:a2,start:b30,x:b23,y:b24,platform:Android,
+436f6e74726f6c6c6572000000000000,Mayflash N64 Adapter,a:b1,b:b19,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightx:a2,righty:a3,start:b18,platform:Android,
+65666330633838383061313633326461,Mayflash N64 Adapter,a:b1,b:b19,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightx:a2,righty:a3,start:b18,platform:Android,
+37316565396364386635383230353365,Mayflash Saturn Adapter,a:b21,b:b22,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b26,lefttrigger:b28,rightshoulder:b27,righttrigger:b23,start:b30,x:b24,y:b25,platform:Android,
+4875694a696120205553422047616d65,Mayflash Saturn Adapter,a:b21,b:b22,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b26,lefttrigger:b28,rightshoulder:b27,righttrigger:b23,start:b30,x:b24,y:b25,platform:Android,
+535a4d792d706f776572204c54442043,Mayflash Wii Classic Adapter,a:b23,b:b22,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b31,leftshoulder:b27,lefttrigger:b25,leftx:a0,lefty:a1,rightshoulder:b28,righttrigger:b26,rightx:a2,righty:a3,start:b30,x:b24,y:b21,platform:Android,
+30653962643666303631376438373532,Mayflash Wii DolphinBar,a:b23,b:b24,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b0,leftshoulder:b25,lefttrigger:b27,leftx:a0,lefty:a1,rightshoulder:b26,righttrigger:b28,rightx:a2,righty:a3,start:b30,x:b21,y:b22,platform:Android,
+39346131396233376535393665363161,Mayflash Wii U Pro Adapter,a:b22,b:b23,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b25,leftstick:b31,lefttrigger:b27,rightshoulder:b26,rightstick:b0,righttrigger:b28,rightx:a0,righty:a1,start:b30,x:b21,y:b24,platform:Android,
+31323564663862633234646330373138,Mega Drive,a:b23,b:b22,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,rightshoulder:b25,righttrigger:b26,start:b30,x:b24,y:b21,platform:Android,
+37333564393261653735306132613061,Mega Drive,a:b21,b:b22,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b26,lefttrigger:b28,rightshoulder:b27,righttrigger:b23,start:b30,x:b24,y:b25,platform:Android,
+64363363336633363736393038313464,Mega Drive,a:b1,b:b0,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,start:b9,x:b2,y:b3,platform:Android,
+33323763323132376537376266393366,Microsoft Dual Strike,a:b24,b:b23,back:b25,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b27,lefttrigger:b29,rightshoulder:b78,rightx:a0,righty:a1~,start:b26,x:b22,y:b21,platform:Android,
+30306461613834333439303734316539,Microsoft SideWinder Pro,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b20,lefttrigger:b9,rightshoulder:b19,righttrigger:b10,start:b17,x:b2,y:b3,platform:Android,
+32386235353630393033393135613831,Microsoft Xbox Series Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+4d4f42415041442050726f2d48440000,Mobapad Chitu HD,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+4d4f435554452d303533582d4d35312d,Mocute 053X,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+33343361376163623438613466616531,Mocute M053,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+39306635663061636563316166303966,Mocute M053,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+7573622067616d657061642020202020,NEXT SNES Controller,a:b2,b:b1,back:b8,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b4,rightshoulder:b5,righttrigger:b6,start:b9,x:b3,y:b0,platform:Android,
+050000007e05000009200000ffff0f00,Nintendo Switch Pro Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b4,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b16,x:b17,y:b2,platform:Android,
+31316661666466633938376335383661,Nintendo Switch Pro Controller,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,misc1:b5,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,start:b6,x:b3,y:b2,platform:Android,
+34323437396534643531326161633738,Nintendo Switch Pro Controller,a:b0,b:b1,back:b15,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,leftstick:b7,lefttrigger:b17,misc1:b5,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+50726f20436f6e74726f6c6c65720000,Nintendo Switch Pro Controller,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b2,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:b10,rightx:a2,righty:a3,start:b18,y:b3,platform:Android,
+36326533353166323965623661303933,NSO N64 Controller,+rightx:b17,+righty:b10,-rightx:b2,-righty:b19,a:b1,b:b0,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,misc1:b7,rightshoulder:b20,righttrigger:b15,start:b18,platform:Android,
+4e363420436f6e74726f6c6c65720000,NSO N64 Controller,+rightx:b17,+righty:b10,-rightx:b2,-righty:b19,a:b1,b:b0,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,misc1:b7,rightshoulder:b20,righttrigger:b15,start:b18,platform:Android,
+534e455320436f6e74726f6c6c657200,NSO SNES Controller,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,rightshoulder:b20,start:b18,x:b19,y:b2,platform:Android,
+64623863346133633561626136366634,NSO SNES Controller,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,rightshoulder:b20,start:b18,x:b19,y:b2,platform:Android,
+050000005509000003720000cf7f3f00,NVIDIA Controller,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005509000010720000ffff3f00,NVIDIA Controller,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005509000014720000df7f3f00,NVIDIA Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a5,start:b6,x:b2,y:b3,platform:Android,
+050000005509000014720000df7f3f80,NVIDIA Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a3,rightx:a4,righty:a5,start:b6,x:b2,y:b3,platform:Android,
+37336435666338653565313731303834,NVIDIA Controller,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+4e564944494120436f72706f72617469,NVIDIA Controller,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+61363931656135336130663561616264,NVIDIA Controller,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+39383335313438623439373538343266,OUYA Controller,a:b0,b:b2,dpdown:b18,dpleft:b15,dpright:b16,dpup:b17,leftshoulder:b3,leftstick:b9,lefttrigger:b5,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b10,righttrigger:b7,rightx:a3,righty:a4,x:b1,y:b19,platform:Android,
+4f5559412047616d6520436f6e74726f,OUYA Controller,a:b0,b:b2,dpdown:b18,dpleft:b15,dpright:b6,dpup:b17,leftshoulder:b3,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b10,righttrigger:a5,rightx:a3,righty:a4,x:b1,y:b19,platform:Android,
+506572666f726d616e63652044657369,PDP PS3 Rock Candy Controller,a:b1,b:b17,back:h0.2,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b4,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b16,x:b0,y:b2,platform:Android,
+61653962353232366130326530363061,Pokken,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:b9,rightshoulder:b20,righttrigger:b10,start:b18,x:b0,y:b2,platform:Android,
+32666633663735353234363064386132,PS2,a:b23,b:b22,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b27,lefttrigger:b25,leftx:a0,lefty:a1,rightshoulder:b28,righttrigger:b26,rightx:a3,righty:a2,start:b30,x:b24,y:b21,platform:Android,
+050000004c05000068020000dfff3f00,PS3 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+536f6e7920504c415953544154494f4e,PS3 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+61363034663839376638653463633865,PS3 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+66366539656564653432353139356536,PS3 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+66383132326164626636313737373037,PS3 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000004c050000c405000000783f00,PS4 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000004c050000c4050000fffe3f00,PS4 Controller,a:b1,b:b17,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b4,lefttrigger:+a3,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:+a4,rightx:a2,righty:a5,start:b16,x:b0,y:b2,platform:Android,
+050000004c050000c4050000fffe3f80,PS4 Controller,a:b1,b:b17,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b4,lefttrigger:+a2,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:+a3,rightx:a4,righty:a5,start:b16,x:b0,y:b2,platform:Android,
+050000004c050000c4050000ffff3f00,PS4 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000004c050000cc090000fffe3f00,PS4 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000004c050000cc090000ffff3f00,PS4 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+30303839663330346632363232623138,PS4 Controller,a:b1,b:b17,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:a4,rightx:a2,righty:a5,start:b16,x:b0,y:b2,platform:Android,
+31326235383662333266633463653332,PS4 Controller,a:b1,b:b16,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:a4,rightx:a2,righty:a5,start:b17,x:b0,y:b2,platform:Android,
+31373231336561636235613666323035,PS4 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+31663838336334393132303338353963,PS4 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+34613139376634626133336530386430,PS4 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+35643031303033326130316330353564,PS4 Controller,a:b1,b:b17,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b4,lefttrigger:+a3,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:+a4,rightx:a2,righty:a5,start:b16,x:b0,y:b2,platform:Android,
+37626233336235343937333961353732,PS4 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+37626464343430636562316661643863,PS4 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+38393161636261653636653532386639,PS4 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+63313733393535663339656564343962,PS4 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+63393662363836383439353064663939,PS4 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+65366465656364636137653363376531,PS4 Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+66613532303965383534396638613230,PS4 Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a5,start:b18,x:b0,y:b2,platform:Android,
+050000004c050000e60c0000fffe3f00,PS5 Controller,a:b1,b:b17,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b4,lefttrigger:a3,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:a4,rightx:a2,righty:a5,start:b16,x:b0,y:b2,platform:Android,
+050000004c050000e60c0000fffe3f80,PS5 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b4,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b6,righttrigger:a3,rightx:a4,righty:a5,start:b16,x:b2,y:b17,platform:Android,
+050000004c050000e60c0000ffff3f00,PS5 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+32346465346533616263386539323932,PS5 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+32633532643734376632656664383733,PS5 Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a5,start:b18,x:b0,y:b2,platform:Android,
+37363764353731323963323639666565,PS5 Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a5,start:b18,x:b0,y:b2,platform:Android,
+61303162353165316365336436343139,PS5 Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,misc1:b8,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a5,start:b18,x:b0,y:b2,platform:Android,
+64336263393933626535303339616332,Qanba 4RAF,a:b0,b:b1,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b20,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:b3,righttrigger:b9,rightx:a2,righty:a3,start:b18,x:b19,y:b2,platform:Android,
+36626666353861663864336130363137,Razer Junglecat,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+05000000f8270000bf0b0000ffff3f00,Razer Kishi,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+62653861643333663663383332396665,Razer Kishi,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000003215000005070000ffff3f00,Razer Raiju Mobile,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000003215000007070000ffff3f00,Razer Raiju Mobile,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000003215000000090000bf7f3f00,Razer Serval,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,x:b2,y:b3,platform:Android,
+5a6869587520526574726f2042697420,Retro Bit Saturn Controller,a:b21,b:b22,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b25,lefttrigger:b26,rightshoulder:b27,righttrigger:b28,start:b30,x:b23,y:b24,platform:Android,
+32417865732031314b6579732047616d,Retro Bit SNES Controller,a:b0,b:b1,back:b15,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b2,y:b3,platform:Android,
+36313938306539326233393732613361,Retro Bit SNES Controller,a:b0,b:b1,back:b15,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b6,x:b2,y:b3,platform:Android,
+526574726f466c616720576972656420,Retro Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b17,rightshoulder:b18,start:b10,x:b2,y:b3,platform:Android,
+61343739353764363165343237303336,Retro Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b17,lefttrigger:b18,leftx:a0,lefty:a1,start:b10,x:b2,y:b3,platform:Android,
+526574726f696420506f636b65742043,Retroid Pocket,a:b1,b:b0,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b17,paddle2:b18,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+582d426f7820436f6e74726f6c6c6572,Retroid Pocket,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,paddle1:b17,paddle2:b18,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+64633735616665613536653363336132,Retroid Pocket,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,paddle1:b19,paddle2:b20,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38653130373365613538333235303036,Retroid Pocket 2,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+64363363336633363736393038313463,Retrolink,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,start:b6,platform:Android,
+37393234373533633333323633646531,RetroUSB N64 RetroPort,+rightx:b17,+righty:b15,-rightx:b18,-righty:b6,a:b10,b:b9,dpdown:b19,dpleft:b1,dpright:b0,dpup:b2,leftshoulder:b7,lefttrigger:b20,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Android,
+5365616c6965436f6d707574696e6720,RetroUSB N64 RetroPort,+rightx:b17,+righty:b15,-rightx:b18,-righty:b6,a:b10,b:b9,dpdown:b19,dpleft:b1,dpright:b0,dpup:b2,leftshoulder:b7,lefttrigger:b20,leftx:a0,lefty:a1,rightshoulder:b5,start:b3,platform:Android,
+526574726f5553422e636f6d20534e45,RetroUSB SNES RetroPort,a:b1,b:b20,back:b19,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b2,x:b0,y:b3,platform:Android,
+64643037633038386238303966376137,RetroUSB SNES RetroPort,a:b1,b:b20,back:b19,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,rightshoulder:b10,start:b2,x:b0,y:b3,platform:Android,
+37656564346533643138636436356230,Rock Candy Switch Controller,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b3,leftstick:b15,lefttrigger:b9,leftx:a0,lefty:a1,misc1:b7,rightshoulder:b20,rightstick:b6,righttrigger:b10,rightx:a2,righty:a3,start:b18,x:b0,y:b2,platform:Android,
+33373336396634316434323337666361,RumblePad 2,a:b22,b:b23,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b25,lefttrigger:b27,leftx:a0,lefty:a1,rightshoulder:b26,righttrigger:b28,rightx:a2,righty:a3,start:b30,x:b21,y:b24,platform:Android,
+36363537303435333566386638366333,Samsung EIGP20,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+53616d73756e672047616d6520506164,Samsung EIGP20,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+66386565396238363534313863353065,Sanwa PlayOnline Mobile,a:b21,b:b22,back:b23,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,start:b24,platform:Android,
+32383165316333383766336338373261,Saturn,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:a4,righttrigger:a5,x:b2,y:b3,platform:Android,
+38613865396530353338373763623431,Saturn,a:b0,b:b1,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,lefttrigger:b10,rightshoulder:b20,righttrigger:b19,start:b17,x:b2,y:b3,platform:Android,
+61316232336262373631343137633631,Saturn,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,lefttrigger:b10,leftx:a0,lefty:a1,rightshoulder:a4,righttrigger:a5,x:b2,y:b3,platform:Android,
+30353835333338613130373363646337,SG H510,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b17,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b18,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b19,y:b2,platform:Android,
+66386262366536653765333235343634,SG H510,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,x:b2,y:b3,platform:Android,
+66633132393363353531373465633064,SG H510,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b17,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b20,rightstick:b18,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b19,y:b2,platform:Android,
+62653761636366393366613135366338,SN30 PP,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b3,y:b2,platform:Android,
+38376662666661636265313264613039,SNES,a:b0,b:b1,back:b9,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b3,rightshoulder:b20,start:b10,x:b19,y:b2,platform:Android,
+5346432f555342205061640000000000,SNES Adapter,a:b0,b:b1,back:b9,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b3,rightshoulder:b20,start:b10,x:b19,y:b2,platform:Android,
+5553422047616d657061642000000000,SNES Controller,a:b1,b:b0,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,rightshoulder:b10,start:b6,x:b3,y:b2,platform:Android,
+62653335326261303663356263626339,Sony PlayStation Classic Controller,a:b19,b:b1,back:b17,dpdown:+a1,dpleft:-a0,dpright:+a0,dpup:-a1,leftshoulder:b9,lefttrigger:b3,rightshoulder:b10,righttrigger:b20,start:b18,x:b2,y:b0,platform:Android,
+536f6e7920496e746572616374697665,Sony PlayStation Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,misc1:b8,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+576972656c65737320436f6e74726f6c,Sony PlayStation Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+63303964303462366136616266653561,Sony PSP,a:b21,b:b22,back:b27,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b25,leftx:a0,lefty:a1,rightshoulder:b26,start:b28,x:b23,y:b24,platform:Android,
+63376637643462343766333462383235,Sony Vita,a:b1,b:b19,back:b17,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftx:a0,lefty:a1,rightshoulder:b20,rightx:a3,righty:a4,start:b18,x:b0,y:b2,platform:Android,
+05000000de2800000511000001000000,Steam Controller,a:b0,b:b1,back:b6,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Android,
+05000000de2800000611000001000000,Steam Controller,a:b0,b:b1,back:b6,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:Android,
+0500000011010000201400000f7e0f00,SteelSeries Nimbus,a:b0,b:b1,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,lefttrigger:b9,leftx:a0,lefty:a1,rightshoulder:b20,righttrigger:b10,rightx:a2,righty:a3,x:b19,y:b2,platform:Android,
+35306436396437373135383665646464,SteelSeries Nimbus Plus,a:b0,b:b1,leftshoulder:b3,leftstick:b17,lefttrigger:b9,leftx:a0,rightshoulder:b20,rightstick:b18,righttrigger:b10,rightx:a2,x:b19,y:b2,platform:Android,
+33313930373536613937326534303931,Taito Egret II Mini Control Panel,a:b25,b:b23,back:b27,guide:b30,leftx:a0,lefty:a1,rightshoulder:b21,righttrigger:b22,start:b28,x:b29,y:b24,platform:Android,
+54475a20436f6e74726f6c6c65720000,TGZ Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+62363434353532386238336663643836,TGZ Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:b17,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:b18,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+37323236633763666465316365313236,THEC64 Joystick,a:b21,b:b22,back:b27,leftshoulder:b25,leftx:a0,lefty:a1,rightshoulder:b26,start:b27,x:b23,y:b24,platform:Android,
+38346162326232346533316164363336,THEGamepad,a:b23,b:b22,back:b27,leftshoulder:b25,leftx:a0,lefty:a1,rightshoulder:b26,start:b28,x:b24,y:b21,platform:Android,
+050000004f0400000ed00000fffe3f00,Thrustmaster eSwap Pro Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+5477696e20555342204a6f7973746963,Twin Joystick,a:b22,b:b21,back:b28,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b26,leftstick:b30,lefttrigger:b24,leftx:a0,lefty:a1,rightshoulder:b27,rightstick:b31,righttrigger:b25,rightx:a3,righty:a2,start:b29,x:b23,y:b20,platform:Android,
+30623739343039643830333266346439,Valve Steam Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,leftx:a0,lefty:a1,paddle1:b24,paddle2:b23,rightshoulder:b10,rightstick:b8,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+31643365666432386133346639383937,Valve Steam Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,leftx:a0,lefty:a1,paddle1:b24,paddle2:b23,rightshoulder:b10,rightstick:b8,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+30386438313564306161393537333663,Wii Classic Adapter,a:b23,b:b22,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b27,lefttrigger:b25,leftx:a0,lefty:a1,rightshoulder:b28,righttrigger:b26,rightx:a2,righty:a3,start:b30,x:b24,y:b21,platform:Android,
+33333034646336346339646538643633,Wii Classic Adapter,a:b23,b:b22,back:b29,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b27,lefttrigger:b25,leftx:a0,lefty:a1,rightshoulder:b28,righttrigger:b26,rightx:a2,righty:a3,start:b30,x:b24,y:b21,platform:Android,
+050000005e0400008e02000000783f00,Xbox 360 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+30396232393162346330326334636566,Xbox 360 Controller,a:b0,b:b1,back:b4,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+38313038323730383864666463383533,Xbox 360 Controller,a:b0,b:b1,back:b4,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+58626f782033363020576972656c6573,Xbox 360 Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+65353331386662343338643939643636,Xbox 360 Controller,a:b0,b:b1,back:b4,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+65613532386633373963616462363038,Xbox 360 Controller,a:b0,b:b1,back:b4,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+47656e6572696320582d426f78207061,Xbox Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+4d6963726f736f667420582d426f7820,Xbox Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a4,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+64633436313965656664373634323364,Xbox Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b19,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e04000091020000ff073f00,Xbox One Controller,a:b0,b:b1,back:b4,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Android,
+050000005e04000091020000ff073f80,Xbox One Controller,a:b0,b:b1,back:b4,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000e00200000ffe3f00,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b16,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b17,y:b2,platform:Android,
+050000005e040000e00200000ffe3f80,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b3,leftstick:b15,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b16,righttrigger:a5,rightx:a2,righty:a3,start:b10,x:b17,y:b2,platform:Android,
+050000005e040000e0020000ffff3f00,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b4,leftshoulder:b3,leftstick:b8,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b17,y:b2,platform:Android,
+050000005e040000e0020000ffff3f80,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b4,leftshoulder:b3,leftstick:b8,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b7,righttrigger:a5,rightx:a2,righty:a3,start:b10,x:b17,y:b2,platform:Android,
+050000005e040000fd020000ffff3f00,Xbox One Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+33356661323266333733373865656366,Xbox One Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+34356136633366613530316338376136,Xbox One Controller,a:b0,b:b1,back:b9,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b10,leftshoulder:b3,leftstick:b15,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b18,rightstick:b16,righttrigger:a5,rightx:a3,righty:a4,x:b17,y:b2,platform:Android,
+35623965373264386238353433656138,Xbox One Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+36616131643361333337396261666433,Xbox One Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+58626f7820576972656c65737320436f,Xbox One Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+65316262316265373335666131623538,Xbox One Controller,a:b0,b:b1,back:b15,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000000b000000783f00,Xbox One Elite 2 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000000b000000783f80,Xbox One Elite 2 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000050b0000ffff3f00,Xbox One Elite 2 Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a5,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a6,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000e002000000783f00,Xbox One S Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000ea02000000783f00,Xbox One S Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000fd020000ff7f3f00,Xbox One S Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000120b000000783f00,Xbox Series Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000120b000000783f80,Xbox Series Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000005e040000130b0000ffff3f00,Xbox Series Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+65633038363832353634653836396239,Xbox Series Controller,a:b0,b:b1,back:b15,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,guide:b5,leftshoulder:b9,leftstick:b7,lefttrigger:a4,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a5,rightx:a2,righty:a3,start:b6,x:b2,y:b3,platform:Android,
+050000001727000044310000ffff3f00,XiaoMi Controller,a:b0,b:b1,back:b4,dpdown:b12,dpleft:b13,dpright:b14,dpup:b11,leftshoulder:b9,leftstick:b7,lefttrigger:a7,leftx:a0,lefty:a1,rightshoulder:b10,rightstick:b8,righttrigger:a6,rightx:a2,righty:a5,start:b6,x:b2,y:b3,platform:Android,
+
+# iOS
+05000000ac0500000100000000006d01,*,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,leftshoulder:b4,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a5,rightx:a3,righty:a4,x:b2,y:b3,platform:iOS,
+05000000ac050000010000004f066d01,*,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,leftshoulder:b4,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a5,rightx:a3,righty:a4,x:b2,y:b3,platform:iOS,
+05000000ac05000001000000cf076d01,*,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b8,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,x:b2,y:b3,platform:iOS,
+05000000ac05000001000000df076d01,*,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:iOS,
+05000000ac05000001000000ff076d01,*,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
+05000000ac0500000200000000006d02,*,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,leftshoulder:b4,rightshoulder:b5,x:b2,y:b3,platform:iOS,
+05000000ac050000020000004f066d02,*,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b6,leftshoulder:b4,rightshoulder:b5,x:b2,y:b3,platform:iOS,
+05000000ac05000004000000a8986d04,8BitDo Micro,a:b1,b:b0,back:b4,dpdown:b7,dpleft:b8,dpright:b9,dpup:b10,guide:b2,leftshoulder:b11,lefttrigger:b12,rightshoulder:b13,righttrigger:b14,start:b3,x:b6,y:b5,platform:iOS,
+05000000ac05000004000000fd216d04,8BitDo Pro 2,a:b3,b:b2,back:b6,dpdown:b9,dpleft:b10,dpright:b11,dpup:b12,guide:b4,leftshoulder:b13,leftstick:b14,lefttrigger:+a2,leftx:a0,lefty:a1~,paddle1:b1,paddle2:b0,rightshoulder:b16,rightstick:b17,righttrigger:+a5,rightx:a3,righty:a4~,start:b5,x:b8,y:b7,platform:iOS,
+05000000ac05000004000000209f6d04,8Bitdo SN30 Pro,a:b1,b:b0,back:b4,dpdown:b7,dpleft:b8,dpright:b9,dpup:b10,guide:b2,leftshoulder:b11,leftstick:b12,lefttrigger:b13,leftx:a0,lefty:a1~,rightshoulder:b14,rightstick:b15,righttrigger:b16,rightx:a2,righty:a3~,start:b3,x:b6,y:b5,platform:iOS,
+05000000ac050000040000003b8a6d04,8BitDo SN30 Pro+,a:b1,b:b0,back:b4,dpdown:b7,dpleft:b8,dpright:b9,dpup:b10,guide:b2,leftshoulder:b11,leftstick:b12,lefttrigger:b13,leftx:a0,lefty:a1~,rightshoulder:b14,rightstick:b15,righttrigger:b16,rightx:a2,righty:a3~,start:b3,x:b6,y:b5,platform:iOS,
+050000008a35000003010000ff070000,Backbone One,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
+050000008a35000004010000ff070000,Backbone One,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
+4d466947616d65706164010000000000,MFi Extended Gamepad,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a5,rightx:a3,righty:a4,start:b6,x:b2,y:b3,platform:iOS,
+4d466947616d65706164020000000000,MFi Gamepad,a:b0,b:b1,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,rightshoulder:b5,start:b6,x:b2,y:b3,platform:iOS,
+050000007e050000062000000f060000,Nintendo Switch Joy-Con (L),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b2,leftshoulder:b4,rightshoulder:b5,x:b1,y:b3,platform:iOS,
+050000007e050000062000004f060000,Nintendo Switch Joy-Con (L),+leftx:h0.1,+lefty:h0.2,-leftx:h0.4,-lefty:h0.8,dpdown:b2,dpleft:b0,dpright:b3,dpup:b1,leftshoulder:b4,misc1:b6,rightshoulder:b5,platform:iOS,
+050000007e05000008200000df070000,Nintendo Switch Joy-Con (L/R),a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:iOS,
+050000007e0500000e200000df070000,Nintendo Switch Joy-Con (L/R),a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:iOS,
+050000007e050000072000000f060000,Nintendo Switch Joy-Con (R),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b2,leftshoulder:b4,rightshoulder:b5,x:b1,y:b3,platform:iOS,
+050000007e050000072000004f060000,Nintendo Switch Joy-Con (R),+leftx:h0.2,+lefty:h0.4,-leftx:h0.8,-lefty:h0.1,a:b0,b:b2,guide:b6,leftshoulder:b4,rightshoulder:b5,x:b1,y:b3,platform:iOS,
+050000007e05000009200000df870000,Nintendo Switch Pro Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b10,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b3,y:b2,platform:iOS,
+050000007e05000009200000ff870000,Nintendo Switch Pro Controller,a:b1,b:b0,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b3,y:b2,platform:iOS,
+05000000ac050000040000008e586d04,PlayStation VR2 Sense Controller (L),+leftx:+a3,+lefty:+a1,-leftx:+a2,-lefty:+a4,back:b2,leftstick:b4,lefttrigger:+a7,paddle2:b3,x:b0,y:b1,platform:iOS,
+05000000ac050000040000000eb86d04,PlayStation VR2 Sense Controller (R),+rightx:+a3,+righty:+a1,-rightx:+a2,-righty:+a4,a:b0,b:b1,paddle1:b3,rightstick:b4,righttrigger:+a7,start:b2,platform:iOS,
+050000004c050000cc090000df070000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:iOS,
+050000004c050000cc090000df870001,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:iOS,
+050000004c050000cc090000ff070000,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
+050000004c050000cc090000ff870001,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,touchpad:b11,x:b2,y:b3,platform:iOS,
+050000004c050000cc090000ff876d01,PS4 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
+050000004c050000e60c0000df870000,PS5 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,touchpad:b10,x:b2,y:b3,platform:iOS,
+050000004c050000e60c0000ff870000,PS5 Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,touchpad:b11,x:b2,y:b3,platform:iOS,
+05000000ac0500000300000000006d03,Remote,a:b0,b:b2,leftx:a0,lefty:a1,platform:iOS,
+05000000ac0500000300000043006d03,Remote,a:b0,b:b2,leftx:a0,lefty:a1,platform:iOS,
+05000000de2800000511000001000000,Steam Controller,a:b0,b:b1,back:b6,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:iOS,
+05000000de2800000611000001000000,Steam Controller,a:b0,b:b1,back:b6,guide:b8,leftshoulder:b4,leftstick:b9,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,righttrigger:a3,start:b7,x:b2,y:b3,platform:iOS,
+050000005e040000050b0000df070001,Xbox Elite Wireless Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b10,paddle2:b12,paddle3:b11,paddle4:b13,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:iOS,
+050000005e040000050b0000ff070001,Xbox Elite Wireless Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,paddle1:b11,paddle2:b13,paddle3:b12,paddle4:b14,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
+050000005e040000130b0000df870001,Xbox Series X Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b10,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:iOS,
+050000005e040000130b0000ff870001,Xbox Series X Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,misc1:b11,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
+050000005e040000e0020000df070000,Xbox Wireless Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b9,x:b2,y:b3,platform:iOS,
+050000005e040000e0020000ff070000,Xbox Wireless Controller,a:b0,b:b1,back:b8,dpdown:h0.4,dpleft:h0.8,dpright:h0.2,dpup:h0.1,guide:b9,leftshoulder:b4,leftstick:b6,lefttrigger:a2,leftx:a0,lefty:a1,rightshoulder:b5,rightstick:b7,righttrigger:a5,rightx:a3,righty:a4,start:b10,x:b2,y:b3,platform:iOS,
diff --git a/py/assets/levels/collecting.ldtk b/py/assets/levels/collecting.ldtk
new file mode 100644
index 0000000..926052a
--- /dev/null
+++ b/py/assets/levels/collecting.ldtk
@@ -0,0 +1,5571 @@
+{
+	"__header__": {
+		"fileType": "LDtk Project JSON",
+		"app": "LDtk",
+		"doc": "https://ldtk.io/json",
+		"schema": "https://ldtk.io/files/JSON_SCHEMA.json",
+		"appAuthor": "Sebastien 'deepnight' Benard",
+		"appVersion": "1.5.3",
+		"url": "https://ldtk.io"
+	},
+	"iid": "d73f3980-d380-11f0-87cf-5fab6ff1ccf3",
+	"jsonVersion": "1.5.3",
+	"appBuildId": 473703,
+	"nextUid": 193,
+	"identifierStyle": "Capitalize",
+	"toc": [],
+	"worldLayout": "Free",
+	"worldGridWidth": 256,
+	"worldGridHeight": 256,
+	"defaultLevelWidth": 256,
+	"defaultLevelHeight": 256,
+	"defaultPivotX": 0,
+	"defaultPivotY": 0,
+	"defaultGridSize": 18,
+	"defaultEntityWidth": 18,
+	"defaultEntityHeight": 18,
+	"bgColor": "#40465B",
+	"defaultLevelBgColor": "#696A79",
+	"minifyJson": false,
+	"externalLevels": false,
+	"exportTiled": false,
+	"simplifiedExport": false,
+	"imageExportMode": "None",
+	"exportLevelBg": true,
+	"pngFilePattern": null,
+	"backupOnSave": false,
+	"backupLimit": 10,
+	"backupRelPath": null,
+	"levelNamePattern": "Level_%idx",
+	"tutorialDesc": null,
+	"customCommands": [],
+	"flags": [],
+	"defs": { "layers": [
+		{
+			"__type": "Entities",
+			"identifier": "Entities",
+			"type": "Entities",
+			"uid": 191,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 4,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 0.6,
+			"hideInList": false,
+			"hideFieldsWhenInactive": true,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": null,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		},
+		{
+			"__type": "IntGrid",
+			"identifier": "IntGrid",
+			"type": "IntGrid",
+			"uid": 3,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 18,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 1,
+			"hideInList": false,
+			"hideFieldsWhenInactive": false,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [
+				{ "value": 1, "identifier": "walls", "color": "#C28569", "tile": null, "groupUid": 0 },
+				{ "value": 2, "identifier": "clouds", "color": "#F7F5F5", "tile": null, "groupUid": 0 },
+				{ "value": 3, "identifier": "trees", "color": "#63C74D", "tile": null, "groupUid": 0 },
+				{ "value": 4, "identifier": "trunks", "color": "#BE4A2F", "tile": null, "groupUid": 0 }
+			],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [
+				{
+					"uid": 116,
+					"name": "trunks",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 167,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[58]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,3,3,4,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 172,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[57]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,-3,3,4,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 168,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[38]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,3,3,4,0,3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 169,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[38]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,4,3,3,0,3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 170,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[58]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,4,3,3,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 171,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[59]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,4,3,-3,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 173,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[38]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,3,3,3,0,4,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 174,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[18]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,3,3,3,0,4,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3116739,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 117,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[97]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,3,0,3,4,3,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4416921,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 166,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [ [96], [116] ],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,4,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3675461,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 175,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[137]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,4,0,0,4,0,0,1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3675461,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": false,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 99,
+					"name": "trees",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 150,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[16]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,-3,3,-3,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 8361328,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 151,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[77]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,-3,3,0,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2633089,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 152,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[79]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,0,3,-3,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5051035,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 153,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[78]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,0,3,0,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1854154,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 154,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[36]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,-3,3,-3,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 579623,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 155,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[76]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-3,3,-3,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 7616645,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 156,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[56]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-3,3,-3,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9052676,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 157,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[17]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,-3,3,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1665955,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 158,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[19]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,0,3,-3,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6836908,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 159,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[59]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,3,-3,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9407960,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 160,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[57]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-3,3,0,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2177855,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 161,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[18]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-3,0,0,3,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1611404,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 162,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[39]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,3,-3,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 7076077,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 163,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[58]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,3,0,0,-3,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4450915,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 164,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[37]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-3,3,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5393818,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 165,
+							"active": true,
+							"size": 1,
+							"tileRectsIds": [[38]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [3],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 3,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1014530,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": false,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 39,
+					"name": "clouds",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 40,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[156]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-2,0,-2,2,-2,0,-2,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 2,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1447730,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 41,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[153]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-2,0,-2,2,0,0,-2,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 2,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3308547,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 42,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[155]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-2,0,0,2,-2,0,-2,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 2,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2061711,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 43,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[154]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-2,0,0,2,0,0,-2,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 2,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6319210,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": true,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 4,
+					"name": "walls",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 47,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[0]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2573424,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 48,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[4]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,1,0,1,-1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5728887,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 49,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[5]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,1,1,-1,-1,1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3731684,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 50,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[25]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,0,1,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5393657,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 51,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[24]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,1,-1,-1,1,1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2759139,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 52,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[1]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3628070,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 53,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[3]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 329268,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 54,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[2]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3230151,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 55,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[21]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5032169,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 56,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[23]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,-1,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3560916,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 57,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[143]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2981275,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 58,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[141]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-1,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2125068,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 59,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[22]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4206024,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 60,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[123]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,1,-1,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6801093,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 61,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[142]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 256579,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 62,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[121]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-1,1,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6625497,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 63,
+							"active": true,
+							"size": 1,
+							"tileRectsIds": [[122]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 58927,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": true,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 21,
+					"name": "plants",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 22,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [ [124], [125], [128], [144] ],
+							"alpha": 1,
+							"chance": 0.2,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,0,0,0,1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 467680,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": false,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				}
+			],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": 1,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		},
+		{
+			"__type": "Tiles",
+			"identifier": "Background",
+			"type": "Tiles",
+			"uid": 180,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 24,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 1,
+			"hideInList": false,
+			"hideFieldsWhenInactive": false,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": 2,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		}
+	], "entities": [
+		{
+			"identifier": "Start",
+			"uid": 181,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 24,
+			"height": 24,
+			"resizableX": false,
+			"resizableY": false,
+			"minWidth": null,
+			"maxWidth": null,
+			"minHeight": null,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 0.08,
+			"lineOpacity": 0,
+			"hollow": false,
+			"color": "#4CBE2F",
+			"renderMode": "Tile",
+			"showName": true,
+			"tilesetId": 183,
+			"tileRenderMode": "FitInside",
+			"tileRect": { "tilesetUid": 183, "x": 24, "y": 0, "w": 24, "h": 24 },
+			"uiTileRect": { "tilesetUid": 183, "x": 24, "y": 0, "w": 24, "h": 24 },
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0.5,
+			"pivotY": 0.5,
+			"fieldDefs": []
+		},
+		{
+			"identifier": "Bat",
+			"uid": 182,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 24,
+			"height": 24,
+			"resizableX": false,
+			"resizableY": false,
+			"minWidth": null,
+			"maxWidth": null,
+			"minHeight": null,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 0.08,
+			"lineOpacity": 0,
+			"hollow": false,
+			"color": "#F03307",
+			"renderMode": "Tile",
+			"showName": true,
+			"tilesetId": 183,
+			"tileRenderMode": "FitInside",
+			"tileRect": { "tilesetUid": 183, "x": 144, "y": 48, "w": 24, "h": 24 },
+			"uiTileRect": { "tilesetUid": 183, "x": 144, "y": 48, "w": 24, "h": 24 },
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0.5,
+			"pivotY": 0.5,
+			"fieldDefs": [
+				{
+					"identifier": "end",
+					"doc": null,
+					"__type": "Point",
+					"uid": 185,
+					"type": "F_Point",
+					"isArray": false,
+					"canBeNull": false,
+					"arrayMinLength": null,
+					"arrayMaxLength": null,
+					"editorDisplayMode": "PointPath",
+					"editorDisplayScale": 1,
+					"editorDisplayPos": "Above",
+					"editorLinkStyle": "StraightArrow",
+					"editorDisplayColor": null,
+					"editorAlwaysShow": false,
+					"editorShowInWorld": true,
+					"editorCutLongValues": true,
+					"editorTextSuffix": null,
+					"editorTextPrefix": null,
+					"useForSmartColor": false,
+					"exportToToc": false,
+					"searchable": false,
+					"min": null,
+					"max": null,
+					"regex": null,
+					"acceptFileTypes": null,
+					"defaultOverride": null,
+					"textLanguageMode": null,
+					"symmetricalRef": false,
+					"autoChainRef": true,
+					"allowOutOfLevelRef": true,
+					"allowedRefs": "OnlySame",
+					"allowedRefsEntityUid": null,
+					"allowedRefTags": [],
+					"tilesetUid": null
+				}
+			]
+		},
+		{
+			"identifier": "DrillHead",
+			"uid": 186,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 24,
+			"height": 24,
+			"resizableX": false,
+			"resizableY": false,
+			"minWidth": null,
+			"maxWidth": null,
+			"minHeight": null,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 0.08,
+			"lineOpacity": 0,
+			"hollow": false,
+			"color": "#F52F01",
+			"renderMode": "Tile",
+			"showName": true,
+			"tilesetId": 183,
+			"tileRenderMode": "FitInside",
+			"tileRect": { "tilesetUid": 183, "x": 144, "y": 24, "w": 24, "h": 24 },
+			"uiTileRect": { "tilesetUid": 183, "x": 144, "y": 24, "w": 24, "h": 24 },
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0.5,
+			"pivotY": 0.5,
+			"fieldDefs": [
+				{
+					"identifier": "end",
+					"doc": null,
+					"__type": "Point",
+					"uid": 188,
+					"type": "F_Point",
+					"isArray": false,
+					"canBeNull": false,
+					"arrayMinLength": null,
+					"arrayMaxLength": null,
+					"editorDisplayMode": "PointPath",
+					"editorDisplayScale": 1,
+					"editorDisplayPos": "Above",
+					"editorLinkStyle": "StraightArrow",
+					"editorDisplayColor": null,
+					"editorAlwaysShow": false,
+					"editorShowInWorld": true,
+					"editorCutLongValues": true,
+					"editorTextSuffix": null,
+					"editorTextPrefix": null,
+					"useForSmartColor": false,
+					"exportToToc": false,
+					"searchable": false,
+					"min": null,
+					"max": null,
+					"regex": null,
+					"acceptFileTypes": null,
+					"defaultOverride": null,
+					"textLanguageMode": null,
+					"symmetricalRef": false,
+					"autoChainRef": true,
+					"allowOutOfLevelRef": true,
+					"allowedRefs": "OnlySame",
+					"allowedRefsEntityUid": null,
+					"allowedRefTags": [],
+					"tilesetUid": null
+				}
+			]
+		},
+		{
+			"identifier": "BlockHead",
+			"uid": 189,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 24,
+			"height": 24,
+			"resizableX": false,
+			"resizableY": false,
+			"minWidth": null,
+			"maxWidth": null,
+			"minHeight": null,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 0.08,
+			"lineOpacity": 0,
+			"hollow": false,
+			"color": "#EB350B",
+			"renderMode": "Tile",
+			"showName": true,
+			"tilesetId": 183,
+			"tileRenderMode": "FitInside",
+			"tileRect": { "tilesetUid": 183, "x": 0, "y": 48, "w": 24, "h": 24 },
+			"uiTileRect": { "tilesetUid": 183, "x": 0, "y": 48, "w": 24, "h": 24 },
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0.5,
+			"pivotY": 0.5,
+			"fieldDefs": [
+				{
+					"identifier": "end",
+					"doc": null,
+					"__type": "Point",
+					"uid": 190,
+					"type": "F_Point",
+					"isArray": false,
+					"canBeNull": false,
+					"arrayMinLength": null,
+					"arrayMaxLength": null,
+					"editorDisplayMode": "PointPath",
+					"editorDisplayScale": 1,
+					"editorDisplayPos": "Above",
+					"editorLinkStyle": "StraightArrow",
+					"editorDisplayColor": null,
+					"editorAlwaysShow": false,
+					"editorShowInWorld": true,
+					"editorCutLongValues": true,
+					"editorTextSuffix": null,
+					"editorTextPrefix": null,
+					"useForSmartColor": false,
+					"exportToToc": false,
+					"searchable": false,
+					"min": null,
+					"max": null,
+					"regex": null,
+					"acceptFileTypes": null,
+					"defaultOverride": null,
+					"textLanguageMode": null,
+					"symmetricalRef": false,
+					"autoChainRef": true,
+					"allowOutOfLevelRef": true,
+					"allowedRefs": "OnlySame",
+					"allowedRefsEntityUid": null,
+					"allowedRefTags": [],
+					"tilesetUid": null
+				}
+			]
+		},
+		{
+			"identifier": "Coin",
+			"uid": 192,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 18,
+			"height": 18,
+			"resizableX": false,
+			"resizableY": false,
+			"minWidth": null,
+			"maxWidth": null,
+			"minHeight": null,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 0.08,
+			"lineOpacity": 0,
+			"hollow": false,
+			"color": "#E5EB08",
+			"renderMode": "Tile",
+			"showName": true,
+			"tilesetId": 1,
+			"tileRenderMode": "FitInside",
+			"tileRect": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+			"uiTileRect": null,
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0.5,
+			"pivotY": 0.5,
+			"fieldDefs": []
+		}
+	], "tilesets": [
+		{
+			"__cWid": 20,
+			"__cHei": 9,
+			"identifier": "Tilemap",
+			"uid": 1,
+			"relPath": "../pixel_platformer/tilemap.png",
+			"embedAtlas": null,
+			"pxWid": 360,
+			"pxHei": 162,
+			"tileGridSize": 18,
+			"spacing": 0,
+			"padding": 0,
+			"tags": [],
+			"tagsSourceEnumUid": null,
+			"enumTags": [],
+			"customData": [],
+			"savedSelections": [],
+			"cachedPixelData": {
+				"opaqueTiles": "001011000000000000000010110000000000001000100000010000110000001000000001011100000010000000000000000000101000000000000000111100000010000000000010000000100000000000000000000000000000",
+				"averageColors": "f786f886f886f886fc85fc85fa756a653965fc94fc95fc96fd75fc65fc65fc65c396e3a7e3a7e3a7f886f886f996f886fc85fc85fa659a73fb84fa75fa75fa759c96f3bef6bdf6bdd397e3a7f3a8e3a7fa76fb86fb86fb866b4359444446fa65fb75fb75fb75c9659c96f3bef4bdf4bde397e3a7e3a7e3a7fb86fb86fc86fb867977797779776379688978665889f965ac96f3cef6bdf6bdd397d397e3a7d397fa99fba9fbaafba9ca65ca65ca65b955b9555854786658547866c3acc3ace39bb786f59765868675fb99fba9fcaafba9fc85c96589657977997878664b75ca55ca55c3acc3ace39c9a65ba6538545954fb75fb76fc85fb7563869386748693866b657a75fa765778e39be39ce39be39baa65aa65aa653854fa76fb75fb75fb754899a9998a658976589a489afa656b854a74abcccccdabcc7aaa167769996889599a5999599a599a5999599a599a5899599a599a799a5999799a799a7999899a699a699979aa699a"
+			}
+		},
+		{
+			"__cWid": 8,
+			"__cHei": 3,
+			"identifier": "Backgrounds",
+			"uid": 2,
+			"relPath": "../pixel_platformer/backgrounds.png",
+			"embedAtlas": null,
+			"pxWid": 192,
+			"pxHei": 72,
+			"tileGridSize": 24,
+			"spacing": 0,
+			"padding": 0,
+			"tags": [],
+			"tagsSourceEnumUid": null,
+			"enumTags": [],
+			"customData": [],
+			"savedSelections": [],
+			"cachedPixelData": {
+				"opaqueTiles": "111111111111111111111111",
+				"averageColors": "fdeefdeefdeefdeeffc7ffc7f7eaf7eafefffeeefffffefffea6fea6f4d7f4d8fbdefbdefbdefbdefc85fc85f3a8f3a8"
+			}
+		},
+		{
+			"__cWid": 9,
+			"__cHei": 3,
+			"identifier": "Characters",
+			"uid": 183,
+			"relPath": "../pixel_platformer/characters.png",
+			"embedAtlas": null,
+			"pxWid": 216,
+			"pxHei": 72,
+			"tileGridSize": 24,
+			"spacing": 0,
+			"padding": 0,
+			"tags": [],
+			"tagsSourceEnumUid": null,
+			"enumTags": [],
+			"customData": [],
+			"savedSelections": [],
+			"cachedPixelData": {
+				"opaqueTiles": "000000000000000000000000000",
+				"averageColors": "a9cba9cbaacdaabdacbcacbcacbbacbb9889accbaccb8c948c954a744a74597769775977568a568a568ac68ad68ac69a587758775877"
+			}
+		}
+	], "enums": [], "externalEnums": [], "levelFields": [] },
+	"levels": [
+		{
+			"identifier": "Level",
+			"iid": "d7407200-d380-11f0-87cf-077db831fe53",
+			"uid": 0,
+			"worldX": 0,
+			"worldY": 0,
+			"worldDepth": 0,
+			"pxWid": 1024,
+			"pxHei": 1024,
+			"__bgColor": "#696A79",
+			"bgColor": null,
+			"useAutoIdentifier": false,
+			"bgRelPath": null,
+			"bgPos": null,
+			"bgPivotX": 0.5,
+			"bgPivotY": 0.5,
+			"__smartColor": "#ADADB5",
+			"__bgPos": null,
+			"externalRelPath": null,
+			"fieldInstances": [],
+			"layerInstances": [
+				{
+					"__identifier": "Entities",
+					"__type": "Entities",
+					"__cWid": 256,
+					"__cHei": 256,
+					"__gridSize": 4,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": null,
+					"__tilesetRelPath": null,
+					"iid": "a2f8aa20-d380-11f0-8c50-9763fc783dba",
+					"levelId": 0,
+					"layerDefUid": 191,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [],
+					"autoLayerTiles": [],
+					"seed": 2769432,
+					"overrideTilesetUid": null,
+					"gridTiles": [],
+					"entityInstances": [
+						{
+							"__identifier": "Start",
+							"__grid": [14,15],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 24, "y": 0, "w": 24, "h": 24 },
+							"__smartColor": "#4CBE2F",
+							"iid": "00a25df0-d380-11f0-8c50-739061d740f3",
+							"width": 24,
+							"height": 24,
+							"defUid": 181,
+							"px": [58,62],
+							"fieldInstances": [],
+							"__worldX": 58,
+							"__worldY": 62
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [221,46],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 24, "y": 0, "w": 24, "h": 24 },
+							"__smartColor": "#4CBE2F",
+							"iid": "045d4310-d380-11f0-8c50-710bd1478e02",
+							"width": 24,
+							"height": 24,
+							"defUid": 181,
+							"px": [886,186],
+							"fieldInstances": [],
+							"__worldX": 886,
+							"__worldY": 186
+						},
+						{
+							"__identifier": "Bat",
+							"__grid": [98,160],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 144, "y": 48, "w": 24, "h": 24 },
+							"__smartColor": "#F03307",
+							"iid": "0ae13340-d380-11f0-8c50-65300abf4c46",
+							"width": 24,
+							"height": 24,
+							"defUid": 182,
+							"px": [394,642],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 157, "cy": 160 }, "__tile": null, "defUid": 185, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["157,160"]
+							}] }],
+							"__worldX": 394,
+							"__worldY": 642
+						},
+						{
+							"__identifier": "Bat",
+							"__grid": [224,82],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 144, "y": 48, "w": 24, "h": 24 },
+							"__smartColor": "#F03307",
+							"iid": "177d0b60-d380-11f0-8c50-ffbb9eac13b3",
+							"width": 24,
+							"height": 24,
+							"defUid": 182,
+							"px": [898,330],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 241, "cy": 82 }, "__tile": null, "defUid": 185, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["241,82"]
+							}] }],
+							"__worldX": 898,
+							"__worldY": 330
+						},
+						{
+							"__identifier": "Bat",
+							"__grid": [98,34],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 144, "y": 48, "w": 24, "h": 24 },
+							"__smartColor": "#F03307",
+							"iid": "19da8360-d380-11f0-8c50-bf21d35bf7f8",
+							"width": 24,
+							"height": 24,
+							"defUid": 182,
+							"px": [394,138],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 166, "cy": 34 }, "__tile": null, "defUid": 185, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["166,34"]
+							}] }],
+							"__worldX": 394,
+							"__worldY": 138
+						},
+						{
+							"__identifier": "DrillHead",
+							"__grid": [51,123],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 144, "y": 24, "w": 24, "h": 24 },
+							"__smartColor": "#F52F01",
+							"iid": "201a65b0-d380-11f0-8c50-5d44b9b521d7",
+							"width": 24,
+							"height": 24,
+							"defUid": 186,
+							"px": [206,494],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 10, "cy": 123 }, "__tile": null, "defUid": 188, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["10,123"]
+							}] }],
+							"__worldX": 206,
+							"__worldY": 494
+						},
+						{
+							"__identifier": "DrillHead",
+							"__grid": [160,132],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 144, "y": 24, "w": 24, "h": 24 },
+							"__smartColor": "#F52F01",
+							"iid": "2a8e06a0-d380-11f0-8c50-75c2c285118f",
+							"width": 24,
+							"height": 24,
+							"defUid": 186,
+							"px": [642,530],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 204, "cy": 132 }, "__tile": null, "defUid": 188, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["204,132"]
+							}] }],
+							"__worldX": 642,
+							"__worldY": 530
+						},
+						{
+							"__identifier": "BlockHead",
+							"__grid": [32,235],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 0, "y": 48, "w": 24, "h": 24 },
+							"__smartColor": "#EB350B",
+							"iid": "3119bf00-d380-11f0-8c50-576bc1ad5a31",
+							"width": 24,
+							"height": 24,
+							"defUid": 189,
+							"px": [130,942],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 90, "cy": 235 }, "__tile": null, "defUid": 190, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["90,235"]
+							}] }],
+							"__worldX": 130,
+							"__worldY": 942
+						},
+						{
+							"__identifier": "BlockHead",
+							"__grid": [145,235],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 0, "y": 48, "w": 24, "h": 24 },
+							"__smartColor": "#EB350B",
+							"iid": "3868a050-d380-11f0-8c50-85188ffcff08",
+							"width": 24,
+							"height": 24,
+							"defUid": 189,
+							"px": [582,942],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 191, "cy": 235 }, "__tile": null, "defUid": 190, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["191,235"]
+							}] }],
+							"__worldX": 582,
+							"__worldY": 942
+						},
+						{
+							"__identifier": "BlockHead",
+							"__grid": [182,82],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 0, "y": 48, "w": 24, "h": 24 },
+							"__smartColor": "#EB350B",
+							"iid": "41315060-d380-11f0-8c50-1b8e3004102a",
+							"width": 24,
+							"height": 24,
+							"defUid": 189,
+							"px": [730,330],
+							"fieldInstances": [{ "__identifier": "end", "__type": "Point", "__value": { "cx": 200, "cy": 82 }, "__tile": null, "defUid": 190, "realEditorValues": [{
+								"id": "V_String",
+								"params": ["200,82"]
+							}] }],
+							"__worldX": 730,
+							"__worldY": 330
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [89,74],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "4972f620-d380-11f0-8c50-5d5d153784fc",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [358,298],
+							"fieldInstances": [],
+							"__worldX": 358,
+							"__worldY": 298
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [127,168],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "4bc76d70-d380-11f0-8c50-e5748b4866b3",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [510,674],
+							"fieldInstances": [],
+							"__worldX": 510,
+							"__worldY": 674
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [111,167],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "4ccfdcc0-d380-11f0-8c50-c39270d8de5b",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [446,670],
+							"fieldInstances": [],
+							"__worldX": 446,
+							"__worldY": 670
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [145,166],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "4d9eec90-d380-11f0-8c50-57a6decc2b9e",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [582,666],
+							"fieldInstances": [],
+							"__worldX": 582,
+							"__worldY": 666
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [200,183],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "4f3d0c30-d380-11f0-8c50-fbf31ff006f5",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [802,734],
+							"fieldInstances": [],
+							"__worldX": 802,
+							"__worldY": 734
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [247,235],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5093c290-d380-11f0-8c50-6bd5819aa46f",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [990,942],
+							"fieldInstances": [],
+							"__worldX": 990,
+							"__worldY": 942
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [225,234],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "516ac1a0-d380-11f0-8c50-6f45c2705899",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [902,938],
+							"fieldInstances": [],
+							"__worldX": 902,
+							"__worldY": 938
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [54,204],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5312f360-d380-11f0-8c50-c96e13577028",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [218,818],
+							"fieldInstances": [],
+							"__worldX": 218,
+							"__worldY": 818
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [20,123],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "54a88780-d380-11f0-8c50-ab7ce626f220",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [82,494],
+							"fieldInstances": [],
+							"__worldX": 82,
+							"__worldY": 494
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [43,123],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "559a6190-d380-11f0-8c50-cb4213af8bca",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [174,494],
+							"fieldInstances": [],
+							"__worldX": 174,
+							"__worldY": 494
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [103,87],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5757f010-d380-11f0-8c50-874c95593ff2",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [414,350],
+							"fieldInstances": [],
+							"__worldX": 414,
+							"__worldY": 350
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [58,56],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "596bb4e0-d380-11f0-8c50-5f2f941b5561",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [234,226],
+							"fieldInstances": [],
+							"__worldX": 234,
+							"__worldY": 226
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [91,56],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5a79a270-d380-11f0-8c50-479af5647ebf",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [366,226],
+							"fieldInstances": [],
+							"__worldX": 366,
+							"__worldY": 226
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [142,60],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5b745620-d380-11f0-8c50-4ff429a23456",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [570,242],
+							"fieldInstances": [],
+							"__worldX": 570,
+							"__worldY": 242
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [159,60],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5c31d9c0-d380-11f0-8c50-192cafdb0960",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [638,242],
+							"fieldInstances": [],
+							"__worldX": 638,
+							"__worldY": 242
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [231,15],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5db67df0-d380-11f0-8c50-bd6a51eabfa2",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [926,62],
+							"fieldInstances": [],
+							"__worldX": 926,
+							"__worldY": 62
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [239,46],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5f078f00-d380-11f0-8c50-9bfe2de7aee6",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [958,186],
+							"fieldInstances": [],
+							"__worldX": 958,
+							"__worldY": 186
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [188,32],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "5fedf760-d380-11f0-8c50-59f5dad6cb06",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [754,130],
+							"fieldInstances": [],
+							"__worldX": 754,
+							"__worldY": 130
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [223,110],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "60b65070-d380-11f0-8c50-3b7861f4afae",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [894,442],
+							"fieldInstances": [],
+							"__worldX": 894,
+							"__worldY": 442
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [191,82],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "620a47b0-d380-11f0-8c50-d35c233a202e",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [766,330],
+							"fieldInstances": [],
+							"__worldX": 766,
+							"__worldY": 330
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [232,165],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "63760cb0-d380-11f0-8c50-412f99fa06fb",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [930,662],
+							"fieldInstances": [],
+							"__worldX": 930,
+							"__worldY": 662
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [10,236],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "661e7060-d380-11f0-8c50-2b6841643e82",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [42,946],
+							"fieldInstances": [],
+							"__worldX": 42,
+							"__worldY": 946
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [61,235],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "672a3b10-d380-11f0-8c50-5b5a32b08555",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [246,942],
+							"fieldInstances": [],
+							"__worldX": 246,
+							"__worldY": 942
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [112,235],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "69c7f060-d380-11f0-8c50-7f9a3ec5a2a9",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [450,942],
+							"fieldInstances": [],
+							"__worldX": 450,
+							"__worldY": 942
+						},
+						{
+							"__identifier": "Coin",
+							"__grid": [208,204],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 1, "x": 198, "y": 126, "w": 18, "h": 18 },
+							"__smartColor": "#E5EB08",
+							"iid": "6cf49f40-d380-11f0-8c50-dd815cc55c9d",
+							"width": 18,
+							"height": 18,
+							"defUid": 192,
+							"px": [834,818],
+							"fieldInstances": [],
+							"__worldX": 834,
+							"__worldY": 818
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [44,203],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 24, "y": 0, "w": 24, "h": 24 },
+							"__smartColor": "#4CBE2F",
+							"iid": "d3d65b90-d380-11f0-99ec-6ba27ee57174",
+							"width": 24,
+							"height": 24,
+							"defUid": 181,
+							"px": [178,814],
+							"fieldInstances": [],
+							"__worldX": 178,
+							"__worldY": 814
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [205,235],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": { "tilesetUid": 183, "x": 24, "y": 0, "w": 24, "h": 24 },
+							"__smartColor": "#4CBE2F",
+							"iid": "d5b61810-d380-11f0-99ec-55871e1edc52",
+							"width": 24,
+							"height": 24,
+							"defUid": 181,
+							"px": [822,942],
+							"fieldInstances": [],
+							"__worldX": 822,
+							"__worldY": 942
+						}
+					]
+				},
+				{
+					"__identifier": "IntGrid",
+					"__type": "IntGrid",
+					"__cWid": 57,
+					"__cHei": 57,
+					"__gridSize": 18,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": 1,
+					"__tilesetRelPath": "../pixel_platformer/tilemap.png",
+					"iid": "546900d0-d380-11f0-87cf-9d65a3c66d96",
+					"levelId": 0,
+					"layerDefUid": 3,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [
+						1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,3,3,
+						3,3,0,0,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,3,3,3,3,0,0,1,1,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,3,3,4,3,3,0,0,1,1,0,0,0,0,0,0,0,0,3,3,3,3,3,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,
+						1,1,0,0,0,0,0,0,0,0,3,3,3,3,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,2,2,2,2,0,0,0,0,0,0,0,4,0,0,0,0,1,1,0,0,0,0,0,0,0,0,3,3,4,
+						3,3,0,0,3,3,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,4,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,3,4,3,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,1,1,0,0,
+						0,0,0,0,0,0,0,0,4,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						2,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,
+						0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,
+						0,0,0,0,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,1,1,1,1,1,0,
+						0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,1,1,1,1,0,0,0,0,0,0,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,0,0,0,0,0,0,0,0,
+						0,0,0,3,3,3,3,3,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,
+						1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,
+						0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,3,3,3,3,3,3,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,2,2,2,2,2,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,
+						0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,
+						1,1,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,
+						1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,2,2,2,2,
+						2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,2,2,2,2,0,0,1,1,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,3,3,3,3,3,3,3,3,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						2,2,2,2,2,0,0,3,3,3,3,3,3,3,3,3,0,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,3,3,3,3,3,
+						3,3,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,3,3,3,3,3,3,3,3,0,0,0,0,0,0,0,0,0,0,
+						3,3,3,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,
+						0,0,0,3,3,3,3,3,3,3,3,3,0,0,0,0,0,0,0,0,0,0,3,3,3,0,0,0,0,0,0,0,0,0,0,
+						1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,3,3,3,4,3,3,3,3,0,
+						0,0,0,0,1,1,1,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,
+						0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,
+						0,0,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,1,1,1,1,1,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,1,1,1,1,1,1,1,1,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,1,0,0,0,0,
+						0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,1,1,1,1,0,0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,1,1,
+						0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						4,0,0,0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1
+					],
+					"autoLayerTiles": [
+						{ "px": [18,54], "src": [144,108], "f": 0, "t": 128, "d": [22,172], "a": 1 },
+						{ "px": [72,54], "src": [90,108], "f": 0, "t": 125, "d": [22,175], "a": 1 },
+						{ "px": [900,180], "src": [72,126], "f": 0, "t": 144, "d": [22,620], "a": 1 },
+						{ "px": [972,180], "src": [72,108], "f": 0, "t": 124, "d": [22,624], "a": 1 },
+						{ "px": [990,180], "src": [72,126], "f": 0, "t": 144, "d": [22,625], "a": 1 },
+						{ "px": [450,216], "src": [144,108], "f": 0, "t": 128, "d": [22,709], "a": 1 },
+						{ "px": [432,324], "src": [72,108], "f": 0, "t": 124, "d": [22,1050], "a": 1 },
+						{ "px": [18,486], "src": [72,126], "f": 0, "t": 144, "d": [22,1540], "a": 1 },
+						{ "px": [108,486], "src": [72,126], "f": 0, "t": 144, "d": [22,1545], "a": 1 },
+						{ "px": [144,486], "src": [144,108], "f": 0, "t": 128, "d": [22,1547], "a": 1 },
+						{ "px": [792,522], "src": [90,108], "f": 0, "t": 125, "d": [22,1697], "a": 1 },
+						{ "px": [810,522], "src": [90,108], "f": 0, "t": 125, "d": [22,1698], "a": 1 },
+						{ "px": [612,684], "src": [72,126], "f": 0, "t": 144, "d": [22,2200], "a": 1 },
+						{ "px": [630,684], "src": [144,108], "f": 0, "t": 128, "d": [22,2201], "a": 1 },
+						{ "px": [684,756], "src": [90,108], "f": 0, "t": 125, "d": [22,2432], "a": 1 },
+						{ "px": [90,810], "src": [90,108], "f": 0, "t": 125, "d": [22,2570], "a": 1 },
+						{ "px": [126,810], "src": [144,108], "f": 0, "t": 128, "d": [22,2572], "a": 1 },
+						{ "px": [774,810], "src": [72,108], "f": 0, "t": 124, "d": [22,2608], "a": 1 },
+						{ "px": [810,810], "src": [90,108], "f": 0, "t": 125, "d": [22,2610], "a": 1 },
+						{ "px": [918,864], "src": [144,108], "f": 0, "t": 128, "d": [22,2787], "a": 1 },
+						{ "px": [54,936], "src": [144,108], "f": 0, "t": 128, "d": [22,2967], "a": 1 },
+						{ "px": [108,936], "src": [144,108], "f": 0, "t": 128, "d": [22,2970], "a": 1 },
+						{ "px": [144,936], "src": [72,108], "f": 0, "t": 124, "d": [22,2972], "a": 1 },
+						{ "px": [288,936], "src": [72,126], "f": 0, "t": 144, "d": [22,2980], "a": 1 },
+						{ "px": [378,936], "src": [144,108], "f": 0, "t": 128, "d": [22,2985], "a": 1 },
+						{ "px": [468,936], "src": [72,126], "f": 0, "t": 144, "d": [22,2990], "a": 1 },
+						{ "px": [486,936], "src": [144,108], "f": 0, "t": 128, "d": [22,2991], "a": 1 },
+						{ "px": [558,936], "src": [90,108], "f": 0, "t": 125, "d": [22,2995], "a": 1 },
+						{ "px": [594,936], "src": [72,126], "f": 0, "t": 144, "d": [22,2997], "a": 1 },
+						{ "px": [630,936], "src": [72,108], "f": 0, "t": 124, "d": [22,2999], "a": 1 },
+						{ "px": [648,936], "src": [90,108], "f": 0, "t": 125, "d": [22,3000], "a": 1 },
+						{ "px": [666,936], "src": [144,108], "f": 0, "t": 128, "d": [22,3001], "a": 1 },
+						{ "px": [702,936], "src": [72,108], "f": 0, "t": 124, "d": [22,3003], "a": 1 },
+						{ "px": [864,936], "src": [72,126], "f": 0, "t": 144, "d": [22,3012], "a": 1 },
+						{ "px": [918,936], "src": [72,108], "f": 0, "t": 124, "d": [22,3015], "a": 1 },
+						{ "px": [0,72], "src": [36,108], "f": 0, "t": 122, "d": [63,228], "a": 1 },
+						{ "px": [0,90], "src": [36,108], "f": 0, "t": 122, "d": [63,285], "a": 1 },
+						{ "px": [1008,198], "src": [36,108], "f": 0, "t": 122, "d": [63,683], "a": 1 },
+						{ "px": [324,252], "src": [36,108], "f": 0, "t": 122, "d": [63,816], "a": 1 },
+						{ "px": [432,252], "src": [36,108], "f": 0, "t": 122, "d": [63,822], "a": 1 },
+						{ "px": [450,252], "src": [36,108], "f": 0, "t": 122, "d": [63,823], "a": 1 },
+						{ "px": [468,252], "src": [36,108], "f": 0, "t": 122, "d": [63,824], "a": 1 },
+						{ "px": [486,252], "src": [36,108], "f": 0, "t": 122, "d": [63,825], "a": 1 },
+						{ "px": [504,252], "src": [36,108], "f": 0, "t": 122, "d": [63,826], "a": 1 },
+						{ "px": [486,270], "src": [36,108], "f": 0, "t": 122, "d": [63,882], "a": 1 },
+						{ "px": [504,270], "src": [36,108], "f": 0, "t": 122, "d": [63,883], "a": 1 },
+						{ "px": [522,270], "src": [36,108], "f": 0, "t": 122, "d": [63,884], "a": 1 },
+						{ "px": [540,270], "src": [36,108], "f": 0, "t": 122, "d": [63,885], "a": 1 },
+						{ "px": [504,288], "src": [36,108], "f": 0, "t": 122, "d": [63,940], "a": 1 },
+						{ "px": [522,288], "src": [36,108], "f": 0, "t": 122, "d": [63,941], "a": 1 },
+						{ "px": [540,288], "src": [36,108], "f": 0, "t": 122, "d": [63,942], "a": 1 },
+						{ "px": [504,306], "src": [36,108], "f": 0, "t": 122, "d": [63,997], "a": 1 },
+						{ "px": [486,324], "src": [36,108], "f": 0, "t": 122, "d": [63,1053], "a": 1 },
+						{ "px": [468,342], "src": [36,108], "f": 0, "t": 122, "d": [63,1109], "a": 1 },
+						{ "px": [486,342], "src": [36,108], "f": 0, "t": 122, "d": [63,1110], "a": 1 },
+						{ "px": [432,360], "src": [36,108], "f": 0, "t": 122, "d": [63,1164], "a": 1 },
+						{ "px": [450,360], "src": [36,108], "f": 0, "t": 122, "d": [63,1165], "a": 1 },
+						{ "px": [468,360], "src": [36,108], "f": 0, "t": 122, "d": [63,1166], "a": 1 },
+						{ "px": [486,360], "src": [36,108], "f": 0, "t": 122, "d": [63,1167], "a": 1 },
+						{ "px": [396,378], "src": [36,108], "f": 0, "t": 122, "d": [63,1219], "a": 1 },
+						{ "px": [414,378], "src": [36,108], "f": 0, "t": 122, "d": [63,1220], "a": 1 },
+						{ "px": [432,378], "src": [36,108], "f": 0, "t": 122, "d": [63,1221], "a": 1 },
+						{ "px": [450,378], "src": [36,108], "f": 0, "t": 122, "d": [63,1222], "a": 1 },
+						{ "px": [468,378], "src": [36,108], "f": 0, "t": 122, "d": [63,1223], "a": 1 },
+						{ "px": [486,378], "src": [36,108], "f": 0, "t": 122, "d": [63,1224], "a": 1 },
+						{ "px": [0,504], "src": [36,108], "f": 0, "t": 122, "d": [63,1596], "a": 1 },
+						{ "px": [0,522], "src": [36,108], "f": 0, "t": 122, "d": [63,1653], "a": 1 },
+						{ "px": [648,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1803], "a": 1 },
+						{ "px": [666,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1804], "a": 1 },
+						{ "px": [684,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1805], "a": 1 },
+						{ "px": [702,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1806], "a": 1 },
+						{ "px": [720,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1807], "a": 1 },
+						{ "px": [738,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1808], "a": 1 },
+						{ "px": [756,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1809], "a": 1 },
+						{ "px": [774,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1810], "a": 1 },
+						{ "px": [792,558], "src": [36,108], "f": 0, "t": 122, "d": [63,1811], "a": 1 },
+						{ "px": [648,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1860], "a": 1 },
+						{ "px": [666,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1861], "a": 1 },
+						{ "px": [684,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1862], "a": 1 },
+						{ "px": [702,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1863], "a": 1 },
+						{ "px": [720,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1864], "a": 1 },
+						{ "px": [738,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1865], "a": 1 },
+						{ "px": [756,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1866], "a": 1 },
+						{ "px": [774,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1867], "a": 1 },
+						{ "px": [792,576], "src": [36,108], "f": 0, "t": 122, "d": [63,1868], "a": 1 },
+						{ "px": [0,954], "src": [36,108], "f": 0, "t": 122, "d": [63,3021], "a": 1 },
+						{ "px": [1008,954], "src": [36,108], "f": 0, "t": 122, "d": [63,3077], "a": 1 },
+						{ "px": [0,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3078], "a": 1 },
+						{ "px": [18,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3079], "a": 1 },
+						{ "px": [36,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3080], "a": 1 },
+						{ "px": [54,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3081], "a": 1 },
+						{ "px": [72,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3082], "a": 1 },
+						{ "px": [90,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3083], "a": 1 },
+						{ "px": [108,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3084], "a": 1 },
+						{ "px": [126,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3085], "a": 1 },
+						{ "px": [144,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3086], "a": 1 },
+						{ "px": [162,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3087], "a": 1 },
+						{ "px": [180,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3088], "a": 1 },
+						{ "px": [198,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3089], "a": 1 },
+						{ "px": [216,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3090], "a": 1 },
+						{ "px": [234,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3091], "a": 1 },
+						{ "px": [252,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3092], "a": 1 },
+						{ "px": [270,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3093], "a": 1 },
+						{ "px": [288,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3094], "a": 1 },
+						{ "px": [306,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3095], "a": 1 },
+						{ "px": [324,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3096], "a": 1 },
+						{ "px": [342,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3097], "a": 1 },
+						{ "px": [360,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3098], "a": 1 },
+						{ "px": [378,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3099], "a": 1 },
+						{ "px": [396,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3100], "a": 1 },
+						{ "px": [414,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3101], "a": 1 },
+						{ "px": [432,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3102], "a": 1 },
+						{ "px": [450,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3103], "a": 1 },
+						{ "px": [468,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3104], "a": 1 },
+						{ "px": [486,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3105], "a": 1 },
+						{ "px": [504,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3106], "a": 1 },
+						{ "px": [522,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3107], "a": 1 },
+						{ "px": [540,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3108], "a": 1 },
+						{ "px": [558,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3109], "a": 1 },
+						{ "px": [576,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3110], "a": 1 },
+						{ "px": [594,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3111], "a": 1 },
+						{ "px": [612,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3112], "a": 1 },
+						{ "px": [630,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3113], "a": 1 },
+						{ "px": [648,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3114], "a": 1 },
+						{ "px": [666,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3115], "a": 1 },
+						{ "px": [684,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3116], "a": 1 },
+						{ "px": [702,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3117], "a": 1 },
+						{ "px": [720,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3118], "a": 1 },
+						{ "px": [738,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3119], "a": 1 },
+						{ "px": [756,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3120], "a": 1 },
+						{ "px": [774,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3121], "a": 1 },
+						{ "px": [792,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3122], "a": 1 },
+						{ "px": [810,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3123], "a": 1 },
+						{ "px": [828,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3124], "a": 1 },
+						{ "px": [846,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3125], "a": 1 },
+						{ "px": [864,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3126], "a": 1 },
+						{ "px": [882,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3127], "a": 1 },
+						{ "px": [900,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3128], "a": 1 },
+						{ "px": [918,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3129], "a": 1 },
+						{ "px": [936,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3130], "a": 1 },
+						{ "px": [954,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3131], "a": 1 },
+						{ "px": [972,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3132], "a": 1 },
+						{ "px": [990,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3133], "a": 1 },
+						{ "px": [1008,972], "src": [36,108], "f": 0, "t": 122, "d": [63,3134], "a": 1 },
+						{ "px": [0,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3135], "a": 1 },
+						{ "px": [18,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3136], "a": 1 },
+						{ "px": [36,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3137], "a": 1 },
+						{ "px": [54,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3138], "a": 1 },
+						{ "px": [72,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3139], "a": 1 },
+						{ "px": [90,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3140], "a": 1 },
+						{ "px": [108,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3141], "a": 1 },
+						{ "px": [126,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3142], "a": 1 },
+						{ "px": [144,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3143], "a": 1 },
+						{ "px": [162,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3144], "a": 1 },
+						{ "px": [180,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3145], "a": 1 },
+						{ "px": [198,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3146], "a": 1 },
+						{ "px": [216,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3147], "a": 1 },
+						{ "px": [234,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3148], "a": 1 },
+						{ "px": [252,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3149], "a": 1 },
+						{ "px": [270,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3150], "a": 1 },
+						{ "px": [288,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3151], "a": 1 },
+						{ "px": [306,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3152], "a": 1 },
+						{ "px": [324,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3153], "a": 1 },
+						{ "px": [342,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3154], "a": 1 },
+						{ "px": [360,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3155], "a": 1 },
+						{ "px": [378,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3156], "a": 1 },
+						{ "px": [396,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3157], "a": 1 },
+						{ "px": [414,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3158], "a": 1 },
+						{ "px": [432,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3159], "a": 1 },
+						{ "px": [450,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3160], "a": 1 },
+						{ "px": [468,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3161], "a": 1 },
+						{ "px": [486,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3162], "a": 1 },
+						{ "px": [504,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3163], "a": 1 },
+						{ "px": [522,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3164], "a": 1 },
+						{ "px": [540,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3165], "a": 1 },
+						{ "px": [558,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3166], "a": 1 },
+						{ "px": [576,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3167], "a": 1 },
+						{ "px": [594,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3168], "a": 1 },
+						{ "px": [612,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3169], "a": 1 },
+						{ "px": [630,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3170], "a": 1 },
+						{ "px": [648,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3171], "a": 1 },
+						{ "px": [666,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3172], "a": 1 },
+						{ "px": [684,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3173], "a": 1 },
+						{ "px": [702,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3174], "a": 1 },
+						{ "px": [720,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3175], "a": 1 },
+						{ "px": [738,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3176], "a": 1 },
+						{ "px": [756,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3177], "a": 1 },
+						{ "px": [774,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3178], "a": 1 },
+						{ "px": [792,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3179], "a": 1 },
+						{ "px": [810,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3180], "a": 1 },
+						{ "px": [828,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3181], "a": 1 },
+						{ "px": [846,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3182], "a": 1 },
+						{ "px": [864,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3183], "a": 1 },
+						{ "px": [882,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3184], "a": 1 },
+						{ "px": [900,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3185], "a": 1 },
+						{ "px": [918,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3186], "a": 1 },
+						{ "px": [936,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3187], "a": 1 },
+						{ "px": [954,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3188], "a": 1 },
+						{ "px": [972,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3189], "a": 1 },
+						{ "px": [990,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3190], "a": 1 },
+						{ "px": [1008,990], "src": [36,108], "f": 0, "t": 122, "d": [63,3191], "a": 1 },
+						{ "px": [0,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3192], "a": 1 },
+						{ "px": [18,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3193], "a": 1 },
+						{ "px": [36,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3194], "a": 1 },
+						{ "px": [54,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3195], "a": 1 },
+						{ "px": [72,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3196], "a": 1 },
+						{ "px": [90,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3197], "a": 1 },
+						{ "px": [108,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3198], "a": 1 },
+						{ "px": [126,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3199], "a": 1 },
+						{ "px": [144,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3200], "a": 1 },
+						{ "px": [162,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3201], "a": 1 },
+						{ "px": [180,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3202], "a": 1 },
+						{ "px": [198,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3203], "a": 1 },
+						{ "px": [216,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3204], "a": 1 },
+						{ "px": [234,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3205], "a": 1 },
+						{ "px": [252,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3206], "a": 1 },
+						{ "px": [270,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3207], "a": 1 },
+						{ "px": [288,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3208], "a": 1 },
+						{ "px": [306,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3209], "a": 1 },
+						{ "px": [324,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3210], "a": 1 },
+						{ "px": [342,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3211], "a": 1 },
+						{ "px": [360,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3212], "a": 1 },
+						{ "px": [378,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3213], "a": 1 },
+						{ "px": [396,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3214], "a": 1 },
+						{ "px": [414,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3215], "a": 1 },
+						{ "px": [432,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3216], "a": 1 },
+						{ "px": [450,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3217], "a": 1 },
+						{ "px": [468,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3218], "a": 1 },
+						{ "px": [486,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3219], "a": 1 },
+						{ "px": [504,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3220], "a": 1 },
+						{ "px": [522,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3221], "a": 1 },
+						{ "px": [540,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3222], "a": 1 },
+						{ "px": [558,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3223], "a": 1 },
+						{ "px": [576,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3224], "a": 1 },
+						{ "px": [594,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3225], "a": 1 },
+						{ "px": [612,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3226], "a": 1 },
+						{ "px": [630,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3227], "a": 1 },
+						{ "px": [648,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3228], "a": 1 },
+						{ "px": [666,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3229], "a": 1 },
+						{ "px": [684,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3230], "a": 1 },
+						{ "px": [702,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3231], "a": 1 },
+						{ "px": [720,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3232], "a": 1 },
+						{ "px": [738,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3233], "a": 1 },
+						{ "px": [756,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3234], "a": 1 },
+						{ "px": [774,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3235], "a": 1 },
+						{ "px": [792,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3236], "a": 1 },
+						{ "px": [810,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3237], "a": 1 },
+						{ "px": [828,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3238], "a": 1 },
+						{ "px": [846,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3239], "a": 1 },
+						{ "px": [864,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3240], "a": 1 },
+						{ "px": [882,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3241], "a": 1 },
+						{ "px": [900,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3242], "a": 1 },
+						{ "px": [918,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3243], "a": 1 },
+						{ "px": [936,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3244], "a": 1 },
+						{ "px": [954,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3245], "a": 1 },
+						{ "px": [972,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3246], "a": 1 },
+						{ "px": [990,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3247], "a": 1 },
+						{ "px": [1008,1008], "src": [36,108], "f": 0, "t": 122, "d": [63,3248], "a": 1 },
+						{ "px": [1008,0], "src": [18,108], "f": 0, "t": 121, "d": [62,56], "a": 1 },
+						{ "px": [1008,18], "src": [18,108], "f": 0, "t": 121, "d": [62,113], "a": 1 },
+						{ "px": [1008,36], "src": [18,108], "f": 0, "t": 121, "d": [62,170], "a": 1 },
+						{ "px": [1008,54], "src": [18,108], "f": 0, "t": 121, "d": [62,227], "a": 1 },
+						{ "px": [1008,72], "src": [18,108], "f": 0, "t": 121, "d": [62,284], "a": 1 },
+						{ "px": [1008,90], "src": [18,108], "f": 0, "t": 121, "d": [62,341], "a": 1 },
+						{ "px": [1008,108], "src": [18,108], "f": 0, "t": 121, "d": [62,398], "a": 1 },
+						{ "px": [1008,126], "src": [18,108], "f": 0, "t": 121, "d": [62,455], "a": 1 },
+						{ "px": [1008,144], "src": [18,108], "f": 0, "t": 121, "d": [62,512], "a": 1 },
+						{ "px": [1008,162], "src": [18,108], "f": 0, "t": 121, "d": [62,569], "a": 1 },
+						{ "px": [1008,180], "src": [18,108], "f": 0, "t": 121, "d": [62,626], "a": 1 },
+						{ "px": [1008,216], "src": [18,108], "f": 0, "t": 121, "d": [62,740], "a": 1 },
+						{ "px": [1008,234], "src": [18,108], "f": 0, "t": 121, "d": [62,797], "a": 1 },
+						{ "px": [306,252], "src": [18,108], "f": 0, "t": 121, "d": [62,815], "a": 1 },
+						{ "px": [1008,252], "src": [18,108], "f": 0, "t": 121, "d": [62,854], "a": 1 },
+						{ "px": [306,270], "src": [18,108], "f": 0, "t": 121, "d": [62,872], "a": 1 },
+						{ "px": [1008,270], "src": [18,108], "f": 0, "t": 121, "d": [62,911], "a": 1 },
+						{ "px": [306,288], "src": [18,108], "f": 0, "t": 121, "d": [62,929], "a": 1 },
+						{ "px": [486,288], "src": [18,108], "f": 0, "t": 121, "d": [62,939], "a": 1 },
+						{ "px": [1008,288], "src": [18,108], "f": 0, "t": 121, "d": [62,968], "a": 1 },
+						{ "px": [486,306], "src": [18,108], "f": 0, "t": 121, "d": [62,996], "a": 1 },
+						{ "px": [1008,306], "src": [18,108], "f": 0, "t": 121, "d": [62,1025], "a": 1 },
+						{ "px": [1008,324], "src": [18,108], "f": 0, "t": 121, "d": [62,1082], "a": 1 },
+						{ "px": [1008,342], "src": [18,108], "f": 0, "t": 121, "d": [62,1139], "a": 1 },
+						{ "px": [1008,360], "src": [18,108], "f": 0, "t": 121, "d": [62,1196], "a": 1 },
+						{ "px": [1008,378], "src": [18,108], "f": 0, "t": 121, "d": [62,1253], "a": 1 },
+						{ "px": [1008,396], "src": [18,108], "f": 0, "t": 121, "d": [62,1310], "a": 1 },
+						{ "px": [1008,414], "src": [18,108], "f": 0, "t": 121, "d": [62,1367], "a": 1 },
+						{ "px": [1008,432], "src": [18,108], "f": 0, "t": 121, "d": [62,1424], "a": 1 },
+						{ "px": [1008,450], "src": [18,108], "f": 0, "t": 121, "d": [62,1481], "a": 1 },
+						{ "px": [1008,468], "src": [18,108], "f": 0, "t": 121, "d": [62,1538], "a": 1 },
+						{ "px": [1008,486], "src": [18,108], "f": 0, "t": 121, "d": [62,1595], "a": 1 },
+						{ "px": [1008,504], "src": [18,108], "f": 0, "t": 121, "d": [62,1652], "a": 1 },
+						{ "px": [1008,522], "src": [18,108], "f": 0, "t": 121, "d": [62,1709], "a": 1 },
+						{ "px": [1008,540], "src": [18,108], "f": 0, "t": 121, "d": [62,1766], "a": 1 },
+						{ "px": [630,558], "src": [18,108], "f": 0, "t": 121, "d": [62,1802], "a": 1 },
+						{ "px": [1008,558], "src": [18,108], "f": 0, "t": 121, "d": [62,1823], "a": 1 },
+						{ "px": [630,576], "src": [18,108], "f": 0, "t": 121, "d": [62,1859], "a": 1 },
+						{ "px": [1008,576], "src": [18,108], "f": 0, "t": 121, "d": [62,1880], "a": 1 },
+						{ "px": [1008,594], "src": [18,108], "f": 0, "t": 121, "d": [62,1937], "a": 1 },
+						{ "px": [1008,612], "src": [18,108], "f": 0, "t": 121, "d": [62,1994], "a": 1 },
+						{ "px": [1008,630], "src": [18,108], "f": 0, "t": 121, "d": [62,2051], "a": 1 },
+						{ "px": [1008,648], "src": [18,108], "f": 0, "t": 121, "d": [62,2108], "a": 1 },
+						{ "px": [1008,666], "src": [18,108], "f": 0, "t": 121, "d": [62,2165], "a": 1 },
+						{ "px": [1008,684], "src": [18,108], "f": 0, "t": 121, "d": [62,2222], "a": 1 },
+						{ "px": [1008,702], "src": [18,108], "f": 0, "t": 121, "d": [62,2279], "a": 1 },
+						{ "px": [1008,720], "src": [18,108], "f": 0, "t": 121, "d": [62,2336], "a": 1 },
+						{ "px": [1008,738], "src": [18,108], "f": 0, "t": 121, "d": [62,2393], "a": 1 },
+						{ "px": [1008,756], "src": [18,108], "f": 0, "t": 121, "d": [62,2450], "a": 1 },
+						{ "px": [1008,774], "src": [18,108], "f": 0, "t": 121, "d": [62,2507], "a": 1 },
+						{ "px": [1008,792], "src": [18,108], "f": 0, "t": 121, "d": [62,2564], "a": 1 },
+						{ "px": [1008,810], "src": [18,108], "f": 0, "t": 121, "d": [62,2621], "a": 1 },
+						{ "px": [1008,828], "src": [18,108], "f": 0, "t": 121, "d": [62,2678], "a": 1 },
+						{ "px": [1008,846], "src": [18,108], "f": 0, "t": 121, "d": [62,2735], "a": 1 },
+						{ "px": [1008,864], "src": [18,108], "f": 0, "t": 121, "d": [62,2792], "a": 1 },
+						{ "px": [1008,882], "src": [18,108], "f": 0, "t": 121, "d": [62,2849], "a": 1 },
+						{ "px": [1008,900], "src": [18,108], "f": 0, "t": 121, "d": [62,2906], "a": 1 },
+						{ "px": [1008,918], "src": [18,108], "f": 0, "t": 121, "d": [62,2963], "a": 1 },
+						{ "px": [1008,936], "src": [18,108], "f": 0, "t": 121, "d": [62,3020], "a": 1 },
+						{ "px": [18,90], "src": [36,126], "f": 0, "t": 142, "d": [61,286], "a": 1 },
+						{ "px": [36,90], "src": [36,126], "f": 0, "t": 142, "d": [61,287], "a": 1 },
+						{ "px": [54,90], "src": [36,126], "f": 0, "t": 142, "d": [61,288], "a": 1 },
+						{ "px": [72,90], "src": [36,126], "f": 0, "t": 142, "d": [61,289], "a": 1 },
+						{ "px": [342,252], "src": [36,126], "f": 0, "t": 142, "d": [61,817], "a": 1 },
+						{ "px": [360,252], "src": [36,126], "f": 0, "t": 142, "d": [61,818], "a": 1 },
+						{ "px": [378,252], "src": [36,126], "f": 0, "t": 142, "d": [61,819], "a": 1 },
+						{ "px": [396,252], "src": [36,126], "f": 0, "t": 142, "d": [61,820], "a": 1 },
+						{ "px": [414,252], "src": [36,126], "f": 0, "t": 142, "d": [61,821], "a": 1 },
+						{ "px": [450,270], "src": [36,126], "f": 0, "t": 142, "d": [61,880], "a": 1 },
+						{ "px": [468,270], "src": [36,126], "f": 0, "t": 142, "d": [61,881], "a": 1 },
+						{ "px": [324,306], "src": [36,126], "f": 0, "t": 142, "d": [61,987], "a": 1 },
+						{ "px": [522,306], "src": [36,126], "f": 0, "t": 142, "d": [61,998], "a": 1 },
+						{ "px": [540,306], "src": [36,126], "f": 0, "t": 142, "d": [61,999], "a": 1 },
+						{ "px": [342,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1273], "a": 1 },
+						{ "px": [360,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1274], "a": 1 },
+						{ "px": [378,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1275], "a": 1 },
+						{ "px": [396,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1276], "a": 1 },
+						{ "px": [414,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1277], "a": 1 },
+						{ "px": [432,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1278], "a": 1 },
+						{ "px": [450,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1279], "a": 1 },
+						{ "px": [468,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1280], "a": 1 },
+						{ "px": [486,396], "src": [36,126], "f": 0, "t": 142, "d": [61,1281], "a": 1 },
+						{ "px": [18,522], "src": [36,126], "f": 0, "t": 142, "d": [61,1654], "a": 1 },
+						{ "px": [36,522], "src": [36,126], "f": 0, "t": 142, "d": [61,1655], "a": 1 },
+						{ "px": [54,522], "src": [36,126], "f": 0, "t": 142, "d": [61,1656], "a": 1 },
+						{ "px": [72,522], "src": [36,126], "f": 0, "t": 142, "d": [61,1657], "a": 1 },
+						{ "px": [648,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1917], "a": 1 },
+						{ "px": [666,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1918], "a": 1 },
+						{ "px": [684,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1919], "a": 1 },
+						{ "px": [702,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1920], "a": 1 },
+						{ "px": [720,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1921], "a": 1 },
+						{ "px": [738,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1922], "a": 1 },
+						{ "px": [756,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1923], "a": 1 },
+						{ "px": [774,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1924], "a": 1 },
+						{ "px": [792,594], "src": [36,126], "f": 0, "t": 142, "d": [61,1925], "a": 1 },
+						{ "px": [108,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2685], "a": 1 },
+						{ "px": [126,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2686], "a": 1 },
+						{ "px": [144,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2687], "a": 1 },
+						{ "px": [162,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2688], "a": 1 },
+						{ "px": [180,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2689], "a": 1 },
+						{ "px": [198,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2690], "a": 1 },
+						{ "px": [774,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2722], "a": 1 },
+						{ "px": [792,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2723], "a": 1 },
+						{ "px": [810,846], "src": [36,126], "f": 0, "t": 142, "d": [61,2724], "a": 1 },
+						{ "px": [0,0], "src": [54,108], "f": 0, "t": 123, "d": [60,0], "a": 1 },
+						{ "px": [0,18], "src": [54,108], "f": 0, "t": 123, "d": [60,57], "a": 1 },
+						{ "px": [0,36], "src": [54,108], "f": 0, "t": 123, "d": [60,114], "a": 1 },
+						{ "px": [0,54], "src": [54,108], "f": 0, "t": 123, "d": [60,171], "a": 1 },
+						{ "px": [0,108], "src": [54,108], "f": 0, "t": 123, "d": [60,342], "a": 1 },
+						{ "px": [0,126], "src": [54,108], "f": 0, "t": 123, "d": [60,399], "a": 1 },
+						{ "px": [0,144], "src": [54,108], "f": 0, "t": 123, "d": [60,456], "a": 1 },
+						{ "px": [0,162], "src": [54,108], "f": 0, "t": 123, "d": [60,513], "a": 1 },
+						{ "px": [0,180], "src": [54,108], "f": 0, "t": 123, "d": [60,570], "a": 1 },
+						{ "px": [0,198], "src": [54,108], "f": 0, "t": 123, "d": [60,627], "a": 1 },
+						{ "px": [0,216], "src": [54,108], "f": 0, "t": 123, "d": [60,684], "a": 1 },
+						{ "px": [0,234], "src": [54,108], "f": 0, "t": 123, "d": [60,741], "a": 1 },
+						{ "px": [0,252], "src": [54,108], "f": 0, "t": 123, "d": [60,798], "a": 1 },
+						{ "px": [0,270], "src": [54,108], "f": 0, "t": 123, "d": [60,855], "a": 1 },
+						{ "px": [324,270], "src": [54,108], "f": 0, "t": 123, "d": [60,873], "a": 1 },
+						{ "px": [558,270], "src": [54,108], "f": 0, "t": 123, "d": [60,886], "a": 1 },
+						{ "px": [0,288], "src": [54,108], "f": 0, "t": 123, "d": [60,912], "a": 1 },
+						{ "px": [324,288], "src": [54,108], "f": 0, "t": 123, "d": [60,930], "a": 1 },
+						{ "px": [558,288], "src": [54,108], "f": 0, "t": 123, "d": [60,943], "a": 1 },
+						{ "px": [0,306], "src": [54,108], "f": 0, "t": 123, "d": [60,969], "a": 1 },
+						{ "px": [0,324], "src": [54,108], "f": 0, "t": 123, "d": [60,1026], "a": 1 },
+						{ "px": [504,324], "src": [54,108], "f": 0, "t": 123, "d": [60,1054], "a": 1 },
+						{ "px": [0,342], "src": [54,108], "f": 0, "t": 123, "d": [60,1083], "a": 1 },
+						{ "px": [504,342], "src": [54,108], "f": 0, "t": 123, "d": [60,1111], "a": 1 },
+						{ "px": [0,360], "src": [54,108], "f": 0, "t": 123, "d": [60,1140], "a": 1 },
+						{ "px": [504,360], "src": [54,108], "f": 0, "t": 123, "d": [60,1168], "a": 1 },
+						{ "px": [0,378], "src": [54,108], "f": 0, "t": 123, "d": [60,1197], "a": 1 },
+						{ "px": [504,378], "src": [54,108], "f": 0, "t": 123, "d": [60,1225], "a": 1 },
+						{ "px": [0,396], "src": [54,108], "f": 0, "t": 123, "d": [60,1254], "a": 1 },
+						{ "px": [0,414], "src": [54,108], "f": 0, "t": 123, "d": [60,1311], "a": 1 },
+						{ "px": [0,432], "src": [54,108], "f": 0, "t": 123, "d": [60,1368], "a": 1 },
+						{ "px": [0,450], "src": [54,108], "f": 0, "t": 123, "d": [60,1425], "a": 1 },
+						{ "px": [0,468], "src": [54,108], "f": 0, "t": 123, "d": [60,1482], "a": 1 },
+						{ "px": [0,486], "src": [54,108], "f": 0, "t": 123, "d": [60,1539], "a": 1 },
+						{ "px": [0,540], "src": [54,108], "f": 0, "t": 123, "d": [60,1710], "a": 1 },
+						{ "px": [0,558], "src": [54,108], "f": 0, "t": 123, "d": [60,1767], "a": 1 },
+						{ "px": [810,558], "src": [54,108], "f": 0, "t": 123, "d": [60,1812], "a": 1 },
+						{ "px": [0,576], "src": [54,108], "f": 0, "t": 123, "d": [60,1824], "a": 1 },
+						{ "px": [810,576], "src": [54,108], "f": 0, "t": 123, "d": [60,1869], "a": 1 },
+						{ "px": [0,594], "src": [54,108], "f": 0, "t": 123, "d": [60,1881], "a": 1 },
+						{ "px": [0,612], "src": [54,108], "f": 0, "t": 123, "d": [60,1938], "a": 1 },
+						{ "px": [0,630], "src": [54,108], "f": 0, "t": 123, "d": [60,1995], "a": 1 },
+						{ "px": [0,648], "src": [54,108], "f": 0, "t": 123, "d": [60,2052], "a": 1 },
+						{ "px": [0,666], "src": [54,108], "f": 0, "t": 123, "d": [60,2109], "a": 1 },
+						{ "px": [0,684], "src": [54,108], "f": 0, "t": 123, "d": [60,2166], "a": 1 },
+						{ "px": [0,702], "src": [54,108], "f": 0, "t": 123, "d": [60,2223], "a": 1 },
+						{ "px": [0,720], "src": [54,108], "f": 0, "t": 123, "d": [60,2280], "a": 1 },
+						{ "px": [0,738], "src": [54,108], "f": 0, "t": 123, "d": [60,2337], "a": 1 },
+						{ "px": [0,756], "src": [54,108], "f": 0, "t": 123, "d": [60,2394], "a": 1 },
+						{ "px": [0,774], "src": [54,108], "f": 0, "t": 123, "d": [60,2451], "a": 1 },
+						{ "px": [0,792], "src": [54,108], "f": 0, "t": 123, "d": [60,2508], "a": 1 },
+						{ "px": [0,810], "src": [54,108], "f": 0, "t": 123, "d": [60,2565], "a": 1 },
+						{ "px": [0,828], "src": [54,108], "f": 0, "t": 123, "d": [60,2622], "a": 1 },
+						{ "px": [0,846], "src": [54,108], "f": 0, "t": 123, "d": [60,2679], "a": 1 },
+						{ "px": [0,864], "src": [54,108], "f": 0, "t": 123, "d": [60,2736], "a": 1 },
+						{ "px": [0,882], "src": [54,108], "f": 0, "t": 123, "d": [60,2793], "a": 1 },
+						{ "px": [0,900], "src": [54,108], "f": 0, "t": 123, "d": [60,2850], "a": 1 },
+						{ "px": [0,918], "src": [54,108], "f": 0, "t": 123, "d": [60,2907], "a": 1 },
+						{ "px": [0,936], "src": [54,108], "f": 0, "t": 123, "d": [60,2964], "a": 1 },
+						{ "px": [18,72], "src": [36,18], "f": 0, "t": 22, "d": [59,229], "a": 1 },
+						{ "px": [36,72], "src": [36,18], "f": 0, "t": 22, "d": [59,230], "a": 1 },
+						{ "px": [54,72], "src": [36,18], "f": 0, "t": 22, "d": [59,231], "a": 1 },
+						{ "px": [72,72], "src": [36,18], "f": 0, "t": 22, "d": [59,232], "a": 1 },
+						{ "px": [306,234], "src": [36,18], "f": 0, "t": 22, "d": [59,758], "a": 1 },
+						{ "px": [324,234], "src": [36,18], "f": 0, "t": 22, "d": [59,759], "a": 1 },
+						{ "px": [342,234], "src": [36,18], "f": 0, "t": 22, "d": [59,760], "a": 1 },
+						{ "px": [360,234], "src": [36,18], "f": 0, "t": 22, "d": [59,761], "a": 1 },
+						{ "px": [378,234], "src": [36,18], "f": 0, "t": 22, "d": [59,762], "a": 1 },
+						{ "px": [396,234], "src": [36,18], "f": 0, "t": 22, "d": [59,763], "a": 1 },
+						{ "px": [414,234], "src": [36,18], "f": 0, "t": 22, "d": [59,764], "a": 1 },
+						{ "px": [432,234], "src": [36,18], "f": 0, "t": 22, "d": [59,765], "a": 1 },
+						{ "px": [450,234], "src": [36,18], "f": 0, "t": 22, "d": [59,766], "a": 1 },
+						{ "px": [468,234], "src": [36,18], "f": 0, "t": 22, "d": [59,767], "a": 1 },
+						{ "px": [486,234], "src": [36,18], "f": 0, "t": 22, "d": [59,768], "a": 1 },
+						{ "px": [522,252], "src": [36,18], "f": 0, "t": 22, "d": [59,827], "a": 1 },
+						{ "px": [540,252], "src": [36,18], "f": 0, "t": 22, "d": [59,828], "a": 1 },
+						{ "px": [558,252], "src": [36,18], "f": 0, "t": 22, "d": [59,829], "a": 1 },
+						{ "px": [450,342], "src": [36,18], "f": 0, "t": 22, "d": [59,1108], "a": 1 },
+						{ "px": [414,360], "src": [36,18], "f": 0, "t": 22, "d": [59,1163], "a": 1 },
+						{ "px": [360,378], "src": [36,18], "f": 0, "t": 22, "d": [59,1217], "a": 1 },
+						{ "px": [378,378], "src": [36,18], "f": 0, "t": 22, "d": [59,1218], "a": 1 },
+						{ "px": [18,504], "src": [36,18], "f": 0, "t": 22, "d": [59,1597], "a": 1 },
+						{ "px": [36,504], "src": [36,18], "f": 0, "t": 22, "d": [59,1598], "a": 1 },
+						{ "px": [54,504], "src": [36,18], "f": 0, "t": 22, "d": [59,1599], "a": 1 },
+						{ "px": [72,504], "src": [36,18], "f": 0, "t": 22, "d": [59,1600], "a": 1 },
+						{ "px": [90,504], "src": [36,18], "f": 0, "t": 22, "d": [59,1601], "a": 1 },
+						{ "px": [630,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1745], "a": 1 },
+						{ "px": [648,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1746], "a": 1 },
+						{ "px": [666,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1747], "a": 1 },
+						{ "px": [684,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1748], "a": 1 },
+						{ "px": [702,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1749], "a": 1 },
+						{ "px": [720,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1750], "a": 1 },
+						{ "px": [738,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1751], "a": 1 },
+						{ "px": [756,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1752], "a": 1 },
+						{ "px": [774,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1753], "a": 1 },
+						{ "px": [792,540], "src": [36,18], "f": 0, "t": 22, "d": [59,1754], "a": 1 },
+						{ "px": [108,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2628], "a": 1 },
+						{ "px": [126,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2629], "a": 1 },
+						{ "px": [144,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2630], "a": 1 },
+						{ "px": [162,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2631], "a": 1 },
+						{ "px": [180,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2632], "a": 1 },
+						{ "px": [198,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2633], "a": 1 },
+						{ "px": [774,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2665], "a": 1 },
+						{ "px": [792,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2666], "a": 1 },
+						{ "px": [810,828], "src": [36,18], "f": 0, "t": 22, "d": [59,2667], "a": 1 },
+						{ "px": [18,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3022], "a": 1 },
+						{ "px": [36,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3023], "a": 1 },
+						{ "px": [54,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3024], "a": 1 },
+						{ "px": [72,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3025], "a": 1 },
+						{ "px": [90,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3026], "a": 1 },
+						{ "px": [108,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3027], "a": 1 },
+						{ "px": [126,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3028], "a": 1 },
+						{ "px": [144,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3029], "a": 1 },
+						{ "px": [162,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3030], "a": 1 },
+						{ "px": [180,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3031], "a": 1 },
+						{ "px": [198,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3032], "a": 1 },
+						{ "px": [216,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3033], "a": 1 },
+						{ "px": [234,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3034], "a": 1 },
+						{ "px": [252,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3035], "a": 1 },
+						{ "px": [270,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3036], "a": 1 },
+						{ "px": [288,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3037], "a": 1 },
+						{ "px": [306,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3038], "a": 1 },
+						{ "px": [324,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3039], "a": 1 },
+						{ "px": [342,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3040], "a": 1 },
+						{ "px": [360,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3041], "a": 1 },
+						{ "px": [378,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3042], "a": 1 },
+						{ "px": [396,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3043], "a": 1 },
+						{ "px": [414,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3044], "a": 1 },
+						{ "px": [432,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3045], "a": 1 },
+						{ "px": [450,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3046], "a": 1 },
+						{ "px": [468,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3047], "a": 1 },
+						{ "px": [486,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3048], "a": 1 },
+						{ "px": [504,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3049], "a": 1 },
+						{ "px": [522,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3050], "a": 1 },
+						{ "px": [540,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3051], "a": 1 },
+						{ "px": [558,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3052], "a": 1 },
+						{ "px": [576,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3053], "a": 1 },
+						{ "px": [594,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3054], "a": 1 },
+						{ "px": [612,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3055], "a": 1 },
+						{ "px": [630,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3056], "a": 1 },
+						{ "px": [648,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3057], "a": 1 },
+						{ "px": [666,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3058], "a": 1 },
+						{ "px": [684,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3059], "a": 1 },
+						{ "px": [702,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3060], "a": 1 },
+						{ "px": [720,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3061], "a": 1 },
+						{ "px": [738,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3062], "a": 1 },
+						{ "px": [756,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3063], "a": 1 },
+						{ "px": [774,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3064], "a": 1 },
+						{ "px": [792,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3065], "a": 1 },
+						{ "px": [810,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3066], "a": 1 },
+						{ "px": [828,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3067], "a": 1 },
+						{ "px": [846,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3068], "a": 1 },
+						{ "px": [864,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3069], "a": 1 },
+						{ "px": [882,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3070], "a": 1 },
+						{ "px": [900,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3071], "a": 1 },
+						{ "px": [918,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3072], "a": 1 },
+						{ "px": [936,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3073], "a": 1 },
+						{ "px": [954,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3074], "a": 1 },
+						{ "px": [972,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3075], "a": 1 },
+						{ "px": [990,954], "src": [36,18], "f": 0, "t": 22, "d": [59,3076], "a": 1 },
+						{ "px": [432,270], "src": [18,126], "f": 0, "t": 141, "d": [58,879], "a": 1 },
+						{ "px": [306,306], "src": [18,126], "f": 0, "t": 141, "d": [58,986], "a": 1 },
+						{ "px": [630,594], "src": [18,126], "f": 0, "t": 141, "d": [58,1916], "a": 1 },
+						{ "px": [90,846], "src": [18,126], "f": 0, "t": 141, "d": [58,2684], "a": 1 },
+						{ "px": [756,846], "src": [18,126], "f": 0, "t": 141, "d": [58,2721], "a": 1 },
+						{ "px": [90,90], "src": [54,126], "f": 0, "t": 143, "d": [57,290], "a": 1 },
+						{ "px": [558,306], "src": [54,126], "f": 0, "t": 143, "d": [57,1000], "a": 1 },
+						{ "px": [504,396], "src": [54,126], "f": 0, "t": 143, "d": [57,1282], "a": 1 },
+						{ "px": [90,522], "src": [54,126], "f": 0, "t": 143, "d": [57,1658], "a": 1 },
+						{ "px": [810,594], "src": [54,126], "f": 0, "t": 143, "d": [57,1926], "a": 1 },
+						{ "px": [216,846], "src": [54,126], "f": 0, "t": 143, "d": [57,2691], "a": 1 },
+						{ "px": [828,846], "src": [54,126], "f": 0, "t": 143, "d": [57,2725], "a": 1 },
+						{ "px": [90,72], "src": [54,18], "f": 0, "t": 23, "d": [56,233], "a": 1 },
+						{ "px": [504,234], "src": [54,18], "f": 0, "t": 23, "d": [56,769], "a": 1 },
+						{ "px": [810,540], "src": [54,18], "f": 0, "t": 23, "d": [56,1755], "a": 1 },
+						{ "px": [216,828], "src": [54,18], "f": 0, "t": 23, "d": [56,2634], "a": 1 },
+						{ "px": [828,828], "src": [54,18], "f": 0, "t": 23, "d": [56,2668], "a": 1 },
+						{ "px": [468,324], "src": [18,18], "f": 0, "t": 21, "d": [55,1052], "a": 1 },
+						{ "px": [432,342], "src": [18,18], "f": 0, "t": 21, "d": [55,1107], "a": 1 },
+						{ "px": [396,360], "src": [18,18], "f": 0, "t": 21, "d": [55,1162], "a": 1 },
+						{ "px": [342,378], "src": [18,18], "f": 0, "t": 21, "d": [55,1216], "a": 1 },
+						{ "px": [90,828], "src": [18,18], "f": 0, "t": 21, "d": [55,2627], "a": 1 },
+						{ "px": [756,828], "src": [18,18], "f": 0, "t": 21, "d": [55,2664], "a": 1 },
+						{ "px": [864,198], "src": [36,0], "f": 0, "t": 2, "d": [54,675], "a": 1 },
+						{ "px": [882,198], "src": [36,0], "f": 0, "t": 2, "d": [54,676], "a": 1 },
+						{ "px": [900,198], "src": [36,0], "f": 0, "t": 2, "d": [54,677], "a": 1 },
+						{ "px": [918,198], "src": [36,0], "f": 0, "t": 2, "d": [54,678], "a": 1 },
+						{ "px": [936,198], "src": [36,0], "f": 0, "t": 2, "d": [54,679], "a": 1 },
+						{ "px": [954,198], "src": [36,0], "f": 0, "t": 2, "d": [54,680], "a": 1 },
+						{ "px": [972,198], "src": [36,0], "f": 0, "t": 2, "d": [54,681], "a": 1 },
+						{ "px": [990,198], "src": [36,0], "f": 0, "t": 2, "d": [54,682], "a": 1 },
+						{ "px": [198,234], "src": [36,0], "f": 0, "t": 2, "d": [54,752], "a": 1 },
+						{ "px": [216,234], "src": [36,0], "f": 0, "t": 2, "d": [54,753], "a": 1 },
+						{ "px": [234,234], "src": [36,0], "f": 0, "t": 2, "d": [54,754], "a": 1 },
+						{ "px": [252,234], "src": [36,0], "f": 0, "t": 2, "d": [54,755], "a": 1 },
+						{ "px": [270,234], "src": [36,0], "f": 0, "t": 2, "d": [54,756], "a": 1 },
+						{ "px": [288,234], "src": [36,0], "f": 0, "t": 2, "d": [54,757], "a": 1 },
+						{ "px": [576,252], "src": [36,0], "f": 0, "t": 2, "d": [54,830], "a": 1 },
+						{ "px": [594,252], "src": [36,0], "f": 0, "t": 2, "d": [54,831], "a": 1 },
+						{ "px": [612,252], "src": [36,0], "f": 0, "t": 2, "d": [54,832], "a": 1 },
+						{ "px": [630,252], "src": [36,0], "f": 0, "t": 2, "d": [54,833], "a": 1 },
+						{ "px": [342,306], "src": [36,0], "f": 0, "t": 2, "d": [54,988], "a": 1 },
+						{ "px": [306,396], "src": [36,0], "f": 0, "t": 2, "d": [54,1271], "a": 1 },
+						{ "px": [324,396], "src": [36,0], "f": 0, "t": 2, "d": [54,1272], "a": 1 },
+						{ "px": [108,504], "src": [36,0], "f": 0, "t": 2, "d": [54,1602], "a": 1 },
+						{ "px": [126,504], "src": [36,0], "f": 0, "t": 2, "d": [54,1603], "a": 1 },
+						{ "px": [144,504], "src": [36,0], "f": 0, "t": 2, "d": [54,1604], "a": 1 },
+						{ "px": [162,504], "src": [36,0], "f": 0, "t": 2, "d": [54,1605], "a": 1 },
+						{ "px": [180,504], "src": [36,0], "f": 0, "t": 2, "d": [54,1606], "a": 1 },
+						{ "px": [558,540], "src": [36,0], "f": 0, "t": 2, "d": [54,1741], "a": 1 },
+						{ "px": [576,540], "src": [36,0], "f": 0, "t": 2, "d": [54,1742], "a": 1 },
+						{ "px": [594,540], "src": [36,0], "f": 0, "t": 2, "d": [54,1743], "a": 1 },
+						{ "px": [612,540], "src": [36,0], "f": 0, "t": 2, "d": [54,1744], "a": 1 },
+						{ "px": [630,702], "src": [36,0], "f": 0, "t": 2, "d": [54,2258], "a": 1 },
+						{ "px": [648,702], "src": [36,0], "f": 0, "t": 2, "d": [54,2259], "a": 1 },
+						{ "px": [702,774], "src": [36,0], "f": 0, "t": 2, "d": [54,2490], "a": 1 },
+						{ "px": [918,882], "src": [36,0], "f": 0, "t": 2, "d": [54,2844], "a": 1 },
+						{ "px": [936,882], "src": [36,0], "f": 0, "t": 2, "d": [54,2845], "a": 1 },
+						{ "px": [306,900], "src": [36,0], "f": 0, "t": 2, "d": [54,2867], "a": 1 },
+						{ "px": [324,900], "src": [36,0], "f": 0, "t": 2, "d": [54,2868], "a": 1 },
+						{ "px": [648,252], "src": [54,0], "f": 0, "t": 3, "d": [53,834], "a": 1 },
+						{ "px": [360,306], "src": [54,0], "f": 0, "t": 3, "d": [53,989], "a": 1 },
+						{ "px": [198,504], "src": [54,0], "f": 0, "t": 3, "d": [53,1607], "a": 1 },
+						{ "px": [666,702], "src": [54,0], "f": 0, "t": 3, "d": [53,2260], "a": 1 },
+						{ "px": [720,774], "src": [54,0], "f": 0, "t": 3, "d": [53,2491], "a": 1 },
+						{ "px": [954,882], "src": [54,0], "f": 0, "t": 3, "d": [53,2846], "a": 1 },
+						{ "px": [342,900], "src": [54,0], "f": 0, "t": 3, "d": [53,2869], "a": 1 },
+						{ "px": [846,198], "src": [18,0], "f": 0, "t": 1, "d": [52,674], "a": 1 },
+						{ "px": [180,234], "src": [18,0], "f": 0, "t": 1, "d": [52,751], "a": 1 },
+						{ "px": [288,396], "src": [18,0], "f": 0, "t": 1, "d": [52,1270], "a": 1 },
+						{ "px": [540,540], "src": [18,0], "f": 0, "t": 1, "d": [52,1740], "a": 1 },
+						{ "px": [612,702], "src": [18,0], "f": 0, "t": 1, "d": [52,2257], "a": 1 },
+						{ "px": [684,774], "src": [18,0], "f": 0, "t": 1, "d": [52,2489], "a": 1 },
+						{ "px": [900,882], "src": [18,0], "f": 0, "t": 1, "d": [52,2843], "a": 1 },
+						{ "px": [288,900], "src": [18,0], "f": 0, "t": 1, "d": [52,2866], "a": 1 },
+						{ "px": [738,144], "src": [252,126], "f": 0, "t": 154, "d": [43,497], "a": 1 },
+						{ "px": [756,144], "src": [252,126], "f": 0, "t": 154, "d": [43,498], "a": 1 },
+						{ "px": [360,540], "src": [252,126], "f": 0, "t": 154, "d": [43,1730], "a": 1 },
+						{ "px": [378,540], "src": [252,126], "f": 0, "t": 154, "d": [43,1731], "a": 1 },
+						{ "px": [396,540], "src": [252,126], "f": 0, "t": 154, "d": [43,1732], "a": 1 },
+						{ "px": [414,540], "src": [252,126], "f": 0, "t": 154, "d": [43,1733], "a": 1 },
+						{ "px": [270,576], "src": [252,126], "f": 0, "t": 154, "d": [43,1839], "a": 1 },
+						{ "px": [180,648], "src": [252,126], "f": 0, "t": 154, "d": [43,2062], "a": 1 },
+						{ "px": [198,648], "src": [252,126], "f": 0, "t": 154, "d": [43,2063], "a": 1 },
+						{ "px": [216,648], "src": [252,126], "f": 0, "t": 154, "d": [43,2064], "a": 1 },
+						{ "px": [900,666], "src": [252,126], "f": 0, "t": 154, "d": [43,2159], "a": 1 },
+						{ "px": [918,666], "src": [252,126], "f": 0, "t": 154, "d": [43,2160], "a": 1 },
+						{ "px": [936,666], "src": [252,126], "f": 0, "t": 154, "d": [43,2161], "a": 1 },
+						{ "px": [324,702], "src": [252,126], "f": 0, "t": 154, "d": [43,2241], "a": 1 },
+						{ "px": [342,702], "src": [252,126], "f": 0, "t": 154, "d": [43,2242], "a": 1 },
+						{ "px": [360,702], "src": [252,126], "f": 0, "t": 154, "d": [43,2243], "a": 1 },
+						{ "px": [774,144], "src": [270,126], "f": 0, "t": 155, "d": [42,499], "a": 1 },
+						{ "px": [432,540], "src": [270,126], "f": 0, "t": 155, "d": [42,1734], "a": 1 },
+						{ "px": [288,576], "src": [270,126], "f": 0, "t": 155, "d": [42,1840], "a": 1 },
+						{ "px": [234,648], "src": [270,126], "f": 0, "t": 155, "d": [42,2065], "a": 1 },
+						{ "px": [954,666], "src": [270,126], "f": 0, "t": 155, "d": [42,2162], "a": 1 },
+						{ "px": [378,702], "src": [270,126], "f": 0, "t": 155, "d": [42,2244], "a": 1 },
+						{ "px": [720,144], "src": [234,126], "f": 0, "t": 153, "d": [41,496], "a": 1 },
+						{ "px": [342,540], "src": [234,126], "f": 0, "t": 153, "d": [41,1729], "a": 1 },
+						{ "px": [252,576], "src": [234,126], "f": 0, "t": 153, "d": [41,1838], "a": 1 },
+						{ "px": [162,648], "src": [234,126], "f": 0, "t": 153, "d": [41,2061], "a": 1 },
+						{ "px": [882,666], "src": [234,126], "f": 0, "t": 153, "d": [41,2158], "a": 1 },
+						{ "px": [306,702], "src": [234,126], "f": 0, "t": 153, "d": [41,2240], "a": 1 },
+						{ "px": [684,198], "src": [288,126], "f": 0, "t": 156, "d": [40,665], "a": 1 },
+						{ "px": [252,414], "src": [288,126], "f": 0, "t": 156, "d": [40,1325], "a": 1 },
+						{ "px": [198,450], "src": [288,126], "f": 0, "t": 156, "d": [40,1436], "a": 1 },
+						{ "px": [252,756], "src": [288,126], "f": 0, "t": 156, "d": [40,2408], "a": 1 },
+						{ "px": [900,90], "src": [324,18], "f": 0, "t": 38, "d": [165,335], "a": 1 },
+						{ "px": [936,90], "src": [324,18], "f": 0, "t": 38, "d": [165,337], "a": 1 },
+						{ "px": [180,144], "src": [324,18], "f": 0, "t": 38, "d": [165,466], "a": 1 },
+						{ "px": [216,144], "src": [324,18], "f": 0, "t": 38, "d": [165,468], "a": 1 },
+						{ "px": [450,702], "src": [324,18], "f": 0, "t": 38, "d": [165,2248], "a": 1 },
+						{ "px": [468,702], "src": [324,18], "f": 0, "t": 38, "d": [165,2249], "a": 1 },
+						{ "px": [486,702], "src": [324,18], "f": 0, "t": 38, "d": [165,2250], "a": 1 },
+						{ "px": [504,702], "src": [324,18], "f": 0, "t": 38, "d": [165,2251], "a": 1 },
+						{ "px": [522,702], "src": [324,18], "f": 0, "t": 38, "d": [165,2252], "a": 1 },
+						{ "px": [540,702], "src": [324,18], "f": 0, "t": 38, "d": [165,2253], "a": 1 },
+						{ "px": [558,702], "src": [324,18], "f": 0, "t": 38, "d": [165,2254], "a": 1 },
+						{ "px": [450,720], "src": [324,18], "f": 0, "t": 38, "d": [165,2305], "a": 1 },
+						{ "px": [468,720], "src": [324,18], "f": 0, "t": 38, "d": [165,2306], "a": 1 },
+						{ "px": [486,720], "src": [324,18], "f": 0, "t": 38, "d": [165,2307], "a": 1 },
+						{ "px": [504,720], "src": [324,18], "f": 0, "t": 38, "d": [165,2308], "a": 1 },
+						{ "px": [522,720], "src": [324,18], "f": 0, "t": 38, "d": [165,2309], "a": 1 },
+						{ "px": [540,720], "src": [324,18], "f": 0, "t": 38, "d": [165,2310], "a": 1 },
+						{ "px": [558,720], "src": [324,18], "f": 0, "t": 38, "d": [165,2311], "a": 1 },
+						{ "px": [450,738], "src": [324,18], "f": 0, "t": 38, "d": [165,2362], "a": 1 },
+						{ "px": [468,738], "src": [324,18], "f": 0, "t": 38, "d": [165,2363], "a": 1 },
+						{ "px": [486,738], "src": [324,18], "f": 0, "t": 38, "d": [165,2364], "a": 1 },
+						{ "px": [504,738], "src": [324,18], "f": 0, "t": 38, "d": [165,2365], "a": 1 },
+						{ "px": [522,738], "src": [324,18], "f": 0, "t": 38, "d": [165,2366], "a": 1 },
+						{ "px": [540,738], "src": [324,18], "f": 0, "t": 38, "d": [165,2367], "a": 1 },
+						{ "px": [558,738], "src": [324,18], "f": 0, "t": 38, "d": [165,2368], "a": 1 },
+						{ "px": [450,756], "src": [324,18], "f": 0, "t": 38, "d": [165,2419], "a": 1 },
+						{ "px": [468,756], "src": [324,18], "f": 0, "t": 38, "d": [165,2420], "a": 1 },
+						{ "px": [486,756], "src": [324,18], "f": 0, "t": 38, "d": [165,2421], "a": 1 },
+						{ "px": [522,756], "src": [324,18], "f": 0, "t": 38, "d": [165,2423], "a": 1 },
+						{ "px": [540,756], "src": [324,18], "f": 0, "t": 38, "d": [165,2424], "a": 1 },
+						{ "px": [558,756], "src": [324,18], "f": 0, "t": 38, "d": [165,2425], "a": 1 },
+						{ "px": [882,90], "src": [306,18], "f": 0, "t": 37, "d": [164,334], "a": 1 },
+						{ "px": [162,144], "src": [306,18], "f": 0, "t": 37, "d": [164,465], "a": 1 },
+						{ "px": [432,702], "src": [306,18], "f": 0, "t": 37, "d": [164,2247], "a": 1 },
+						{ "px": [432,720], "src": [306,18], "f": 0, "t": 37, "d": [164,2304], "a": 1 },
+						{ "px": [432,738], "src": [306,18], "f": 0, "t": 37, "d": [164,2361], "a": 1 },
+						{ "px": [432,756], "src": [306,18], "f": 0, "t": 37, "d": [164,2418], "a": 1 },
+						{ "px": [450,774], "src": [324,36], "f": 0, "t": 58, "d": [163,2476], "a": 1 },
+						{ "px": [468,774], "src": [324,36], "f": 0, "t": 58, "d": [163,2477], "a": 1 },
+						{ "px": [540,774], "src": [324,36], "f": 0, "t": 58, "d": [163,2481], "a": 1 },
+						{ "px": [558,774], "src": [324,36], "f": 0, "t": 58, "d": [163,2482], "a": 1 },
+						{ "px": [954,90], "src": [342,18], "f": 0, "t": 39, "d": [162,338], "a": 1 },
+						{ "px": [234,144], "src": [342,18], "f": 0, "t": 39, "d": [162,469], "a": 1 },
+						{ "px": [576,702], "src": [342,18], "f": 0, "t": 39, "d": [162,2255], "a": 1 },
+						{ "px": [576,720], "src": [342,18], "f": 0, "t": 39, "d": [162,2312], "a": 1 },
+						{ "px": [576,738], "src": [342,18], "f": 0, "t": 39, "d": [162,2369], "a": 1 },
+						{ "px": [576,756], "src": [342,18], "f": 0, "t": 39, "d": [162,2426], "a": 1 },
+						{ "px": [900,72], "src": [324,0], "f": 0, "t": 18, "d": [161,278], "a": 1 },
+						{ "px": [918,72], "src": [324,0], "f": 0, "t": 18, "d": [161,279], "a": 1 },
+						{ "px": [936,72], "src": [324,0], "f": 0, "t": 18, "d": [161,280], "a": 1 },
+						{ "px": [180,126], "src": [324,0], "f": 0, "t": 18, "d": [161,409], "a": 1 },
+						{ "px": [198,126], "src": [324,0], "f": 0, "t": 18, "d": [161,410], "a": 1 },
+						{ "px": [216,126], "src": [324,0], "f": 0, "t": 18, "d": [161,411], "a": 1 },
+						{ "px": [450,684], "src": [324,0], "f": 0, "t": 18, "d": [161,2191], "a": 1 },
+						{ "px": [468,684], "src": [324,0], "f": 0, "t": 18, "d": [161,2192], "a": 1 },
+						{ "px": [486,684], "src": [324,0], "f": 0, "t": 18, "d": [161,2193], "a": 1 },
+						{ "px": [504,684], "src": [324,0], "f": 0, "t": 18, "d": [161,2194], "a": 1 },
+						{ "px": [522,684], "src": [324,0], "f": 0, "t": 18, "d": [161,2195], "a": 1 },
+						{ "px": [540,684], "src": [324,0], "f": 0, "t": 18, "d": [161,2196], "a": 1 },
+						{ "px": [558,684], "src": [324,0], "f": 0, "t": 18, "d": [161,2197], "a": 1 },
+						{ "px": [792,738], "src": [324,0], "f": 0, "t": 18, "d": [161,2381], "a": 1 },
+						{ "px": [882,108], "src": [306,36], "f": 0, "t": 57, "d": [160,391], "a": 1 },
+						{ "px": [162,162], "src": [306,36], "f": 0, "t": 57, "d": [160,522], "a": 1 },
+						{ "px": [774,756], "src": [306,36], "f": 0, "t": 57, "d": [160,2437], "a": 1 },
+						{ "px": [432,774], "src": [306,36], "f": 0, "t": 57, "d": [160,2475], "a": 1 },
+						{ "px": [954,108], "src": [342,36], "f": 0, "t": 59, "d": [159,395], "a": 1 },
+						{ "px": [234,162], "src": [342,36], "f": 0, "t": 59, "d": [159,526], "a": 1 },
+						{ "px": [810,756], "src": [342,36], "f": 0, "t": 59, "d": [159,2439], "a": 1 },
+						{ "px": [576,774], "src": [342,36], "f": 0, "t": 59, "d": [159,2483], "a": 1 },
+						{ "px": [954,72], "src": [342,0], "f": 0, "t": 19, "d": [158,281], "a": 1 },
+						{ "px": [234,126], "src": [342,0], "f": 0, "t": 19, "d": [158,412], "a": 1 },
+						{ "px": [324,162], "src": [342,0], "f": 0, "t": 19, "d": [158,531], "a": 1 },
+						{ "px": [576,684], "src": [342,0], "f": 0, "t": 19, "d": [158,2198], "a": 1 },
+						{ "px": [810,738], "src": [342,0], "f": 0, "t": 19, "d": [158,2382], "a": 1 },
+						{ "px": [882,72], "src": [306,0], "f": 0, "t": 17, "d": [157,277], "a": 1 },
+						{ "px": [162,126], "src": [306,0], "f": 0, "t": 17, "d": [157,408], "a": 1 },
+						{ "px": [288,162], "src": [306,0], "f": 0, "t": 17, "d": [157,529], "a": 1 },
+						{ "px": [432,684], "src": [306,0], "f": 0, "t": 17, "d": [157,2190], "a": 1 },
+						{ "px": [774,738], "src": [306,0], "f": 0, "t": 17, "d": [157,2380], "a": 1 },
+						{ "px": [738,342], "src": [324,54], "f": 0, "t": 78, "d": [153,1124], "a": 1 },
+						{ "px": [756,342], "src": [324,54], "f": 0, "t": 78, "d": [153,1125], "a": 1 },
+						{ "px": [774,342], "src": [324,54], "f": 0, "t": 78, "d": [153,1126], "a": 1 },
+						{ "px": [864,450], "src": [324,54], "f": 0, "t": 78, "d": [153,1473], "a": 1 },
+						{ "px": [882,450], "src": [324,54], "f": 0, "t": 78, "d": [153,1474], "a": 1 },
+						{ "px": [900,450], "src": [324,54], "f": 0, "t": 78, "d": [153,1475], "a": 1 },
+						{ "px": [918,450], "src": [324,54], "f": 0, "t": 78, "d": [153,1476], "a": 1 },
+						{ "px": [792,342], "src": [342,54], "f": 0, "t": 79, "d": [152,1127], "a": 1 },
+						{ "px": [936,450], "src": [342,54], "f": 0, "t": 79, "d": [152,1477], "a": 1 },
+						{ "px": [720,342], "src": [306,54], "f": 0, "t": 77, "d": [151,1123], "a": 1 },
+						{ "px": [846,450], "src": [306,54], "f": 0, "t": 77, "d": [151,1472], "a": 1 },
+						{ "px": [684,288], "src": [288,0], "f": 0, "t": 16, "d": [150,950], "a": 1 },
+						{ "px": [846,378], "src": [288,0], "f": 0, "t": 16, "d": [150,1244], "a": 1 },
+						{ "px": [774,486], "src": [288,0], "f": 0, "t": 16, "d": [150,1582], "a": 1 },
+						{ "px": [918,180], "src": [306,108], "f": 0, "t": 137, "d": [175,621], "a": 1 },
+						{ "px": [198,216], "src": [306,108], "f": 0, "t": 137, "d": [175,695], "a": 1 },
+						{ "px": [306,216], "src": [306,108], "f": 0, "t": 137, "d": [175,701], "a": 1 },
+						{ "px": [792,810], "src": [306,108], "f": 0, "t": 137, "d": [175,2609], "a": 1 },
+						{ "px": [504,936], "src": [306,108], "f": 0, "t": 137, "d": [175,2992], "a": 1 },
+						{ "px": [918,126], "src": [288,72], "f": 0, "t": 96, "d": [166,450], "a": 1 },
+						{ "px": [918,144], "src": [288,90], "f": 0, "t": 116, "d": [166,507], "a": 1 },
+						{ "px": [918,162], "src": [288,90], "f": 0, "t": 116, "d": [166,564], "a": 1 },
+						{ "px": [198,180], "src": [288,72], "f": 0, "t": 96, "d": [166,581], "a": 1 },
+						{ "px": [198,198], "src": [288,90], "f": 0, "t": 116, "d": [166,638], "a": 1 },
+						{ "px": [306,198], "src": [288,90], "f": 0, "t": 116, "d": [166,644], "a": 1 },
+						{ "px": [792,774], "src": [288,90], "f": 0, "t": 116, "d": [166,2495], "a": 1 },
+						{ "px": [504,792], "src": [288,90], "f": 0, "t": 116, "d": [166,2536], "a": 1 },
+						{ "px": [792,792], "src": [288,72], "f": 0, "t": 96, "d": [166,2552], "a": 1 },
+						{ "px": [504,810], "src": [288,72], "f": 0, "t": 96, "d": [166,2593], "a": 1 },
+						{ "px": [504,828], "src": [288,72], "f": 0, "t": 96, "d": [166,2650], "a": 1 },
+						{ "px": [504,846], "src": [288,90], "f": 0, "t": 116, "d": [166,2707], "a": 1 },
+						{ "px": [504,864], "src": [288,72], "f": 0, "t": 96, "d": [166,2764], "a": 1 },
+						{ "px": [504,882], "src": [288,72], "f": 0, "t": 96, "d": [166,2821], "a": 1 },
+						{ "px": [504,900], "src": [288,72], "f": 0, "t": 96, "d": [166,2878], "a": 1 },
+						{ "px": [504,918], "src": [288,72], "f": 0, "t": 96, "d": [166,2935], "a": 1 },
+						{ "px": [918,108], "src": [306,72], "f": 0, "t": 97, "d": [117,393], "a": 1 },
+						{ "px": [198,162], "src": [306,72], "f": 0, "t": 97, "d": [117,524], "a": 1 },
+						{ "px": [306,180], "src": [306,72], "f": 0, "t": 97, "d": [117,587], "a": 1 },
+						{ "px": [504,774], "src": [306,72], "f": 0, "t": 97, "d": [117,2479], "a": 1 },
+						{ "px": [306,162], "src": [324,0], "f": 0, "t": 18, "d": [174,530], "a": 1 },
+						{ "px": [918,90], "src": [324,18], "f": 0, "t": 38, "d": [173,336], "a": 1 },
+						{ "px": [198,144], "src": [324,18], "f": 0, "t": 38, "d": [173,467], "a": 1 },
+						{ "px": [504,756], "src": [324,18], "f": 0, "t": 38, "d": [173,2422], "a": 1 },
+						{ "px": [792,756], "src": [324,18], "f": 0, "t": 38, "d": [173,2438], "a": 1 },
+						{ "px": [324,180], "src": [342,36], "f": 0, "t": 59, "d": [171,588], "a": 1 },
+						{ "px": [936,108], "src": [324,36], "f": 0, "t": 58, "d": [170,394], "a": 1 },
+						{ "px": [216,162], "src": [324,36], "f": 0, "t": 58, "d": [170,525], "a": 1 },
+						{ "px": [522,774], "src": [324,36], "f": 0, "t": 58, "d": [170,2480], "a": 1 },
+						{ "px": [288,180], "src": [306,36], "f": 0, "t": 57, "d": [172,586], "a": 1 },
+						{ "px": [900,108], "src": [324,36], "f": 0, "t": 58, "d": [167,392], "a": 1 },
+						{ "px": [180,162], "src": [324,36], "f": 0, "t": 58, "d": [167,523], "a": 1 },
+						{ "px": [486,774], "src": [324,36], "f": 0, "t": 58, "d": [167,2478], "a": 1 }
+					],
+					"seed": 2107805,
+					"overrideTilesetUid": null,
+					"gridTiles": [],
+					"entityInstances": []
+				},
+				{
+					"__identifier": "Background",
+					"__type": "Tiles",
+					"__cWid": 43,
+					"__cHei": 43,
+					"__gridSize": 24,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": 2,
+					"__tilesetRelPath": "../pixel_platformer/backgrounds.png",
+					"iid": "1196c220-d380-11f0-8c50-6362bd330b3b",
+					"levelId": 0,
+					"layerDefUid": 180,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [],
+					"autoLayerTiles": [],
+					"seed": 4198490,
+					"overrideTilesetUid": null,
+					"gridTiles": [
+						{ "px": [0,0], "src": [0,0], "f": 0, "t": 0, "d": [0], "a": 1 },
+						{ "px": [24,0], "src": [24,0], "f": 0, "t": 1, "d": [1], "a": 1 },
+						{ "px": [48,0], "src": [48,0], "f": 0, "t": 2, "d": [2], "a": 1 },
+						{ "px": [72,0], "src": [72,0], "f": 0, "t": 3, "d": [3], "a": 1 },
+						{ "px": [96,0], "src": [0,0], "f": 0, "t": 0, "d": [4], "a": 1 },
+						{ "px": [120,0], "src": [24,0], "f": 0, "t": 1, "d": [5], "a": 1 },
+						{ "px": [144,0], "src": [48,0], "f": 0, "t": 2, "d": [6], "a": 1 },
+						{ "px": [168,0], "src": [72,0], "f": 0, "t": 3, "d": [7], "a": 1 },
+						{ "px": [192,0], "src": [0,0], "f": 0, "t": 0, "d": [8], "a": 1 },
+						{ "px": [216,0], "src": [24,0], "f": 0, "t": 1, "d": [9], "a": 1 },
+						{ "px": [240,0], "src": [48,0], "f": 0, "t": 2, "d": [10], "a": 1 },
+						{ "px": [264,0], "src": [72,0], "f": 0, "t": 3, "d": [11], "a": 1 },
+						{ "px": [288,0], "src": [0,0], "f": 0, "t": 0, "d": [12], "a": 1 },
+						{ "px": [312,0], "src": [24,0], "f": 0, "t": 1, "d": [13], "a": 1 },
+						{ "px": [336,0], "src": [48,0], "f": 0, "t": 2, "d": [14], "a": 1 },
+						{ "px": [360,0], "src": [72,0], "f": 0, "t": 3, "d": [15], "a": 1 },
+						{ "px": [384,0], "src": [0,0], "f": 0, "t": 0, "d": [16], "a": 1 },
+						{ "px": [408,0], "src": [24,0], "f": 0, "t": 1, "d": [17], "a": 1 },
+						{ "px": [432,0], "src": [48,0], "f": 0, "t": 2, "d": [18], "a": 1 },
+						{ "px": [456,0], "src": [72,0], "f": 0, "t": 3, "d": [19], "a": 1 },
+						{ "px": [480,0], "src": [0,0], "f": 0, "t": 0, "d": [20], "a": 1 },
+						{ "px": [504,0], "src": [24,0], "f": 0, "t": 1, "d": [21], "a": 1 },
+						{ "px": [528,0], "src": [48,0], "f": 0, "t": 2, "d": [22], "a": 1 },
+						{ "px": [552,0], "src": [72,0], "f": 0, "t": 3, "d": [23], "a": 1 },
+						{ "px": [576,0], "src": [0,0], "f": 0, "t": 0, "d": [24], "a": 1 },
+						{ "px": [600,0], "src": [24,0], "f": 0, "t": 1, "d": [25], "a": 1 },
+						{ "px": [624,0], "src": [48,0], "f": 0, "t": 2, "d": [26], "a": 1 },
+						{ "px": [648,0], "src": [72,0], "f": 0, "t": 3, "d": [27], "a": 1 },
+						{ "px": [672,0], "src": [0,0], "f": 0, "t": 0, "d": [28], "a": 1 },
+						{ "px": [696,0], "src": [24,0], "f": 0, "t": 1, "d": [29], "a": 1 },
+						{ "px": [720,0], "src": [48,0], "f": 0, "t": 2, "d": [30], "a": 1 },
+						{ "px": [744,0], "src": [72,0], "f": 0, "t": 3, "d": [31], "a": 1 },
+						{ "px": [768,0], "src": [0,0], "f": 0, "t": 0, "d": [32], "a": 1 },
+						{ "px": [792,0], "src": [24,0], "f": 0, "t": 1, "d": [33], "a": 1 },
+						{ "px": [816,0], "src": [48,0], "f": 0, "t": 2, "d": [34], "a": 1 },
+						{ "px": [840,0], "src": [72,0], "f": 0, "t": 3, "d": [35], "a": 1 },
+						{ "px": [864,0], "src": [0,0], "f": 0, "t": 0, "d": [36], "a": 1 },
+						{ "px": [888,0], "src": [24,0], "f": 0, "t": 1, "d": [37], "a": 1 },
+						{ "px": [912,0], "src": [48,0], "f": 0, "t": 2, "d": [38], "a": 1 },
+						{ "px": [936,0], "src": [72,0], "f": 0, "t": 3, "d": [39], "a": 1 },
+						{ "px": [960,0], "src": [0,0], "f": 0, "t": 0, "d": [40], "a": 1 },
+						{ "px": [984,0], "src": [24,0], "f": 0, "t": 1, "d": [41], "a": 1 },
+						{ "px": [1008,0], "src": [48,0], "f": 0, "t": 2, "d": [42], "a": 1 },
+						{ "px": [0,24], "src": [0,0], "f": 0, "t": 0, "d": [43], "a": 1 },
+						{ "px": [24,24], "src": [24,0], "f": 0, "t": 1, "d": [44], "a": 1 },
+						{ "px": [48,24], "src": [48,0], "f": 0, "t": 2, "d": [45], "a": 1 },
+						{ "px": [72,24], "src": [72,0], "f": 0, "t": 3, "d": [46], "a": 1 },
+						{ "px": [96,24], "src": [0,0], "f": 0, "t": 0, "d": [47], "a": 1 },
+						{ "px": [120,24], "src": [24,0], "f": 0, "t": 1, "d": [48], "a": 1 },
+						{ "px": [144,24], "src": [48,0], "f": 0, "t": 2, "d": [49], "a": 1 },
+						{ "px": [168,24], "src": [72,0], "f": 0, "t": 3, "d": [50], "a": 1 },
+						{ "px": [192,24], "src": [0,0], "f": 0, "t": 0, "d": [51], "a": 1 },
+						{ "px": [216,24], "src": [24,0], "f": 0, "t": 1, "d": [52], "a": 1 },
+						{ "px": [240,24], "src": [48,0], "f": 0, "t": 2, "d": [53], "a": 1 },
+						{ "px": [264,24], "src": [72,0], "f": 0, "t": 3, "d": [54], "a": 1 },
+						{ "px": [288,24], "src": [0,0], "f": 0, "t": 0, "d": [55], "a": 1 },
+						{ "px": [312,24], "src": [24,0], "f": 0, "t": 1, "d": [56], "a": 1 },
+						{ "px": [336,24], "src": [48,0], "f": 0, "t": 2, "d": [57], "a": 1 },
+						{ "px": [360,24], "src": [72,0], "f": 0, "t": 3, "d": [58], "a": 1 },
+						{ "px": [384,24], "src": [0,0], "f": 0, "t": 0, "d": [59], "a": 1 },
+						{ "px": [408,24], "src": [24,0], "f": 0, "t": 1, "d": [60], "a": 1 },
+						{ "px": [432,24], "src": [48,0], "f": 0, "t": 2, "d": [61], "a": 1 },
+						{ "px": [456,24], "src": [72,0], "f": 0, "t": 3, "d": [62], "a": 1 },
+						{ "px": [480,24], "src": [0,0], "f": 0, "t": 0, "d": [63], "a": 1 },
+						{ "px": [504,24], "src": [24,0], "f": 0, "t": 1, "d": [64], "a": 1 },
+						{ "px": [528,24], "src": [48,0], "f": 0, "t": 2, "d": [65], "a": 1 },
+						{ "px": [552,24], "src": [72,0], "f": 0, "t": 3, "d": [66], "a": 1 },
+						{ "px": [576,24], "src": [0,0], "f": 0, "t": 0, "d": [67], "a": 1 },
+						{ "px": [600,24], "src": [24,0], "f": 0, "t": 1, "d": [68], "a": 1 },
+						{ "px": [624,24], "src": [48,0], "f": 0, "t": 2, "d": [69], "a": 1 },
+						{ "px": [648,24], "src": [72,0], "f": 0, "t": 3, "d": [70], "a": 1 },
+						{ "px": [672,24], "src": [0,0], "f": 0, "t": 0, "d": [71], "a": 1 },
+						{ "px": [696,24], "src": [24,0], "f": 0, "t": 1, "d": [72], "a": 1 },
+						{ "px": [720,24], "src": [48,0], "f": 0, "t": 2, "d": [73], "a": 1 },
+						{ "px": [744,24], "src": [72,0], "f": 0, "t": 3, "d": [74], "a": 1 },
+						{ "px": [768,24], "src": [0,0], "f": 0, "t": 0, "d": [75], "a": 1 },
+						{ "px": [792,24], "src": [24,0], "f": 0, "t": 1, "d": [76], "a": 1 },
+						{ "px": [816,24], "src": [48,0], "f": 0, "t": 2, "d": [77], "a": 1 },
+						{ "px": [840,24], "src": [72,0], "f": 0, "t": 3, "d": [78], "a": 1 },
+						{ "px": [864,24], "src": [0,0], "f": 0, "t": 0, "d": [79], "a": 1 },
+						{ "px": [888,24], "src": [24,0], "f": 0, "t": 1, "d": [80], "a": 1 },
+						{ "px": [912,24], "src": [48,0], "f": 0, "t": 2, "d": [81], "a": 1 },
+						{ "px": [936,24], "src": [72,0], "f": 0, "t": 3, "d": [82], "a": 1 },
+						{ "px": [960,24], "src": [0,0], "f": 0, "t": 0, "d": [83], "a": 1 },
+						{ "px": [984,24], "src": [24,0], "f": 0, "t": 1, "d": [84], "a": 1 },
+						{ "px": [1008,24], "src": [48,0], "f": 0, "t": 2, "d": [85], "a": 1 },
+						{ "px": [0,48], "src": [0,0], "f": 0, "t": 0, "d": [86], "a": 1 },
+						{ "px": [24,48], "src": [24,0], "f": 0, "t": 1, "d": [87], "a": 1 },
+						{ "px": [48,48], "src": [48,0], "f": 0, "t": 2, "d": [88], "a": 1 },
+						{ "px": [72,48], "src": [72,0], "f": 0, "t": 3, "d": [89], "a": 1 },
+						{ "px": [96,48], "src": [0,0], "f": 0, "t": 0, "d": [90], "a": 1 },
+						{ "px": [120,48], "src": [24,0], "f": 0, "t": 1, "d": [91], "a": 1 },
+						{ "px": [144,48], "src": [48,0], "f": 0, "t": 2, "d": [92], "a": 1 },
+						{ "px": [168,48], "src": [72,0], "f": 0, "t": 3, "d": [93], "a": 1 },
+						{ "px": [192,48], "src": [0,0], "f": 0, "t": 0, "d": [94], "a": 1 },
+						{ "px": [216,48], "src": [24,0], "f": 0, "t": 1, "d": [95], "a": 1 },
+						{ "px": [240,48], "src": [48,0], "f": 0, "t": 2, "d": [96], "a": 1 },
+						{ "px": [264,48], "src": [72,0], "f": 0, "t": 3, "d": [97], "a": 1 },
+						{ "px": [288,48], "src": [0,0], "f": 0, "t": 0, "d": [98], "a": 1 },
+						{ "px": [312,48], "src": [24,0], "f": 0, "t": 1, "d": [99], "a": 1 },
+						{ "px": [336,48], "src": [48,0], "f": 0, "t": 2, "d": [100], "a": 1 },
+						{ "px": [360,48], "src": [72,0], "f": 0, "t": 3, "d": [101], "a": 1 },
+						{ "px": [384,48], "src": [0,0], "f": 0, "t": 0, "d": [102], "a": 1 },
+						{ "px": [408,48], "src": [24,0], "f": 0, "t": 1, "d": [103], "a": 1 },
+						{ "px": [432,48], "src": [48,0], "f": 0, "t": 2, "d": [104], "a": 1 },
+						{ "px": [456,48], "src": [72,0], "f": 0, "t": 3, "d": [105], "a": 1 },
+						{ "px": [480,48], "src": [0,0], "f": 0, "t": 0, "d": [106], "a": 1 },
+						{ "px": [504,48], "src": [24,0], "f": 0, "t": 1, "d": [107], "a": 1 },
+						{ "px": [528,48], "src": [48,0], "f": 0, "t": 2, "d": [108], "a": 1 },
+						{ "px": [552,48], "src": [72,0], "f": 0, "t": 3, "d": [109], "a": 1 },
+						{ "px": [576,48], "src": [0,0], "f": 0, "t": 0, "d": [110], "a": 1 },
+						{ "px": [600,48], "src": [24,0], "f": 0, "t": 1, "d": [111], "a": 1 },
+						{ "px": [624,48], "src": [48,0], "f": 0, "t": 2, "d": [112], "a": 1 },
+						{ "px": [648,48], "src": [72,0], "f": 0, "t": 3, "d": [113], "a": 1 },
+						{ "px": [672,48], "src": [0,0], "f": 0, "t": 0, "d": [114], "a": 1 },
+						{ "px": [696,48], "src": [24,0], "f": 0, "t": 1, "d": [115], "a": 1 },
+						{ "px": [720,48], "src": [48,0], "f": 0, "t": 2, "d": [116], "a": 1 },
+						{ "px": [744,48], "src": [72,0], "f": 0, "t": 3, "d": [117], "a": 1 },
+						{ "px": [768,48], "src": [0,0], "f": 0, "t": 0, "d": [118], "a": 1 },
+						{ "px": [792,48], "src": [24,0], "f": 0, "t": 1, "d": [119], "a": 1 },
+						{ "px": [816,48], "src": [48,0], "f": 0, "t": 2, "d": [120], "a": 1 },
+						{ "px": [840,48], "src": [72,0], "f": 0, "t": 3, "d": [121], "a": 1 },
+						{ "px": [864,48], "src": [0,0], "f": 0, "t": 0, "d": [122], "a": 1 },
+						{ "px": [888,48], "src": [24,0], "f": 0, "t": 1, "d": [123], "a": 1 },
+						{ "px": [912,48], "src": [48,0], "f": 0, "t": 2, "d": [124], "a": 1 },
+						{ "px": [936,48], "src": [72,0], "f": 0, "t": 3, "d": [125], "a": 1 },
+						{ "px": [960,48], "src": [0,0], "f": 0, "t": 0, "d": [126], "a": 1 },
+						{ "px": [984,48], "src": [24,0], "f": 0, "t": 1, "d": [127], "a": 1 },
+						{ "px": [1008,48], "src": [48,0], "f": 0, "t": 2, "d": [128], "a": 1 },
+						{ "px": [0,72], "src": [0,0], "f": 0, "t": 0, "d": [129], "a": 1 },
+						{ "px": [24,72], "src": [24,0], "f": 0, "t": 1, "d": [130], "a": 1 },
+						{ "px": [48,72], "src": [48,0], "f": 0, "t": 2, "d": [131], "a": 1 },
+						{ "px": [72,72], "src": [72,0], "f": 0, "t": 3, "d": [132], "a": 1 },
+						{ "px": [96,72], "src": [0,0], "f": 0, "t": 0, "d": [133], "a": 1 },
+						{ "px": [120,72], "src": [24,0], "f": 0, "t": 1, "d": [134], "a": 1 },
+						{ "px": [144,72], "src": [48,0], "f": 0, "t": 2, "d": [135], "a": 1 },
+						{ "px": [168,72], "src": [72,0], "f": 0, "t": 3, "d": [136], "a": 1 },
+						{ "px": [192,72], "src": [0,0], "f": 0, "t": 0, "d": [137], "a": 1 },
+						{ "px": [216,72], "src": [24,0], "f": 0, "t": 1, "d": [138], "a": 1 },
+						{ "px": [240,72], "src": [48,0], "f": 0, "t": 2, "d": [139], "a": 1 },
+						{ "px": [264,72], "src": [72,0], "f": 0, "t": 3, "d": [140], "a": 1 },
+						{ "px": [288,72], "src": [0,0], "f": 0, "t": 0, "d": [141], "a": 1 },
+						{ "px": [312,72], "src": [24,0], "f": 0, "t": 1, "d": [142], "a": 1 },
+						{ "px": [336,72], "src": [48,0], "f": 0, "t": 2, "d": [143], "a": 1 },
+						{ "px": [360,72], "src": [72,0], "f": 0, "t": 3, "d": [144], "a": 1 },
+						{ "px": [384,72], "src": [0,0], "f": 0, "t": 0, "d": [145], "a": 1 },
+						{ "px": [408,72], "src": [24,0], "f": 0, "t": 1, "d": [146], "a": 1 },
+						{ "px": [432,72], "src": [48,0], "f": 0, "t": 2, "d": [147], "a": 1 },
+						{ "px": [456,72], "src": [72,0], "f": 0, "t": 3, "d": [148], "a": 1 },
+						{ "px": [480,72], "src": [0,0], "f": 0, "t": 0, "d": [149], "a": 1 },
+						{ "px": [504,72], "src": [24,0], "f": 0, "t": 1, "d": [150], "a": 1 },
+						{ "px": [528,72], "src": [48,0], "f": 0, "t": 2, "d": [151], "a": 1 },
+						{ "px": [552,72], "src": [72,0], "f": 0, "t": 3, "d": [152], "a": 1 },
+						{ "px": [576,72], "src": [0,0], "f": 0, "t": 0, "d": [153], "a": 1 },
+						{ "px": [600,72], "src": [24,0], "f": 0, "t": 1, "d": [154], "a": 1 },
+						{ "px": [624,72], "src": [48,0], "f": 0, "t": 2, "d": [155], "a": 1 },
+						{ "px": [648,72], "src": [72,0], "f": 0, "t": 3, "d": [156], "a": 1 },
+						{ "px": [672,72], "src": [0,0], "f": 0, "t": 0, "d": [157], "a": 1 },
+						{ "px": [696,72], "src": [24,0], "f": 0, "t": 1, "d": [158], "a": 1 },
+						{ "px": [720,72], "src": [48,0], "f": 0, "t": 2, "d": [159], "a": 1 },
+						{ "px": [744,72], "src": [72,0], "f": 0, "t": 3, "d": [160], "a": 1 },
+						{ "px": [768,72], "src": [0,0], "f": 0, "t": 0, "d": [161], "a": 1 },
+						{ "px": [792,72], "src": [24,0], "f": 0, "t": 1, "d": [162], "a": 1 },
+						{ "px": [816,72], "src": [48,0], "f": 0, "t": 2, "d": [163], "a": 1 },
+						{ "px": [840,72], "src": [72,0], "f": 0, "t": 3, "d": [164], "a": 1 },
+						{ "px": [864,72], "src": [0,0], "f": 0, "t": 0, "d": [165], "a": 1 },
+						{ "px": [888,72], "src": [24,0], "f": 0, "t": 1, "d": [166], "a": 1 },
+						{ "px": [912,72], "src": [48,0], "f": 0, "t": 2, "d": [167], "a": 1 },
+						{ "px": [936,72], "src": [72,0], "f": 0, "t": 3, "d": [168], "a": 1 },
+						{ "px": [960,72], "src": [0,0], "f": 0, "t": 0, "d": [169], "a": 1 },
+						{ "px": [984,72], "src": [24,0], "f": 0, "t": 1, "d": [170], "a": 1 },
+						{ "px": [1008,72], "src": [48,0], "f": 0, "t": 2, "d": [171], "a": 1 },
+						{ "px": [0,96], "src": [0,0], "f": 0, "t": 0, "d": [172], "a": 1 },
+						{ "px": [24,96], "src": [24,0], "f": 0, "t": 1, "d": [173], "a": 1 },
+						{ "px": [48,96], "src": [48,0], "f": 0, "t": 2, "d": [174], "a": 1 },
+						{ "px": [72,96], "src": [72,0], "f": 0, "t": 3, "d": [175], "a": 1 },
+						{ "px": [96,96], "src": [0,0], "f": 0, "t": 0, "d": [176], "a": 1 },
+						{ "px": [120,96], "src": [24,0], "f": 0, "t": 1, "d": [177], "a": 1 },
+						{ "px": [144,96], "src": [48,0], "f": 0, "t": 2, "d": [178], "a": 1 },
+						{ "px": [168,96], "src": [72,0], "f": 0, "t": 3, "d": [179], "a": 1 },
+						{ "px": [192,96], "src": [0,0], "f": 0, "t": 0, "d": [180], "a": 1 },
+						{ "px": [216,96], "src": [24,0], "f": 0, "t": 1, "d": [181], "a": 1 },
+						{ "px": [240,96], "src": [48,0], "f": 0, "t": 2, "d": [182], "a": 1 },
+						{ "px": [264,96], "src": [72,0], "f": 0, "t": 3, "d": [183], "a": 1 },
+						{ "px": [288,96], "src": [0,0], "f": 0, "t": 0, "d": [184], "a": 1 },
+						{ "px": [312,96], "src": [24,0], "f": 0, "t": 1, "d": [185], "a": 1 },
+						{ "px": [336,96], "src": [48,0], "f": 0, "t": 2, "d": [186], "a": 1 },
+						{ "px": [360,96], "src": [72,0], "f": 0, "t": 3, "d": [187], "a": 1 },
+						{ "px": [384,96], "src": [0,0], "f": 0, "t": 0, "d": [188], "a": 1 },
+						{ "px": [408,96], "src": [24,0], "f": 0, "t": 1, "d": [189], "a": 1 },
+						{ "px": [432,96], "src": [48,0], "f": 0, "t": 2, "d": [190], "a": 1 },
+						{ "px": [456,96], "src": [72,0], "f": 0, "t": 3, "d": [191], "a": 1 },
+						{ "px": [480,96], "src": [0,0], "f": 0, "t": 0, "d": [192], "a": 1 },
+						{ "px": [504,96], "src": [24,0], "f": 0, "t": 1, "d": [193], "a": 1 },
+						{ "px": [528,96], "src": [48,0], "f": 0, "t": 2, "d": [194], "a": 1 },
+						{ "px": [552,96], "src": [72,0], "f": 0, "t": 3, "d": [195], "a": 1 },
+						{ "px": [576,96], "src": [0,0], "f": 0, "t": 0, "d": [196], "a": 1 },
+						{ "px": [600,96], "src": [24,0], "f": 0, "t": 1, "d": [197], "a": 1 },
+						{ "px": [624,96], "src": [48,0], "f": 0, "t": 2, "d": [198], "a": 1 },
+						{ "px": [648,96], "src": [72,0], "f": 0, "t": 3, "d": [199], "a": 1 },
+						{ "px": [672,96], "src": [0,0], "f": 0, "t": 0, "d": [200], "a": 1 },
+						{ "px": [696,96], "src": [24,0], "f": 0, "t": 1, "d": [201], "a": 1 },
+						{ "px": [720,96], "src": [48,0], "f": 0, "t": 2, "d": [202], "a": 1 },
+						{ "px": [744,96], "src": [72,0], "f": 0, "t": 3, "d": [203], "a": 1 },
+						{ "px": [768,96], "src": [0,0], "f": 0, "t": 0, "d": [204], "a": 1 },
+						{ "px": [792,96], "src": [24,0], "f": 0, "t": 1, "d": [205], "a": 1 },
+						{ "px": [816,96], "src": [48,0], "f": 0, "t": 2, "d": [206], "a": 1 },
+						{ "px": [840,96], "src": [72,0], "f": 0, "t": 3, "d": [207], "a": 1 },
+						{ "px": [864,96], "src": [0,0], "f": 0, "t": 0, "d": [208], "a": 1 },
+						{ "px": [888,96], "src": [24,0], "f": 0, "t": 1, "d": [209], "a": 1 },
+						{ "px": [912,96], "src": [48,0], "f": 0, "t": 2, "d": [210], "a": 1 },
+						{ "px": [936,96], "src": [72,0], "f": 0, "t": 3, "d": [211], "a": 1 },
+						{ "px": [960,96], "src": [0,0], "f": 0, "t": 0, "d": [212], "a": 1 },
+						{ "px": [984,96], "src": [24,0], "f": 0, "t": 1, "d": [213], "a": 1 },
+						{ "px": [1008,96], "src": [48,0], "f": 0, "t": 2, "d": [214], "a": 1 },
+						{ "px": [0,120], "src": [0,0], "f": 0, "t": 0, "d": [215], "a": 1 },
+						{ "px": [24,120], "src": [24,0], "f": 0, "t": 1, "d": [216], "a": 1 },
+						{ "px": [48,120], "src": [48,0], "f": 0, "t": 2, "d": [217], "a": 1 },
+						{ "px": [72,120], "src": [72,0], "f": 0, "t": 3, "d": [218], "a": 1 },
+						{ "px": [96,120], "src": [0,0], "f": 0, "t": 0, "d": [219], "a": 1 },
+						{ "px": [120,120], "src": [24,0], "f": 0, "t": 1, "d": [220], "a": 1 },
+						{ "px": [144,120], "src": [48,0], "f": 0, "t": 2, "d": [221], "a": 1 },
+						{ "px": [168,120], "src": [72,0], "f": 0, "t": 3, "d": [222], "a": 1 },
+						{ "px": [192,120], "src": [0,0], "f": 0, "t": 0, "d": [223], "a": 1 },
+						{ "px": [216,120], "src": [24,0], "f": 0, "t": 1, "d": [224], "a": 1 },
+						{ "px": [240,120], "src": [48,0], "f": 0, "t": 2, "d": [225], "a": 1 },
+						{ "px": [264,120], "src": [72,0], "f": 0, "t": 3, "d": [226], "a": 1 },
+						{ "px": [288,120], "src": [0,0], "f": 0, "t": 0, "d": [227], "a": 1 },
+						{ "px": [312,120], "src": [24,0], "f": 0, "t": 1, "d": [228], "a": 1 },
+						{ "px": [336,120], "src": [48,0], "f": 0, "t": 2, "d": [229], "a": 1 },
+						{ "px": [360,120], "src": [72,0], "f": 0, "t": 3, "d": [230], "a": 1 },
+						{ "px": [384,120], "src": [0,0], "f": 0, "t": 0, "d": [231], "a": 1 },
+						{ "px": [408,120], "src": [24,0], "f": 0, "t": 1, "d": [232], "a": 1 },
+						{ "px": [432,120], "src": [48,0], "f": 0, "t": 2, "d": [233], "a": 1 },
+						{ "px": [456,120], "src": [72,0], "f": 0, "t": 3, "d": [234], "a": 1 },
+						{ "px": [480,120], "src": [0,0], "f": 0, "t": 0, "d": [235], "a": 1 },
+						{ "px": [504,120], "src": [24,0], "f": 0, "t": 1, "d": [236], "a": 1 },
+						{ "px": [528,120], "src": [48,0], "f": 0, "t": 2, "d": [237], "a": 1 },
+						{ "px": [552,120], "src": [72,0], "f": 0, "t": 3, "d": [238], "a": 1 },
+						{ "px": [576,120], "src": [0,0], "f": 0, "t": 0, "d": [239], "a": 1 },
+						{ "px": [600,120], "src": [24,0], "f": 0, "t": 1, "d": [240], "a": 1 },
+						{ "px": [624,120], "src": [48,0], "f": 0, "t": 2, "d": [241], "a": 1 },
+						{ "px": [648,120], "src": [72,0], "f": 0, "t": 3, "d": [242], "a": 1 },
+						{ "px": [672,120], "src": [0,0], "f": 0, "t": 0, "d": [243], "a": 1 },
+						{ "px": [696,120], "src": [24,0], "f": 0, "t": 1, "d": [244], "a": 1 },
+						{ "px": [720,120], "src": [48,0], "f": 0, "t": 2, "d": [245], "a": 1 },
+						{ "px": [744,120], "src": [72,0], "f": 0, "t": 3, "d": [246], "a": 1 },
+						{ "px": [768,120], "src": [0,0], "f": 0, "t": 0, "d": [247], "a": 1 },
+						{ "px": [792,120], "src": [24,0], "f": 0, "t": 1, "d": [248], "a": 1 },
+						{ "px": [816,120], "src": [48,0], "f": 0, "t": 2, "d": [249], "a": 1 },
+						{ "px": [840,120], "src": [72,0], "f": 0, "t": 3, "d": [250], "a": 1 },
+						{ "px": [864,120], "src": [0,0], "f": 0, "t": 0, "d": [251], "a": 1 },
+						{ "px": [888,120], "src": [24,0], "f": 0, "t": 1, "d": [252], "a": 1 },
+						{ "px": [912,120], "src": [48,0], "f": 0, "t": 2, "d": [253], "a": 1 },
+						{ "px": [936,120], "src": [72,0], "f": 0, "t": 3, "d": [254], "a": 1 },
+						{ "px": [960,120], "src": [0,0], "f": 0, "t": 0, "d": [255], "a": 1 },
+						{ "px": [984,120], "src": [24,0], "f": 0, "t": 1, "d": [256], "a": 1 },
+						{ "px": [1008,120], "src": [48,0], "f": 0, "t": 2, "d": [257], "a": 1 },
+						{ "px": [0,144], "src": [0,0], "f": 0, "t": 0, "d": [258], "a": 1 },
+						{ "px": [24,144], "src": [24,0], "f": 0, "t": 1, "d": [259], "a": 1 },
+						{ "px": [48,144], "src": [48,0], "f": 0, "t": 2, "d": [260], "a": 1 },
+						{ "px": [72,144], "src": [72,0], "f": 0, "t": 3, "d": [261], "a": 1 },
+						{ "px": [96,144], "src": [0,0], "f": 0, "t": 0, "d": [262], "a": 1 },
+						{ "px": [120,144], "src": [24,0], "f": 0, "t": 1, "d": [263], "a": 1 },
+						{ "px": [144,144], "src": [48,0], "f": 0, "t": 2, "d": [264], "a": 1 },
+						{ "px": [168,144], "src": [72,0], "f": 0, "t": 3, "d": [265], "a": 1 },
+						{ "px": [192,144], "src": [0,0], "f": 0, "t": 0, "d": [266], "a": 1 },
+						{ "px": [216,144], "src": [24,0], "f": 0, "t": 1, "d": [267], "a": 1 },
+						{ "px": [240,144], "src": [48,0], "f": 0, "t": 2, "d": [268], "a": 1 },
+						{ "px": [264,144], "src": [72,0], "f": 0, "t": 3, "d": [269], "a": 1 },
+						{ "px": [288,144], "src": [0,0], "f": 0, "t": 0, "d": [270], "a": 1 },
+						{ "px": [312,144], "src": [24,0], "f": 0, "t": 1, "d": [271], "a": 1 },
+						{ "px": [336,144], "src": [48,0], "f": 0, "t": 2, "d": [272], "a": 1 },
+						{ "px": [360,144], "src": [72,0], "f": 0, "t": 3, "d": [273], "a": 1 },
+						{ "px": [384,144], "src": [0,0], "f": 0, "t": 0, "d": [274], "a": 1 },
+						{ "px": [408,144], "src": [24,0], "f": 0, "t": 1, "d": [275], "a": 1 },
+						{ "px": [432,144], "src": [48,0], "f": 0, "t": 2, "d": [276], "a": 1 },
+						{ "px": [456,144], "src": [72,0], "f": 0, "t": 3, "d": [277], "a": 1 },
+						{ "px": [480,144], "src": [0,0], "f": 0, "t": 0, "d": [278], "a": 1 },
+						{ "px": [504,144], "src": [24,0], "f": 0, "t": 1, "d": [279], "a": 1 },
+						{ "px": [528,144], "src": [48,0], "f": 0, "t": 2, "d": [280], "a": 1 },
+						{ "px": [552,144], "src": [72,0], "f": 0, "t": 3, "d": [281], "a": 1 },
+						{ "px": [576,144], "src": [0,0], "f": 0, "t": 0, "d": [282], "a": 1 },
+						{ "px": [600,144], "src": [24,0], "f": 0, "t": 1, "d": [283], "a": 1 },
+						{ "px": [624,144], "src": [48,0], "f": 0, "t": 2, "d": [284], "a": 1 },
+						{ "px": [648,144], "src": [72,0], "f": 0, "t": 3, "d": [285], "a": 1 },
+						{ "px": [672,144], "src": [0,0], "f": 0, "t": 0, "d": [286], "a": 1 },
+						{ "px": [696,144], "src": [24,0], "f": 0, "t": 1, "d": [287], "a": 1 },
+						{ "px": [720,144], "src": [48,0], "f": 0, "t": 2, "d": [288], "a": 1 },
+						{ "px": [744,144], "src": [72,0], "f": 0, "t": 3, "d": [289], "a": 1 },
+						{ "px": [768,144], "src": [0,0], "f": 0, "t": 0, "d": [290], "a": 1 },
+						{ "px": [792,144], "src": [24,0], "f": 0, "t": 1, "d": [291], "a": 1 },
+						{ "px": [816,144], "src": [48,0], "f": 0, "t": 2, "d": [292], "a": 1 },
+						{ "px": [840,144], "src": [72,0], "f": 0, "t": 3, "d": [293], "a": 1 },
+						{ "px": [864,144], "src": [0,0], "f": 0, "t": 0, "d": [294], "a": 1 },
+						{ "px": [888,144], "src": [24,0], "f": 0, "t": 1, "d": [295], "a": 1 },
+						{ "px": [912,144], "src": [48,0], "f": 0, "t": 2, "d": [296], "a": 1 },
+						{ "px": [936,144], "src": [72,0], "f": 0, "t": 3, "d": [297], "a": 1 },
+						{ "px": [960,144], "src": [0,0], "f": 0, "t": 0, "d": [298], "a": 1 },
+						{ "px": [984,144], "src": [24,0], "f": 0, "t": 1, "d": [299], "a": 1 },
+						{ "px": [1008,144], "src": [48,0], "f": 0, "t": 2, "d": [300], "a": 1 },
+						{ "px": [0,168], "src": [0,0], "f": 0, "t": 0, "d": [301], "a": 1 },
+						{ "px": [24,168], "src": [24,0], "f": 0, "t": 1, "d": [302], "a": 1 },
+						{ "px": [48,168], "src": [48,0], "f": 0, "t": 2, "d": [303], "a": 1 },
+						{ "px": [72,168], "src": [72,0], "f": 0, "t": 3, "d": [304], "a": 1 },
+						{ "px": [96,168], "src": [0,0], "f": 0, "t": 0, "d": [305], "a": 1 },
+						{ "px": [120,168], "src": [24,0], "f": 0, "t": 1, "d": [306], "a": 1 },
+						{ "px": [144,168], "src": [48,0], "f": 0, "t": 2, "d": [307], "a": 1 },
+						{ "px": [168,168], "src": [72,0], "f": 0, "t": 3, "d": [308], "a": 1 },
+						{ "px": [192,168], "src": [0,0], "f": 0, "t": 0, "d": [309], "a": 1 },
+						{ "px": [216,168], "src": [24,0], "f": 0, "t": 1, "d": [310], "a": 1 },
+						{ "px": [240,168], "src": [48,0], "f": 0, "t": 2, "d": [311], "a": 1 },
+						{ "px": [264,168], "src": [72,0], "f": 0, "t": 3, "d": [312], "a": 1 },
+						{ "px": [288,168], "src": [0,0], "f": 0, "t": 0, "d": [313], "a": 1 },
+						{ "px": [312,168], "src": [24,0], "f": 0, "t": 1, "d": [314], "a": 1 },
+						{ "px": [336,168], "src": [48,0], "f": 0, "t": 2, "d": [315], "a": 1 },
+						{ "px": [360,168], "src": [72,0], "f": 0, "t": 3, "d": [316], "a": 1 },
+						{ "px": [384,168], "src": [0,0], "f": 0, "t": 0, "d": [317], "a": 1 },
+						{ "px": [408,168], "src": [24,0], "f": 0, "t": 1, "d": [318], "a": 1 },
+						{ "px": [432,168], "src": [48,0], "f": 0, "t": 2, "d": [319], "a": 1 },
+						{ "px": [456,168], "src": [72,0], "f": 0, "t": 3, "d": [320], "a": 1 },
+						{ "px": [480,168], "src": [0,0], "f": 0, "t": 0, "d": [321], "a": 1 },
+						{ "px": [504,168], "src": [24,0], "f": 0, "t": 1, "d": [322], "a": 1 },
+						{ "px": [528,168], "src": [48,0], "f": 0, "t": 2, "d": [323], "a": 1 },
+						{ "px": [552,168], "src": [72,0], "f": 0, "t": 3, "d": [324], "a": 1 },
+						{ "px": [576,168], "src": [0,0], "f": 0, "t": 0, "d": [325], "a": 1 },
+						{ "px": [600,168], "src": [24,0], "f": 0, "t": 1, "d": [326], "a": 1 },
+						{ "px": [624,168], "src": [48,0], "f": 0, "t": 2, "d": [327], "a": 1 },
+						{ "px": [648,168], "src": [72,0], "f": 0, "t": 3, "d": [328], "a": 1 },
+						{ "px": [672,168], "src": [0,0], "f": 0, "t": 0, "d": [329], "a": 1 },
+						{ "px": [696,168], "src": [24,0], "f": 0, "t": 1, "d": [330], "a": 1 },
+						{ "px": [720,168], "src": [48,0], "f": 0, "t": 2, "d": [331], "a": 1 },
+						{ "px": [744,168], "src": [72,0], "f": 0, "t": 3, "d": [332], "a": 1 },
+						{ "px": [768,168], "src": [0,0], "f": 0, "t": 0, "d": [333], "a": 1 },
+						{ "px": [792,168], "src": [24,0], "f": 0, "t": 1, "d": [334], "a": 1 },
+						{ "px": [816,168], "src": [48,0], "f": 0, "t": 2, "d": [335], "a": 1 },
+						{ "px": [840,168], "src": [72,0], "f": 0, "t": 3, "d": [336], "a": 1 },
+						{ "px": [864,168], "src": [0,0], "f": 0, "t": 0, "d": [337], "a": 1 },
+						{ "px": [888,168], "src": [24,0], "f": 0, "t": 1, "d": [338], "a": 1 },
+						{ "px": [912,168], "src": [48,0], "f": 0, "t": 2, "d": [339], "a": 1 },
+						{ "px": [936,168], "src": [72,0], "f": 0, "t": 3, "d": [340], "a": 1 },
+						{ "px": [960,168], "src": [0,0], "f": 0, "t": 0, "d": [341], "a": 1 },
+						{ "px": [984,168], "src": [24,0], "f": 0, "t": 1, "d": [342], "a": 1 },
+						{ "px": [1008,168], "src": [48,0], "f": 0, "t": 2, "d": [343], "a": 1 },
+						{ "px": [0,192], "src": [0,0], "f": 0, "t": 0, "d": [344], "a": 1 },
+						{ "px": [24,192], "src": [24,0], "f": 0, "t": 1, "d": [345], "a": 1 },
+						{ "px": [48,192], "src": [48,0], "f": 0, "t": 2, "d": [346], "a": 1 },
+						{ "px": [72,192], "src": [72,0], "f": 0, "t": 3, "d": [347], "a": 1 },
+						{ "px": [96,192], "src": [0,0], "f": 0, "t": 0, "d": [348], "a": 1 },
+						{ "px": [120,192], "src": [24,0], "f": 0, "t": 1, "d": [349], "a": 1 },
+						{ "px": [144,192], "src": [48,0], "f": 0, "t": 2, "d": [350], "a": 1 },
+						{ "px": [168,192], "src": [72,0], "f": 0, "t": 3, "d": [351], "a": 1 },
+						{ "px": [192,192], "src": [0,0], "f": 0, "t": 0, "d": [352], "a": 1 },
+						{ "px": [216,192], "src": [24,0], "f": 0, "t": 1, "d": [353], "a": 1 },
+						{ "px": [240,192], "src": [48,0], "f": 0, "t": 2, "d": [354], "a": 1 },
+						{ "px": [264,192], "src": [72,0], "f": 0, "t": 3, "d": [355], "a": 1 },
+						{ "px": [288,192], "src": [0,0], "f": 0, "t": 0, "d": [356], "a": 1 },
+						{ "px": [312,192], "src": [24,0], "f": 0, "t": 1, "d": [357], "a": 1 },
+						{ "px": [336,192], "src": [48,0], "f": 0, "t": 2, "d": [358], "a": 1 },
+						{ "px": [360,192], "src": [72,0], "f": 0, "t": 3, "d": [359], "a": 1 },
+						{ "px": [384,192], "src": [0,0], "f": 0, "t": 0, "d": [360], "a": 1 },
+						{ "px": [408,192], "src": [24,0], "f": 0, "t": 1, "d": [361], "a": 1 },
+						{ "px": [432,192], "src": [48,0], "f": 0, "t": 2, "d": [362], "a": 1 },
+						{ "px": [456,192], "src": [72,0], "f": 0, "t": 3, "d": [363], "a": 1 },
+						{ "px": [480,192], "src": [0,0], "f": 0, "t": 0, "d": [364], "a": 1 },
+						{ "px": [504,192], "src": [24,0], "f": 0, "t": 1, "d": [365], "a": 1 },
+						{ "px": [528,192], "src": [48,0], "f": 0, "t": 2, "d": [366], "a": 1 },
+						{ "px": [552,192], "src": [72,0], "f": 0, "t": 3, "d": [367], "a": 1 },
+						{ "px": [576,192], "src": [0,0], "f": 0, "t": 0, "d": [368], "a": 1 },
+						{ "px": [600,192], "src": [24,0], "f": 0, "t": 1, "d": [369], "a": 1 },
+						{ "px": [624,192], "src": [48,0], "f": 0, "t": 2, "d": [370], "a": 1 },
+						{ "px": [648,192], "src": [72,0], "f": 0, "t": 3, "d": [371], "a": 1 },
+						{ "px": [672,192], "src": [0,0], "f": 0, "t": 0, "d": [372], "a": 1 },
+						{ "px": [696,192], "src": [24,0], "f": 0, "t": 1, "d": [373], "a": 1 },
+						{ "px": [720,192], "src": [48,0], "f": 0, "t": 2, "d": [374], "a": 1 },
+						{ "px": [744,192], "src": [72,0], "f": 0, "t": 3, "d": [375], "a": 1 },
+						{ "px": [768,192], "src": [0,0], "f": 0, "t": 0, "d": [376], "a": 1 },
+						{ "px": [792,192], "src": [24,0], "f": 0, "t": 1, "d": [377], "a": 1 },
+						{ "px": [816,192], "src": [48,0], "f": 0, "t": 2, "d": [378], "a": 1 },
+						{ "px": [840,192], "src": [72,0], "f": 0, "t": 3, "d": [379], "a": 1 },
+						{ "px": [864,192], "src": [0,0], "f": 0, "t": 0, "d": [380], "a": 1 },
+						{ "px": [888,192], "src": [24,0], "f": 0, "t": 1, "d": [381], "a": 1 },
+						{ "px": [912,192], "src": [48,0], "f": 0, "t": 2, "d": [382], "a": 1 },
+						{ "px": [936,192], "src": [72,0], "f": 0, "t": 3, "d": [383], "a": 1 },
+						{ "px": [960,192], "src": [0,0], "f": 0, "t": 0, "d": [384], "a": 1 },
+						{ "px": [984,192], "src": [24,0], "f": 0, "t": 1, "d": [385], "a": 1 },
+						{ "px": [1008,192], "src": [48,0], "f": 0, "t": 2, "d": [386], "a": 1 },
+						{ "px": [0,216], "src": [0,0], "f": 0, "t": 0, "d": [387], "a": 1 },
+						{ "px": [24,216], "src": [24,0], "f": 0, "t": 1, "d": [388], "a": 1 },
+						{ "px": [48,216], "src": [48,0], "f": 0, "t": 2, "d": [389], "a": 1 },
+						{ "px": [72,216], "src": [72,0], "f": 0, "t": 3, "d": [390], "a": 1 },
+						{ "px": [96,216], "src": [0,0], "f": 0, "t": 0, "d": [391], "a": 1 },
+						{ "px": [120,216], "src": [24,0], "f": 0, "t": 1, "d": [392], "a": 1 },
+						{ "px": [144,216], "src": [48,0], "f": 0, "t": 2, "d": [393], "a": 1 },
+						{ "px": [168,216], "src": [72,0], "f": 0, "t": 3, "d": [394], "a": 1 },
+						{ "px": [192,216], "src": [0,0], "f": 0, "t": 0, "d": [395], "a": 1 },
+						{ "px": [216,216], "src": [24,0], "f": 0, "t": 1, "d": [396], "a": 1 },
+						{ "px": [240,216], "src": [48,0], "f": 0, "t": 2, "d": [397], "a": 1 },
+						{ "px": [264,216], "src": [72,0], "f": 0, "t": 3, "d": [398], "a": 1 },
+						{ "px": [288,216], "src": [0,0], "f": 0, "t": 0, "d": [399], "a": 1 },
+						{ "px": [312,216], "src": [24,0], "f": 0, "t": 1, "d": [400], "a": 1 },
+						{ "px": [336,216], "src": [48,0], "f": 0, "t": 2, "d": [401], "a": 1 },
+						{ "px": [360,216], "src": [72,0], "f": 0, "t": 3, "d": [402], "a": 1 },
+						{ "px": [384,216], "src": [0,0], "f": 0, "t": 0, "d": [403], "a": 1 },
+						{ "px": [408,216], "src": [24,0], "f": 0, "t": 1, "d": [404], "a": 1 },
+						{ "px": [432,216], "src": [48,0], "f": 0, "t": 2, "d": [405], "a": 1 },
+						{ "px": [456,216], "src": [72,0], "f": 0, "t": 3, "d": [406], "a": 1 },
+						{ "px": [480,216], "src": [0,0], "f": 0, "t": 0, "d": [407], "a": 1 },
+						{ "px": [504,216], "src": [24,0], "f": 0, "t": 1, "d": [408], "a": 1 },
+						{ "px": [528,216], "src": [48,0], "f": 0, "t": 2, "d": [409], "a": 1 },
+						{ "px": [552,216], "src": [72,0], "f": 0, "t": 3, "d": [410], "a": 1 },
+						{ "px": [576,216], "src": [0,0], "f": 0, "t": 0, "d": [411], "a": 1 },
+						{ "px": [600,216], "src": [24,0], "f": 0, "t": 1, "d": [412], "a": 1 },
+						{ "px": [624,216], "src": [48,0], "f": 0, "t": 2, "d": [413], "a": 1 },
+						{ "px": [648,216], "src": [72,0], "f": 0, "t": 3, "d": [414], "a": 1 },
+						{ "px": [672,216], "src": [0,0], "f": 0, "t": 0, "d": [415], "a": 1 },
+						{ "px": [696,216], "src": [24,0], "f": 0, "t": 1, "d": [416], "a": 1 },
+						{ "px": [720,216], "src": [48,0], "f": 0, "t": 2, "d": [417], "a": 1 },
+						{ "px": [744,216], "src": [72,0], "f": 0, "t": 3, "d": [418], "a": 1 },
+						{ "px": [768,216], "src": [0,0], "f": 0, "t": 0, "d": [419], "a": 1 },
+						{ "px": [792,216], "src": [24,0], "f": 0, "t": 1, "d": [420], "a": 1 },
+						{ "px": [816,216], "src": [48,0], "f": 0, "t": 2, "d": [421], "a": 1 },
+						{ "px": [840,216], "src": [72,0], "f": 0, "t": 3, "d": [422], "a": 1 },
+						{ "px": [864,216], "src": [0,0], "f": 0, "t": 0, "d": [423], "a": 1 },
+						{ "px": [888,216], "src": [24,0], "f": 0, "t": 1, "d": [424], "a": 1 },
+						{ "px": [912,216], "src": [48,0], "f": 0, "t": 2, "d": [425], "a": 1 },
+						{ "px": [936,216], "src": [72,0], "f": 0, "t": 3, "d": [426], "a": 1 },
+						{ "px": [960,216], "src": [0,0], "f": 0, "t": 0, "d": [427], "a": 1 },
+						{ "px": [984,216], "src": [24,0], "f": 0, "t": 1, "d": [428], "a": 1 },
+						{ "px": [1008,216], "src": [48,0], "f": 0, "t": 2, "d": [429], "a": 1 },
+						{ "px": [0,240], "src": [0,0], "f": 0, "t": 0, "d": [430], "a": 1 },
+						{ "px": [24,240], "src": [24,0], "f": 0, "t": 1, "d": [431], "a": 1 },
+						{ "px": [48,240], "src": [48,0], "f": 0, "t": 2, "d": [432], "a": 1 },
+						{ "px": [72,240], "src": [72,0], "f": 0, "t": 3, "d": [433], "a": 1 },
+						{ "px": [96,240], "src": [0,0], "f": 0, "t": 0, "d": [434], "a": 1 },
+						{ "px": [120,240], "src": [24,0], "f": 0, "t": 1, "d": [435], "a": 1 },
+						{ "px": [144,240], "src": [48,0], "f": 0, "t": 2, "d": [436], "a": 1 },
+						{ "px": [168,240], "src": [72,0], "f": 0, "t": 3, "d": [437], "a": 1 },
+						{ "px": [192,240], "src": [0,0], "f": 0, "t": 0, "d": [438], "a": 1 },
+						{ "px": [216,240], "src": [24,0], "f": 0, "t": 1, "d": [439], "a": 1 },
+						{ "px": [240,240], "src": [48,0], "f": 0, "t": 2, "d": [440], "a": 1 },
+						{ "px": [264,240], "src": [72,0], "f": 0, "t": 3, "d": [441], "a": 1 },
+						{ "px": [288,240], "src": [0,0], "f": 0, "t": 0, "d": [442], "a": 1 },
+						{ "px": [312,240], "src": [24,0], "f": 0, "t": 1, "d": [443], "a": 1 },
+						{ "px": [336,240], "src": [48,0], "f": 0, "t": 2, "d": [444], "a": 1 },
+						{ "px": [360,240], "src": [72,0], "f": 0, "t": 3, "d": [445], "a": 1 },
+						{ "px": [384,240], "src": [0,0], "f": 0, "t": 0, "d": [446], "a": 1 },
+						{ "px": [408,240], "src": [24,0], "f": 0, "t": 1, "d": [447], "a": 1 },
+						{ "px": [432,240], "src": [48,0], "f": 0, "t": 2, "d": [448], "a": 1 },
+						{ "px": [456,240], "src": [72,0], "f": 0, "t": 3, "d": [449], "a": 1 },
+						{ "px": [480,240], "src": [0,0], "f": 0, "t": 0, "d": [450], "a": 1 },
+						{ "px": [504,240], "src": [24,0], "f": 0, "t": 1, "d": [451], "a": 1 },
+						{ "px": [528,240], "src": [48,0], "f": 0, "t": 2, "d": [452], "a": 1 },
+						{ "px": [552,240], "src": [72,0], "f": 0, "t": 3, "d": [453], "a": 1 },
+						{ "px": [576,240], "src": [0,0], "f": 0, "t": 0, "d": [454], "a": 1 },
+						{ "px": [600,240], "src": [24,0], "f": 0, "t": 1, "d": [455], "a": 1 },
+						{ "px": [624,240], "src": [48,0], "f": 0, "t": 2, "d": [456], "a": 1 },
+						{ "px": [648,240], "src": [72,0], "f": 0, "t": 3, "d": [457], "a": 1 },
+						{ "px": [672,240], "src": [0,0], "f": 0, "t": 0, "d": [458], "a": 1 },
+						{ "px": [696,240], "src": [24,0], "f": 0, "t": 1, "d": [459], "a": 1 },
+						{ "px": [720,240], "src": [48,0], "f": 0, "t": 2, "d": [460], "a": 1 },
+						{ "px": [744,240], "src": [72,0], "f": 0, "t": 3, "d": [461], "a": 1 },
+						{ "px": [768,240], "src": [0,0], "f": 0, "t": 0, "d": [462], "a": 1 },
+						{ "px": [792,240], "src": [24,0], "f": 0, "t": 1, "d": [463], "a": 1 },
+						{ "px": [816,240], "src": [48,0], "f": 0, "t": 2, "d": [464], "a": 1 },
+						{ "px": [840,240], "src": [72,0], "f": 0, "t": 3, "d": [465], "a": 1 },
+						{ "px": [864,240], "src": [0,0], "f": 0, "t": 0, "d": [466], "a": 1 },
+						{ "px": [888,240], "src": [24,0], "f": 0, "t": 1, "d": [467], "a": 1 },
+						{ "px": [912,240], "src": [48,0], "f": 0, "t": 2, "d": [468], "a": 1 },
+						{ "px": [936,240], "src": [72,0], "f": 0, "t": 3, "d": [469], "a": 1 },
+						{ "px": [960,240], "src": [0,0], "f": 0, "t": 0, "d": [470], "a": 1 },
+						{ "px": [984,240], "src": [24,0], "f": 0, "t": 1, "d": [471], "a": 1 },
+						{ "px": [1008,240], "src": [48,0], "f": 0, "t": 2, "d": [472], "a": 1 },
+						{ "px": [0,264], "src": [0,0], "f": 0, "t": 0, "d": [473], "a": 1 },
+						{ "px": [24,264], "src": [24,0], "f": 0, "t": 1, "d": [474], "a": 1 },
+						{ "px": [48,264], "src": [48,0], "f": 0, "t": 2, "d": [475], "a": 1 },
+						{ "px": [72,264], "src": [72,0], "f": 0, "t": 3, "d": [476], "a": 1 },
+						{ "px": [96,264], "src": [0,0], "f": 0, "t": 0, "d": [477], "a": 1 },
+						{ "px": [120,264], "src": [24,0], "f": 0, "t": 1, "d": [478], "a": 1 },
+						{ "px": [144,264], "src": [48,0], "f": 0, "t": 2, "d": [479], "a": 1 },
+						{ "px": [168,264], "src": [72,0], "f": 0, "t": 3, "d": [480], "a": 1 },
+						{ "px": [192,264], "src": [0,0], "f": 0, "t": 0, "d": [481], "a": 1 },
+						{ "px": [216,264], "src": [24,0], "f": 0, "t": 1, "d": [482], "a": 1 },
+						{ "px": [240,264], "src": [48,0], "f": 0, "t": 2, "d": [483], "a": 1 },
+						{ "px": [264,264], "src": [72,0], "f": 0, "t": 3, "d": [484], "a": 1 },
+						{ "px": [288,264], "src": [0,0], "f": 0, "t": 0, "d": [485], "a": 1 },
+						{ "px": [312,264], "src": [24,0], "f": 0, "t": 1, "d": [486], "a": 1 },
+						{ "px": [336,264], "src": [48,0], "f": 0, "t": 2, "d": [487], "a": 1 },
+						{ "px": [360,264], "src": [72,0], "f": 0, "t": 3, "d": [488], "a": 1 },
+						{ "px": [384,264], "src": [0,0], "f": 0, "t": 0, "d": [489], "a": 1 },
+						{ "px": [408,264], "src": [24,0], "f": 0, "t": 1, "d": [490], "a": 1 },
+						{ "px": [432,264], "src": [48,0], "f": 0, "t": 2, "d": [491], "a": 1 },
+						{ "px": [456,264], "src": [72,0], "f": 0, "t": 3, "d": [492], "a": 1 },
+						{ "px": [480,264], "src": [0,0], "f": 0, "t": 0, "d": [493], "a": 1 },
+						{ "px": [504,264], "src": [24,0], "f": 0, "t": 1, "d": [494], "a": 1 },
+						{ "px": [528,264], "src": [48,0], "f": 0, "t": 2, "d": [495], "a": 1 },
+						{ "px": [552,264], "src": [72,0], "f": 0, "t": 3, "d": [496], "a": 1 },
+						{ "px": [576,264], "src": [0,0], "f": 0, "t": 0, "d": [497], "a": 1 },
+						{ "px": [600,264], "src": [24,0], "f": 0, "t": 1, "d": [498], "a": 1 },
+						{ "px": [624,264], "src": [48,0], "f": 0, "t": 2, "d": [499], "a": 1 },
+						{ "px": [648,264], "src": [72,0], "f": 0, "t": 3, "d": [500], "a": 1 },
+						{ "px": [672,264], "src": [0,0], "f": 0, "t": 0, "d": [501], "a": 1 },
+						{ "px": [696,264], "src": [24,0], "f": 0, "t": 1, "d": [502], "a": 1 },
+						{ "px": [720,264], "src": [48,0], "f": 0, "t": 2, "d": [503], "a": 1 },
+						{ "px": [744,264], "src": [72,0], "f": 0, "t": 3, "d": [504], "a": 1 },
+						{ "px": [768,264], "src": [0,0], "f": 0, "t": 0, "d": [505], "a": 1 },
+						{ "px": [792,264], "src": [24,0], "f": 0, "t": 1, "d": [506], "a": 1 },
+						{ "px": [816,264], "src": [48,0], "f": 0, "t": 2, "d": [507], "a": 1 },
+						{ "px": [840,264], "src": [72,0], "f": 0, "t": 3, "d": [508], "a": 1 },
+						{ "px": [864,264], "src": [0,0], "f": 0, "t": 0, "d": [509], "a": 1 },
+						{ "px": [888,264], "src": [24,0], "f": 0, "t": 1, "d": [510], "a": 1 },
+						{ "px": [912,264], "src": [48,0], "f": 0, "t": 2, "d": [511], "a": 1 },
+						{ "px": [936,264], "src": [72,0], "f": 0, "t": 3, "d": [512], "a": 1 },
+						{ "px": [960,264], "src": [0,0], "f": 0, "t": 0, "d": [513], "a": 1 },
+						{ "px": [984,264], "src": [24,0], "f": 0, "t": 1, "d": [514], "a": 1 },
+						{ "px": [1008,264], "src": [48,0], "f": 0, "t": 2, "d": [515], "a": 1 },
+						{ "px": [0,288], "src": [0,0], "f": 0, "t": 0, "d": [516], "a": 1 },
+						{ "px": [24,288], "src": [24,0], "f": 0, "t": 1, "d": [517], "a": 1 },
+						{ "px": [48,288], "src": [48,0], "f": 0, "t": 2, "d": [518], "a": 1 },
+						{ "px": [72,288], "src": [72,0], "f": 0, "t": 3, "d": [519], "a": 1 },
+						{ "px": [96,288], "src": [0,0], "f": 0, "t": 0, "d": [520], "a": 1 },
+						{ "px": [120,288], "src": [24,0], "f": 0, "t": 1, "d": [521], "a": 1 },
+						{ "px": [144,288], "src": [48,0], "f": 0, "t": 2, "d": [522], "a": 1 },
+						{ "px": [168,288], "src": [72,0], "f": 0, "t": 3, "d": [523], "a": 1 },
+						{ "px": [192,288], "src": [0,0], "f": 0, "t": 0, "d": [524], "a": 1 },
+						{ "px": [216,288], "src": [24,0], "f": 0, "t": 1, "d": [525], "a": 1 },
+						{ "px": [240,288], "src": [48,0], "f": 0, "t": 2, "d": [526], "a": 1 },
+						{ "px": [264,288], "src": [72,0], "f": 0, "t": 3, "d": [527], "a": 1 },
+						{ "px": [288,288], "src": [0,0], "f": 0, "t": 0, "d": [528], "a": 1 },
+						{ "px": [312,288], "src": [24,0], "f": 0, "t": 1, "d": [529], "a": 1 },
+						{ "px": [336,288], "src": [48,0], "f": 0, "t": 2, "d": [530], "a": 1 },
+						{ "px": [360,288], "src": [72,0], "f": 0, "t": 3, "d": [531], "a": 1 },
+						{ "px": [384,288], "src": [0,0], "f": 0, "t": 0, "d": [532], "a": 1 },
+						{ "px": [408,288], "src": [24,0], "f": 0, "t": 1, "d": [533], "a": 1 },
+						{ "px": [432,288], "src": [48,0], "f": 0, "t": 2, "d": [534], "a": 1 },
+						{ "px": [456,288], "src": [72,0], "f": 0, "t": 3, "d": [535], "a": 1 },
+						{ "px": [480,288], "src": [0,0], "f": 0, "t": 0, "d": [536], "a": 1 },
+						{ "px": [504,288], "src": [24,0], "f": 0, "t": 1, "d": [537], "a": 1 },
+						{ "px": [528,288], "src": [48,0], "f": 0, "t": 2, "d": [538], "a": 1 },
+						{ "px": [552,288], "src": [72,0], "f": 0, "t": 3, "d": [539], "a": 1 },
+						{ "px": [576,288], "src": [0,0], "f": 0, "t": 0, "d": [540], "a": 1 },
+						{ "px": [600,288], "src": [24,0], "f": 0, "t": 1, "d": [541], "a": 1 },
+						{ "px": [624,288], "src": [48,0], "f": 0, "t": 2, "d": [542], "a": 1 },
+						{ "px": [648,288], "src": [72,0], "f": 0, "t": 3, "d": [543], "a": 1 },
+						{ "px": [672,288], "src": [0,0], "f": 0, "t": 0, "d": [544], "a": 1 },
+						{ "px": [696,288], "src": [24,0], "f": 0, "t": 1, "d": [545], "a": 1 },
+						{ "px": [720,288], "src": [48,0], "f": 0, "t": 2, "d": [546], "a": 1 },
+						{ "px": [744,288], "src": [72,0], "f": 0, "t": 3, "d": [547], "a": 1 },
+						{ "px": [768,288], "src": [0,0], "f": 0, "t": 0, "d": [548], "a": 1 },
+						{ "px": [792,288], "src": [24,0], "f": 0, "t": 1, "d": [549], "a": 1 },
+						{ "px": [816,288], "src": [48,0], "f": 0, "t": 2, "d": [550], "a": 1 },
+						{ "px": [840,288], "src": [72,0], "f": 0, "t": 3, "d": [551], "a": 1 },
+						{ "px": [864,288], "src": [0,0], "f": 0, "t": 0, "d": [552], "a": 1 },
+						{ "px": [888,288], "src": [24,0], "f": 0, "t": 1, "d": [553], "a": 1 },
+						{ "px": [912,288], "src": [48,0], "f": 0, "t": 2, "d": [554], "a": 1 },
+						{ "px": [936,288], "src": [72,0], "f": 0, "t": 3, "d": [555], "a": 1 },
+						{ "px": [960,288], "src": [0,0], "f": 0, "t": 0, "d": [556], "a": 1 },
+						{ "px": [984,288], "src": [24,0], "f": 0, "t": 1, "d": [557], "a": 1 },
+						{ "px": [1008,288], "src": [48,0], "f": 0, "t": 2, "d": [558], "a": 1 },
+						{ "px": [0,312], "src": [0,0], "f": 0, "t": 0, "d": [559], "a": 1 },
+						{ "px": [24,312], "src": [24,0], "f": 0, "t": 1, "d": [560], "a": 1 },
+						{ "px": [48,312], "src": [48,0], "f": 0, "t": 2, "d": [561], "a": 1 },
+						{ "px": [72,312], "src": [72,0], "f": 0, "t": 3, "d": [562], "a": 1 },
+						{ "px": [96,312], "src": [0,0], "f": 0, "t": 0, "d": [563], "a": 1 },
+						{ "px": [120,312], "src": [24,0], "f": 0, "t": 1, "d": [564], "a": 1 },
+						{ "px": [144,312], "src": [48,0], "f": 0, "t": 2, "d": [565], "a": 1 },
+						{ "px": [168,312], "src": [72,0], "f": 0, "t": 3, "d": [566], "a": 1 },
+						{ "px": [192,312], "src": [0,0], "f": 0, "t": 0, "d": [567], "a": 1 },
+						{ "px": [216,312], "src": [24,0], "f": 0, "t": 1, "d": [568], "a": 1 },
+						{ "px": [240,312], "src": [48,0], "f": 0, "t": 2, "d": [569], "a": 1 },
+						{ "px": [264,312], "src": [72,0], "f": 0, "t": 3, "d": [570], "a": 1 },
+						{ "px": [288,312], "src": [0,0], "f": 0, "t": 0, "d": [571], "a": 1 },
+						{ "px": [312,312], "src": [24,0], "f": 0, "t": 1, "d": [572], "a": 1 },
+						{ "px": [336,312], "src": [48,0], "f": 0, "t": 2, "d": [573], "a": 1 },
+						{ "px": [360,312], "src": [72,0], "f": 0, "t": 3, "d": [574], "a": 1 },
+						{ "px": [384,312], "src": [0,0], "f": 0, "t": 0, "d": [575], "a": 1 },
+						{ "px": [408,312], "src": [24,0], "f": 0, "t": 1, "d": [576], "a": 1 },
+						{ "px": [432,312], "src": [48,0], "f": 0, "t": 2, "d": [577], "a": 1 },
+						{ "px": [456,312], "src": [72,0], "f": 0, "t": 3, "d": [578], "a": 1 },
+						{ "px": [480,312], "src": [0,0], "f": 0, "t": 0, "d": [579], "a": 1 },
+						{ "px": [504,312], "src": [24,0], "f": 0, "t": 1, "d": [580], "a": 1 },
+						{ "px": [528,312], "src": [48,0], "f": 0, "t": 2, "d": [581], "a": 1 },
+						{ "px": [552,312], "src": [72,0], "f": 0, "t": 3, "d": [582], "a": 1 },
+						{ "px": [576,312], "src": [0,0], "f": 0, "t": 0, "d": [583], "a": 1 },
+						{ "px": [600,312], "src": [24,0], "f": 0, "t": 1, "d": [584], "a": 1 },
+						{ "px": [624,312], "src": [48,0], "f": 0, "t": 2, "d": [585], "a": 1 },
+						{ "px": [648,312], "src": [72,0], "f": 0, "t": 3, "d": [586], "a": 1 },
+						{ "px": [672,312], "src": [0,0], "f": 0, "t": 0, "d": [587], "a": 1 },
+						{ "px": [696,312], "src": [24,0], "f": 0, "t": 1, "d": [588], "a": 1 },
+						{ "px": [720,312], "src": [48,0], "f": 0, "t": 2, "d": [589], "a": 1 },
+						{ "px": [744,312], "src": [72,0], "f": 0, "t": 3, "d": [590], "a": 1 },
+						{ "px": [768,312], "src": [0,0], "f": 0, "t": 0, "d": [591], "a": 1 },
+						{ "px": [792,312], "src": [24,0], "f": 0, "t": 1, "d": [592], "a": 1 },
+						{ "px": [816,312], "src": [48,0], "f": 0, "t": 2, "d": [593], "a": 1 },
+						{ "px": [840,312], "src": [72,0], "f": 0, "t": 3, "d": [594], "a": 1 },
+						{ "px": [864,312], "src": [0,0], "f": 0, "t": 0, "d": [595], "a": 1 },
+						{ "px": [888,312], "src": [24,0], "f": 0, "t": 1, "d": [596], "a": 1 },
+						{ "px": [912,312], "src": [48,0], "f": 0, "t": 2, "d": [597], "a": 1 },
+						{ "px": [936,312], "src": [72,0], "f": 0, "t": 3, "d": [598], "a": 1 },
+						{ "px": [960,312], "src": [0,0], "f": 0, "t": 0, "d": [599], "a": 1 },
+						{ "px": [984,312], "src": [24,0], "f": 0, "t": 1, "d": [600], "a": 1 },
+						{ "px": [1008,312], "src": [48,0], "f": 0, "t": 2, "d": [601], "a": 1 },
+						{ "px": [0,336], "src": [0,0], "f": 0, "t": 0, "d": [602], "a": 1 },
+						{ "px": [24,336], "src": [0,0], "f": 0, "t": 0, "d": [603], "a": 1 },
+						{ "px": [48,336], "src": [0,0], "f": 0, "t": 0, "d": [604], "a": 1 },
+						{ "px": [72,336], "src": [0,0], "f": 0, "t": 0, "d": [605], "a": 1 },
+						{ "px": [96,336], "src": [0,0], "f": 0, "t": 0, "d": [606], "a": 1 },
+						{ "px": [120,336], "src": [0,0], "f": 0, "t": 0, "d": [607], "a": 1 },
+						{ "px": [144,336], "src": [0,0], "f": 0, "t": 0, "d": [608], "a": 1 },
+						{ "px": [168,336], "src": [0,0], "f": 0, "t": 0, "d": [609], "a": 1 },
+						{ "px": [192,336], "src": [0,0], "f": 0, "t": 0, "d": [610], "a": 1 },
+						{ "px": [216,336], "src": [0,0], "f": 0, "t": 0, "d": [611], "a": 1 },
+						{ "px": [240,336], "src": [0,0], "f": 0, "t": 0, "d": [612], "a": 1 },
+						{ "px": [264,336], "src": [72,0], "f": 0, "t": 3, "d": [613], "a": 1 },
+						{ "px": [288,336], "src": [0,0], "f": 0, "t": 0, "d": [614], "a": 1 },
+						{ "px": [312,336], "src": [24,0], "f": 0, "t": 1, "d": [615], "a": 1 },
+						{ "px": [336,336], "src": [48,0], "f": 0, "t": 2, "d": [616], "a": 1 },
+						{ "px": [360,336], "src": [72,0], "f": 0, "t": 3, "d": [617], "a": 1 },
+						{ "px": [384,336], "src": [0,0], "f": 0, "t": 0, "d": [618], "a": 1 },
+						{ "px": [408,336], "src": [24,0], "f": 0, "t": 1, "d": [619], "a": 1 },
+						{ "px": [432,336], "src": [48,0], "f": 0, "t": 2, "d": [620], "a": 1 },
+						{ "px": [456,336], "src": [72,0], "f": 0, "t": 3, "d": [621], "a": 1 },
+						{ "px": [480,336], "src": [0,0], "f": 0, "t": 0, "d": [622], "a": 1 },
+						{ "px": [504,336], "src": [24,0], "f": 0, "t": 1, "d": [623], "a": 1 },
+						{ "px": [528,336], "src": [48,0], "f": 0, "t": 2, "d": [624], "a": 1 },
+						{ "px": [552,336], "src": [72,0], "f": 0, "t": 3, "d": [625], "a": 1 },
+						{ "px": [576,336], "src": [0,0], "f": 0, "t": 0, "d": [626], "a": 1 },
+						{ "px": [600,336], "src": [24,0], "f": 0, "t": 1, "d": [627], "a": 1 },
+						{ "px": [624,336], "src": [48,0], "f": 0, "t": 2, "d": [628], "a": 1 },
+						{ "px": [648,336], "src": [72,0], "f": 0, "t": 3, "d": [629], "a": 1 },
+						{ "px": [672,336], "src": [0,0], "f": 0, "t": 0, "d": [630], "a": 1 },
+						{ "px": [696,336], "src": [24,0], "f": 0, "t": 1, "d": [631], "a": 1 },
+						{ "px": [720,336], "src": [48,0], "f": 0, "t": 2, "d": [632], "a": 1 },
+						{ "px": [744,336], "src": [72,0], "f": 0, "t": 3, "d": [633], "a": 1 },
+						{ "px": [768,336], "src": [0,0], "f": 0, "t": 0, "d": [634], "a": 1 },
+						{ "px": [792,336], "src": [24,0], "f": 0, "t": 1, "d": [635], "a": 1 },
+						{ "px": [816,336], "src": [48,0], "f": 0, "t": 2, "d": [636], "a": 1 },
+						{ "px": [840,336], "src": [72,0], "f": 0, "t": 3, "d": [637], "a": 1 },
+						{ "px": [864,336], "src": [0,0], "f": 0, "t": 0, "d": [638], "a": 1 },
+						{ "px": [888,336], "src": [24,0], "f": 0, "t": 1, "d": [639], "a": 1 },
+						{ "px": [912,336], "src": [48,0], "f": 0, "t": 2, "d": [640], "a": 1 },
+						{ "px": [936,336], "src": [72,0], "f": 0, "t": 3, "d": [641], "a": 1 },
+						{ "px": [960,336], "src": [0,0], "f": 0, "t": 0, "d": [642], "a": 1 },
+						{ "px": [984,336], "src": [24,0], "f": 0, "t": 1, "d": [643], "a": 1 },
+						{ "px": [1008,336], "src": [48,0], "f": 0, "t": 2, "d": [644], "a": 1 },
+						{ "px": [0,360], "src": [0,0], "f": 0, "t": 0, "d": [645], "a": 1 },
+						{ "px": [24,360], "src": [0,0], "f": 0, "t": 0, "d": [646], "a": 1 },
+						{ "px": [48,360], "src": [0,0], "f": 0, "t": 0, "d": [647], "a": 1 },
+						{ "px": [72,360], "src": [0,0], "f": 0, "t": 0, "d": [648], "a": 1 },
+						{ "px": [96,360], "src": [0,0], "f": 0, "t": 0, "d": [649], "a": 1 },
+						{ "px": [120,360], "src": [0,0], "f": 0, "t": 0, "d": [650], "a": 1 },
+						{ "px": [144,360], "src": [0,0], "f": 0, "t": 0, "d": [651], "a": 1 },
+						{ "px": [168,360], "src": [0,0], "f": 0, "t": 0, "d": [652], "a": 1 },
+						{ "px": [192,360], "src": [0,0], "f": 0, "t": 0, "d": [653], "a": 1 },
+						{ "px": [216,360], "src": [0,0], "f": 0, "t": 0, "d": [654], "a": 1 },
+						{ "px": [240,360], "src": [0,0], "f": 0, "t": 0, "d": [655], "a": 1 },
+						{ "px": [264,360], "src": [0,0], "f": 0, "t": 0, "d": [656], "a": 1 },
+						{ "px": [288,360], "src": [0,0], "f": 0, "t": 0, "d": [657], "a": 1 },
+						{ "px": [312,360], "src": [0,0], "f": 0, "t": 0, "d": [658], "a": 1 },
+						{ "px": [336,360], "src": [0,0], "f": 0, "t": 0, "d": [659], "a": 1 },
+						{ "px": [360,360], "src": [0,0], "f": 0, "t": 0, "d": [660], "a": 1 },
+						{ "px": [384,360], "src": [0,0], "f": 0, "t": 0, "d": [661], "a": 1 },
+						{ "px": [408,360], "src": [0,0], "f": 0, "t": 0, "d": [662], "a": 1 },
+						{ "px": [432,360], "src": [0,0], "f": 0, "t": 0, "d": [663], "a": 1 },
+						{ "px": [456,360], "src": [0,0], "f": 0, "t": 0, "d": [664], "a": 1 },
+						{ "px": [480,360], "src": [0,0], "f": 0, "t": 0, "d": [665], "a": 1 },
+						{ "px": [504,360], "src": [0,0], "f": 0, "t": 0, "d": [666], "a": 1 },
+						{ "px": [528,360], "src": [0,0], "f": 0, "t": 0, "d": [667], "a": 1 },
+						{ "px": [552,360], "src": [0,0], "f": 0, "t": 0, "d": [668], "a": 1 },
+						{ "px": [576,360], "src": [0,0], "f": 0, "t": 0, "d": [669], "a": 1 },
+						{ "px": [600,360], "src": [0,0], "f": 0, "t": 0, "d": [670], "a": 1 },
+						{ "px": [624,360], "src": [0,0], "f": 0, "t": 0, "d": [671], "a": 1 },
+						{ "px": [648,360], "src": [0,0], "f": 0, "t": 0, "d": [672], "a": 1 },
+						{ "px": [672,360], "src": [0,0], "f": 0, "t": 0, "d": [673], "a": 1 },
+						{ "px": [696,360], "src": [0,0], "f": 0, "t": 0, "d": [674], "a": 1 },
+						{ "px": [720,360], "src": [0,0], "f": 0, "t": 0, "d": [675], "a": 1 },
+						{ "px": [744,360], "src": [0,0], "f": 0, "t": 0, "d": [676], "a": 1 },
+						{ "px": [768,360], "src": [0,0], "f": 0, "t": 0, "d": [677], "a": 1 },
+						{ "px": [792,360], "src": [0,0], "f": 0, "t": 0, "d": [678], "a": 1 },
+						{ "px": [816,360], "src": [0,0], "f": 0, "t": 0, "d": [679], "a": 1 },
+						{ "px": [840,360], "src": [0,0], "f": 0, "t": 0, "d": [680], "a": 1 },
+						{ "px": [864,360], "src": [0,0], "f": 0, "t": 0, "d": [681], "a": 1 },
+						{ "px": [888,360], "src": [0,0], "f": 0, "t": 0, "d": [682], "a": 1 },
+						{ "px": [912,360], "src": [0,0], "f": 0, "t": 0, "d": [683], "a": 1 },
+						{ "px": [936,360], "src": [0,0], "f": 0, "t": 0, "d": [684], "a": 1 },
+						{ "px": [960,360], "src": [0,0], "f": 0, "t": 0, "d": [685], "a": 1 },
+						{ "px": [984,360], "src": [0,0], "f": 0, "t": 0, "d": [686], "a": 1 },
+						{ "px": [1008,360], "src": [0,0], "f": 0, "t": 0, "d": [687], "a": 1 },
+						{ "px": [0,384], "src": [0,0], "f": 0, "t": 0, "d": [688], "a": 1 },
+						{ "px": [24,384], "src": [24,0], "f": 0, "t": 1, "d": [689], "a": 1 },
+						{ "px": [48,384], "src": [48,0], "f": 0, "t": 2, "d": [690], "a": 1 },
+						{ "px": [72,384], "src": [72,0], "f": 0, "t": 3, "d": [691], "a": 1 },
+						{ "px": [96,384], "src": [0,0], "f": 0, "t": 0, "d": [692], "a": 1 },
+						{ "px": [120,384], "src": [24,0], "f": 0, "t": 1, "d": [693], "a": 1 },
+						{ "px": [144,384], "src": [48,0], "f": 0, "t": 2, "d": [694], "a": 1 },
+						{ "px": [168,384], "src": [72,0], "f": 0, "t": 3, "d": [695], "a": 1 },
+						{ "px": [192,384], "src": [0,0], "f": 0, "t": 0, "d": [696], "a": 1 },
+						{ "px": [216,384], "src": [24,0], "f": 0, "t": 1, "d": [697], "a": 1 },
+						{ "px": [240,384], "src": [48,0], "f": 0, "t": 2, "d": [698], "a": 1 },
+						{ "px": [264,384], "src": [72,0], "f": 0, "t": 3, "d": [699], "a": 1 },
+						{ "px": [288,384], "src": [0,0], "f": 0, "t": 0, "d": [700], "a": 1 },
+						{ "px": [312,384], "src": [24,0], "f": 0, "t": 1, "d": [701], "a": 1 },
+						{ "px": [336,384], "src": [48,0], "f": 0, "t": 2, "d": [702], "a": 1 },
+						{ "px": [360,384], "src": [72,0], "f": 0, "t": 3, "d": [703], "a": 1 },
+						{ "px": [384,384], "src": [0,0], "f": 0, "t": 0, "d": [704], "a": 1 },
+						{ "px": [408,384], "src": [24,0], "f": 0, "t": 1, "d": [705], "a": 1 },
+						{ "px": [432,384], "src": [48,0], "f": 0, "t": 2, "d": [706], "a": 1 },
+						{ "px": [456,384], "src": [72,0], "f": 0, "t": 3, "d": [707], "a": 1 },
+						{ "px": [480,384], "src": [0,0], "f": 0, "t": 0, "d": [708], "a": 1 },
+						{ "px": [504,384], "src": [24,0], "f": 0, "t": 1, "d": [709], "a": 1 },
+						{ "px": [528,384], "src": [48,0], "f": 0, "t": 2, "d": [710], "a": 1 },
+						{ "px": [552,384], "src": [72,0], "f": 0, "t": 3, "d": [711], "a": 1 },
+						{ "px": [576,384], "src": [0,0], "f": 0, "t": 0, "d": [712], "a": 1 },
+						{ "px": [600,384], "src": [24,0], "f": 0, "t": 1, "d": [713], "a": 1 },
+						{ "px": [624,384], "src": [48,0], "f": 0, "t": 2, "d": [714], "a": 1 },
+						{ "px": [648,384], "src": [72,0], "f": 0, "t": 3, "d": [715], "a": 1 },
+						{ "px": [672,384], "src": [0,0], "f": 0, "t": 0, "d": [716], "a": 1 },
+						{ "px": [696,384], "src": [24,0], "f": 0, "t": 1, "d": [717], "a": 1 },
+						{ "px": [720,384], "src": [48,0], "f": 0, "t": 2, "d": [718], "a": 1 },
+						{ "px": [744,384], "src": [72,0], "f": 0, "t": 3, "d": [719], "a": 1 },
+						{ "px": [768,384], "src": [0,0], "f": 0, "t": 0, "d": [720], "a": 1 },
+						{ "px": [792,384], "src": [24,0], "f": 0, "t": 1, "d": [721], "a": 1 },
+						{ "px": [816,384], "src": [48,0], "f": 0, "t": 2, "d": [722], "a": 1 },
+						{ "px": [840,384], "src": [72,0], "f": 0, "t": 3, "d": [723], "a": 1 },
+						{ "px": [864,384], "src": [0,0], "f": 0, "t": 0, "d": [724], "a": 1 },
+						{ "px": [888,384], "src": [24,0], "f": 0, "t": 1, "d": [725], "a": 1 },
+						{ "px": [912,384], "src": [48,0], "f": 0, "t": 2, "d": [726], "a": 1 },
+						{ "px": [936,384], "src": [72,0], "f": 0, "t": 3, "d": [727], "a": 1 },
+						{ "px": [960,384], "src": [0,0], "f": 0, "t": 0, "d": [728], "a": 1 },
+						{ "px": [984,384], "src": [24,0], "f": 0, "t": 1, "d": [729], "a": 1 },
+						{ "px": [1008,384], "src": [48,0], "f": 0, "t": 2, "d": [730], "a": 1 },
+						{ "px": [0,408], "src": [0,0], "f": 0, "t": 0, "d": [731], "a": 1 },
+						{ "px": [24,408], "src": [24,0], "f": 0, "t": 1, "d": [732], "a": 1 },
+						{ "px": [48,408], "src": [48,0], "f": 0, "t": 2, "d": [733], "a": 1 },
+						{ "px": [72,408], "src": [72,0], "f": 0, "t": 3, "d": [734], "a": 1 },
+						{ "px": [96,408], "src": [0,0], "f": 0, "t": 0, "d": [735], "a": 1 },
+						{ "px": [120,408], "src": [24,0], "f": 0, "t": 1, "d": [736], "a": 1 },
+						{ "px": [144,408], "src": [48,0], "f": 0, "t": 2, "d": [737], "a": 1 },
+						{ "px": [168,408], "src": [72,0], "f": 0, "t": 3, "d": [738], "a": 1 },
+						{ "px": [192,408], "src": [0,0], "f": 0, "t": 0, "d": [739], "a": 1 },
+						{ "px": [216,408], "src": [24,0], "f": 0, "t": 1, "d": [740], "a": 1 },
+						{ "px": [240,408], "src": [48,0], "f": 0, "t": 2, "d": [741], "a": 1 },
+						{ "px": [264,408], "src": [72,0], "f": 0, "t": 3, "d": [742], "a": 1 },
+						{ "px": [288,408], "src": [0,0], "f": 0, "t": 0, "d": [743], "a": 1 },
+						{ "px": [312,408], "src": [24,0], "f": 0, "t": 1, "d": [744], "a": 1 },
+						{ "px": [336,408], "src": [48,0], "f": 0, "t": 2, "d": [745], "a": 1 },
+						{ "px": [360,408], "src": [72,0], "f": 0, "t": 3, "d": [746], "a": 1 },
+						{ "px": [384,408], "src": [0,0], "f": 0, "t": 0, "d": [747], "a": 1 },
+						{ "px": [408,408], "src": [24,0], "f": 0, "t": 1, "d": [748], "a": 1 },
+						{ "px": [432,408], "src": [48,0], "f": 0, "t": 2, "d": [749], "a": 1 },
+						{ "px": [456,408], "src": [72,0], "f": 0, "t": 3, "d": [750], "a": 1 },
+						{ "px": [480,408], "src": [0,0], "f": 0, "t": 0, "d": [751], "a": 1 },
+						{ "px": [504,408], "src": [24,0], "f": 0, "t": 1, "d": [752], "a": 1 },
+						{ "px": [528,408], "src": [48,0], "f": 0, "t": 2, "d": [753], "a": 1 },
+						{ "px": [552,408], "src": [72,0], "f": 0, "t": 3, "d": [754], "a": 1 },
+						{ "px": [576,408], "src": [0,0], "f": 0, "t": 0, "d": [755], "a": 1 },
+						{ "px": [600,408], "src": [24,0], "f": 0, "t": 1, "d": [756], "a": 1 },
+						{ "px": [624,408], "src": [48,0], "f": 0, "t": 2, "d": [757], "a": 1 },
+						{ "px": [648,408], "src": [72,0], "f": 0, "t": 3, "d": [758], "a": 1 },
+						{ "px": [672,408], "src": [0,0], "f": 0, "t": 0, "d": [759], "a": 1 },
+						{ "px": [696,408], "src": [24,0], "f": 0, "t": 1, "d": [760], "a": 1 },
+						{ "px": [720,408], "src": [48,0], "f": 0, "t": 2, "d": [761], "a": 1 },
+						{ "px": [744,408], "src": [72,0], "f": 0, "t": 3, "d": [762], "a": 1 },
+						{ "px": [768,408], "src": [0,0], "f": 0, "t": 0, "d": [763], "a": 1 },
+						{ "px": [792,408], "src": [24,0], "f": 0, "t": 1, "d": [764], "a": 1 },
+						{ "px": [816,408], "src": [48,0], "f": 0, "t": 2, "d": [765], "a": 1 },
+						{ "px": [840,408], "src": [72,0], "f": 0, "t": 3, "d": [766], "a": 1 },
+						{ "px": [864,408], "src": [0,0], "f": 0, "t": 0, "d": [767], "a": 1 },
+						{ "px": [888,408], "src": [24,0], "f": 0, "t": 1, "d": [768], "a": 1 },
+						{ "px": [912,408], "src": [48,0], "f": 0, "t": 2, "d": [769], "a": 1 },
+						{ "px": [936,408], "src": [72,0], "f": 0, "t": 3, "d": [770], "a": 1 },
+						{ "px": [960,408], "src": [0,0], "f": 0, "t": 0, "d": [771], "a": 1 },
+						{ "px": [984,408], "src": [24,0], "f": 0, "t": 1, "d": [772], "a": 1 },
+						{ "px": [1008,408], "src": [48,0], "f": 0, "t": 2, "d": [773], "a": 1 },
+						{ "px": [0,432], "src": [0,0], "f": 0, "t": 0, "d": [774], "a": 1 },
+						{ "px": [24,432], "src": [24,0], "f": 0, "t": 1, "d": [775], "a": 1 },
+						{ "px": [48,432], "src": [48,0], "f": 0, "t": 2, "d": [776], "a": 1 },
+						{ "px": [72,432], "src": [72,0], "f": 0, "t": 3, "d": [777], "a": 1 },
+						{ "px": [96,432], "src": [0,0], "f": 0, "t": 0, "d": [778], "a": 1 },
+						{ "px": [120,432], "src": [24,0], "f": 0, "t": 1, "d": [779], "a": 1 },
+						{ "px": [144,432], "src": [48,0], "f": 0, "t": 2, "d": [780], "a": 1 },
+						{ "px": [168,432], "src": [72,0], "f": 0, "t": 3, "d": [781], "a": 1 },
+						{ "px": [192,432], "src": [0,0], "f": 0, "t": 0, "d": [782], "a": 1 },
+						{ "px": [216,432], "src": [24,0], "f": 0, "t": 1, "d": [783], "a": 1 },
+						{ "px": [240,432], "src": [48,0], "f": 0, "t": 2, "d": [784], "a": 1 },
+						{ "px": [264,432], "src": [72,0], "f": 0, "t": 3, "d": [785], "a": 1 },
+						{ "px": [288,432], "src": [0,0], "f": 0, "t": 0, "d": [786], "a": 1 },
+						{ "px": [312,432], "src": [24,0], "f": 0, "t": 1, "d": [787], "a": 1 },
+						{ "px": [336,432], "src": [48,0], "f": 0, "t": 2, "d": [788], "a": 1 },
+						{ "px": [360,432], "src": [72,0], "f": 0, "t": 3, "d": [789], "a": 1 },
+						{ "px": [384,432], "src": [0,0], "f": 0, "t": 0, "d": [790], "a": 1 },
+						{ "px": [408,432], "src": [24,0], "f": 0, "t": 1, "d": [791], "a": 1 },
+						{ "px": [432,432], "src": [48,0], "f": 0, "t": 2, "d": [792], "a": 1 },
+						{ "px": [456,432], "src": [72,0], "f": 0, "t": 3, "d": [793], "a": 1 },
+						{ "px": [480,432], "src": [0,0], "f": 0, "t": 0, "d": [794], "a": 1 },
+						{ "px": [504,432], "src": [24,0], "f": 0, "t": 1, "d": [795], "a": 1 },
+						{ "px": [528,432], "src": [48,0], "f": 0, "t": 2, "d": [796], "a": 1 },
+						{ "px": [552,432], "src": [72,0], "f": 0, "t": 3, "d": [797], "a": 1 },
+						{ "px": [576,432], "src": [0,0], "f": 0, "t": 0, "d": [798], "a": 1 },
+						{ "px": [600,432], "src": [24,0], "f": 0, "t": 1, "d": [799], "a": 1 },
+						{ "px": [624,432], "src": [48,0], "f": 0, "t": 2, "d": [800], "a": 1 },
+						{ "px": [648,432], "src": [72,0], "f": 0, "t": 3, "d": [801], "a": 1 },
+						{ "px": [672,432], "src": [0,0], "f": 0, "t": 0, "d": [802], "a": 1 },
+						{ "px": [696,432], "src": [24,0], "f": 0, "t": 1, "d": [803], "a": 1 },
+						{ "px": [720,432], "src": [48,0], "f": 0, "t": 2, "d": [804], "a": 1 },
+						{ "px": [744,432], "src": [72,0], "f": 0, "t": 3, "d": [805], "a": 1 },
+						{ "px": [768,432], "src": [0,0], "f": 0, "t": 0, "d": [806], "a": 1 },
+						{ "px": [792,432], "src": [24,0], "f": 0, "t": 1, "d": [807], "a": 1 },
+						{ "px": [816,432], "src": [48,0], "f": 0, "t": 2, "d": [808], "a": 1 },
+						{ "px": [840,432], "src": [72,0], "f": 0, "t": 3, "d": [809], "a": 1 },
+						{ "px": [864,432], "src": [0,0], "f": 0, "t": 0, "d": [810], "a": 1 },
+						{ "px": [888,432], "src": [24,0], "f": 0, "t": 1, "d": [811], "a": 1 },
+						{ "px": [912,432], "src": [48,0], "f": 0, "t": 2, "d": [812], "a": 1 },
+						{ "px": [936,432], "src": [72,0], "f": 0, "t": 3, "d": [813], "a": 1 },
+						{ "px": [960,432], "src": [0,0], "f": 0, "t": 0, "d": [814], "a": 1 },
+						{ "px": [984,432], "src": [24,0], "f": 0, "t": 1, "d": [815], "a": 1 },
+						{ "px": [1008,432], "src": [48,0], "f": 0, "t": 2, "d": [816], "a": 1 },
+						{ "px": [0,456], "src": [0,0], "f": 0, "t": 0, "d": [817], "a": 1 },
+						{ "px": [24,456], "src": [24,0], "f": 0, "t": 1, "d": [818], "a": 1 },
+						{ "px": [48,456], "src": [48,0], "f": 0, "t": 2, "d": [819], "a": 1 },
+						{ "px": [72,456], "src": [72,0], "f": 0, "t": 3, "d": [820], "a": 1 },
+						{ "px": [96,456], "src": [0,0], "f": 0, "t": 0, "d": [821], "a": 1 },
+						{ "px": [120,456], "src": [24,0], "f": 0, "t": 1, "d": [822], "a": 1 },
+						{ "px": [144,456], "src": [48,0], "f": 0, "t": 2, "d": [823], "a": 1 },
+						{ "px": [168,456], "src": [72,0], "f": 0, "t": 3, "d": [824], "a": 1 },
+						{ "px": [192,456], "src": [0,0], "f": 0, "t": 0, "d": [825], "a": 1 },
+						{ "px": [216,456], "src": [24,0], "f": 0, "t": 1, "d": [826], "a": 1 },
+						{ "px": [240,456], "src": [48,0], "f": 0, "t": 2, "d": [827], "a": 1 },
+						{ "px": [264,456], "src": [72,0], "f": 0, "t": 3, "d": [828], "a": 1 },
+						{ "px": [288,456], "src": [0,0], "f": 0, "t": 0, "d": [829], "a": 1 },
+						{ "px": [312,456], "src": [24,0], "f": 0, "t": 1, "d": [830], "a": 1 },
+						{ "px": [336,456], "src": [48,0], "f": 0, "t": 2, "d": [831], "a": 1 },
+						{ "px": [360,456], "src": [72,0], "f": 0, "t": 3, "d": [832], "a": 1 },
+						{ "px": [384,456], "src": [0,0], "f": 0, "t": 0, "d": [833], "a": 1 },
+						{ "px": [408,456], "src": [24,0], "f": 0, "t": 1, "d": [834], "a": 1 },
+						{ "px": [432,456], "src": [48,0], "f": 0, "t": 2, "d": [835], "a": 1 },
+						{ "px": [456,456], "src": [72,0], "f": 0, "t": 3, "d": [836], "a": 1 },
+						{ "px": [480,456], "src": [0,0], "f": 0, "t": 0, "d": [837], "a": 1 },
+						{ "px": [504,456], "src": [24,0], "f": 0, "t": 1, "d": [838], "a": 1 },
+						{ "px": [528,456], "src": [48,0], "f": 0, "t": 2, "d": [839], "a": 1 },
+						{ "px": [552,456], "src": [72,0], "f": 0, "t": 3, "d": [840], "a": 1 },
+						{ "px": [576,456], "src": [0,0], "f": 0, "t": 0, "d": [841], "a": 1 },
+						{ "px": [600,456], "src": [24,0], "f": 0, "t": 1, "d": [842], "a": 1 },
+						{ "px": [624,456], "src": [48,0], "f": 0, "t": 2, "d": [843], "a": 1 },
+						{ "px": [648,456], "src": [72,0], "f": 0, "t": 3, "d": [844], "a": 1 },
+						{ "px": [672,456], "src": [0,0], "f": 0, "t": 0, "d": [845], "a": 1 },
+						{ "px": [696,456], "src": [24,0], "f": 0, "t": 1, "d": [846], "a": 1 },
+						{ "px": [720,456], "src": [48,0], "f": 0, "t": 2, "d": [847], "a": 1 },
+						{ "px": [744,456], "src": [72,0], "f": 0, "t": 3, "d": [848], "a": 1 },
+						{ "px": [768,456], "src": [0,0], "f": 0, "t": 0, "d": [849], "a": 1 },
+						{ "px": [792,456], "src": [24,0], "f": 0, "t": 1, "d": [850], "a": 1 },
+						{ "px": [816,456], "src": [48,0], "f": 0, "t": 2, "d": [851], "a": 1 },
+						{ "px": [840,456], "src": [72,0], "f": 0, "t": 3, "d": [852], "a": 1 },
+						{ "px": [864,456], "src": [0,0], "f": 0, "t": 0, "d": [853], "a": 1 },
+						{ "px": [888,456], "src": [24,0], "f": 0, "t": 1, "d": [854], "a": 1 },
+						{ "px": [912,456], "src": [48,0], "f": 0, "t": 2, "d": [855], "a": 1 },
+						{ "px": [936,456], "src": [72,0], "f": 0, "t": 3, "d": [856], "a": 1 },
+						{ "px": [960,456], "src": [0,0], "f": 0, "t": 0, "d": [857], "a": 1 },
+						{ "px": [984,456], "src": [24,0], "f": 0, "t": 1, "d": [858], "a": 1 },
+						{ "px": [1008,456], "src": [48,0], "f": 0, "t": 2, "d": [859], "a": 1 },
+						{ "px": [0,480], "src": [0,0], "f": 0, "t": 0, "d": [860], "a": 1 },
+						{ "px": [24,480], "src": [24,0], "f": 0, "t": 1, "d": [861], "a": 1 },
+						{ "px": [48,480], "src": [48,0], "f": 0, "t": 2, "d": [862], "a": 1 },
+						{ "px": [72,480], "src": [72,0], "f": 0, "t": 3, "d": [863], "a": 1 },
+						{ "px": [96,480], "src": [0,0], "f": 0, "t": 0, "d": [864], "a": 1 },
+						{ "px": [120,480], "src": [24,0], "f": 0, "t": 1, "d": [865], "a": 1 },
+						{ "px": [144,480], "src": [48,0], "f": 0, "t": 2, "d": [866], "a": 1 },
+						{ "px": [168,480], "src": [72,0], "f": 0, "t": 3, "d": [867], "a": 1 },
+						{ "px": [192,480], "src": [0,0], "f": 0, "t": 0, "d": [868], "a": 1 },
+						{ "px": [216,480], "src": [24,0], "f": 0, "t": 1, "d": [869], "a": 1 },
+						{ "px": [240,480], "src": [48,0], "f": 0, "t": 2, "d": [870], "a": 1 },
+						{ "px": [264,480], "src": [72,0], "f": 0, "t": 3, "d": [871], "a": 1 },
+						{ "px": [288,480], "src": [0,0], "f": 0, "t": 0, "d": [872], "a": 1 },
+						{ "px": [312,480], "src": [24,0], "f": 0, "t": 1, "d": [873], "a": 1 },
+						{ "px": [336,480], "src": [48,0], "f": 0, "t": 2, "d": [874], "a": 1 },
+						{ "px": [360,480], "src": [72,0], "f": 0, "t": 3, "d": [875], "a": 1 },
+						{ "px": [384,480], "src": [0,0], "f": 0, "t": 0, "d": [876], "a": 1 },
+						{ "px": [408,480], "src": [24,0], "f": 0, "t": 1, "d": [877], "a": 1 },
+						{ "px": [432,480], "src": [48,0], "f": 0, "t": 2, "d": [878], "a": 1 },
+						{ "px": [456,480], "src": [72,0], "f": 0, "t": 3, "d": [879], "a": 1 },
+						{ "px": [480,480], "src": [0,0], "f": 0, "t": 0, "d": [880], "a": 1 },
+						{ "px": [504,480], "src": [24,0], "f": 0, "t": 1, "d": [881], "a": 1 },
+						{ "px": [528,480], "src": [48,0], "f": 0, "t": 2, "d": [882], "a": 1 },
+						{ "px": [552,480], "src": [72,0], "f": 0, "t": 3, "d": [883], "a": 1 },
+						{ "px": [576,480], "src": [0,0], "f": 0, "t": 0, "d": [884], "a": 1 },
+						{ "px": [600,480], "src": [24,0], "f": 0, "t": 1, "d": [885], "a": 1 },
+						{ "px": [624,480], "src": [48,0], "f": 0, "t": 2, "d": [886], "a": 1 },
+						{ "px": [648,480], "src": [72,0], "f": 0, "t": 3, "d": [887], "a": 1 },
+						{ "px": [672,480], "src": [0,0], "f": 0, "t": 0, "d": [888], "a": 1 },
+						{ "px": [696,480], "src": [24,0], "f": 0, "t": 1, "d": [889], "a": 1 },
+						{ "px": [720,480], "src": [48,0], "f": 0, "t": 2, "d": [890], "a": 1 },
+						{ "px": [744,480], "src": [72,0], "f": 0, "t": 3, "d": [891], "a": 1 },
+						{ "px": [768,480], "src": [0,0], "f": 0, "t": 0, "d": [892], "a": 1 },
+						{ "px": [792,480], "src": [24,0], "f": 0, "t": 1, "d": [893], "a": 1 },
+						{ "px": [816,480], "src": [48,0], "f": 0, "t": 2, "d": [894], "a": 1 },
+						{ "px": [840,480], "src": [72,0], "f": 0, "t": 3, "d": [895], "a": 1 },
+						{ "px": [864,480], "src": [0,0], "f": 0, "t": 0, "d": [896], "a": 1 },
+						{ "px": [888,480], "src": [24,0], "f": 0, "t": 1, "d": [897], "a": 1 },
+						{ "px": [912,480], "src": [48,0], "f": 0, "t": 2, "d": [898], "a": 1 },
+						{ "px": [936,480], "src": [72,0], "f": 0, "t": 3, "d": [899], "a": 1 },
+						{ "px": [960,480], "src": [0,0], "f": 0, "t": 0, "d": [900], "a": 1 },
+						{ "px": [984,480], "src": [24,0], "f": 0, "t": 1, "d": [901], "a": 1 },
+						{ "px": [1008,480], "src": [48,0], "f": 0, "t": 2, "d": [902], "a": 1 },
+						{ "px": [0,504], "src": [0,0], "f": 0, "t": 0, "d": [903], "a": 1 },
+						{ "px": [24,504], "src": [24,0], "f": 0, "t": 1, "d": [904], "a": 1 },
+						{ "px": [48,504], "src": [48,0], "f": 0, "t": 2, "d": [905], "a": 1 },
+						{ "px": [72,504], "src": [72,0], "f": 0, "t": 3, "d": [906], "a": 1 },
+						{ "px": [96,504], "src": [0,0], "f": 0, "t": 0, "d": [907], "a": 1 },
+						{ "px": [120,504], "src": [24,0], "f": 0, "t": 1, "d": [908], "a": 1 },
+						{ "px": [144,504], "src": [48,0], "f": 0, "t": 2, "d": [909], "a": 1 },
+						{ "px": [168,504], "src": [72,0], "f": 0, "t": 3, "d": [910], "a": 1 },
+						{ "px": [192,504], "src": [0,0], "f": 0, "t": 0, "d": [911], "a": 1 },
+						{ "px": [216,504], "src": [24,0], "f": 0, "t": 1, "d": [912], "a": 1 },
+						{ "px": [240,504], "src": [48,0], "f": 0, "t": 2, "d": [913], "a": 1 },
+						{ "px": [264,504], "src": [72,0], "f": 0, "t": 3, "d": [914], "a": 1 },
+						{ "px": [288,504], "src": [0,0], "f": 0, "t": 0, "d": [915], "a": 1 },
+						{ "px": [312,504], "src": [24,0], "f": 0, "t": 1, "d": [916], "a": 1 },
+						{ "px": [336,504], "src": [48,0], "f": 0, "t": 2, "d": [917], "a": 1 },
+						{ "px": [360,504], "src": [72,0], "f": 0, "t": 3, "d": [918], "a": 1 },
+						{ "px": [384,504], "src": [0,0], "f": 0, "t": 0, "d": [919], "a": 1 },
+						{ "px": [408,504], "src": [24,0], "f": 0, "t": 1, "d": [920], "a": 1 },
+						{ "px": [432,504], "src": [48,0], "f": 0, "t": 2, "d": [921], "a": 1 },
+						{ "px": [456,504], "src": [72,0], "f": 0, "t": 3, "d": [922], "a": 1 },
+						{ "px": [480,504], "src": [0,0], "f": 0, "t": 0, "d": [923], "a": 1 },
+						{ "px": [504,504], "src": [24,0], "f": 0, "t": 1, "d": [924], "a": 1 },
+						{ "px": [528,504], "src": [48,0], "f": 0, "t": 2, "d": [925], "a": 1 },
+						{ "px": [552,504], "src": [72,0], "f": 0, "t": 3, "d": [926], "a": 1 },
+						{ "px": [576,504], "src": [0,0], "f": 0, "t": 0, "d": [927], "a": 1 },
+						{ "px": [600,504], "src": [24,0], "f": 0, "t": 1, "d": [928], "a": 1 },
+						{ "px": [624,504], "src": [48,0], "f": 0, "t": 2, "d": [929], "a": 1 },
+						{ "px": [648,504], "src": [72,0], "f": 0, "t": 3, "d": [930], "a": 1 },
+						{ "px": [672,504], "src": [0,0], "f": 0, "t": 0, "d": [931], "a": 1 },
+						{ "px": [696,504], "src": [24,0], "f": 0, "t": 1, "d": [932], "a": 1 },
+						{ "px": [720,504], "src": [48,0], "f": 0, "t": 2, "d": [933], "a": 1 },
+						{ "px": [744,504], "src": [72,0], "f": 0, "t": 3, "d": [934], "a": 1 },
+						{ "px": [768,504], "src": [0,0], "f": 0, "t": 0, "d": [935], "a": 1 },
+						{ "px": [792,504], "src": [24,0], "f": 0, "t": 1, "d": [936], "a": 1 },
+						{ "px": [816,504], "src": [48,0], "f": 0, "t": 2, "d": [937], "a": 1 },
+						{ "px": [840,504], "src": [72,0], "f": 0, "t": 3, "d": [938], "a": 1 },
+						{ "px": [864,504], "src": [0,0], "f": 0, "t": 0, "d": [939], "a": 1 },
+						{ "px": [888,504], "src": [24,0], "f": 0, "t": 1, "d": [940], "a": 1 },
+						{ "px": [912,504], "src": [48,0], "f": 0, "t": 2, "d": [941], "a": 1 },
+						{ "px": [936,504], "src": [72,0], "f": 0, "t": 3, "d": [942], "a": 1 },
+						{ "px": [960,504], "src": [0,0], "f": 0, "t": 0, "d": [943], "a": 1 },
+						{ "px": [984,504], "src": [24,0], "f": 0, "t": 1, "d": [944], "a": 1 },
+						{ "px": [1008,504], "src": [48,0], "f": 0, "t": 2, "d": [945], "a": 1 },
+						{ "px": [0,528], "src": [0,0], "f": 0, "t": 0, "d": [946], "a": 1 },
+						{ "px": [24,528], "src": [24,0], "f": 0, "t": 1, "d": [947], "a": 1 },
+						{ "px": [48,528], "src": [48,0], "f": 0, "t": 2, "d": [948], "a": 1 },
+						{ "px": [72,528], "src": [72,0], "f": 0, "t": 3, "d": [949], "a": 1 },
+						{ "px": [96,528], "src": [0,0], "f": 0, "t": 0, "d": [950], "a": 1 },
+						{ "px": [120,528], "src": [24,0], "f": 0, "t": 1, "d": [951], "a": 1 },
+						{ "px": [144,528], "src": [48,0], "f": 0, "t": 2, "d": [952], "a": 1 },
+						{ "px": [168,528], "src": [72,0], "f": 0, "t": 3, "d": [953], "a": 1 },
+						{ "px": [192,528], "src": [0,0], "f": 0, "t": 0, "d": [954], "a": 1 },
+						{ "px": [216,528], "src": [24,0], "f": 0, "t": 1, "d": [955], "a": 1 },
+						{ "px": [240,528], "src": [48,0], "f": 0, "t": 2, "d": [956], "a": 1 },
+						{ "px": [264,528], "src": [72,0], "f": 0, "t": 3, "d": [957], "a": 1 },
+						{ "px": [288,528], "src": [0,0], "f": 0, "t": 0, "d": [958], "a": 1 },
+						{ "px": [312,528], "src": [24,0], "f": 0, "t": 1, "d": [959], "a": 1 },
+						{ "px": [336,528], "src": [48,0], "f": 0, "t": 2, "d": [960], "a": 1 },
+						{ "px": [360,528], "src": [72,0], "f": 0, "t": 3, "d": [961], "a": 1 },
+						{ "px": [384,528], "src": [0,0], "f": 0, "t": 0, "d": [962], "a": 1 },
+						{ "px": [408,528], "src": [24,0], "f": 0, "t": 1, "d": [963], "a": 1 },
+						{ "px": [432,528], "src": [48,0], "f": 0, "t": 2, "d": [964], "a": 1 },
+						{ "px": [456,528], "src": [72,0], "f": 0, "t": 3, "d": [965], "a": 1 },
+						{ "px": [480,528], "src": [0,0], "f": 0, "t": 0, "d": [966], "a": 1 },
+						{ "px": [504,528], "src": [24,0], "f": 0, "t": 1, "d": [967], "a": 1 },
+						{ "px": [528,528], "src": [48,0], "f": 0, "t": 2, "d": [968], "a": 1 },
+						{ "px": [552,528], "src": [72,0], "f": 0, "t": 3, "d": [969], "a": 1 },
+						{ "px": [576,528], "src": [0,0], "f": 0, "t": 0, "d": [970], "a": 1 },
+						{ "px": [600,528], "src": [24,0], "f": 0, "t": 1, "d": [971], "a": 1 },
+						{ "px": [624,528], "src": [48,0], "f": 0, "t": 2, "d": [972], "a": 1 },
+						{ "px": [648,528], "src": [72,0], "f": 0, "t": 3, "d": [973], "a": 1 },
+						{ "px": [672,528], "src": [0,0], "f": 0, "t": 0, "d": [974], "a": 1 },
+						{ "px": [696,528], "src": [24,0], "f": 0, "t": 1, "d": [975], "a": 1 },
+						{ "px": [720,528], "src": [48,0], "f": 0, "t": 2, "d": [976], "a": 1 },
+						{ "px": [744,528], "src": [72,0], "f": 0, "t": 3, "d": [977], "a": 1 },
+						{ "px": [768,528], "src": [0,0], "f": 0, "t": 0, "d": [978], "a": 1 },
+						{ "px": [792,528], "src": [24,0], "f": 0, "t": 1, "d": [979], "a": 1 },
+						{ "px": [816,528], "src": [48,0], "f": 0, "t": 2, "d": [980], "a": 1 },
+						{ "px": [840,528], "src": [72,0], "f": 0, "t": 3, "d": [981], "a": 1 },
+						{ "px": [864,528], "src": [0,0], "f": 0, "t": 0, "d": [982], "a": 1 },
+						{ "px": [888,528], "src": [24,0], "f": 0, "t": 1, "d": [983], "a": 1 },
+						{ "px": [912,528], "src": [48,0], "f": 0, "t": 2, "d": [984], "a": 1 },
+						{ "px": [936,528], "src": [72,0], "f": 0, "t": 3, "d": [985], "a": 1 },
+						{ "px": [960,528], "src": [0,0], "f": 0, "t": 0, "d": [986], "a": 1 },
+						{ "px": [984,528], "src": [24,0], "f": 0, "t": 1, "d": [987], "a": 1 },
+						{ "px": [1008,528], "src": [48,0], "f": 0, "t": 2, "d": [988], "a": 1 },
+						{ "px": [0,552], "src": [0,0], "f": 0, "t": 0, "d": [989], "a": 1 },
+						{ "px": [24,552], "src": [24,0], "f": 0, "t": 1, "d": [990], "a": 1 },
+						{ "px": [48,552], "src": [48,0], "f": 0, "t": 2, "d": [991], "a": 1 },
+						{ "px": [72,552], "src": [72,0], "f": 0, "t": 3, "d": [992], "a": 1 },
+						{ "px": [96,552], "src": [0,0], "f": 0, "t": 0, "d": [993], "a": 1 },
+						{ "px": [120,552], "src": [24,0], "f": 0, "t": 1, "d": [994], "a": 1 },
+						{ "px": [144,552], "src": [48,0], "f": 0, "t": 2, "d": [995], "a": 1 },
+						{ "px": [168,552], "src": [72,0], "f": 0, "t": 3, "d": [996], "a": 1 },
+						{ "px": [192,552], "src": [0,0], "f": 0, "t": 0, "d": [997], "a": 1 },
+						{ "px": [216,552], "src": [24,0], "f": 0, "t": 1, "d": [998], "a": 1 },
+						{ "px": [240,552], "src": [48,0], "f": 0, "t": 2, "d": [999], "a": 1 },
+						{ "px": [264,552], "src": [72,0], "f": 0, "t": 3, "d": [1000], "a": 1 },
+						{ "px": [288,552], "src": [0,0], "f": 0, "t": 0, "d": [1001], "a": 1 },
+						{ "px": [312,552], "src": [24,0], "f": 0, "t": 1, "d": [1002], "a": 1 },
+						{ "px": [336,552], "src": [48,0], "f": 0, "t": 2, "d": [1003], "a": 1 },
+						{ "px": [360,552], "src": [72,0], "f": 0, "t": 3, "d": [1004], "a": 1 },
+						{ "px": [384,552], "src": [0,0], "f": 0, "t": 0, "d": [1005], "a": 1 },
+						{ "px": [408,552], "src": [24,0], "f": 0, "t": 1, "d": [1006], "a": 1 },
+						{ "px": [432,552], "src": [48,0], "f": 0, "t": 2, "d": [1007], "a": 1 },
+						{ "px": [456,552], "src": [72,0], "f": 0, "t": 3, "d": [1008], "a": 1 },
+						{ "px": [480,552], "src": [0,0], "f": 0, "t": 0, "d": [1009], "a": 1 },
+						{ "px": [504,552], "src": [24,0], "f": 0, "t": 1, "d": [1010], "a": 1 },
+						{ "px": [528,552], "src": [48,0], "f": 0, "t": 2, "d": [1011], "a": 1 },
+						{ "px": [552,552], "src": [72,0], "f": 0, "t": 3, "d": [1012], "a": 1 },
+						{ "px": [576,552], "src": [0,0], "f": 0, "t": 0, "d": [1013], "a": 1 },
+						{ "px": [600,552], "src": [24,0], "f": 0, "t": 1, "d": [1014], "a": 1 },
+						{ "px": [624,552], "src": [48,0], "f": 0, "t": 2, "d": [1015], "a": 1 },
+						{ "px": [648,552], "src": [72,0], "f": 0, "t": 3, "d": [1016], "a": 1 },
+						{ "px": [672,552], "src": [0,0], "f": 0, "t": 0, "d": [1017], "a": 1 },
+						{ "px": [696,552], "src": [24,0], "f": 0, "t": 1, "d": [1018], "a": 1 },
+						{ "px": [720,552], "src": [48,0], "f": 0, "t": 2, "d": [1019], "a": 1 },
+						{ "px": [744,552], "src": [72,0], "f": 0, "t": 3, "d": [1020], "a": 1 },
+						{ "px": [768,552], "src": [0,0], "f": 0, "t": 0, "d": [1021], "a": 1 },
+						{ "px": [792,552], "src": [24,0], "f": 0, "t": 1, "d": [1022], "a": 1 },
+						{ "px": [816,552], "src": [48,0], "f": 0, "t": 2, "d": [1023], "a": 1 },
+						{ "px": [840,552], "src": [72,0], "f": 0, "t": 3, "d": [1024], "a": 1 },
+						{ "px": [864,552], "src": [0,0], "f": 0, "t": 0, "d": [1025], "a": 1 },
+						{ "px": [888,552], "src": [24,0], "f": 0, "t": 1, "d": [1026], "a": 1 },
+						{ "px": [912,552], "src": [48,0], "f": 0, "t": 2, "d": [1027], "a": 1 },
+						{ "px": [936,552], "src": [72,0], "f": 0, "t": 3, "d": [1028], "a": 1 },
+						{ "px": [960,552], "src": [0,0], "f": 0, "t": 0, "d": [1029], "a": 1 },
+						{ "px": [984,552], "src": [24,0], "f": 0, "t": 1, "d": [1030], "a": 1 },
+						{ "px": [1008,552], "src": [48,0], "f": 0, "t": 2, "d": [1031], "a": 1 },
+						{ "px": [0,576], "src": [0,0], "f": 0, "t": 0, "d": [1032], "a": 1 },
+						{ "px": [24,576], "src": [24,0], "f": 0, "t": 1, "d": [1033], "a": 1 },
+						{ "px": [48,576], "src": [48,0], "f": 0, "t": 2, "d": [1034], "a": 1 },
+						{ "px": [72,576], "src": [72,0], "f": 0, "t": 3, "d": [1035], "a": 1 },
+						{ "px": [96,576], "src": [0,0], "f": 0, "t": 0, "d": [1036], "a": 1 },
+						{ "px": [120,576], "src": [24,0], "f": 0, "t": 1, "d": [1037], "a": 1 },
+						{ "px": [144,576], "src": [48,0], "f": 0, "t": 2, "d": [1038], "a": 1 },
+						{ "px": [168,576], "src": [72,0], "f": 0, "t": 3, "d": [1039], "a": 1 },
+						{ "px": [192,576], "src": [0,0], "f": 0, "t": 0, "d": [1040], "a": 1 },
+						{ "px": [216,576], "src": [24,0], "f": 0, "t": 1, "d": [1041], "a": 1 },
+						{ "px": [240,576], "src": [48,0], "f": 0, "t": 2, "d": [1042], "a": 1 },
+						{ "px": [264,576], "src": [72,0], "f": 0, "t": 3, "d": [1043], "a": 1 },
+						{ "px": [288,576], "src": [0,0], "f": 0, "t": 0, "d": [1044], "a": 1 },
+						{ "px": [312,576], "src": [24,0], "f": 0, "t": 1, "d": [1045], "a": 1 },
+						{ "px": [336,576], "src": [48,0], "f": 0, "t": 2, "d": [1046], "a": 1 },
+						{ "px": [360,576], "src": [72,0], "f": 0, "t": 3, "d": [1047], "a": 1 },
+						{ "px": [384,576], "src": [0,0], "f": 0, "t": 0, "d": [1048], "a": 1 },
+						{ "px": [408,576], "src": [24,0], "f": 0, "t": 1, "d": [1049], "a": 1 },
+						{ "px": [432,576], "src": [48,0], "f": 0, "t": 2, "d": [1050], "a": 1 },
+						{ "px": [456,576], "src": [72,0], "f": 0, "t": 3, "d": [1051], "a": 1 },
+						{ "px": [480,576], "src": [0,0], "f": 0, "t": 0, "d": [1052], "a": 1 },
+						{ "px": [504,576], "src": [24,0], "f": 0, "t": 1, "d": [1053], "a": 1 },
+						{ "px": [528,576], "src": [48,0], "f": 0, "t": 2, "d": [1054], "a": 1 },
+						{ "px": [552,576], "src": [72,0], "f": 0, "t": 3, "d": [1055], "a": 1 },
+						{ "px": [576,576], "src": [0,0], "f": 0, "t": 0, "d": [1056], "a": 1 },
+						{ "px": [600,576], "src": [24,0], "f": 0, "t": 1, "d": [1057], "a": 1 },
+						{ "px": [624,576], "src": [48,0], "f": 0, "t": 2, "d": [1058], "a": 1 },
+						{ "px": [648,576], "src": [72,0], "f": 0, "t": 3, "d": [1059], "a": 1 },
+						{ "px": [672,576], "src": [0,0], "f": 0, "t": 0, "d": [1060], "a": 1 },
+						{ "px": [696,576], "src": [24,0], "f": 0, "t": 1, "d": [1061], "a": 1 },
+						{ "px": [720,576], "src": [48,0], "f": 0, "t": 2, "d": [1062], "a": 1 },
+						{ "px": [744,576], "src": [72,0], "f": 0, "t": 3, "d": [1063], "a": 1 },
+						{ "px": [768,576], "src": [0,0], "f": 0, "t": 0, "d": [1064], "a": 1 },
+						{ "px": [792,576], "src": [24,0], "f": 0, "t": 1, "d": [1065], "a": 1 },
+						{ "px": [816,576], "src": [48,0], "f": 0, "t": 2, "d": [1066], "a": 1 },
+						{ "px": [840,576], "src": [72,0], "f": 0, "t": 3, "d": [1067], "a": 1 },
+						{ "px": [864,576], "src": [0,0], "f": 0, "t": 0, "d": [1068], "a": 1 },
+						{ "px": [888,576], "src": [24,0], "f": 0, "t": 1, "d": [1069], "a": 1 },
+						{ "px": [912,576], "src": [48,0], "f": 0, "t": 2, "d": [1070], "a": 1 },
+						{ "px": [936,576], "src": [72,0], "f": 0, "t": 3, "d": [1071], "a": 1 },
+						{ "px": [960,576], "src": [0,0], "f": 0, "t": 0, "d": [1072], "a": 1 },
+						{ "px": [984,576], "src": [24,0], "f": 0, "t": 1, "d": [1073], "a": 1 },
+						{ "px": [1008,576], "src": [48,0], "f": 0, "t": 2, "d": [1074], "a": 1 },
+						{ "px": [0,600], "src": [0,0], "f": 0, "t": 0, "d": [1075], "a": 1 },
+						{ "px": [24,600], "src": [24,0], "f": 0, "t": 1, "d": [1076], "a": 1 },
+						{ "px": [48,600], "src": [48,0], "f": 0, "t": 2, "d": [1077], "a": 1 },
+						{ "px": [72,600], "src": [72,0], "f": 0, "t": 3, "d": [1078], "a": 1 },
+						{ "px": [96,600], "src": [0,0], "f": 0, "t": 0, "d": [1079], "a": 1 },
+						{ "px": [120,600], "src": [24,0], "f": 0, "t": 1, "d": [1080], "a": 1 },
+						{ "px": [144,600], "src": [48,0], "f": 0, "t": 2, "d": [1081], "a": 1 },
+						{ "px": [168,600], "src": [72,0], "f": 0, "t": 3, "d": [1082], "a": 1 },
+						{ "px": [192,600], "src": [0,0], "f": 0, "t": 0, "d": [1083], "a": 1 },
+						{ "px": [216,600], "src": [24,0], "f": 0, "t": 1, "d": [1084], "a": 1 },
+						{ "px": [240,600], "src": [48,0], "f": 0, "t": 2, "d": [1085], "a": 1 },
+						{ "px": [264,600], "src": [72,0], "f": 0, "t": 3, "d": [1086], "a": 1 },
+						{ "px": [288,600], "src": [0,0], "f": 0, "t": 0, "d": [1087], "a": 1 },
+						{ "px": [312,600], "src": [24,0], "f": 0, "t": 1, "d": [1088], "a": 1 },
+						{ "px": [336,600], "src": [48,0], "f": 0, "t": 2, "d": [1089], "a": 1 },
+						{ "px": [360,600], "src": [72,0], "f": 0, "t": 3, "d": [1090], "a": 1 },
+						{ "px": [384,600], "src": [0,0], "f": 0, "t": 0, "d": [1091], "a": 1 },
+						{ "px": [408,600], "src": [24,0], "f": 0, "t": 1, "d": [1092], "a": 1 },
+						{ "px": [432,600], "src": [48,0], "f": 0, "t": 2, "d": [1093], "a": 1 },
+						{ "px": [456,600], "src": [72,0], "f": 0, "t": 3, "d": [1094], "a": 1 },
+						{ "px": [480,600], "src": [0,0], "f": 0, "t": 0, "d": [1095], "a": 1 },
+						{ "px": [504,600], "src": [24,0], "f": 0, "t": 1, "d": [1096], "a": 1 },
+						{ "px": [528,600], "src": [48,0], "f": 0, "t": 2, "d": [1097], "a": 1 },
+						{ "px": [552,600], "src": [72,0], "f": 0, "t": 3, "d": [1098], "a": 1 },
+						{ "px": [576,600], "src": [0,0], "f": 0, "t": 0, "d": [1099], "a": 1 },
+						{ "px": [600,600], "src": [24,0], "f": 0, "t": 1, "d": [1100], "a": 1 },
+						{ "px": [624,600], "src": [48,0], "f": 0, "t": 2, "d": [1101], "a": 1 },
+						{ "px": [648,600], "src": [72,0], "f": 0, "t": 3, "d": [1102], "a": 1 },
+						{ "px": [672,600], "src": [0,0], "f": 0, "t": 0, "d": [1103], "a": 1 },
+						{ "px": [696,600], "src": [24,0], "f": 0, "t": 1, "d": [1104], "a": 1 },
+						{ "px": [720,600], "src": [48,0], "f": 0, "t": 2, "d": [1105], "a": 1 },
+						{ "px": [744,600], "src": [72,0], "f": 0, "t": 3, "d": [1106], "a": 1 },
+						{ "px": [768,600], "src": [0,0], "f": 0, "t": 0, "d": [1107], "a": 1 },
+						{ "px": [792,600], "src": [24,0], "f": 0, "t": 1, "d": [1108], "a": 1 },
+						{ "px": [816,600], "src": [48,0], "f": 0, "t": 2, "d": [1109], "a": 1 },
+						{ "px": [840,600], "src": [72,0], "f": 0, "t": 3, "d": [1110], "a": 1 },
+						{ "px": [864,600], "src": [0,0], "f": 0, "t": 0, "d": [1111], "a": 1 },
+						{ "px": [888,600], "src": [24,0], "f": 0, "t": 1, "d": [1112], "a": 1 },
+						{ "px": [912,600], "src": [48,0], "f": 0, "t": 2, "d": [1113], "a": 1 },
+						{ "px": [936,600], "src": [72,0], "f": 0, "t": 3, "d": [1114], "a": 1 },
+						{ "px": [960,600], "src": [0,0], "f": 0, "t": 0, "d": [1115], "a": 1 },
+						{ "px": [984,600], "src": [24,0], "f": 0, "t": 1, "d": [1116], "a": 1 },
+						{ "px": [1008,600], "src": [48,0], "f": 0, "t": 2, "d": [1117], "a": 1 },
+						{ "px": [0,624], "src": [0,0], "f": 0, "t": 0, "d": [1118], "a": 1 },
+						{ "px": [24,624], "src": [24,0], "f": 0, "t": 1, "d": [1119], "a": 1 },
+						{ "px": [48,624], "src": [48,0], "f": 0, "t": 2, "d": [1120], "a": 1 },
+						{ "px": [72,624], "src": [72,0], "f": 0, "t": 3, "d": [1121], "a": 1 },
+						{ "px": [96,624], "src": [0,0], "f": 0, "t": 0, "d": [1122], "a": 1 },
+						{ "px": [120,624], "src": [24,0], "f": 0, "t": 1, "d": [1123], "a": 1 },
+						{ "px": [144,624], "src": [48,0], "f": 0, "t": 2, "d": [1124], "a": 1 },
+						{ "px": [168,624], "src": [72,0], "f": 0, "t": 3, "d": [1125], "a": 1 },
+						{ "px": [192,624], "src": [0,0], "f": 0, "t": 0, "d": [1126], "a": 1 },
+						{ "px": [216,624], "src": [24,0], "f": 0, "t": 1, "d": [1127], "a": 1 },
+						{ "px": [240,624], "src": [48,0], "f": 0, "t": 2, "d": [1128], "a": 1 },
+						{ "px": [264,624], "src": [72,0], "f": 0, "t": 3, "d": [1129], "a": 1 },
+						{ "px": [288,624], "src": [0,0], "f": 0, "t": 0, "d": [1130], "a": 1 },
+						{ "px": [312,624], "src": [24,0], "f": 0, "t": 1, "d": [1131], "a": 1 },
+						{ "px": [336,624], "src": [48,0], "f": 0, "t": 2, "d": [1132], "a": 1 },
+						{ "px": [360,624], "src": [72,0], "f": 0, "t": 3, "d": [1133], "a": 1 },
+						{ "px": [384,624], "src": [0,0], "f": 0, "t": 0, "d": [1134], "a": 1 },
+						{ "px": [408,624], "src": [24,0], "f": 0, "t": 1, "d": [1135], "a": 1 },
+						{ "px": [432,624], "src": [48,0], "f": 0, "t": 2, "d": [1136], "a": 1 },
+						{ "px": [456,624], "src": [72,0], "f": 0, "t": 3, "d": [1137], "a": 1 },
+						{ "px": [480,624], "src": [0,0], "f": 0, "t": 0, "d": [1138], "a": 1 },
+						{ "px": [504,624], "src": [24,0], "f": 0, "t": 1, "d": [1139], "a": 1 },
+						{ "px": [528,624], "src": [48,0], "f": 0, "t": 2, "d": [1140], "a": 1 },
+						{ "px": [552,624], "src": [72,0], "f": 0, "t": 3, "d": [1141], "a": 1 },
+						{ "px": [576,624], "src": [0,0], "f": 0, "t": 0, "d": [1142], "a": 1 },
+						{ "px": [600,624], "src": [24,0], "f": 0, "t": 1, "d": [1143], "a": 1 },
+						{ "px": [624,624], "src": [48,0], "f": 0, "t": 2, "d": [1144], "a": 1 },
+						{ "px": [648,624], "src": [72,0], "f": 0, "t": 3, "d": [1145], "a": 1 },
+						{ "px": [672,624], "src": [0,0], "f": 0, "t": 0, "d": [1146], "a": 1 },
+						{ "px": [696,624], "src": [24,0], "f": 0, "t": 1, "d": [1147], "a": 1 },
+						{ "px": [720,624], "src": [48,0], "f": 0, "t": 2, "d": [1148], "a": 1 },
+						{ "px": [744,624], "src": [72,0], "f": 0, "t": 3, "d": [1149], "a": 1 },
+						{ "px": [768,624], "src": [0,0], "f": 0, "t": 0, "d": [1150], "a": 1 },
+						{ "px": [792,624], "src": [24,0], "f": 0, "t": 1, "d": [1151], "a": 1 },
+						{ "px": [816,624], "src": [48,0], "f": 0, "t": 2, "d": [1152], "a": 1 },
+						{ "px": [840,624], "src": [72,0], "f": 0, "t": 3, "d": [1153], "a": 1 },
+						{ "px": [864,624], "src": [0,0], "f": 0, "t": 0, "d": [1154], "a": 1 },
+						{ "px": [888,624], "src": [24,0], "f": 0, "t": 1, "d": [1155], "a": 1 },
+						{ "px": [912,624], "src": [48,0], "f": 0, "t": 2, "d": [1156], "a": 1 },
+						{ "px": [936,624], "src": [72,0], "f": 0, "t": 3, "d": [1157], "a": 1 },
+						{ "px": [960,624], "src": [0,0], "f": 0, "t": 0, "d": [1158], "a": 1 },
+						{ "px": [984,624], "src": [24,0], "f": 0, "t": 1, "d": [1159], "a": 1 },
+						{ "px": [1008,624], "src": [48,0], "f": 0, "t": 2, "d": [1160], "a": 1 },
+						{ "px": [0,648], "src": [0,0], "f": 0, "t": 0, "d": [1161], "a": 1 },
+						{ "px": [24,648], "src": [24,0], "f": 0, "t": 1, "d": [1162], "a": 1 },
+						{ "px": [48,648], "src": [48,0], "f": 0, "t": 2, "d": [1163], "a": 1 },
+						{ "px": [72,648], "src": [72,0], "f": 0, "t": 3, "d": [1164], "a": 1 },
+						{ "px": [96,648], "src": [0,0], "f": 0, "t": 0, "d": [1165], "a": 1 },
+						{ "px": [120,648], "src": [24,0], "f": 0, "t": 1, "d": [1166], "a": 1 },
+						{ "px": [144,648], "src": [48,0], "f": 0, "t": 2, "d": [1167], "a": 1 },
+						{ "px": [168,648], "src": [72,0], "f": 0, "t": 3, "d": [1168], "a": 1 },
+						{ "px": [192,648], "src": [0,0], "f": 0, "t": 0, "d": [1169], "a": 1 },
+						{ "px": [216,648], "src": [24,0], "f": 0, "t": 1, "d": [1170], "a": 1 },
+						{ "px": [240,648], "src": [48,0], "f": 0, "t": 2, "d": [1171], "a": 1 },
+						{ "px": [264,648], "src": [72,0], "f": 0, "t": 3, "d": [1172], "a": 1 },
+						{ "px": [288,648], "src": [0,0], "f": 0, "t": 0, "d": [1173], "a": 1 },
+						{ "px": [312,648], "src": [24,0], "f": 0, "t": 1, "d": [1174], "a": 1 },
+						{ "px": [336,648], "src": [48,0], "f": 0, "t": 2, "d": [1175], "a": 1 },
+						{ "px": [360,648], "src": [72,0], "f": 0, "t": 3, "d": [1176], "a": 1 },
+						{ "px": [384,648], "src": [0,0], "f": 0, "t": 0, "d": [1177], "a": 1 },
+						{ "px": [408,648], "src": [24,0], "f": 0, "t": 1, "d": [1178], "a": 1 },
+						{ "px": [432,648], "src": [48,0], "f": 0, "t": 2, "d": [1179], "a": 1 },
+						{ "px": [456,648], "src": [72,0], "f": 0, "t": 3, "d": [1180], "a": 1 },
+						{ "px": [480,648], "src": [0,0], "f": 0, "t": 0, "d": [1181], "a": 1 },
+						{ "px": [504,648], "src": [24,0], "f": 0, "t": 1, "d": [1182], "a": 1 },
+						{ "px": [528,648], "src": [48,0], "f": 0, "t": 2, "d": [1183], "a": 1 },
+						{ "px": [552,648], "src": [72,0], "f": 0, "t": 3, "d": [1184], "a": 1 },
+						{ "px": [576,648], "src": [0,0], "f": 0, "t": 0, "d": [1185], "a": 1 },
+						{ "px": [600,648], "src": [24,0], "f": 0, "t": 1, "d": [1186], "a": 1 },
+						{ "px": [624,648], "src": [48,0], "f": 0, "t": 2, "d": [1187], "a": 1 },
+						{ "px": [648,648], "src": [72,0], "f": 0, "t": 3, "d": [1188], "a": 1 },
+						{ "px": [672,648], "src": [0,0], "f": 0, "t": 0, "d": [1189], "a": 1 },
+						{ "px": [696,648], "src": [24,0], "f": 0, "t": 1, "d": [1190], "a": 1 },
+						{ "px": [720,648], "src": [48,0], "f": 0, "t": 2, "d": [1191], "a": 1 },
+						{ "px": [744,648], "src": [72,0], "f": 0, "t": 3, "d": [1192], "a": 1 },
+						{ "px": [768,648], "src": [0,0], "f": 0, "t": 0, "d": [1193], "a": 1 },
+						{ "px": [792,648], "src": [24,0], "f": 0, "t": 1, "d": [1194], "a": 1 },
+						{ "px": [816,648], "src": [48,0], "f": 0, "t": 2, "d": [1195], "a": 1 },
+						{ "px": [840,648], "src": [72,0], "f": 0, "t": 3, "d": [1196], "a": 1 },
+						{ "px": [864,648], "src": [0,0], "f": 0, "t": 0, "d": [1197], "a": 1 },
+						{ "px": [888,648], "src": [24,0], "f": 0, "t": 1, "d": [1198], "a": 1 },
+						{ "px": [912,648], "src": [48,0], "f": 0, "t": 2, "d": [1199], "a": 1 },
+						{ "px": [936,648], "src": [72,0], "f": 0, "t": 3, "d": [1200], "a": 1 },
+						{ "px": [960,648], "src": [0,0], "f": 0, "t": 0, "d": [1201], "a": 1 },
+						{ "px": [984,648], "src": [24,0], "f": 0, "t": 1, "d": [1202], "a": 1 },
+						{ "px": [1008,648], "src": [48,0], "f": 0, "t": 2, "d": [1203], "a": 1 },
+						{ "px": [0,672], "src": [0,0], "f": 0, "t": 0, "d": [1204], "a": 1 },
+						{ "px": [24,672], "src": [24,0], "f": 0, "t": 1, "d": [1205], "a": 1 },
+						{ "px": [48,672], "src": [48,0], "f": 0, "t": 2, "d": [1206], "a": 1 },
+						{ "px": [72,672], "src": [72,0], "f": 0, "t": 3, "d": [1207], "a": 1 },
+						{ "px": [96,672], "src": [0,0], "f": 0, "t": 0, "d": [1208], "a": 1 },
+						{ "px": [120,672], "src": [24,0], "f": 0, "t": 1, "d": [1209], "a": 1 },
+						{ "px": [144,672], "src": [48,0], "f": 0, "t": 2, "d": [1210], "a": 1 },
+						{ "px": [168,672], "src": [72,0], "f": 0, "t": 3, "d": [1211], "a": 1 },
+						{ "px": [192,672], "src": [0,0], "f": 0, "t": 0, "d": [1212], "a": 1 },
+						{ "px": [216,672], "src": [24,0], "f": 0, "t": 1, "d": [1213], "a": 1 },
+						{ "px": [240,672], "src": [48,0], "f": 0, "t": 2, "d": [1214], "a": 1 },
+						{ "px": [264,672], "src": [72,0], "f": 0, "t": 3, "d": [1215], "a": 1 },
+						{ "px": [288,672], "src": [0,0], "f": 0, "t": 0, "d": [1216], "a": 1 },
+						{ "px": [312,672], "src": [24,0], "f": 0, "t": 1, "d": [1217], "a": 1 },
+						{ "px": [336,672], "src": [48,0], "f": 0, "t": 2, "d": [1218], "a": 1 },
+						{ "px": [360,672], "src": [72,0], "f": 0, "t": 3, "d": [1219], "a": 1 },
+						{ "px": [384,672], "src": [0,0], "f": 0, "t": 0, "d": [1220], "a": 1 },
+						{ "px": [408,672], "src": [24,0], "f": 0, "t": 1, "d": [1221], "a": 1 },
+						{ "px": [432,672], "src": [48,0], "f": 0, "t": 2, "d": [1222], "a": 1 },
+						{ "px": [456,672], "src": [72,0], "f": 0, "t": 3, "d": [1223], "a": 1 },
+						{ "px": [480,672], "src": [0,0], "f": 0, "t": 0, "d": [1224], "a": 1 },
+						{ "px": [504,672], "src": [24,0], "f": 0, "t": 1, "d": [1225], "a": 1 },
+						{ "px": [528,672], "src": [48,0], "f": 0, "t": 2, "d": [1226], "a": 1 },
+						{ "px": [552,672], "src": [72,0], "f": 0, "t": 3, "d": [1227], "a": 1 },
+						{ "px": [576,672], "src": [0,0], "f": 0, "t": 0, "d": [1228], "a": 1 },
+						{ "px": [600,672], "src": [24,0], "f": 0, "t": 1, "d": [1229], "a": 1 },
+						{ "px": [624,672], "src": [48,0], "f": 0, "t": 2, "d": [1230], "a": 1 },
+						{ "px": [648,672], "src": [72,0], "f": 0, "t": 3, "d": [1231], "a": 1 },
+						{ "px": [672,672], "src": [0,0], "f": 0, "t": 0, "d": [1232], "a": 1 },
+						{ "px": [696,672], "src": [24,0], "f": 0, "t": 1, "d": [1233], "a": 1 },
+						{ "px": [720,672], "src": [48,0], "f": 0, "t": 2, "d": [1234], "a": 1 },
+						{ "px": [744,672], "src": [72,0], "f": 0, "t": 3, "d": [1235], "a": 1 },
+						{ "px": [768,672], "src": [0,0], "f": 0, "t": 0, "d": [1236], "a": 1 },
+						{ "px": [792,672], "src": [24,0], "f": 0, "t": 1, "d": [1237], "a": 1 },
+						{ "px": [816,672], "src": [48,0], "f": 0, "t": 2, "d": [1238], "a": 1 },
+						{ "px": [840,672], "src": [72,0], "f": 0, "t": 3, "d": [1239], "a": 1 },
+						{ "px": [864,672], "src": [0,0], "f": 0, "t": 0, "d": [1240], "a": 1 },
+						{ "px": [888,672], "src": [24,0], "f": 0, "t": 1, "d": [1241], "a": 1 },
+						{ "px": [912,672], "src": [48,0], "f": 0, "t": 2, "d": [1242], "a": 1 },
+						{ "px": [936,672], "src": [72,0], "f": 0, "t": 3, "d": [1243], "a": 1 },
+						{ "px": [960,672], "src": [0,0], "f": 0, "t": 0, "d": [1244], "a": 1 },
+						{ "px": [984,672], "src": [24,0], "f": 0, "t": 1, "d": [1245], "a": 1 },
+						{ "px": [1008,672], "src": [48,0], "f": 0, "t": 2, "d": [1246], "a": 1 },
+						{ "px": [0,696], "src": [0,0], "f": 0, "t": 0, "d": [1247], "a": 1 },
+						{ "px": [24,696], "src": [24,0], "f": 0, "t": 1, "d": [1248], "a": 1 },
+						{ "px": [48,696], "src": [48,0], "f": 0, "t": 2, "d": [1249], "a": 1 },
+						{ "px": [72,696], "src": [72,0], "f": 0, "t": 3, "d": [1250], "a": 1 },
+						{ "px": [96,696], "src": [0,0], "f": 0, "t": 0, "d": [1251], "a": 1 },
+						{ "px": [120,696], "src": [24,0], "f": 0, "t": 1, "d": [1252], "a": 1 },
+						{ "px": [144,696], "src": [48,0], "f": 0, "t": 2, "d": [1253], "a": 1 },
+						{ "px": [168,696], "src": [72,0], "f": 0, "t": 3, "d": [1254], "a": 1 },
+						{ "px": [192,696], "src": [0,0], "f": 0, "t": 0, "d": [1255], "a": 1 },
+						{ "px": [216,696], "src": [24,0], "f": 0, "t": 1, "d": [1256], "a": 1 },
+						{ "px": [240,696], "src": [48,0], "f": 0, "t": 2, "d": [1257], "a": 1 },
+						{ "px": [264,696], "src": [72,0], "f": 0, "t": 3, "d": [1258], "a": 1 },
+						{ "px": [288,696], "src": [0,0], "f": 0, "t": 0, "d": [1259], "a": 1 },
+						{ "px": [312,696], "src": [24,0], "f": 0, "t": 1, "d": [1260], "a": 1 },
+						{ "px": [336,696], "src": [48,0], "f": 0, "t": 2, "d": [1261], "a": 1 },
+						{ "px": [360,696], "src": [72,0], "f": 0, "t": 3, "d": [1262], "a": 1 },
+						{ "px": [384,696], "src": [0,0], "f": 0, "t": 0, "d": [1263], "a": 1 },
+						{ "px": [408,696], "src": [24,0], "f": 0, "t": 1, "d": [1264], "a": 1 },
+						{ "px": [432,696], "src": [48,0], "f": 0, "t": 2, "d": [1265], "a": 1 },
+						{ "px": [456,696], "src": [72,0], "f": 0, "t": 3, "d": [1266], "a": 1 },
+						{ "px": [480,696], "src": [0,0], "f": 0, "t": 0, "d": [1267], "a": 1 },
+						{ "px": [504,696], "src": [24,0], "f": 0, "t": 1, "d": [1268], "a": 1 },
+						{ "px": [528,696], "src": [48,0], "f": 0, "t": 2, "d": [1269], "a": 1 },
+						{ "px": [552,696], "src": [72,0], "f": 0, "t": 3, "d": [1270], "a": 1 },
+						{ "px": [576,696], "src": [0,0], "f": 0, "t": 0, "d": [1271], "a": 1 },
+						{ "px": [600,696], "src": [24,0], "f": 0, "t": 1, "d": [1272], "a": 1 },
+						{ "px": [624,696], "src": [48,0], "f": 0, "t": 2, "d": [1273], "a": 1 },
+						{ "px": [648,696], "src": [72,0], "f": 0, "t": 3, "d": [1274], "a": 1 },
+						{ "px": [672,696], "src": [0,0], "f": 0, "t": 0, "d": [1275], "a": 1 },
+						{ "px": [696,696], "src": [24,0], "f": 0, "t": 1, "d": [1276], "a": 1 },
+						{ "px": [720,696], "src": [48,0], "f": 0, "t": 2, "d": [1277], "a": 1 },
+						{ "px": [744,696], "src": [72,0], "f": 0, "t": 3, "d": [1278], "a": 1 },
+						{ "px": [768,696], "src": [0,0], "f": 0, "t": 0, "d": [1279], "a": 1 },
+						{ "px": [792,696], "src": [24,0], "f": 0, "t": 1, "d": [1280], "a": 1 },
+						{ "px": [816,696], "src": [48,0], "f": 0, "t": 2, "d": [1281], "a": 1 },
+						{ "px": [840,696], "src": [72,0], "f": 0, "t": 3, "d": [1282], "a": 1 },
+						{ "px": [864,696], "src": [0,0], "f": 0, "t": 0, "d": [1283], "a": 1 },
+						{ "px": [888,696], "src": [24,0], "f": 0, "t": 1, "d": [1284], "a": 1 },
+						{ "px": [912,696], "src": [48,0], "f": 0, "t": 2, "d": [1285], "a": 1 },
+						{ "px": [936,696], "src": [72,0], "f": 0, "t": 3, "d": [1286], "a": 1 },
+						{ "px": [960,696], "src": [0,0], "f": 0, "t": 0, "d": [1287], "a": 1 },
+						{ "px": [984,696], "src": [24,0], "f": 0, "t": 1, "d": [1288], "a": 1 },
+						{ "px": [1008,696], "src": [48,0], "f": 0, "t": 2, "d": [1289], "a": 1 },
+						{ "px": [0,720], "src": [0,0], "f": 0, "t": 0, "d": [1290], "a": 1 },
+						{ "px": [24,720], "src": [24,0], "f": 0, "t": 1, "d": [1291], "a": 1 },
+						{ "px": [48,720], "src": [48,0], "f": 0, "t": 2, "d": [1292], "a": 1 },
+						{ "px": [72,720], "src": [72,0], "f": 0, "t": 3, "d": [1293], "a": 1 },
+						{ "px": [96,720], "src": [0,0], "f": 0, "t": 0, "d": [1294], "a": 1 },
+						{ "px": [120,720], "src": [24,0], "f": 0, "t": 1, "d": [1295], "a": 1 },
+						{ "px": [144,720], "src": [48,0], "f": 0, "t": 2, "d": [1296], "a": 1 },
+						{ "px": [168,720], "src": [72,0], "f": 0, "t": 3, "d": [1297], "a": 1 },
+						{ "px": [192,720], "src": [0,0], "f": 0, "t": 0, "d": [1298], "a": 1 },
+						{ "px": [216,720], "src": [24,0], "f": 0, "t": 1, "d": [1299], "a": 1 },
+						{ "px": [240,720], "src": [48,0], "f": 0, "t": 2, "d": [1300], "a": 1 },
+						{ "px": [264,720], "src": [72,0], "f": 0, "t": 3, "d": [1301], "a": 1 },
+						{ "px": [288,720], "src": [0,0], "f": 0, "t": 0, "d": [1302], "a": 1 },
+						{ "px": [312,720], "src": [24,0], "f": 0, "t": 1, "d": [1303], "a": 1 },
+						{ "px": [336,720], "src": [48,0], "f": 0, "t": 2, "d": [1304], "a": 1 },
+						{ "px": [360,720], "src": [72,0], "f": 0, "t": 3, "d": [1305], "a": 1 },
+						{ "px": [384,720], "src": [0,0], "f": 0, "t": 0, "d": [1306], "a": 1 },
+						{ "px": [408,720], "src": [24,0], "f": 0, "t": 1, "d": [1307], "a": 1 },
+						{ "px": [432,720], "src": [48,0], "f": 0, "t": 2, "d": [1308], "a": 1 },
+						{ "px": [456,720], "src": [72,0], "f": 0, "t": 3, "d": [1309], "a": 1 },
+						{ "px": [480,720], "src": [0,0], "f": 0, "t": 0, "d": [1310], "a": 1 },
+						{ "px": [504,720], "src": [24,0], "f": 0, "t": 1, "d": [1311], "a": 1 },
+						{ "px": [528,720], "src": [48,0], "f": 0, "t": 2, "d": [1312], "a": 1 },
+						{ "px": [552,720], "src": [72,0], "f": 0, "t": 3, "d": [1313], "a": 1 },
+						{ "px": [576,720], "src": [0,0], "f": 0, "t": 0, "d": [1314], "a": 1 },
+						{ "px": [600,720], "src": [24,0], "f": 0, "t": 1, "d": [1315], "a": 1 },
+						{ "px": [624,720], "src": [48,0], "f": 0, "t": 2, "d": [1316], "a": 1 },
+						{ "px": [648,720], "src": [72,0], "f": 0, "t": 3, "d": [1317], "a": 1 },
+						{ "px": [672,720], "src": [0,0], "f": 0, "t": 0, "d": [1318], "a": 1 },
+						{ "px": [696,720], "src": [24,0], "f": 0, "t": 1, "d": [1319], "a": 1 },
+						{ "px": [720,720], "src": [48,0], "f": 0, "t": 2, "d": [1320], "a": 1 },
+						{ "px": [744,720], "src": [72,0], "f": 0, "t": 3, "d": [1321], "a": 1 },
+						{ "px": [768,720], "src": [0,0], "f": 0, "t": 0, "d": [1322], "a": 1 },
+						{ "px": [792,720], "src": [24,0], "f": 0, "t": 1, "d": [1323], "a": 1 },
+						{ "px": [816,720], "src": [48,0], "f": 0, "t": 2, "d": [1324], "a": 1 },
+						{ "px": [840,720], "src": [72,0], "f": 0, "t": 3, "d": [1325], "a": 1 },
+						{ "px": [864,720], "src": [0,0], "f": 0, "t": 0, "d": [1326], "a": 1 },
+						{ "px": [888,720], "src": [24,0], "f": 0, "t": 1, "d": [1327], "a": 1 },
+						{ "px": [912,720], "src": [48,0], "f": 0, "t": 2, "d": [1328], "a": 1 },
+						{ "px": [936,720], "src": [72,0], "f": 0, "t": 3, "d": [1329], "a": 1 },
+						{ "px": [960,720], "src": [0,0], "f": 0, "t": 0, "d": [1330], "a": 1 },
+						{ "px": [984,720], "src": [24,0], "f": 0, "t": 1, "d": [1331], "a": 1 },
+						{ "px": [1008,720], "src": [48,0], "f": 0, "t": 2, "d": [1332], "a": 1 },
+						{ "px": [0,744], "src": [0,0], "f": 0, "t": 0, "d": [1333], "a": 1 },
+						{ "px": [24,744], "src": [24,0], "f": 0, "t": 1, "d": [1334], "a": 1 },
+						{ "px": [48,744], "src": [48,0], "f": 0, "t": 2, "d": [1335], "a": 1 },
+						{ "px": [72,744], "src": [72,0], "f": 0, "t": 3, "d": [1336], "a": 1 },
+						{ "px": [96,744], "src": [0,0], "f": 0, "t": 0, "d": [1337], "a": 1 },
+						{ "px": [120,744], "src": [24,0], "f": 0, "t": 1, "d": [1338], "a": 1 },
+						{ "px": [144,744], "src": [48,0], "f": 0, "t": 2, "d": [1339], "a": 1 },
+						{ "px": [168,744], "src": [72,0], "f": 0, "t": 3, "d": [1340], "a": 1 },
+						{ "px": [192,744], "src": [0,0], "f": 0, "t": 0, "d": [1341], "a": 1 },
+						{ "px": [216,744], "src": [24,0], "f": 0, "t": 1, "d": [1342], "a": 1 },
+						{ "px": [240,744], "src": [48,0], "f": 0, "t": 2, "d": [1343], "a": 1 },
+						{ "px": [264,744], "src": [72,0], "f": 0, "t": 3, "d": [1344], "a": 1 },
+						{ "px": [288,744], "src": [0,0], "f": 0, "t": 0, "d": [1345], "a": 1 },
+						{ "px": [312,744], "src": [24,0], "f": 0, "t": 1, "d": [1346], "a": 1 },
+						{ "px": [336,744], "src": [48,0], "f": 0, "t": 2, "d": [1347], "a": 1 },
+						{ "px": [360,744], "src": [72,0], "f": 0, "t": 3, "d": [1348], "a": 1 },
+						{ "px": [384,744], "src": [0,0], "f": 0, "t": 0, "d": [1349], "a": 1 },
+						{ "px": [408,744], "src": [24,0], "f": 0, "t": 1, "d": [1350], "a": 1 },
+						{ "px": [432,744], "src": [48,0], "f": 0, "t": 2, "d": [1351], "a": 1 },
+						{ "px": [456,744], "src": [72,0], "f": 0, "t": 3, "d": [1352], "a": 1 },
+						{ "px": [480,744], "src": [0,0], "f": 0, "t": 0, "d": [1353], "a": 1 },
+						{ "px": [504,744], "src": [24,0], "f": 0, "t": 1, "d": [1354], "a": 1 },
+						{ "px": [528,744], "src": [48,0], "f": 0, "t": 2, "d": [1355], "a": 1 },
+						{ "px": [552,744], "src": [72,0], "f": 0, "t": 3, "d": [1356], "a": 1 },
+						{ "px": [576,744], "src": [0,0], "f": 0, "t": 0, "d": [1357], "a": 1 },
+						{ "px": [600,744], "src": [24,0], "f": 0, "t": 1, "d": [1358], "a": 1 },
+						{ "px": [624,744], "src": [48,0], "f": 0, "t": 2, "d": [1359], "a": 1 },
+						{ "px": [648,744], "src": [72,0], "f": 0, "t": 3, "d": [1360], "a": 1 },
+						{ "px": [672,744], "src": [0,0], "f": 0, "t": 0, "d": [1361], "a": 1 },
+						{ "px": [696,744], "src": [24,0], "f": 0, "t": 1, "d": [1362], "a": 1 },
+						{ "px": [720,744], "src": [48,0], "f": 0, "t": 2, "d": [1363], "a": 1 },
+						{ "px": [744,744], "src": [72,0], "f": 0, "t": 3, "d": [1364], "a": 1 },
+						{ "px": [768,744], "src": [0,0], "f": 0, "t": 0, "d": [1365], "a": 1 },
+						{ "px": [792,744], "src": [24,0], "f": 0, "t": 1, "d": [1366], "a": 1 },
+						{ "px": [816,744], "src": [48,0], "f": 0, "t": 2, "d": [1367], "a": 1 },
+						{ "px": [840,744], "src": [72,0], "f": 0, "t": 3, "d": [1368], "a": 1 },
+						{ "px": [864,744], "src": [0,0], "f": 0, "t": 0, "d": [1369], "a": 1 },
+						{ "px": [888,744], "src": [24,0], "f": 0, "t": 1, "d": [1370], "a": 1 },
+						{ "px": [912,744], "src": [48,0], "f": 0, "t": 2, "d": [1371], "a": 1 },
+						{ "px": [936,744], "src": [72,0], "f": 0, "t": 3, "d": [1372], "a": 1 },
+						{ "px": [960,744], "src": [0,0], "f": 0, "t": 0, "d": [1373], "a": 1 },
+						{ "px": [984,744], "src": [24,0], "f": 0, "t": 1, "d": [1374], "a": 1 },
+						{ "px": [1008,744], "src": [48,0], "f": 0, "t": 2, "d": [1375], "a": 1 },
+						{ "px": [0,768], "src": [0,0], "f": 0, "t": 0, "d": [1376], "a": 1 },
+						{ "px": [24,768], "src": [24,0], "f": 0, "t": 1, "d": [1377], "a": 1 },
+						{ "px": [48,768], "src": [48,0], "f": 0, "t": 2, "d": [1378], "a": 1 },
+						{ "px": [72,768], "src": [72,0], "f": 0, "t": 3, "d": [1379], "a": 1 },
+						{ "px": [96,768], "src": [0,0], "f": 0, "t": 0, "d": [1380], "a": 1 },
+						{ "px": [120,768], "src": [24,0], "f": 0, "t": 1, "d": [1381], "a": 1 },
+						{ "px": [144,768], "src": [48,0], "f": 0, "t": 2, "d": [1382], "a": 1 },
+						{ "px": [168,768], "src": [72,0], "f": 0, "t": 3, "d": [1383], "a": 1 },
+						{ "px": [192,768], "src": [0,0], "f": 0, "t": 0, "d": [1384], "a": 1 },
+						{ "px": [216,768], "src": [24,0], "f": 0, "t": 1, "d": [1385], "a": 1 },
+						{ "px": [240,768], "src": [48,0], "f": 0, "t": 2, "d": [1386], "a": 1 },
+						{ "px": [264,768], "src": [72,0], "f": 0, "t": 3, "d": [1387], "a": 1 },
+						{ "px": [288,768], "src": [0,0], "f": 0, "t": 0, "d": [1388], "a": 1 },
+						{ "px": [312,768], "src": [24,0], "f": 0, "t": 1, "d": [1389], "a": 1 },
+						{ "px": [336,768], "src": [48,0], "f": 0, "t": 2, "d": [1390], "a": 1 },
+						{ "px": [360,768], "src": [72,0], "f": 0, "t": 3, "d": [1391], "a": 1 },
+						{ "px": [384,768], "src": [0,0], "f": 0, "t": 0, "d": [1392], "a": 1 },
+						{ "px": [408,768], "src": [24,0], "f": 0, "t": 1, "d": [1393], "a": 1 },
+						{ "px": [432,768], "src": [48,0], "f": 0, "t": 2, "d": [1394], "a": 1 },
+						{ "px": [456,768], "src": [72,0], "f": 0, "t": 3, "d": [1395], "a": 1 },
+						{ "px": [480,768], "src": [0,0], "f": 0, "t": 0, "d": [1396], "a": 1 },
+						{ "px": [504,768], "src": [24,0], "f": 0, "t": 1, "d": [1397], "a": 1 },
+						{ "px": [528,768], "src": [48,0], "f": 0, "t": 2, "d": [1398], "a": 1 },
+						{ "px": [552,768], "src": [72,0], "f": 0, "t": 3, "d": [1399], "a": 1 },
+						{ "px": [576,768], "src": [0,0], "f": 0, "t": 0, "d": [1400], "a": 1 },
+						{ "px": [600,768], "src": [24,0], "f": 0, "t": 1, "d": [1401], "a": 1 },
+						{ "px": [624,768], "src": [48,0], "f": 0, "t": 2, "d": [1402], "a": 1 },
+						{ "px": [648,768], "src": [72,0], "f": 0, "t": 3, "d": [1403], "a": 1 },
+						{ "px": [672,768], "src": [0,0], "f": 0, "t": 0, "d": [1404], "a": 1 },
+						{ "px": [696,768], "src": [24,0], "f": 0, "t": 1, "d": [1405], "a": 1 },
+						{ "px": [720,768], "src": [48,0], "f": 0, "t": 2, "d": [1406], "a": 1 },
+						{ "px": [744,768], "src": [72,0], "f": 0, "t": 3, "d": [1407], "a": 1 },
+						{ "px": [768,768], "src": [0,0], "f": 0, "t": 0, "d": [1408], "a": 1 },
+						{ "px": [792,768], "src": [24,0], "f": 0, "t": 1, "d": [1409], "a": 1 },
+						{ "px": [816,768], "src": [48,0], "f": 0, "t": 2, "d": [1410], "a": 1 },
+						{ "px": [840,768], "src": [72,0], "f": 0, "t": 3, "d": [1411], "a": 1 },
+						{ "px": [864,768], "src": [0,0], "f": 0, "t": 0, "d": [1412], "a": 1 },
+						{ "px": [888,768], "src": [24,0], "f": 0, "t": 1, "d": [1413], "a": 1 },
+						{ "px": [912,768], "src": [48,0], "f": 0, "t": 2, "d": [1414], "a": 1 },
+						{ "px": [936,768], "src": [72,0], "f": 0, "t": 3, "d": [1415], "a": 1 },
+						{ "px": [960,768], "src": [0,0], "f": 0, "t": 0, "d": [1416], "a": 1 },
+						{ "px": [984,768], "src": [24,0], "f": 0, "t": 1, "d": [1417], "a": 1 },
+						{ "px": [1008,768], "src": [48,0], "f": 0, "t": 2, "d": [1418], "a": 1 },
+						{ "px": [0,792], "src": [0,0], "f": 0, "t": 0, "d": [1419], "a": 1 },
+						{ "px": [24,792], "src": [24,0], "f": 0, "t": 1, "d": [1420], "a": 1 },
+						{ "px": [48,792], "src": [48,0], "f": 0, "t": 2, "d": [1421], "a": 1 },
+						{ "px": [72,792], "src": [72,0], "f": 0, "t": 3, "d": [1422], "a": 1 },
+						{ "px": [96,792], "src": [0,0], "f": 0, "t": 0, "d": [1423], "a": 1 },
+						{ "px": [120,792], "src": [24,0], "f": 0, "t": 1, "d": [1424], "a": 1 },
+						{ "px": [144,792], "src": [48,0], "f": 0, "t": 2, "d": [1425], "a": 1 },
+						{ "px": [168,792], "src": [72,0], "f": 0, "t": 3, "d": [1426], "a": 1 },
+						{ "px": [192,792], "src": [0,0], "f": 0, "t": 0, "d": [1427], "a": 1 },
+						{ "px": [216,792], "src": [24,0], "f": 0, "t": 1, "d": [1428], "a": 1 },
+						{ "px": [240,792], "src": [48,0], "f": 0, "t": 2, "d": [1429], "a": 1 },
+						{ "px": [264,792], "src": [72,0], "f": 0, "t": 3, "d": [1430], "a": 1 },
+						{ "px": [288,792], "src": [0,0], "f": 0, "t": 0, "d": [1431], "a": 1 },
+						{ "px": [312,792], "src": [24,0], "f": 0, "t": 1, "d": [1432], "a": 1 },
+						{ "px": [336,792], "src": [48,0], "f": 0, "t": 2, "d": [1433], "a": 1 },
+						{ "px": [360,792], "src": [72,0], "f": 0, "t": 3, "d": [1434], "a": 1 },
+						{ "px": [384,792], "src": [0,0], "f": 0, "t": 0, "d": [1435], "a": 1 },
+						{ "px": [408,792], "src": [24,0], "f": 0, "t": 1, "d": [1436], "a": 1 },
+						{ "px": [432,792], "src": [48,0], "f": 0, "t": 2, "d": [1437], "a": 1 },
+						{ "px": [456,792], "src": [72,0], "f": 0, "t": 3, "d": [1438], "a": 1 },
+						{ "px": [480,792], "src": [0,0], "f": 0, "t": 0, "d": [1439], "a": 1 },
+						{ "px": [504,792], "src": [24,0], "f": 0, "t": 1, "d": [1440], "a": 1 },
+						{ "px": [528,792], "src": [48,0], "f": 0, "t": 2, "d": [1441], "a": 1 },
+						{ "px": [552,792], "src": [72,0], "f": 0, "t": 3, "d": [1442], "a": 1 },
+						{ "px": [576,792], "src": [0,0], "f": 0, "t": 0, "d": [1443], "a": 1 },
+						{ "px": [600,792], "src": [24,0], "f": 0, "t": 1, "d": [1444], "a": 1 },
+						{ "px": [624,792], "src": [48,0], "f": 0, "t": 2, "d": [1445], "a": 1 },
+						{ "px": [648,792], "src": [72,0], "f": 0, "t": 3, "d": [1446], "a": 1 },
+						{ "px": [672,792], "src": [0,0], "f": 0, "t": 0, "d": [1447], "a": 1 },
+						{ "px": [696,792], "src": [24,0], "f": 0, "t": 1, "d": [1448], "a": 1 },
+						{ "px": [720,792], "src": [48,0], "f": 0, "t": 2, "d": [1449], "a": 1 },
+						{ "px": [744,792], "src": [72,0], "f": 0, "t": 3, "d": [1450], "a": 1 },
+						{ "px": [768,792], "src": [0,0], "f": 0, "t": 0, "d": [1451], "a": 1 },
+						{ "px": [792,792], "src": [24,0], "f": 0, "t": 1, "d": [1452], "a": 1 },
+						{ "px": [816,792], "src": [48,0], "f": 0, "t": 2, "d": [1453], "a": 1 },
+						{ "px": [840,792], "src": [72,0], "f": 0, "t": 3, "d": [1454], "a": 1 },
+						{ "px": [864,792], "src": [0,0], "f": 0, "t": 0, "d": [1455], "a": 1 },
+						{ "px": [888,792], "src": [24,0], "f": 0, "t": 1, "d": [1456], "a": 1 },
+						{ "px": [912,792], "src": [48,0], "f": 0, "t": 2, "d": [1457], "a": 1 },
+						{ "px": [936,792], "src": [72,0], "f": 0, "t": 3, "d": [1458], "a": 1 },
+						{ "px": [960,792], "src": [0,0], "f": 0, "t": 0, "d": [1459], "a": 1 },
+						{ "px": [984,792], "src": [24,0], "f": 0, "t": 1, "d": [1460], "a": 1 },
+						{ "px": [1008,792], "src": [48,0], "f": 0, "t": 2, "d": [1461], "a": 1 },
+						{ "px": [0,816], "src": [0,0], "f": 0, "t": 0, "d": [1462], "a": 1 },
+						{ "px": [24,816], "src": [24,0], "f": 0, "t": 1, "d": [1463], "a": 1 },
+						{ "px": [48,816], "src": [48,0], "f": 0, "t": 2, "d": [1464], "a": 1 },
+						{ "px": [72,816], "src": [72,0], "f": 0, "t": 3, "d": [1465], "a": 1 },
+						{ "px": [96,816], "src": [0,0], "f": 0, "t": 0, "d": [1466], "a": 1 },
+						{ "px": [120,816], "src": [24,0], "f": 0, "t": 1, "d": [1467], "a": 1 },
+						{ "px": [144,816], "src": [48,0], "f": 0, "t": 2, "d": [1468], "a": 1 },
+						{ "px": [168,816], "src": [72,0], "f": 0, "t": 3, "d": [1469], "a": 1 },
+						{ "px": [192,816], "src": [0,0], "f": 0, "t": 0, "d": [1470], "a": 1 },
+						{ "px": [216,816], "src": [24,0], "f": 0, "t": 1, "d": [1471], "a": 1 },
+						{ "px": [240,816], "src": [48,0], "f": 0, "t": 2, "d": [1472], "a": 1 },
+						{ "px": [264,816], "src": [72,0], "f": 0, "t": 3, "d": [1473], "a": 1 },
+						{ "px": [288,816], "src": [0,0], "f": 0, "t": 0, "d": [1474], "a": 1 },
+						{ "px": [312,816], "src": [24,0], "f": 0, "t": 1, "d": [1475], "a": 1 },
+						{ "px": [336,816], "src": [48,0], "f": 0, "t": 2, "d": [1476], "a": 1 },
+						{ "px": [360,816], "src": [72,0], "f": 0, "t": 3, "d": [1477], "a": 1 },
+						{ "px": [384,816], "src": [0,0], "f": 0, "t": 0, "d": [1478], "a": 1 },
+						{ "px": [408,816], "src": [24,0], "f": 0, "t": 1, "d": [1479], "a": 1 },
+						{ "px": [432,816], "src": [48,0], "f": 0, "t": 2, "d": [1480], "a": 1 },
+						{ "px": [456,816], "src": [72,0], "f": 0, "t": 3, "d": [1481], "a": 1 },
+						{ "px": [480,816], "src": [0,0], "f": 0, "t": 0, "d": [1482], "a": 1 },
+						{ "px": [504,816], "src": [24,0], "f": 0, "t": 1, "d": [1483], "a": 1 },
+						{ "px": [528,816], "src": [48,0], "f": 0, "t": 2, "d": [1484], "a": 1 },
+						{ "px": [552,816], "src": [72,0], "f": 0, "t": 3, "d": [1485], "a": 1 },
+						{ "px": [576,816], "src": [0,0], "f": 0, "t": 0, "d": [1486], "a": 1 },
+						{ "px": [600,816], "src": [24,0], "f": 0, "t": 1, "d": [1487], "a": 1 },
+						{ "px": [624,816], "src": [48,0], "f": 0, "t": 2, "d": [1488], "a": 1 },
+						{ "px": [648,816], "src": [72,0], "f": 0, "t": 3, "d": [1489], "a": 1 },
+						{ "px": [672,816], "src": [0,0], "f": 0, "t": 0, "d": [1490], "a": 1 },
+						{ "px": [696,816], "src": [24,0], "f": 0, "t": 1, "d": [1491], "a": 1 },
+						{ "px": [720,816], "src": [48,0], "f": 0, "t": 2, "d": [1492], "a": 1 },
+						{ "px": [744,816], "src": [72,0], "f": 0, "t": 3, "d": [1493], "a": 1 },
+						{ "px": [768,816], "src": [0,0], "f": 0, "t": 0, "d": [1494], "a": 1 },
+						{ "px": [792,816], "src": [24,0], "f": 0, "t": 1, "d": [1495], "a": 1 },
+						{ "px": [816,816], "src": [48,0], "f": 0, "t": 2, "d": [1496], "a": 1 },
+						{ "px": [840,816], "src": [72,0], "f": 0, "t": 3, "d": [1497], "a": 1 },
+						{ "px": [864,816], "src": [0,0], "f": 0, "t": 0, "d": [1498], "a": 1 },
+						{ "px": [888,816], "src": [24,0], "f": 0, "t": 1, "d": [1499], "a": 1 },
+						{ "px": [912,816], "src": [48,0], "f": 0, "t": 2, "d": [1500], "a": 1 },
+						{ "px": [936,816], "src": [72,0], "f": 0, "t": 3, "d": [1501], "a": 1 },
+						{ "px": [960,816], "src": [0,0], "f": 0, "t": 0, "d": [1502], "a": 1 },
+						{ "px": [984,816], "src": [24,0], "f": 0, "t": 1, "d": [1503], "a": 1 },
+						{ "px": [1008,816], "src": [48,0], "f": 0, "t": 2, "d": [1504], "a": 1 },
+						{ "px": [0,840], "src": [0,24], "f": 0, "t": 8, "d": [1505], "a": 1 },
+						{ "px": [24,840], "src": [24,24], "f": 0, "t": 9, "d": [1506], "a": 1 },
+						{ "px": [48,840], "src": [48,24], "f": 0, "t": 10, "d": [1507], "a": 1 },
+						{ "px": [72,840], "src": [72,24], "f": 0, "t": 11, "d": [1508], "a": 1 },
+						{ "px": [96,840], "src": [0,24], "f": 0, "t": 8, "d": [1509], "a": 1 },
+						{ "px": [120,840], "src": [24,24], "f": 0, "t": 9, "d": [1510], "a": 1 },
+						{ "px": [144,840], "src": [48,24], "f": 0, "t": 10, "d": [1511], "a": 1 },
+						{ "px": [168,840], "src": [72,24], "f": 0, "t": 11, "d": [1512], "a": 1 },
+						{ "px": [192,840], "src": [0,24], "f": 0, "t": 8, "d": [1513], "a": 1 },
+						{ "px": [216,840], "src": [24,24], "f": 0, "t": 9, "d": [1514], "a": 1 },
+						{ "px": [240,840], "src": [48,24], "f": 0, "t": 10, "d": [1515], "a": 1 },
+						{ "px": [264,840], "src": [72,24], "f": 0, "t": 11, "d": [1516], "a": 1 },
+						{ "px": [288,840], "src": [0,24], "f": 0, "t": 8, "d": [1517], "a": 1 },
+						{ "px": [312,840], "src": [24,24], "f": 0, "t": 9, "d": [1518], "a": 1 },
+						{ "px": [336,840], "src": [48,24], "f": 0, "t": 10, "d": [1519], "a": 1 },
+						{ "px": [360,840], "src": [72,24], "f": 0, "t": 11, "d": [1520], "a": 1 },
+						{ "px": [384,840], "src": [0,24], "f": 0, "t": 8, "d": [1521], "a": 1 },
+						{ "px": [408,840], "src": [24,24], "f": 0, "t": 9, "d": [1522], "a": 1 },
+						{ "px": [432,840], "src": [48,24], "f": 0, "t": 10, "d": [1523], "a": 1 },
+						{ "px": [456,840], "src": [72,24], "f": 0, "t": 11, "d": [1524], "a": 1 },
+						{ "px": [480,840], "src": [0,24], "f": 0, "t": 8, "d": [1525], "a": 1 },
+						{ "px": [504,840], "src": [24,24], "f": 0, "t": 9, "d": [1526], "a": 1 },
+						{ "px": [528,840], "src": [48,24], "f": 0, "t": 10, "d": [1527], "a": 1 },
+						{ "px": [552,840], "src": [72,24], "f": 0, "t": 11, "d": [1528], "a": 1 },
+						{ "px": [576,840], "src": [0,24], "f": 0, "t": 8, "d": [1529], "a": 1 },
+						{ "px": [600,840], "src": [24,24], "f": 0, "t": 9, "d": [1530], "a": 1 },
+						{ "px": [624,840], "src": [48,24], "f": 0, "t": 10, "d": [1531], "a": 1 },
+						{ "px": [648,840], "src": [72,24], "f": 0, "t": 11, "d": [1532], "a": 1 },
+						{ "px": [672,840], "src": [0,24], "f": 0, "t": 8, "d": [1533], "a": 1 },
+						{ "px": [696,840], "src": [24,24], "f": 0, "t": 9, "d": [1534], "a": 1 },
+						{ "px": [720,840], "src": [48,24], "f": 0, "t": 10, "d": [1535], "a": 1 },
+						{ "px": [744,840], "src": [72,24], "f": 0, "t": 11, "d": [1536], "a": 1 },
+						{ "px": [768,840], "src": [0,24], "f": 0, "t": 8, "d": [1537], "a": 1 },
+						{ "px": [792,840], "src": [24,24], "f": 0, "t": 9, "d": [1538], "a": 1 },
+						{ "px": [816,840], "src": [48,24], "f": 0, "t": 10, "d": [1539], "a": 1 },
+						{ "px": [840,840], "src": [72,24], "f": 0, "t": 11, "d": [1540], "a": 1 },
+						{ "px": [864,840], "src": [0,24], "f": 0, "t": 8, "d": [1541], "a": 1 },
+						{ "px": [888,840], "src": [24,24], "f": 0, "t": 9, "d": [1542], "a": 1 },
+						{ "px": [912,840], "src": [48,24], "f": 0, "t": 10, "d": [1543], "a": 1 },
+						{ "px": [936,840], "src": [72,24], "f": 0, "t": 11, "d": [1544], "a": 1 },
+						{ "px": [960,840], "src": [0,24], "f": 0, "t": 8, "d": [1545], "a": 1 },
+						{ "px": [984,840], "src": [24,24], "f": 0, "t": 9, "d": [1546], "a": 1 },
+						{ "px": [1008,840], "src": [48,24], "f": 0, "t": 10, "d": [1547], "a": 1 },
+						{ "px": [0,864], "src": [0,48], "f": 0, "t": 16, "d": [1548], "a": 1 },
+						{ "px": [24,864], "src": [24,48], "f": 0, "t": 17, "d": [1549], "a": 1 },
+						{ "px": [48,864], "src": [48,48], "f": 0, "t": 18, "d": [1550], "a": 1 },
+						{ "px": [72,864], "src": [72,48], "f": 0, "t": 19, "d": [1551], "a": 1 },
+						{ "px": [96,864], "src": [72,48], "f": 0, "t": 19, "d": [1552], "a": 1 },
+						{ "px": [120,864], "src": [72,48], "f": 0, "t": 19, "d": [1553], "a": 1 },
+						{ "px": [144,864], "src": [72,48], "f": 0, "t": 19, "d": [1554], "a": 1 },
+						{ "px": [168,864], "src": [72,48], "f": 0, "t": 19, "d": [1555], "a": 1 },
+						{ "px": [192,864], "src": [72,48], "f": 0, "t": 19, "d": [1556], "a": 1 },
+						{ "px": [216,864], "src": [72,48], "f": 0, "t": 19, "d": [1557], "a": 1 },
+						{ "px": [240,864], "src": [72,48], "f": 0, "t": 19, "d": [1558], "a": 1 },
+						{ "px": [264,864], "src": [72,48], "f": 0, "t": 19, "d": [1559], "a": 1 },
+						{ "px": [288,864], "src": [72,48], "f": 0, "t": 19, "d": [1560], "a": 1 },
+						{ "px": [312,864], "src": [72,48], "f": 0, "t": 19, "d": [1561], "a": 1 },
+						{ "px": [336,864], "src": [72,48], "f": 0, "t": 19, "d": [1562], "a": 1 },
+						{ "px": [360,864], "src": [72,48], "f": 0, "t": 19, "d": [1563], "a": 1 },
+						{ "px": [384,864], "src": [72,48], "f": 0, "t": 19, "d": [1564], "a": 1 },
+						{ "px": [408,864], "src": [72,48], "f": 0, "t": 19, "d": [1565], "a": 1 },
+						{ "px": [432,864], "src": [72,48], "f": 0, "t": 19, "d": [1566], "a": 1 },
+						{ "px": [456,864], "src": [72,48], "f": 0, "t": 19, "d": [1567], "a": 1 },
+						{ "px": [480,864], "src": [72,48], "f": 0, "t": 19, "d": [1568], "a": 1 },
+						{ "px": [504,864], "src": [72,48], "f": 0, "t": 19, "d": [1569], "a": 1 },
+						{ "px": [528,864], "src": [72,48], "f": 0, "t": 19, "d": [1570], "a": 1 },
+						{ "px": [552,864], "src": [72,48], "f": 0, "t": 19, "d": [1571], "a": 1 },
+						{ "px": [576,864], "src": [72,48], "f": 0, "t": 19, "d": [1572], "a": 1 },
+						{ "px": [600,864], "src": [72,48], "f": 0, "t": 19, "d": [1573], "a": 1 },
+						{ "px": [624,864], "src": [72,48], "f": 0, "t": 19, "d": [1574], "a": 1 },
+						{ "px": [648,864], "src": [72,48], "f": 0, "t": 19, "d": [1575], "a": 1 },
+						{ "px": [672,864], "src": [72,48], "f": 0, "t": 19, "d": [1576], "a": 1 },
+						{ "px": [696,864], "src": [72,48], "f": 0, "t": 19, "d": [1577], "a": 1 },
+						{ "px": [720,864], "src": [72,48], "f": 0, "t": 19, "d": [1578], "a": 1 },
+						{ "px": [744,864], "src": [72,48], "f": 0, "t": 19, "d": [1579], "a": 1 },
+						{ "px": [768,864], "src": [72,48], "f": 0, "t": 19, "d": [1580], "a": 1 },
+						{ "px": [792,864], "src": [72,48], "f": 0, "t": 19, "d": [1581], "a": 1 },
+						{ "px": [816,864], "src": [72,48], "f": 0, "t": 19, "d": [1582], "a": 1 },
+						{ "px": [840,864], "src": [72,48], "f": 0, "t": 19, "d": [1583], "a": 1 },
+						{ "px": [864,864], "src": [72,48], "f": 0, "t": 19, "d": [1584], "a": 1 },
+						{ "px": [888,864], "src": [72,48], "f": 0, "t": 19, "d": [1585], "a": 1 },
+						{ "px": [912,864], "src": [72,48], "f": 0, "t": 19, "d": [1586], "a": 1 },
+						{ "px": [936,864], "src": [72,48], "f": 0, "t": 19, "d": [1587], "a": 1 },
+						{ "px": [960,864], "src": [72,48], "f": 0, "t": 19, "d": [1588], "a": 1 },
+						{ "px": [984,864], "src": [72,48], "f": 0, "t": 19, "d": [1589], "a": 1 },
+						{ "px": [1008,864], "src": [72,48], "f": 0, "t": 19, "d": [1590], "a": 1 },
+						{ "px": [0,888], "src": [0,48], "f": 0, "t": 16, "d": [1591], "a": 1 },
+						{ "px": [24,888], "src": [24,48], "f": 0, "t": 17, "d": [1592], "a": 1 },
+						{ "px": [48,888], "src": [48,48], "f": 0, "t": 18, "d": [1593], "a": 1 },
+						{ "px": [72,888], "src": [72,48], "f": 0, "t": 19, "d": [1594], "a": 1 },
+						{ "px": [96,888], "src": [72,48], "f": 0, "t": 19, "d": [1595], "a": 1 },
+						{ "px": [120,888], "src": [72,48], "f": 0, "t": 19, "d": [1596], "a": 1 },
+						{ "px": [144,888], "src": [72,48], "f": 0, "t": 19, "d": [1597], "a": 1 },
+						{ "px": [168,888], "src": [72,48], "f": 0, "t": 19, "d": [1598], "a": 1 },
+						{ "px": [192,888], "src": [72,48], "f": 0, "t": 19, "d": [1599], "a": 1 },
+						{ "px": [216,888], "src": [72,48], "f": 0, "t": 19, "d": [1600], "a": 1 },
+						{ "px": [240,888], "src": [72,48], "f": 0, "t": 19, "d": [1601], "a": 1 },
+						{ "px": [264,888], "src": [72,48], "f": 0, "t": 19, "d": [1602], "a": 1 },
+						{ "px": [288,888], "src": [72,48], "f": 0, "t": 19, "d": [1603], "a": 1 },
+						{ "px": [312,888], "src": [72,48], "f": 0, "t": 19, "d": [1604], "a": 1 },
+						{ "px": [336,888], "src": [72,48], "f": 0, "t": 19, "d": [1605], "a": 1 },
+						{ "px": [360,888], "src": [72,48], "f": 0, "t": 19, "d": [1606], "a": 1 },
+						{ "px": [384,888], "src": [0,48], "f": 0, "t": 16, "d": [1607], "a": 1 },
+						{ "px": [408,888], "src": [0,48], "f": 0, "t": 16, "d": [1608], "a": 1 },
+						{ "px": [432,888], "src": [24,48], "f": 0, "t": 17, "d": [1609], "a": 1 },
+						{ "px": [456,888], "src": [48,48], "f": 0, "t": 18, "d": [1610], "a": 1 },
+						{ "px": [480,888], "src": [72,48], "f": 0, "t": 19, "d": [1611], "a": 1 },
+						{ "px": [504,888], "src": [72,48], "f": 0, "t": 19, "d": [1612], "a": 1 },
+						{ "px": [528,888], "src": [72,48], "f": 0, "t": 19, "d": [1613], "a": 1 },
+						{ "px": [552,888], "src": [72,48], "f": 0, "t": 19, "d": [1614], "a": 1 },
+						{ "px": [576,888], "src": [72,48], "f": 0, "t": 19, "d": [1615], "a": 1 },
+						{ "px": [600,888], "src": [72,48], "f": 0, "t": 19, "d": [1616], "a": 1 },
+						{ "px": [624,888], "src": [0,48], "f": 0, "t": 16, "d": [1617], "a": 1 },
+						{ "px": [648,888], "src": [0,48], "f": 0, "t": 16, "d": [1618], "a": 1 },
+						{ "px": [672,888], "src": [0,48], "f": 0, "t": 16, "d": [1619], "a": 1 },
+						{ "px": [696,888], "src": [0,48], "f": 0, "t": 16, "d": [1620], "a": 1 },
+						{ "px": [720,888], "src": [0,48], "f": 0, "t": 16, "d": [1621], "a": 1 },
+						{ "px": [744,888], "src": [0,48], "f": 0, "t": 16, "d": [1622], "a": 1 },
+						{ "px": [768,888], "src": [0,48], "f": 0, "t": 16, "d": [1623], "a": 1 },
+						{ "px": [792,888], "src": [0,48], "f": 0, "t": 16, "d": [1624], "a": 1 },
+						{ "px": [816,888], "src": [0,48], "f": 0, "t": 16, "d": [1625], "a": 1 },
+						{ "px": [840,888], "src": [0,48], "f": 0, "t": 16, "d": [1626], "a": 1 },
+						{ "px": [864,888], "src": [0,48], "f": 0, "t": 16, "d": [1627], "a": 1 },
+						{ "px": [888,888], "src": [24,48], "f": 0, "t": 17, "d": [1628], "a": 1 },
+						{ "px": [912,888], "src": [48,48], "f": 0, "t": 18, "d": [1629], "a": 1 },
+						{ "px": [936,888], "src": [0,48], "f": 0, "t": 16, "d": [1630], "a": 1 },
+						{ "px": [960,888], "src": [24,48], "f": 0, "t": 17, "d": [1631], "a": 1 },
+						{ "px": [984,888], "src": [48,48], "f": 0, "t": 18, "d": [1632], "a": 1 },
+						{ "px": [1008,888], "src": [72,48], "f": 0, "t": 19, "d": [1633], "a": 1 },
+						{ "px": [0,912], "src": [0,48], "f": 0, "t": 16, "d": [1634], "a": 1 },
+						{ "px": [24,912], "src": [0,48], "f": 0, "t": 16, "d": [1635], "a": 1 },
+						{ "px": [48,912], "src": [24,48], "f": 0, "t": 17, "d": [1636], "a": 1 },
+						{ "px": [72,912], "src": [48,48], "f": 0, "t": 18, "d": [1637], "a": 1 },
+						{ "px": [96,912], "src": [72,48], "f": 0, "t": 19, "d": [1638], "a": 1 },
+						{ "px": [120,912], "src": [0,48], "f": 0, "t": 16, "d": [1639], "a": 1 },
+						{ "px": [144,912], "src": [0,48], "f": 0, "t": 16, "d": [1640], "a": 1 },
+						{ "px": [168,912], "src": [0,48], "f": 0, "t": 16, "d": [1641], "a": 1 },
+						{ "px": [192,912], "src": [24,48], "f": 0, "t": 17, "d": [1642], "a": 1 },
+						{ "px": [216,912], "src": [48,48], "f": 0, "t": 18, "d": [1643], "a": 1 },
+						{ "px": [240,912], "src": [72,48], "f": 0, "t": 19, "d": [1644], "a": 1 },
+						{ "px": [264,912], "src": [72,48], "f": 0, "t": 19, "d": [1645], "a": 1 },
+						{ "px": [288,912], "src": [72,48], "f": 0, "t": 19, "d": [1646], "a": 1 },
+						{ "px": [312,912], "src": [0,48], "f": 0, "t": 16, "d": [1647], "a": 1 },
+						{ "px": [336,912], "src": [24,48], "f": 0, "t": 17, "d": [1648], "a": 1 },
+						{ "px": [360,912], "src": [48,48], "f": 0, "t": 18, "d": [1649], "a": 1 },
+						{ "px": [384,912], "src": [72,48], "f": 0, "t": 19, "d": [1650], "a": 1 },
+						{ "px": [408,912], "src": [72,48], "f": 0, "t": 19, "d": [1651], "a": 1 },
+						{ "px": [432,912], "src": [72,48], "f": 0, "t": 19, "d": [1652], "a": 1 },
+						{ "px": [456,912], "src": [72,48], "f": 0, "t": 19, "d": [1653], "a": 1 },
+						{ "px": [480,912], "src": [72,48], "f": 0, "t": 19, "d": [1654], "a": 1 },
+						{ "px": [504,912], "src": [72,48], "f": 0, "t": 19, "d": [1655], "a": 1 },
+						{ "px": [528,912], "src": [72,48], "f": 0, "t": 19, "d": [1656], "a": 1 },
+						{ "px": [552,912], "src": [72,48], "f": 0, "t": 19, "d": [1657], "a": 1 },
+						{ "px": [576,912], "src": [72,48], "f": 0, "t": 19, "d": [1658], "a": 1 },
+						{ "px": [600,912], "src": [72,48], "f": 0, "t": 19, "d": [1659], "a": 1 },
+						{ "px": [624,912], "src": [72,48], "f": 0, "t": 19, "d": [1660], "a": 1 },
+						{ "px": [648,912], "src": [72,48], "f": 0, "t": 19, "d": [1661], "a": 1 },
+						{ "px": [672,912], "src": [72,48], "f": 0, "t": 19, "d": [1662], "a": 1 },
+						{ "px": [696,912], "src": [72,48], "f": 0, "t": 19, "d": [1663], "a": 1 },
+						{ "px": [720,912], "src": [72,48], "f": 0, "t": 19, "d": [1664], "a": 1 },
+						{ "px": [744,912], "src": [72,48], "f": 0, "t": 19, "d": [1665], "a": 1 },
+						{ "px": [768,912], "src": [72,48], "f": 0, "t": 19, "d": [1666], "a": 1 },
+						{ "px": [792,912], "src": [72,48], "f": 0, "t": 19, "d": [1667], "a": 1 },
+						{ "px": [816,912], "src": [72,48], "f": 0, "t": 19, "d": [1668], "a": 1 },
+						{ "px": [840,912], "src": [72,48], "f": 0, "t": 19, "d": [1669], "a": 1 },
+						{ "px": [864,912], "src": [72,48], "f": 0, "t": 19, "d": [1670], "a": 1 },
+						{ "px": [888,912], "src": [72,48], "f": 0, "t": 19, "d": [1671], "a": 1 },
+						{ "px": [912,912], "src": [72,48], "f": 0, "t": 19, "d": [1672], "a": 1 },
+						{ "px": [936,912], "src": [0,48], "f": 0, "t": 16, "d": [1673], "a": 1 },
+						{ "px": [960,912], "src": [24,48], "f": 0, "t": 17, "d": [1674], "a": 1 },
+						{ "px": [984,912], "src": [48,48], "f": 0, "t": 18, "d": [1675], "a": 1 },
+						{ "px": [1008,912], "src": [72,48], "f": 0, "t": 19, "d": [1676], "a": 1 },
+						{ "px": [0,936], "src": [0,48], "f": 0, "t": 16, "d": [1677], "a": 1 },
+						{ "px": [24,936], "src": [24,48], "f": 0, "t": 17, "d": [1678], "a": 1 },
+						{ "px": [48,936], "src": [48,48], "f": 0, "t": 18, "d": [1679], "a": 1 },
+						{ "px": [72,936], "src": [72,48], "f": 0, "t": 19, "d": [1680], "a": 1 },
+						{ "px": [96,936], "src": [72,48], "f": 0, "t": 19, "d": [1681], "a": 1 },
+						{ "px": [120,936], "src": [24,48], "f": 0, "t": 17, "d": [1682], "a": 1 },
+						{ "px": [144,936], "src": [48,48], "f": 0, "t": 18, "d": [1683], "a": 1 },
+						{ "px": [168,936], "src": [72,48], "f": 0, "t": 19, "d": [1684], "a": 1 },
+						{ "px": [192,936], "src": [0,48], "f": 0, "t": 16, "d": [1685], "a": 1 },
+						{ "px": [216,936], "src": [0,48], "f": 0, "t": 16, "d": [1686], "a": 1 },
+						{ "px": [240,936], "src": [0,48], "f": 0, "t": 16, "d": [1687], "a": 1 },
+						{ "px": [264,936], "src": [24,48], "f": 0, "t": 17, "d": [1688], "a": 1 },
+						{ "px": [288,936], "src": [0,48], "f": 0, "t": 16, "d": [1689], "a": 1 },
+						{ "px": [312,936], "src": [24,48], "f": 0, "t": 17, "d": [1690], "a": 1 },
+						{ "px": [336,936], "src": [48,48], "f": 0, "t": 18, "d": [1691], "a": 1 },
+						{ "px": [360,936], "src": [72,48], "f": 0, "t": 19, "d": [1692], "a": 1 },
+						{ "px": [384,936], "src": [0,48], "f": 0, "t": 16, "d": [1693], "a": 1 },
+						{ "px": [408,936], "src": [24,48], "f": 0, "t": 17, "d": [1694], "a": 1 },
+						{ "px": [432,936], "src": [48,48], "f": 0, "t": 18, "d": [1695], "a": 1 },
+						{ "px": [456,936], "src": [72,48], "f": 0, "t": 19, "d": [1696], "a": 1 },
+						{ "px": [480,936], "src": [72,48], "f": 0, "t": 19, "d": [1697], "a": 1 },
+						{ "px": [504,936], "src": [72,48], "f": 0, "t": 19, "d": [1698], "a": 1 },
+						{ "px": [528,936], "src": [72,48], "f": 0, "t": 19, "d": [1699], "a": 1 },
+						{ "px": [552,936], "src": [72,48], "f": 0, "t": 19, "d": [1700], "a": 1 },
+						{ "px": [576,936], "src": [72,48], "f": 0, "t": 19, "d": [1701], "a": 1 },
+						{ "px": [600,936], "src": [72,48], "f": 0, "t": 19, "d": [1702], "a": 1 },
+						{ "px": [624,936], "src": [72,48], "f": 0, "t": 19, "d": [1703], "a": 1 },
+						{ "px": [648,936], "src": [72,48], "f": 0, "t": 19, "d": [1704], "a": 1 },
+						{ "px": [672,936], "src": [72,48], "f": 0, "t": 19, "d": [1705], "a": 1 },
+						{ "px": [696,936], "src": [0,48], "f": 0, "t": 16, "d": [1706], "a": 1 },
+						{ "px": [720,936], "src": [0,48], "f": 0, "t": 16, "d": [1707], "a": 1 },
+						{ "px": [744,936], "src": [0,48], "f": 0, "t": 16, "d": [1708], "a": 1 },
+						{ "px": [768,936], "src": [0,48], "f": 0, "t": 16, "d": [1709], "a": 1 },
+						{ "px": [792,936], "src": [0,48], "f": 0, "t": 16, "d": [1710], "a": 1 },
+						{ "px": [816,936], "src": [0,48], "f": 0, "t": 16, "d": [1711], "a": 1 },
+						{ "px": [840,936], "src": [0,48], "f": 0, "t": 16, "d": [1712], "a": 1 },
+						{ "px": [864,936], "src": [0,48], "f": 0, "t": 16, "d": [1713], "a": 1 },
+						{ "px": [888,936], "src": [24,48], "f": 0, "t": 17, "d": [1714], "a": 1 },
+						{ "px": [912,936], "src": [48,48], "f": 0, "t": 18, "d": [1715], "a": 1 },
+						{ "px": [936,936], "src": [0,48], "f": 0, "t": 16, "d": [1716], "a": 1 },
+						{ "px": [960,936], "src": [24,48], "f": 0, "t": 17, "d": [1717], "a": 1 },
+						{ "px": [984,936], "src": [48,48], "f": 0, "t": 18, "d": [1718], "a": 1 },
+						{ "px": [1008,936], "src": [72,48], "f": 0, "t": 19, "d": [1719], "a": 1 },
+						{ "px": [0,960], "src": [0,48], "f": 0, "t": 16, "d": [1720], "a": 1 },
+						{ "px": [24,960], "src": [24,48], "f": 0, "t": 17, "d": [1721], "a": 1 },
+						{ "px": [48,960], "src": [48,48], "f": 0, "t": 18, "d": [1722], "a": 1 },
+						{ "px": [72,960], "src": [72,48], "f": 0, "t": 19, "d": [1723], "a": 1 },
+						{ "px": [96,960], "src": [0,48], "f": 0, "t": 16, "d": [1724], "a": 1 },
+						{ "px": [120,960], "src": [0,48], "f": 0, "t": 16, "d": [1725], "a": 1 },
+						{ "px": [144,960], "src": [0,48], "f": 0, "t": 16, "d": [1726], "a": 1 },
+						{ "px": [168,960], "src": [24,48], "f": 0, "t": 17, "d": [1727], "a": 1 },
+						{ "px": [192,960], "src": [48,48], "f": 0, "t": 18, "d": [1728], "a": 1 },
+						{ "px": [216,960], "src": [72,48], "f": 0, "t": 19, "d": [1729], "a": 1 },
+						{ "px": [240,960], "src": [72,48], "f": 0, "t": 19, "d": [1730], "a": 1 },
+						{ "px": [264,960], "src": [72,48], "f": 0, "t": 19, "d": [1731], "a": 1 },
+						{ "px": [288,960], "src": [72,48], "f": 0, "t": 19, "d": [1732], "a": 1 },
+						{ "px": [312,960], "src": [72,48], "f": 0, "t": 19, "d": [1733], "a": 1 },
+						{ "px": [336,960], "src": [72,48], "f": 0, "t": 19, "d": [1734], "a": 1 },
+						{ "px": [360,960], "src": [72,48], "f": 0, "t": 19, "d": [1735], "a": 1 },
+						{ "px": [384,960], "src": [72,48], "f": 0, "t": 19, "d": [1736], "a": 1 },
+						{ "px": [408,960], "src": [72,48], "f": 0, "t": 19, "d": [1737], "a": 1 },
+						{ "px": [432,960], "src": [72,48], "f": 0, "t": 19, "d": [1738], "a": 1 },
+						{ "px": [456,960], "src": [72,48], "f": 0, "t": 19, "d": [1739], "a": 1 },
+						{ "px": [480,960], "src": [72,48], "f": 0, "t": 19, "d": [1740], "a": 1 },
+						{ "px": [504,960], "src": [72,48], "f": 0, "t": 19, "d": [1741], "a": 1 },
+						{ "px": [528,960], "src": [72,48], "f": 0, "t": 19, "d": [1742], "a": 1 },
+						{ "px": [552,960], "src": [72,48], "f": 0, "t": 19, "d": [1743], "a": 1 },
+						{ "px": [576,960], "src": [0,48], "f": 0, "t": 16, "d": [1744], "a": 1 },
+						{ "px": [600,960], "src": [24,48], "f": 0, "t": 17, "d": [1745], "a": 1 },
+						{ "px": [624,960], "src": [0,48], "f": 0, "t": 16, "d": [1746], "a": 1 },
+						{ "px": [648,960], "src": [24,48], "f": 0, "t": 17, "d": [1747], "a": 1 },
+						{ "px": [672,960], "src": [48,48], "f": 0, "t": 18, "d": [1748], "a": 1 },
+						{ "px": [696,960], "src": [72,48], "f": 0, "t": 19, "d": [1749], "a": 1 },
+						{ "px": [720,960], "src": [72,48], "f": 0, "t": 19, "d": [1750], "a": 1 },
+						{ "px": [744,960], "src": [72,48], "f": 0, "t": 19, "d": [1751], "a": 1 },
+						{ "px": [768,960], "src": [72,48], "f": 0, "t": 19, "d": [1752], "a": 1 },
+						{ "px": [792,960], "src": [72,48], "f": 0, "t": 19, "d": [1753], "a": 1 },
+						{ "px": [816,960], "src": [72,48], "f": 0, "t": 19, "d": [1754], "a": 1 },
+						{ "px": [840,960], "src": [72,48], "f": 0, "t": 19, "d": [1755], "a": 1 },
+						{ "px": [864,960], "src": [72,48], "f": 0, "t": 19, "d": [1756], "a": 1 },
+						{ "px": [888,960], "src": [72,48], "f": 0, "t": 19, "d": [1757], "a": 1 },
+						{ "px": [912,960], "src": [72,48], "f": 0, "t": 19, "d": [1758], "a": 1 },
+						{ "px": [936,960], "src": [0,48], "f": 0, "t": 16, "d": [1759], "a": 1 },
+						{ "px": [960,960], "src": [24,48], "f": 0, "t": 17, "d": [1760], "a": 1 },
+						{ "px": [984,960], "src": [48,48], "f": 0, "t": 18, "d": [1761], "a": 1 },
+						{ "px": [1008,960], "src": [72,48], "f": 0, "t": 19, "d": [1762], "a": 1 },
+						{ "px": [0,984], "src": [0,48], "f": 0, "t": 16, "d": [1763], "a": 1 },
+						{ "px": [24,984], "src": [0,48], "f": 0, "t": 16, "d": [1764], "a": 1 },
+						{ "px": [48,984], "src": [0,48], "f": 0, "t": 16, "d": [1765], "a": 1 },
+						{ "px": [72,984], "src": [0,48], "f": 0, "t": 16, "d": [1766], "a": 1 },
+						{ "px": [96,984], "src": [0,48], "f": 0, "t": 16, "d": [1767], "a": 1 },
+						{ "px": [120,984], "src": [0,48], "f": 0, "t": 16, "d": [1768], "a": 1 },
+						{ "px": [144,984], "src": [0,48], "f": 0, "t": 16, "d": [1769], "a": 1 },
+						{ "px": [168,984], "src": [0,48], "f": 0, "t": 16, "d": [1770], "a": 1 },
+						{ "px": [192,984], "src": [0,48], "f": 0, "t": 16, "d": [1771], "a": 1 },
+						{ "px": [216,984], "src": [0,48], "f": 0, "t": 16, "d": [1772], "a": 1 },
+						{ "px": [240,984], "src": [0,48], "f": 0, "t": 16, "d": [1773], "a": 1 },
+						{ "px": [264,984], "src": [0,48], "f": 0, "t": 16, "d": [1774], "a": 1 },
+						{ "px": [288,984], "src": [0,48], "f": 0, "t": 16, "d": [1775], "a": 1 },
+						{ "px": [312,984], "src": [24,48], "f": 0, "t": 17, "d": [1776], "a": 1 },
+						{ "px": [336,984], "src": [0,48], "f": 0, "t": 16, "d": [1777], "a": 1 },
+						{ "px": [360,984], "src": [0,48], "f": 0, "t": 16, "d": [1778], "a": 1 },
+						{ "px": [384,984], "src": [24,48], "f": 0, "t": 17, "d": [1779], "a": 1 },
+						{ "px": [408,984], "src": [48,48], "f": 0, "t": 18, "d": [1780], "a": 1 },
+						{ "px": [432,984], "src": [72,48], "f": 0, "t": 19, "d": [1781], "a": 1 },
+						{ "px": [456,984], "src": [0,48], "f": 0, "t": 16, "d": [1782], "a": 1 },
+						{ "px": [480,984], "src": [0,48], "f": 0, "t": 16, "d": [1783], "a": 1 },
+						{ "px": [504,984], "src": [0,48], "f": 0, "t": 16, "d": [1784], "a": 1 },
+						{ "px": [528,984], "src": [0,48], "f": 0, "t": 16, "d": [1785], "a": 1 },
+						{ "px": [552,984], "src": [0,48], "f": 0, "t": 16, "d": [1786], "a": 1 },
+						{ "px": [576,984], "src": [24,48], "f": 0, "t": 17, "d": [1787], "a": 1 },
+						{ "px": [600,984], "src": [48,48], "f": 0, "t": 18, "d": [1788], "a": 1 },
+						{ "px": [624,984], "src": [72,48], "f": 0, "t": 19, "d": [1789], "a": 1 },
+						{ "px": [648,984], "src": [48,48], "f": 0, "t": 18, "d": [1790], "a": 1 },
+						{ "px": [672,984], "src": [72,48], "f": 0, "t": 19, "d": [1791], "a": 1 },
+						{ "px": [696,984], "src": [72,48], "f": 0, "t": 19, "d": [1792], "a": 1 },
+						{ "px": [720,984], "src": [72,48], "f": 0, "t": 19, "d": [1793], "a": 1 },
+						{ "px": [744,984], "src": [72,48], "f": 0, "t": 19, "d": [1794], "a": 1 },
+						{ "px": [768,984], "src": [72,48], "f": 0, "t": 19, "d": [1795], "a": 1 },
+						{ "px": [792,984], "src": [72,48], "f": 0, "t": 19, "d": [1796], "a": 1 },
+						{ "px": [816,984], "src": [72,48], "f": 0, "t": 19, "d": [1797], "a": 1 },
+						{ "px": [840,984], "src": [72,48], "f": 0, "t": 19, "d": [1798], "a": 1 },
+						{ "px": [864,984], "src": [72,48], "f": 0, "t": 19, "d": [1799], "a": 1 },
+						{ "px": [888,984], "src": [72,48], "f": 0, "t": 19, "d": [1800], "a": 1 },
+						{ "px": [912,984], "src": [72,48], "f": 0, "t": 19, "d": [1801], "a": 1 },
+						{ "px": [936,984], "src": [0,48], "f": 0, "t": 16, "d": [1802], "a": 1 },
+						{ "px": [960,984], "src": [24,48], "f": 0, "t": 17, "d": [1803], "a": 1 },
+						{ "px": [984,984], "src": [48,48], "f": 0, "t": 18, "d": [1804], "a": 1 },
+						{ "px": [1008,984], "src": [72,48], "f": 0, "t": 19, "d": [1805], "a": 1 },
+						{ "px": [0,1008], "src": [0,48], "f": 0, "t": 16, "d": [1806], "a": 1 },
+						{ "px": [24,1008], "src": [0,48], "f": 0, "t": 16, "d": [1807], "a": 1 },
+						{ "px": [48,1008], "src": [24,48], "f": 0, "t": 17, "d": [1808], "a": 1 },
+						{ "px": [72,1008], "src": [48,48], "f": 0, "t": 18, "d": [1809], "a": 1 },
+						{ "px": [96,1008], "src": [72,48], "f": 0, "t": 19, "d": [1810], "a": 1 },
+						{ "px": [120,1008], "src": [72,48], "f": 0, "t": 19, "d": [1811], "a": 1 },
+						{ "px": [144,1008], "src": [72,48], "f": 0, "t": 19, "d": [1812], "a": 1 },
+						{ "px": [168,1008], "src": [72,48], "f": 0, "t": 19, "d": [1813], "a": 1 },
+						{ "px": [192,1008], "src": [72,48], "f": 0, "t": 19, "d": [1814], "a": 1 },
+						{ "px": [216,1008], "src": [72,48], "f": 0, "t": 19, "d": [1815], "a": 1 },
+						{ "px": [240,1008], "src": [72,48], "f": 0, "t": 19, "d": [1816], "a": 1 },
+						{ "px": [264,1008], "src": [72,48], "f": 0, "t": 19, "d": [1817], "a": 1 },
+						{ "px": [288,1008], "src": [72,48], "f": 0, "t": 19, "d": [1818], "a": 1 },
+						{ "px": [312,1008], "src": [72,48], "f": 0, "t": 19, "d": [1819], "a": 1 },
+						{ "px": [336,1008], "src": [72,48], "f": 0, "t": 19, "d": [1820], "a": 1 },
+						{ "px": [360,1008], "src": [72,48], "f": 0, "t": 19, "d": [1821], "a": 1 },
+						{ "px": [384,1008], "src": [0,48], "f": 0, "t": 16, "d": [1822], "a": 1 },
+						{ "px": [408,1008], "src": [0,48], "f": 0, "t": 16, "d": [1823], "a": 1 },
+						{ "px": [432,1008], "src": [0,48], "f": 0, "t": 16, "d": [1824], "a": 1 },
+						{ "px": [456,1008], "src": [0,48], "f": 0, "t": 16, "d": [1825], "a": 1 },
+						{ "px": [480,1008], "src": [0,48], "f": 0, "t": 16, "d": [1826], "a": 1 },
+						{ "px": [504,1008], "src": [0,48], "f": 0, "t": 16, "d": [1827], "a": 1 },
+						{ "px": [528,1008], "src": [0,48], "f": 0, "t": 16, "d": [1828], "a": 1 },
+						{ "px": [552,1008], "src": [0,48], "f": 0, "t": 16, "d": [1829], "a": 1 },
+						{ "px": [576,1008], "src": [0,48], "f": 0, "t": 16, "d": [1830], "a": 1 },
+						{ "px": [600,1008], "src": [0,48], "f": 0, "t": 16, "d": [1831], "a": 1 },
+						{ "px": [624,1008], "src": [0,48], "f": 0, "t": 16, "d": [1832], "a": 1 },
+						{ "px": [648,1008], "src": [0,48], "f": 0, "t": 16, "d": [1833], "a": 1 },
+						{ "px": [672,1008], "src": [0,48], "f": 0, "t": 16, "d": [1834], "a": 1 },
+						{ "px": [696,1008], "src": [0,48], "f": 0, "t": 16, "d": [1835], "a": 1 },
+						{ "px": [720,1008], "src": [0,48], "f": 0, "t": 16, "d": [1836], "a": 1 },
+						{ "px": [744,1008], "src": [0,48], "f": 0, "t": 16, "d": [1837], "a": 1 },
+						{ "px": [768,1008], "src": [0,48], "f": 0, "t": 16, "d": [1838], "a": 1 },
+						{ "px": [792,1008], "src": [0,48], "f": 0, "t": 16, "d": [1839], "a": 1 },
+						{ "px": [816,1008], "src": [0,48], "f": 0, "t": 16, "d": [1840], "a": 1 },
+						{ "px": [840,1008], "src": [0,48], "f": 0, "t": 16, "d": [1841], "a": 1 },
+						{ "px": [864,1008], "src": [0,48], "f": 0, "t": 16, "d": [1842], "a": 1 },
+						{ "px": [888,1008], "src": [0,48], "f": 0, "t": 16, "d": [1843], "a": 1 },
+						{ "px": [912,1008], "src": [0,48], "f": 0, "t": 16, "d": [1844], "a": 1 },
+						{ "px": [936,1008], "src": [0,48], "f": 0, "t": 16, "d": [1845], "a": 1 },
+						{ "px": [960,1008], "src": [24,48], "f": 0, "t": 17, "d": [1846], "a": 1 },
+						{ "px": [984,1008], "src": [48,48], "f": 0, "t": 18, "d": [1847], "a": 1 },
+						{ "px": [1008,1008], "src": [72,48], "f": 0, "t": 19, "d": [1848], "a": 1 }
+					],
+					"entityInstances": []
+				}
+			],
+			"__neighbours": []
+		}
+	],
+	"worlds": [],
+	"dummyWorldIid": "d73f6090-d380-11f0-87cf-3b8d37e1b2e8"
+}
\ No newline at end of file
diff --git a/py/assets/levels/fighting.ldtk b/py/assets/levels/fighting.ldtk
new file mode 100644
index 0000000..3925af0
--- /dev/null
+++ b/py/assets/levels/fighting.ldtk
@@ -0,0 +1,1622 @@
+{
+	"__header__": {
+		"fileType": "LDtk Project JSON",
+		"app": "LDtk",
+		"doc": "https://ldtk.io/json",
+		"schema": "https://ldtk.io/files/JSON_SCHEMA.json",
+		"appAuthor": "Sebastien 'deepnight' Benard",
+		"appVersion": "1.5.3",
+		"url": "https://ldtk.io"
+	},
+	"iid": "a48de660-d380-11f0-a69c-f18cbbf0556b",
+	"jsonVersion": "1.5.3",
+	"appBuildId": 473703,
+	"nextUid": 109,
+	"identifierStyle": "Capitalize",
+	"toc": [],
+	"worldLayout": "Free",
+	"worldGridWidth": 256,
+	"worldGridHeight": 256,
+	"defaultLevelWidth": 256,
+	"defaultLevelHeight": 256,
+	"defaultPivotX": 0,
+	"defaultPivotY": 0,
+	"defaultGridSize": 16,
+	"defaultEntityWidth": 16,
+	"defaultEntityHeight": 16,
+	"bgColor": "#40465B",
+	"defaultLevelBgColor": "#696A79",
+	"minifyJson": false,
+	"externalLevels": false,
+	"exportTiled": false,
+	"simplifiedExport": false,
+	"imageExportMode": "None",
+	"exportLevelBg": true,
+	"pngFilePattern": null,
+	"backupOnSave": false,
+	"backupLimit": 10,
+	"backupRelPath": null,
+	"levelNamePattern": "Level_%idx",
+	"tutorialDesc": null,
+	"customCommands": [],
+	"flags": [],
+	"defs": { "layers": [
+		{
+			"__type": "Entities",
+			"identifier": "Entities",
+			"type": "Entities",
+			"uid": 93,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 16,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 0.6,
+			"hideInList": false,
+			"hideFieldsWhenInactive": true,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": null,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		},
+		{
+			"__type": "IntGrid",
+			"identifier": "IntGrid",
+			"type": "IntGrid",
+			"uid": 2,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 16,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 1,
+			"hideInList": false,
+			"hideFieldsWhenInactive": false,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [
+				{ "value": 1, "identifier": "walls", "color": "#C28569", "tile": null, "groupUid": 0 },
+				{ "value": 2, "identifier": "platforms", "color": "#BE4A2F", "tile": null, "groupUid": 0 }
+			],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [
+				{
+					"uid": 88,
+					"name": "platforms",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 89,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[365]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-2,0,-2,2,0,0,-2,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 2,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 7012128,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 90,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[369]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-2,0,0,2,-2,0,-2,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 2,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5815173,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 91,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[367]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-2,0,0,2,0,0,-2,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 2,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 8201440,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": true,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 40,
+					"name": "walls",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 77,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[26]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3759126,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 78,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[30]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,-1,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2791386,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 79,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[130]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4294934,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 80,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[126]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-1,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6333830,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 81,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[28]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 7873880,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 82,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[80]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,1,-1,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4660485,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 83,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[128]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9006622,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 84,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[76]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-1,1,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1488742,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 85,
+							"active": true,
+							"size": 1,
+							"tileRectsIds": [[78]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6147733,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": true,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 21,
+					"name": "plants",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 87,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[186]],
+							"alpha": 1,
+							"chance": 0.2,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,0,1,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 765260,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 86,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[184]],
+							"alpha": 1,
+							"chance": 0.2,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,1,0,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6199610,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 22,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [ [176], [178] ],
+							"alpha": 1,
+							"chance": 0.3,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,0,0,0,1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6681065,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": false,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				}
+			],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": 1,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		},
+		{
+			"__type": "Tiles",
+			"identifier": "Background",
+			"type": "Tiles",
+			"uid": 108,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 16,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 1,
+			"hideInList": false,
+			"hideFieldsWhenInactive": false,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": 107,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		}
+	], "entities": [
+		{
+			"identifier": "One_way_platform",
+			"uid": 92,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 16,
+			"height": 16,
+			"resizableX": true,
+			"resizableY": true,
+			"minWidth": 16,
+			"maxWidth": null,
+			"minHeight": 4,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 1,
+			"lineOpacity": 1,
+			"hollow": false,
+			"color": "#BE4A2F",
+			"renderMode": "Rectangle",
+			"showName": true,
+			"tilesetId": null,
+			"tileRenderMode": "FitInside",
+			"tileRect": null,
+			"uiTileRect": null,
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0,
+			"pivotY": 0,
+			"fieldDefs": []
+		},
+		{
+			"identifier": "Start",
+			"uid": 94,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 16,
+			"height": 16,
+			"resizableX": false,
+			"resizableY": false,
+			"minWidth": null,
+			"maxWidth": null,
+			"minHeight": null,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 1,
+			"lineOpacity": 1,
+			"hollow": false,
+			"color": "#6543D7",
+			"renderMode": "Rectangle",
+			"showName": true,
+			"tilesetId": null,
+			"tileRenderMode": "FitInside",
+			"tileRect": null,
+			"uiTileRect": null,
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0,
+			"pivotY": 0,
+			"fieldDefs": []
+		}
+	], "tilesets": [
+		{
+			"__cWid": 25,
+			"__cHei": 23,
+			"identifier": "Sunnyland",
+			"uid": 1,
+			"relPath": "../sunnyland/tileset.png",
+			"embedAtlas": null,
+			"pxWid": 400,
+			"pxHei": 368,
+			"tileGridSize": 16,
+			"spacing": 0,
+			"padding": 0,
+			"tags": [],
+			"tagsSourceEnumUid": null,
+			"enumTags": [],
+			"customData": [],
+			"savedSelections": [],
+			"cachedPixelData": {
+				"opaqueTiles": "00000000000000000000000000101010100010110110000000000000000000011011011011001010101000100000000000000000000000000010100000000010101010000001010001010000000000000000000000000000000010100000001010100000000000000000000000000000000000000000000010101000000010100100000000000000000000000000000000101010000000000000000000000000000000000000101010100000000000000000010101000001000000000101000010000000000000000010100000010011011100000001010000001001100000000001101100001110110101010000000000000000000000000000010110000111011101000000000011000011101110000000000000000000000000000000000",
+				"averageColors": "00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000f9850000f9850000f9850000fa65000069557a65f8450000f644f9650000f965f644000049b5c9950000c99549b500000000000000000000000000000000000000000000000000000000f955f7450000f745f9550000f865f7450000f745f86500000000f9550000f6450000f9550000f845695500006955f845000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000f8550000f85500000000000079a5000079a5000000000000f9550000f8550000f9550000f8457a6569550000000000000000f8550000f855000000000000f7550000f755000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000077a5000078b50000f8450000f7450000947400009474000000000000fa650000f9550000fa65000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000f9550000f6450000f955000000000000000000000000a955f8450000f845a9550000f85500000000ca65b965000000000000000000000000000000000000000000000000000000000000a9550000a9550000000000000000000000000000000000000000fa650000f9550000fa650000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000f7450000f8550000f8550000f855000000000000000000000000000000000000000000000000000000000000000000000000f3440000f3450000f534000000000000e9950000f9950000e995000000000000000000000000b855f5340000f534b855000000000000f33400000000000000000000000000000000000000000000000000000000000000000000f7440000f744000000000000000000000000f43500000000f435f4350000f334f436f335000000000000000000000000b955f5340000f534b95500000000000000000000f34500000000f335f3350000000000000000000000000000000000000000f744f3340000f334f7440000000000000000f344f345f3440000f335f3350000f5340000f4350000f33400000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000fa650000f955f9550000000000000000f334f335f3450000f345f335f3340000f7550000000000000000000000000000000000000000f955f9550000000000000000f335f344f3440000f344f344f3350000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"
+			}
+		},
+		{
+			"__cWid": 24,
+			"__cHei": 15,
+			"identifier": "Back",
+			"uid": 107,
+			"relPath": "../sunnyland/back.png",
+			"embedAtlas": null,
+			"pxWid": 384,
+			"pxHei": 240,
+			"tileGridSize": 16,
+			"spacing": 0,
+			"padding": 0,
+			"tags": [],
+			"tagsSourceEnumUid": null,
+			"enumTags": [],
+			"customData": [],
+			"savedSelections": [],
+			"cachedPixelData": {
+				"opaqueTiles": "111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111111",
+				"averageColors": "f4eff4eff4eff4eff5eff7eff5eff5eff5eff6eff6eff6eff6eff5eff6eff6eff6eff6eff6eff7eff7eff6eff5eff4eff5eff7eff7eff6eff6eff7eff8eff7eff5eff6eff7eff7eff5eff6eff7eff7eff6eff7eff9eff7eff7eff7eff5eff4eff5eff8eff9eff9eff8eff7eff6eff8eff9eff7eff6eff9eff8eff8eff8effceffbeff8eff6eff8eff9eff9eff7eff4eff6eff8eff8eff8eff7eff8eff8eff9eff9eff7eff8eff7eff8effaeffceffceffceffceff9eff8eff7eff8eff6eff4eff5eff8effbeffbeff8eff7effceffceffceffbeff9effaeffbeffceffceffceffceffbeffbeffceffbeffceff9eff4eff8effceffceffceffceffbeffceffceffceffceffceffceffceffdeffceffbeffbeffceffceffceffbeffbeffbeff6effbeffceffceffceffbeffceffceffbeffceffbeffceffceffceffbeffbeffbeffbeffbeffbeffbeffbeffbeffbeffbeff6eef6eef6eef5eef6eef6eef6eef5eef6eef6eef6eef5eef6eef6eef6eef5eef6eef6eef6eef5eef6eef6eef6eef5eef3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3cff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bff3bf"
+			}
+		}
+	], "enums": [], "externalEnums": [], "levelFields": [] },
+	"levels": [
+		{
+			"identifier": "Stage",
+			"iid": "a48ed0c0-d380-11f0-a69c-6511375700bf",
+			"uid": 0,
+			"worldX": 0,
+			"worldY": 0,
+			"worldDepth": 0,
+			"pxWid": 512,
+			"pxHei": 256,
+			"__bgColor": "#696A79",
+			"bgColor": null,
+			"useAutoIdentifier": false,
+			"bgRelPath": null,
+			"bgPos": null,
+			"bgPivotX": 0.5,
+			"bgPivotY": 0.5,
+			"__smartColor": "#ADADB5",
+			"__bgPos": null,
+			"externalRelPath": null,
+			"fieldInstances": [],
+			"layerInstances": [
+				{
+					"__identifier": "Entities",
+					"__type": "Entities",
+					"__cWid": 32,
+					"__cHei": 16,
+					"__gridSize": 16,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": null,
+					"__tilesetRelPath": null,
+					"iid": "d12b1320-d380-11f0-a69c-459639b72f2e",
+					"levelId": 0,
+					"layerDefUid": 93,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [],
+					"autoLayerTiles": [],
+					"seed": 2696159,
+					"overrideTilesetUid": null,
+					"gridTiles": [],
+					"entityInstances": [
+						{
+							"__identifier": "One_way_platform",
+							"__grid": [5,8],
+							"__pivot": [0,0],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#BE4A2F",
+							"iid": "dc0257e0-d380-11f0-a69c-f3c92a38b57d",
+							"width": 64,
+							"height": 4,
+							"defUid": 92,
+							"px": [80,128],
+							"fieldInstances": [],
+							"__worldX": 80,
+							"__worldY": 128
+						},
+						{
+							"__identifier": "One_way_platform",
+							"__grid": [13,5],
+							"__pivot": [0,0],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#BE4A2F",
+							"iid": "e68cb520-d380-11f0-a69c-a57b52b096e9",
+							"width": 80,
+							"height": 4,
+							"defUid": 92,
+							"px": [208,80],
+							"fieldInstances": [],
+							"__worldX": 208,
+							"__worldY": 80
+						},
+						{
+							"__identifier": "One_way_platform",
+							"__grid": [22,8],
+							"__pivot": [0,0],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#BE4A2F",
+							"iid": "e8d14df0-d380-11f0-a69c-834d5fa3ce5c",
+							"width": 64,
+							"height": 4,
+							"defUid": 92,
+							"px": [352,128],
+							"fieldInstances": [],
+							"__worldX": 352,
+							"__worldY": 128
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [6,6],
+							"__pivot": [0,0],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#6543D7",
+							"iid": "10f18570-d380-11f0-a69c-13ebff49b291",
+							"width": 16,
+							"height": 16,
+							"defUid": 94,
+							"px": [96,96],
+							"fieldInstances": [],
+							"__worldX": 96,
+							"__worldY": 96
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [24,6],
+							"__pivot": [0,0],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#6543D7",
+							"iid": "119343b0-d380-11f0-a69c-5573405ca8e2",
+							"width": 16,
+							"height": 16,
+							"defUid": 94,
+							"px": [384,96],
+							"fieldInstances": [],
+							"__worldX": 384,
+							"__worldY": 96
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [15,3],
+							"__pivot": [0,0],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#6543D7",
+							"iid": "12817440-d380-11f0-a69c-43651210f778",
+							"width": 16,
+							"height": 16,
+							"defUid": 94,
+							"px": [240,48],
+							"fieldInstances": [],
+							"__worldX": 240,
+							"__worldY": 48
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [15,10],
+							"__pivot": [0,0],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#6543D7",
+							"iid": "133f4600-d380-11f0-a69c-0fe2575c3095",
+							"width": 16,
+							"height": 16,
+							"defUid": 94,
+							"px": [240,160],
+							"fieldInstances": [],
+							"__worldX": 240,
+							"__worldY": 160
+						}
+					]
+				},
+				{
+					"__identifier": "IntGrid",
+					"__type": "IntGrid",
+					"__cWid": 32,
+					"__cHei": 16,
+					"__gridSize": 16,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": 1,
+					"__tilesetRelPath": "../sunnyland/tileset.png",
+					"iid": "c461a2b0-d380-11f0-a69c-bd8e7588af77",
+					"levelId": 0,
+					"layerDefUid": 2,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,2,
+						2,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,2,2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,2,2,
+						2,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,0,0,0,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,
+						0,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,1,
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,0,0,0,0,0,0,0,0
+					],
+					"autoLayerTiles": [
+						{ "px": [128,176], "src": [48,112], "f": 0, "t": 178, "d": [22,360], "a": 1 },
+						{ "px": [192,176], "src": [48,112], "f": 0, "t": 178, "d": [22,364], "a": 1 },
+						{ "px": [240,176], "src": [16,112], "f": 0, "t": 176, "d": [22,367], "a": 1 },
+						{ "px": [288,176], "src": [16,112], "f": 0, "t": 176, "d": [22,370], "a": 1 },
+						{ "px": [304,176], "src": [16,112], "f": 0, "t": 176, "d": [22,371], "a": 1 },
+						{ "px": [320,176], "src": [16,112], "f": 0, "t": 176, "d": [22,372], "a": 1 },
+						{ "px": [368,176], "src": [16,112], "f": 0, "t": 176, "d": [22,375], "a": 1 },
+						{ "px": [384,224], "src": [144,112], "f": 0, "t": 184, "d": [86,472], "a": 1 },
+						{ "px": [112,208], "src": [176,112], "f": 0, "t": 186, "d": [87,423], "a": 1 },
+						{ "px": [112,240], "src": [176,112], "f": 0, "t": 186, "d": [87,487], "a": 1 },
+						{ "px": [144,208], "src": [48,48], "f": 0, "t": 78, "d": [85,425], "a": 1 },
+						{ "px": [160,208], "src": [48,48], "f": 0, "t": 78, "d": [85,426], "a": 1 },
+						{ "px": [176,208], "src": [48,48], "f": 0, "t": 78, "d": [85,427], "a": 1 },
+						{ "px": [192,208], "src": [48,48], "f": 0, "t": 78, "d": [85,428], "a": 1 },
+						{ "px": [208,208], "src": [48,48], "f": 0, "t": 78, "d": [85,429], "a": 1 },
+						{ "px": [224,208], "src": [48,48], "f": 0, "t": 78, "d": [85,430], "a": 1 },
+						{ "px": [240,208], "src": [48,48], "f": 0, "t": 78, "d": [85,431], "a": 1 },
+						{ "px": [256,208], "src": [48,48], "f": 0, "t": 78, "d": [85,432], "a": 1 },
+						{ "px": [272,208], "src": [48,48], "f": 0, "t": 78, "d": [85,433], "a": 1 },
+						{ "px": [288,208], "src": [48,48], "f": 0, "t": 78, "d": [85,434], "a": 1 },
+						{ "px": [304,208], "src": [48,48], "f": 0, "t": 78, "d": [85,435], "a": 1 },
+						{ "px": [320,208], "src": [48,48], "f": 0, "t": 78, "d": [85,436], "a": 1 },
+						{ "px": [336,208], "src": [48,48], "f": 0, "t": 78, "d": [85,437], "a": 1 },
+						{ "px": [352,208], "src": [48,48], "f": 0, "t": 78, "d": [85,438], "a": 1 },
+						{ "px": [144,224], "src": [48,48], "f": 0, "t": 78, "d": [85,457], "a": 1 },
+						{ "px": [160,224], "src": [48,48], "f": 0, "t": 78, "d": [85,458], "a": 1 },
+						{ "px": [176,224], "src": [48,48], "f": 0, "t": 78, "d": [85,459], "a": 1 },
+						{ "px": [192,224], "src": [48,48], "f": 0, "t": 78, "d": [85,460], "a": 1 },
+						{ "px": [208,224], "src": [48,48], "f": 0, "t": 78, "d": [85,461], "a": 1 },
+						{ "px": [224,224], "src": [48,48], "f": 0, "t": 78, "d": [85,462], "a": 1 },
+						{ "px": [240,224], "src": [48,48], "f": 0, "t": 78, "d": [85,463], "a": 1 },
+						{ "px": [256,224], "src": [48,48], "f": 0, "t": 78, "d": [85,464], "a": 1 },
+						{ "px": [272,224], "src": [48,48], "f": 0, "t": 78, "d": [85,465], "a": 1 },
+						{ "px": [288,224], "src": [48,48], "f": 0, "t": 78, "d": [85,466], "a": 1 },
+						{ "px": [304,224], "src": [48,48], "f": 0, "t": 78, "d": [85,467], "a": 1 },
+						{ "px": [320,224], "src": [48,48], "f": 0, "t": 78, "d": [85,468], "a": 1 },
+						{ "px": [336,224], "src": [48,48], "f": 0, "t": 78, "d": [85,469], "a": 1 },
+						{ "px": [352,224], "src": [48,48], "f": 0, "t": 78, "d": [85,470], "a": 1 },
+						{ "px": [144,240], "src": [48,48], "f": 0, "t": 78, "d": [85,489], "a": 1 },
+						{ "px": [160,240], "src": [48,48], "f": 0, "t": 78, "d": [85,490], "a": 1 },
+						{ "px": [176,240], "src": [48,48], "f": 0, "t": 78, "d": [85,491], "a": 1 },
+						{ "px": [192,240], "src": [48,48], "f": 0, "t": 78, "d": [85,492], "a": 1 },
+						{ "px": [208,240], "src": [48,48], "f": 0, "t": 78, "d": [85,493], "a": 1 },
+						{ "px": [224,240], "src": [48,48], "f": 0, "t": 78, "d": [85,494], "a": 1 },
+						{ "px": [240,240], "src": [48,48], "f": 0, "t": 78, "d": [85,495], "a": 1 },
+						{ "px": [256,240], "src": [48,48], "f": 0, "t": 78, "d": [85,496], "a": 1 },
+						{ "px": [272,240], "src": [48,48], "f": 0, "t": 78, "d": [85,497], "a": 1 },
+						{ "px": [288,240], "src": [48,48], "f": 0, "t": 78, "d": [85,498], "a": 1 },
+						{ "px": [304,240], "src": [48,48], "f": 0, "t": 78, "d": [85,499], "a": 1 },
+						{ "px": [320,240], "src": [48,48], "f": 0, "t": 78, "d": [85,500], "a": 1 },
+						{ "px": [336,240], "src": [48,48], "f": 0, "t": 78, "d": [85,501], "a": 1 },
+						{ "px": [352,240], "src": [48,48], "f": 0, "t": 78, "d": [85,502], "a": 1 },
+						{ "px": [128,208], "src": [16,48], "f": 0, "t": 76, "d": [84,424], "a": 1 },
+						{ "px": [128,224], "src": [16,48], "f": 0, "t": 76, "d": [84,456], "a": 1 },
+						{ "px": [128,240], "src": [16,48], "f": 0, "t": 76, "d": [84,488], "a": 1 },
+						{ "px": [368,208], "src": [80,48], "f": 0, "t": 80, "d": [82,439], "a": 1 },
+						{ "px": [368,224], "src": [80,48], "f": 0, "t": 80, "d": [82,471], "a": 1 },
+						{ "px": [368,240], "src": [80,48], "f": 0, "t": 80, "d": [82,503], "a": 1 },
+						{ "px": [144,192], "src": [48,16], "f": 0, "t": 28, "d": [81,393], "a": 1 },
+						{ "px": [160,192], "src": [48,16], "f": 0, "t": 28, "d": [81,394], "a": 1 },
+						{ "px": [176,192], "src": [48,16], "f": 0, "t": 28, "d": [81,395], "a": 1 },
+						{ "px": [192,192], "src": [48,16], "f": 0, "t": 28, "d": [81,396], "a": 1 },
+						{ "px": [208,192], "src": [48,16], "f": 0, "t": 28, "d": [81,397], "a": 1 },
+						{ "px": [224,192], "src": [48,16], "f": 0, "t": 28, "d": [81,398], "a": 1 },
+						{ "px": [240,192], "src": [48,16], "f": 0, "t": 28, "d": [81,399], "a": 1 },
+						{ "px": [256,192], "src": [48,16], "f": 0, "t": 28, "d": [81,400], "a": 1 },
+						{ "px": [272,192], "src": [48,16], "f": 0, "t": 28, "d": [81,401], "a": 1 },
+						{ "px": [288,192], "src": [48,16], "f": 0, "t": 28, "d": [81,402], "a": 1 },
+						{ "px": [304,192], "src": [48,16], "f": 0, "t": 28, "d": [81,403], "a": 1 },
+						{ "px": [320,192], "src": [48,16], "f": 0, "t": 28, "d": [81,404], "a": 1 },
+						{ "px": [336,192], "src": [48,16], "f": 0, "t": 28, "d": [81,405], "a": 1 },
+						{ "px": [352,192], "src": [48,16], "f": 0, "t": 28, "d": [81,406], "a": 1 },
+						{ "px": [368,192], "src": [80,16], "f": 0, "t": 30, "d": [78,407], "a": 1 },
+						{ "px": [128,192], "src": [16,16], "f": 0, "t": 26, "d": [77,392], "a": 1 },
+						{ "px": [224,80], "src": [272,224], "f": 0, "t": 367, "d": [91,174], "a": 1 },
+						{ "px": [240,80], "src": [272,224], "f": 0, "t": 367, "d": [91,175], "a": 1 },
+						{ "px": [256,80], "src": [272,224], "f": 0, "t": 367, "d": [91,176], "a": 1 },
+						{ "px": [96,128], "src": [272,224], "f": 0, "t": 367, "d": [91,262], "a": 1 },
+						{ "px": [112,128], "src": [272,224], "f": 0, "t": 367, "d": [91,263], "a": 1 },
+						{ "px": [368,128], "src": [272,224], "f": 0, "t": 367, "d": [91,279], "a": 1 },
+						{ "px": [384,128], "src": [272,224], "f": 0, "t": 367, "d": [91,280], "a": 1 },
+						{ "px": [272,80], "src": [304,224], "f": 0, "t": 369, "d": [90,177], "a": 1 },
+						{ "px": [128,128], "src": [304,224], "f": 0, "t": 369, "d": [90,264], "a": 1 },
+						{ "px": [400,128], "src": [304,224], "f": 0, "t": 369, "d": [90,281], "a": 1 },
+						{ "px": [208,80], "src": [240,224], "f": 0, "t": 365, "d": [89,173], "a": 1 },
+						{ "px": [80,128], "src": [240,224], "f": 0, "t": 365, "d": [89,261], "a": 1 },
+						{ "px": [352,128], "src": [240,224], "f": 0, "t": 365, "d": [89,278], "a": 1 }
+					],
+					"seed": 7598100,
+					"overrideTilesetUid": null,
+					"gridTiles": [],
+					"entityInstances": []
+				},
+				{
+					"__identifier": "Background",
+					"__type": "Tiles",
+					"__cWid": 32,
+					"__cHei": 16,
+					"__gridSize": 16,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": 107,
+					"__tilesetRelPath": "../sunnyland/back.png",
+					"iid": "40fafac0-d380-11f0-a69c-b185e3ad3620",
+					"levelId": 0,
+					"layerDefUid": 108,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [],
+					"autoLayerTiles": [],
+					"seed": 8728425,
+					"overrideTilesetUid": null,
+					"gridTiles": [
+						{ "px": [0,0], "src": [0,0], "f": 0, "t": 0, "d": [0], "a": 1 },
+						{ "px": [16,0], "src": [16,0], "f": 0, "t": 1, "d": [1], "a": 1 },
+						{ "px": [32,0], "src": [32,0], "f": 0, "t": 2, "d": [2], "a": 1 },
+						{ "px": [48,0], "src": [48,0], "f": 0, "t": 3, "d": [3], "a": 1 },
+						{ "px": [64,0], "src": [64,0], "f": 0, "t": 4, "d": [4], "a": 1 },
+						{ "px": [80,0], "src": [80,0], "f": 0, "t": 5, "d": [5], "a": 1 },
+						{ "px": [96,0], "src": [96,0], "f": 0, "t": 6, "d": [6], "a": 1 },
+						{ "px": [112,0], "src": [112,0], "f": 0, "t": 7, "d": [7], "a": 1 },
+						{ "px": [128,0], "src": [128,0], "f": 0, "t": 8, "d": [8], "a": 1 },
+						{ "px": [144,0], "src": [144,0], "f": 0, "t": 9, "d": [9], "a": 1 },
+						{ "px": [160,0], "src": [160,0], "f": 0, "t": 10, "d": [10], "a": 1 },
+						{ "px": [176,0], "src": [176,0], "f": 0, "t": 11, "d": [11], "a": 1 },
+						{ "px": [192,0], "src": [192,0], "f": 0, "t": 12, "d": [12], "a": 1 },
+						{ "px": [208,0], "src": [208,0], "f": 0, "t": 13, "d": [13], "a": 1 },
+						{ "px": [224,0], "src": [224,0], "f": 0, "t": 14, "d": [14], "a": 1 },
+						{ "px": [240,0], "src": [240,0], "f": 0, "t": 15, "d": [15], "a": 1 },
+						{ "px": [256,0], "src": [256,0], "f": 0, "t": 16, "d": [16], "a": 1 },
+						{ "px": [272,0], "src": [272,0], "f": 0, "t": 17, "d": [17], "a": 1 },
+						{ "px": [288,0], "src": [288,0], "f": 0, "t": 18, "d": [18], "a": 1 },
+						{ "px": [304,0], "src": [304,0], "f": 0, "t": 19, "d": [19], "a": 1 },
+						{ "px": [320,0], "src": [320,0], "f": 0, "t": 20, "d": [20], "a": 1 },
+						{ "px": [336,0], "src": [336,0], "f": 0, "t": 21, "d": [21], "a": 1 },
+						{ "px": [352,0], "src": [352,0], "f": 0, "t": 22, "d": [22], "a": 1 },
+						{ "px": [368,0], "src": [368,0], "f": 0, "t": 23, "d": [23], "a": 1 },
+						{ "px": [384,0], "src": [0,0], "f": 0, "t": 0, "d": [24], "a": 1 },
+						{ "px": [400,0], "src": [16,0], "f": 0, "t": 1, "d": [25], "a": 1 },
+						{ "px": [416,0], "src": [32,0], "f": 0, "t": 2, "d": [26], "a": 1 },
+						{ "px": [432,0], "src": [48,0], "f": 0, "t": 3, "d": [27], "a": 1 },
+						{ "px": [448,0], "src": [64,0], "f": 0, "t": 4, "d": [28], "a": 1 },
+						{ "px": [464,0], "src": [80,0], "f": 0, "t": 5, "d": [29], "a": 1 },
+						{ "px": [480,0], "src": [96,0], "f": 0, "t": 6, "d": [30], "a": 1 },
+						{ "px": [496,0], "src": [112,0], "f": 0, "t": 7, "d": [31], "a": 1 },
+						{ "px": [0,16], "src": [0,16], "f": 0, "t": 24, "d": [32], "a": 1 },
+						{ "px": [16,16], "src": [16,16], "f": 0, "t": 25, "d": [33], "a": 1 },
+						{ "px": [32,16], "src": [32,16], "f": 0, "t": 26, "d": [34], "a": 1 },
+						{ "px": [48,16], "src": [48,16], "f": 0, "t": 27, "d": [35], "a": 1 },
+						{ "px": [64,16], "src": [64,16], "f": 0, "t": 28, "d": [36], "a": 1 },
+						{ "px": [80,16], "src": [80,16], "f": 0, "t": 29, "d": [37], "a": 1 },
+						{ "px": [96,16], "src": [96,16], "f": 0, "t": 30, "d": [38], "a": 1 },
+						{ "px": [112,16], "src": [112,16], "f": 0, "t": 31, "d": [39], "a": 1 },
+						{ "px": [128,16], "src": [128,16], "f": 0, "t": 32, "d": [40], "a": 1 },
+						{ "px": [144,16], "src": [144,16], "f": 0, "t": 33, "d": [41], "a": 1 },
+						{ "px": [160,16], "src": [160,16], "f": 0, "t": 34, "d": [42], "a": 1 },
+						{ "px": [176,16], "src": [176,16], "f": 0, "t": 35, "d": [43], "a": 1 },
+						{ "px": [192,16], "src": [192,16], "f": 0, "t": 36, "d": [44], "a": 1 },
+						{ "px": [208,16], "src": [208,16], "f": 0, "t": 37, "d": [45], "a": 1 },
+						{ "px": [224,16], "src": [224,16], "f": 0, "t": 38, "d": [46], "a": 1 },
+						{ "px": [240,16], "src": [240,16], "f": 0, "t": 39, "d": [47], "a": 1 },
+						{ "px": [256,16], "src": [256,16], "f": 0, "t": 40, "d": [48], "a": 1 },
+						{ "px": [272,16], "src": [272,16], "f": 0, "t": 41, "d": [49], "a": 1 },
+						{ "px": [288,16], "src": [288,16], "f": 0, "t": 42, "d": [50], "a": 1 },
+						{ "px": [304,16], "src": [304,16], "f": 0, "t": 43, "d": [51], "a": 1 },
+						{ "px": [320,16], "src": [320,16], "f": 0, "t": 44, "d": [52], "a": 1 },
+						{ "px": [336,16], "src": [336,16], "f": 0, "t": 45, "d": [53], "a": 1 },
+						{ "px": [352,16], "src": [352,16], "f": 0, "t": 46, "d": [54], "a": 1 },
+						{ "px": [368,16], "src": [368,16], "f": 0, "t": 47, "d": [55], "a": 1 },
+						{ "px": [384,16], "src": [0,16], "f": 0, "t": 24, "d": [56], "a": 1 },
+						{ "px": [400,16], "src": [16,16], "f": 0, "t": 25, "d": [57], "a": 1 },
+						{ "px": [416,16], "src": [32,16], "f": 0, "t": 26, "d": [58], "a": 1 },
+						{ "px": [432,16], "src": [48,16], "f": 0, "t": 27, "d": [59], "a": 1 },
+						{ "px": [448,16], "src": [64,16], "f": 0, "t": 28, "d": [60], "a": 1 },
+						{ "px": [464,16], "src": [80,16], "f": 0, "t": 29, "d": [61], "a": 1 },
+						{ "px": [480,16], "src": [96,16], "f": 0, "t": 30, "d": [62], "a": 1 },
+						{ "px": [496,16], "src": [112,16], "f": 0, "t": 31, "d": [63], "a": 1 },
+						{ "px": [0,32], "src": [0,32], "f": 0, "t": 48, "d": [64], "a": 1 },
+						{ "px": [16,32], "src": [16,32], "f": 0, "t": 49, "d": [65], "a": 1 },
+						{ "px": [32,32], "src": [32,32], "f": 0, "t": 50, "d": [66], "a": 1 },
+						{ "px": [48,32], "src": [48,32], "f": 0, "t": 51, "d": [67], "a": 1 },
+						{ "px": [64,32], "src": [64,32], "f": 0, "t": 52, "d": [68], "a": 1 },
+						{ "px": [80,32], "src": [80,32], "f": 0, "t": 53, "d": [69], "a": 1 },
+						{ "px": [96,32], "src": [96,32], "f": 0, "t": 54, "d": [70], "a": 1 },
+						{ "px": [112,32], "src": [112,32], "f": 0, "t": 55, "d": [71], "a": 1 },
+						{ "px": [128,32], "src": [128,32], "f": 0, "t": 56, "d": [72], "a": 1 },
+						{ "px": [144,32], "src": [144,32], "f": 0, "t": 57, "d": [73], "a": 1 },
+						{ "px": [160,32], "src": [160,32], "f": 0, "t": 58, "d": [74], "a": 1 },
+						{ "px": [176,32], "src": [176,32], "f": 0, "t": 59, "d": [75], "a": 1 },
+						{ "px": [192,32], "src": [192,32], "f": 0, "t": 60, "d": [76], "a": 1 },
+						{ "px": [208,32], "src": [208,32], "f": 0, "t": 61, "d": [77], "a": 1 },
+						{ "px": [224,32], "src": [224,32], "f": 0, "t": 62, "d": [78], "a": 1 },
+						{ "px": [240,32], "src": [240,32], "f": 0, "t": 63, "d": [79], "a": 1 },
+						{ "px": [256,32], "src": [256,32], "f": 0, "t": 64, "d": [80], "a": 1 },
+						{ "px": [272,32], "src": [272,32], "f": 0, "t": 65, "d": [81], "a": 1 },
+						{ "px": [288,32], "src": [288,32], "f": 0, "t": 66, "d": [82], "a": 1 },
+						{ "px": [304,32], "src": [304,32], "f": 0, "t": 67, "d": [83], "a": 1 },
+						{ "px": [320,32], "src": [320,32], "f": 0, "t": 68, "d": [84], "a": 1 },
+						{ "px": [336,32], "src": [336,32], "f": 0, "t": 69, "d": [85], "a": 1 },
+						{ "px": [352,32], "src": [352,32], "f": 0, "t": 70, "d": [86], "a": 1 },
+						{ "px": [368,32], "src": [368,32], "f": 0, "t": 71, "d": [87], "a": 1 },
+						{ "px": [384,32], "src": [0,32], "f": 0, "t": 48, "d": [88], "a": 1 },
+						{ "px": [400,32], "src": [16,32], "f": 0, "t": 49, "d": [89], "a": 1 },
+						{ "px": [416,32], "src": [32,32], "f": 0, "t": 50, "d": [90], "a": 1 },
+						{ "px": [432,32], "src": [48,32], "f": 0, "t": 51, "d": [91], "a": 1 },
+						{ "px": [448,32], "src": [64,32], "f": 0, "t": 52, "d": [92], "a": 1 },
+						{ "px": [464,32], "src": [80,32], "f": 0, "t": 53, "d": [93], "a": 1 },
+						{ "px": [480,32], "src": [96,32], "f": 0, "t": 54, "d": [94], "a": 1 },
+						{ "px": [496,32], "src": [112,32], "f": 0, "t": 55, "d": [95], "a": 1 },
+						{ "px": [0,48], "src": [0,48], "f": 0, "t": 72, "d": [96], "a": 1 },
+						{ "px": [16,48], "src": [16,48], "f": 0, "t": 73, "d": [97], "a": 1 },
+						{ "px": [32,48], "src": [32,48], "f": 0, "t": 74, "d": [98], "a": 1 },
+						{ "px": [48,48], "src": [48,48], "f": 0, "t": 75, "d": [99], "a": 1 },
+						{ "px": [64,48], "src": [64,48], "f": 0, "t": 76, "d": [100], "a": 1 },
+						{ "px": [80,48], "src": [80,48], "f": 0, "t": 77, "d": [101], "a": 1 },
+						{ "px": [96,48], "src": [96,48], "f": 0, "t": 78, "d": [102], "a": 1 },
+						{ "px": [112,48], "src": [112,48], "f": 0, "t": 79, "d": [103], "a": 1 },
+						{ "px": [128,48], "src": [128,48], "f": 0, "t": 80, "d": [104], "a": 1 },
+						{ "px": [144,48], "src": [144,48], "f": 0, "t": 81, "d": [105], "a": 1 },
+						{ "px": [160,48], "src": [160,48], "f": 0, "t": 82, "d": [106], "a": 1 },
+						{ "px": [176,48], "src": [176,48], "f": 0, "t": 83, "d": [107], "a": 1 },
+						{ "px": [192,48], "src": [192,48], "f": 0, "t": 84, "d": [108], "a": 1 },
+						{ "px": [208,48], "src": [208,48], "f": 0, "t": 85, "d": [109], "a": 1 },
+						{ "px": [224,48], "src": [224,48], "f": 0, "t": 86, "d": [110], "a": 1 },
+						{ "px": [240,48], "src": [240,48], "f": 0, "t": 87, "d": [111], "a": 1 },
+						{ "px": [256,48], "src": [256,48], "f": 0, "t": 88, "d": [112], "a": 1 },
+						{ "px": [272,48], "src": [272,48], "f": 0, "t": 89, "d": [113], "a": 1 },
+						{ "px": [288,48], "src": [288,48], "f": 0, "t": 90, "d": [114], "a": 1 },
+						{ "px": [304,48], "src": [304,48], "f": 0, "t": 91, "d": [115], "a": 1 },
+						{ "px": [320,48], "src": [320,48], "f": 0, "t": 92, "d": [116], "a": 1 },
+						{ "px": [336,48], "src": [336,48], "f": 0, "t": 93, "d": [117], "a": 1 },
+						{ "px": [352,48], "src": [352,48], "f": 0, "t": 94, "d": [118], "a": 1 },
+						{ "px": [368,48], "src": [368,48], "f": 0, "t": 95, "d": [119], "a": 1 },
+						{ "px": [384,48], "src": [0,48], "f": 0, "t": 72, "d": [120], "a": 1 },
+						{ "px": [400,48], "src": [16,48], "f": 0, "t": 73, "d": [121], "a": 1 },
+						{ "px": [416,48], "src": [32,48], "f": 0, "t": 74, "d": [122], "a": 1 },
+						{ "px": [432,48], "src": [48,48], "f": 0, "t": 75, "d": [123], "a": 1 },
+						{ "px": [448,48], "src": [64,48], "f": 0, "t": 76, "d": [124], "a": 1 },
+						{ "px": [464,48], "src": [80,48], "f": 0, "t": 77, "d": [125], "a": 1 },
+						{ "px": [480,48], "src": [96,48], "f": 0, "t": 78, "d": [126], "a": 1 },
+						{ "px": [496,48], "src": [112,48], "f": 0, "t": 79, "d": [127], "a": 1 },
+						{ "px": [0,64], "src": [0,64], "f": 0, "t": 96, "d": [128], "a": 1 },
+						{ "px": [16,64], "src": [16,64], "f": 0, "t": 97, "d": [129], "a": 1 },
+						{ "px": [32,64], "src": [32,64], "f": 0, "t": 98, "d": [130], "a": 1 },
+						{ "px": [48,64], "src": [48,64], "f": 0, "t": 99, "d": [131], "a": 1 },
+						{ "px": [64,64], "src": [64,64], "f": 0, "t": 100, "d": [132], "a": 1 },
+						{ "px": [80,64], "src": [80,64], "f": 0, "t": 101, "d": [133], "a": 1 },
+						{ "px": [96,64], "src": [96,64], "f": 0, "t": 102, "d": [134], "a": 1 },
+						{ "px": [112,64], "src": [112,64], "f": 0, "t": 103, "d": [135], "a": 1 },
+						{ "px": [128,64], "src": [128,64], "f": 0, "t": 104, "d": [136], "a": 1 },
+						{ "px": [144,64], "src": [144,64], "f": 0, "t": 105, "d": [137], "a": 1 },
+						{ "px": [160,64], "src": [160,64], "f": 0, "t": 106, "d": [138], "a": 1 },
+						{ "px": [176,64], "src": [176,64], "f": 0, "t": 107, "d": [139], "a": 1 },
+						{ "px": [192,64], "src": [192,64], "f": 0, "t": 108, "d": [140], "a": 1 },
+						{ "px": [208,64], "src": [208,64], "f": 0, "t": 109, "d": [141], "a": 1 },
+						{ "px": [224,64], "src": [224,64], "f": 0, "t": 110, "d": [142], "a": 1 },
+						{ "px": [240,64], "src": [240,64], "f": 0, "t": 111, "d": [143], "a": 1 },
+						{ "px": [256,64], "src": [256,64], "f": 0, "t": 112, "d": [144], "a": 1 },
+						{ "px": [272,64], "src": [272,64], "f": 0, "t": 113, "d": [145], "a": 1 },
+						{ "px": [288,64], "src": [288,64], "f": 0, "t": 114, "d": [146], "a": 1 },
+						{ "px": [304,64], "src": [304,64], "f": 0, "t": 115, "d": [147], "a": 1 },
+						{ "px": [320,64], "src": [320,64], "f": 0, "t": 116, "d": [148], "a": 1 },
+						{ "px": [336,64], "src": [336,64], "f": 0, "t": 117, "d": [149], "a": 1 },
+						{ "px": [352,64], "src": [352,64], "f": 0, "t": 118, "d": [150], "a": 1 },
+						{ "px": [368,64], "src": [368,64], "f": 0, "t": 119, "d": [151], "a": 1 },
+						{ "px": [384,64], "src": [0,64], "f": 0, "t": 96, "d": [152], "a": 1 },
+						{ "px": [400,64], "src": [16,64], "f": 0, "t": 97, "d": [153], "a": 1 },
+						{ "px": [416,64], "src": [32,64], "f": 0, "t": 98, "d": [154], "a": 1 },
+						{ "px": [432,64], "src": [48,64], "f": 0, "t": 99, "d": [155], "a": 1 },
+						{ "px": [448,64], "src": [64,64], "f": 0, "t": 100, "d": [156], "a": 1 },
+						{ "px": [464,64], "src": [80,64], "f": 0, "t": 101, "d": [157], "a": 1 },
+						{ "px": [480,64], "src": [96,64], "f": 0, "t": 102, "d": [158], "a": 1 },
+						{ "px": [496,64], "src": [112,64], "f": 0, "t": 103, "d": [159], "a": 1 },
+						{ "px": [0,80], "src": [0,80], "f": 0, "t": 120, "d": [160], "a": 1 },
+						{ "px": [16,80], "src": [16,80], "f": 0, "t": 121, "d": [161], "a": 1 },
+						{ "px": [32,80], "src": [32,80], "f": 0, "t": 122, "d": [162], "a": 1 },
+						{ "px": [48,80], "src": [48,80], "f": 0, "t": 123, "d": [163], "a": 1 },
+						{ "px": [64,80], "src": [64,80], "f": 0, "t": 124, "d": [164], "a": 1 },
+						{ "px": [80,80], "src": [80,80], "f": 0, "t": 125, "d": [165], "a": 1 },
+						{ "px": [96,80], "src": [96,80], "f": 0, "t": 126, "d": [166], "a": 1 },
+						{ "px": [112,80], "src": [112,80], "f": 0, "t": 127, "d": [167], "a": 1 },
+						{ "px": [128,80], "src": [128,80], "f": 0, "t": 128, "d": [168], "a": 1 },
+						{ "px": [144,80], "src": [144,80], "f": 0, "t": 129, "d": [169], "a": 1 },
+						{ "px": [160,80], "src": [160,80], "f": 0, "t": 130, "d": [170], "a": 1 },
+						{ "px": [176,80], "src": [176,80], "f": 0, "t": 131, "d": [171], "a": 1 },
+						{ "px": [192,80], "src": [192,80], "f": 0, "t": 132, "d": [172], "a": 1 },
+						{ "px": [208,80], "src": [208,80], "f": 0, "t": 133, "d": [173], "a": 1 },
+						{ "px": [224,80], "src": [224,80], "f": 0, "t": 134, "d": [174], "a": 1 },
+						{ "px": [240,80], "src": [240,80], "f": 0, "t": 135, "d": [175], "a": 1 },
+						{ "px": [256,80], "src": [256,80], "f": 0, "t": 136, "d": [176], "a": 1 },
+						{ "px": [272,80], "src": [272,80], "f": 0, "t": 137, "d": [177], "a": 1 },
+						{ "px": [288,80], "src": [288,80], "f": 0, "t": 138, "d": [178], "a": 1 },
+						{ "px": [304,80], "src": [304,80], "f": 0, "t": 139, "d": [179], "a": 1 },
+						{ "px": [320,80], "src": [320,80], "f": 0, "t": 140, "d": [180], "a": 1 },
+						{ "px": [336,80], "src": [336,80], "f": 0, "t": 141, "d": [181], "a": 1 },
+						{ "px": [352,80], "src": [352,80], "f": 0, "t": 142, "d": [182], "a": 1 },
+						{ "px": [368,80], "src": [368,80], "f": 0, "t": 143, "d": [183], "a": 1 },
+						{ "px": [384,80], "src": [0,80], "f": 0, "t": 120, "d": [184], "a": 1 },
+						{ "px": [400,80], "src": [16,80], "f": 0, "t": 121, "d": [185], "a": 1 },
+						{ "px": [416,80], "src": [32,80], "f": 0, "t": 122, "d": [186], "a": 1 },
+						{ "px": [432,80], "src": [48,80], "f": 0, "t": 123, "d": [187], "a": 1 },
+						{ "px": [448,80], "src": [64,80], "f": 0, "t": 124, "d": [188], "a": 1 },
+						{ "px": [464,80], "src": [80,80], "f": 0, "t": 125, "d": [189], "a": 1 },
+						{ "px": [480,80], "src": [96,80], "f": 0, "t": 126, "d": [190], "a": 1 },
+						{ "px": [496,80], "src": [112,80], "f": 0, "t": 127, "d": [191], "a": 1 },
+						{ "px": [0,96], "src": [0,96], "f": 0, "t": 144, "d": [192], "a": 1 },
+						{ "px": [16,96], "src": [16,96], "f": 0, "t": 145, "d": [193], "a": 1 },
+						{ "px": [32,96], "src": [32,96], "f": 0, "t": 146, "d": [194], "a": 1 },
+						{ "px": [48,96], "src": [48,96], "f": 0, "t": 147, "d": [195], "a": 1 },
+						{ "px": [64,96], "src": [64,96], "f": 0, "t": 148, "d": [196], "a": 1 },
+						{ "px": [80,96], "src": [80,96], "f": 0, "t": 149, "d": [197], "a": 1 },
+						{ "px": [96,96], "src": [96,96], "f": 0, "t": 150, "d": [198], "a": 1 },
+						{ "px": [112,96], "src": [112,96], "f": 0, "t": 151, "d": [199], "a": 1 },
+						{ "px": [128,96], "src": [128,96], "f": 0, "t": 152, "d": [200], "a": 1 },
+						{ "px": [144,96], "src": [144,96], "f": 0, "t": 153, "d": [201], "a": 1 },
+						{ "px": [160,96], "src": [160,96], "f": 0, "t": 154, "d": [202], "a": 1 },
+						{ "px": [176,96], "src": [176,96], "f": 0, "t": 155, "d": [203], "a": 1 },
+						{ "px": [192,96], "src": [192,96], "f": 0, "t": 156, "d": [204], "a": 1 },
+						{ "px": [208,96], "src": [208,96], "f": 0, "t": 157, "d": [205], "a": 1 },
+						{ "px": [224,96], "src": [224,96], "f": 0, "t": 158, "d": [206], "a": 1 },
+						{ "px": [240,96], "src": [240,96], "f": 0, "t": 159, "d": [207], "a": 1 },
+						{ "px": [256,96], "src": [256,96], "f": 0, "t": 160, "d": [208], "a": 1 },
+						{ "px": [272,96], "src": [272,96], "f": 0, "t": 161, "d": [209], "a": 1 },
+						{ "px": [288,96], "src": [288,96], "f": 0, "t": 162, "d": [210], "a": 1 },
+						{ "px": [304,96], "src": [304,96], "f": 0, "t": 163, "d": [211], "a": 1 },
+						{ "px": [320,96], "src": [320,96], "f": 0, "t": 164, "d": [212], "a": 1 },
+						{ "px": [336,96], "src": [336,96], "f": 0, "t": 165, "d": [213], "a": 1 },
+						{ "px": [352,96], "src": [352,96], "f": 0, "t": 166, "d": [214], "a": 1 },
+						{ "px": [368,96], "src": [368,96], "f": 0, "t": 167, "d": [215], "a": 1 },
+						{ "px": [384,96], "src": [0,96], "f": 0, "t": 144, "d": [216], "a": 1 },
+						{ "px": [400,96], "src": [16,96], "f": 0, "t": 145, "d": [217], "a": 1 },
+						{ "px": [416,96], "src": [32,96], "f": 0, "t": 146, "d": [218], "a": 1 },
+						{ "px": [432,96], "src": [48,96], "f": 0, "t": 147, "d": [219], "a": 1 },
+						{ "px": [448,96], "src": [64,96], "f": 0, "t": 148, "d": [220], "a": 1 },
+						{ "px": [464,96], "src": [80,96], "f": 0, "t": 149, "d": [221], "a": 1 },
+						{ "px": [480,96], "src": [96,96], "f": 0, "t": 150, "d": [222], "a": 1 },
+						{ "px": [496,96], "src": [112,96], "f": 0, "t": 151, "d": [223], "a": 1 },
+						{ "px": [0,112], "src": [0,112], "f": 0, "t": 168, "d": [224], "a": 1 },
+						{ "px": [16,112], "src": [16,112], "f": 0, "t": 169, "d": [225], "a": 1 },
+						{ "px": [32,112], "src": [32,112], "f": 0, "t": 170, "d": [226], "a": 1 },
+						{ "px": [48,112], "src": [48,112], "f": 0, "t": 171, "d": [227], "a": 1 },
+						{ "px": [64,112], "src": [64,112], "f": 0, "t": 172, "d": [228], "a": 1 },
+						{ "px": [80,112], "src": [80,112], "f": 0, "t": 173, "d": [229], "a": 1 },
+						{ "px": [96,112], "src": [96,112], "f": 0, "t": 174, "d": [230], "a": 1 },
+						{ "px": [112,112], "src": [112,112], "f": 0, "t": 175, "d": [231], "a": 1 },
+						{ "px": [128,112], "src": [128,112], "f": 0, "t": 176, "d": [232], "a": 1 },
+						{ "px": [144,112], "src": [144,112], "f": 0, "t": 177, "d": [233], "a": 1 },
+						{ "px": [160,112], "src": [160,112], "f": 0, "t": 178, "d": [234], "a": 1 },
+						{ "px": [176,112], "src": [176,112], "f": 0, "t": 179, "d": [235], "a": 1 },
+						{ "px": [192,112], "src": [192,112], "f": 0, "t": 180, "d": [236], "a": 1 },
+						{ "px": [208,112], "src": [208,112], "f": 0, "t": 181, "d": [237], "a": 1 },
+						{ "px": [224,112], "src": [224,112], "f": 0, "t": 182, "d": [238], "a": 1 },
+						{ "px": [240,112], "src": [240,112], "f": 0, "t": 183, "d": [239], "a": 1 },
+						{ "px": [256,112], "src": [256,112], "f": 0, "t": 184, "d": [240], "a": 1 },
+						{ "px": [272,112], "src": [272,112], "f": 0, "t": 185, "d": [241], "a": 1 },
+						{ "px": [288,112], "src": [288,112], "f": 0, "t": 186, "d": [242], "a": 1 },
+						{ "px": [304,112], "src": [304,112], "f": 0, "t": 187, "d": [243], "a": 1 },
+						{ "px": [320,112], "src": [320,112], "f": 0, "t": 188, "d": [244], "a": 1 },
+						{ "px": [336,112], "src": [336,112], "f": 0, "t": 189, "d": [245], "a": 1 },
+						{ "px": [352,112], "src": [352,112], "f": 0, "t": 190, "d": [246], "a": 1 },
+						{ "px": [368,112], "src": [368,112], "f": 0, "t": 191, "d": [247], "a": 1 },
+						{ "px": [384,112], "src": [0,112], "f": 0, "t": 168, "d": [248], "a": 1 },
+						{ "px": [400,112], "src": [16,112], "f": 0, "t": 169, "d": [249], "a": 1 },
+						{ "px": [416,112], "src": [32,112], "f": 0, "t": 170, "d": [250], "a": 1 },
+						{ "px": [432,112], "src": [48,112], "f": 0, "t": 171, "d": [251], "a": 1 },
+						{ "px": [448,112], "src": [64,112], "f": 0, "t": 172, "d": [252], "a": 1 },
+						{ "px": [464,112], "src": [80,112], "f": 0, "t": 173, "d": [253], "a": 1 },
+						{ "px": [480,112], "src": [96,112], "f": 0, "t": 174, "d": [254], "a": 1 },
+						{ "px": [496,112], "src": [112,112], "f": 0, "t": 175, "d": [255], "a": 1 },
+						{ "px": [0,128], "src": [0,128], "f": 0, "t": 192, "d": [256], "a": 1 },
+						{ "px": [16,128], "src": [16,128], "f": 0, "t": 193, "d": [257], "a": 1 },
+						{ "px": [32,128], "src": [32,128], "f": 0, "t": 194, "d": [258], "a": 1 },
+						{ "px": [48,128], "src": [48,128], "f": 0, "t": 195, "d": [259], "a": 1 },
+						{ "px": [64,128], "src": [64,128], "f": 0, "t": 196, "d": [260], "a": 1 },
+						{ "px": [80,128], "src": [80,128], "f": 0, "t": 197, "d": [261], "a": 1 },
+						{ "px": [96,128], "src": [96,128], "f": 0, "t": 198, "d": [262], "a": 1 },
+						{ "px": [112,128], "src": [112,128], "f": 0, "t": 199, "d": [263], "a": 1 },
+						{ "px": [128,128], "src": [128,128], "f": 0, "t": 200, "d": [264], "a": 1 },
+						{ "px": [144,128], "src": [144,128], "f": 0, "t": 201, "d": [265], "a": 1 },
+						{ "px": [160,128], "src": [160,128], "f": 0, "t": 202, "d": [266], "a": 1 },
+						{ "px": [176,128], "src": [176,128], "f": 0, "t": 203, "d": [267], "a": 1 },
+						{ "px": [192,128], "src": [192,128], "f": 0, "t": 204, "d": [268], "a": 1 },
+						{ "px": [208,128], "src": [208,128], "f": 0, "t": 205, "d": [269], "a": 1 },
+						{ "px": [224,128], "src": [224,128], "f": 0, "t": 206, "d": [270], "a": 1 },
+						{ "px": [240,128], "src": [240,128], "f": 0, "t": 207, "d": [271], "a": 1 },
+						{ "px": [256,128], "src": [256,128], "f": 0, "t": 208, "d": [272], "a": 1 },
+						{ "px": [272,128], "src": [272,128], "f": 0, "t": 209, "d": [273], "a": 1 },
+						{ "px": [288,128], "src": [288,128], "f": 0, "t": 210, "d": [274], "a": 1 },
+						{ "px": [304,128], "src": [304,128], "f": 0, "t": 211, "d": [275], "a": 1 },
+						{ "px": [320,128], "src": [320,128], "f": 0, "t": 212, "d": [276], "a": 1 },
+						{ "px": [336,128], "src": [336,128], "f": 0, "t": 213, "d": [277], "a": 1 },
+						{ "px": [352,128], "src": [352,128], "f": 0, "t": 214, "d": [278], "a": 1 },
+						{ "px": [368,128], "src": [368,128], "f": 0, "t": 215, "d": [279], "a": 1 },
+						{ "px": [384,128], "src": [0,128], "f": 0, "t": 192, "d": [280], "a": 1 },
+						{ "px": [400,128], "src": [16,128], "f": 0, "t": 193, "d": [281], "a": 1 },
+						{ "px": [416,128], "src": [32,128], "f": 0, "t": 194, "d": [282], "a": 1 },
+						{ "px": [432,128], "src": [48,128], "f": 0, "t": 195, "d": [283], "a": 1 },
+						{ "px": [448,128], "src": [64,128], "f": 0, "t": 196, "d": [284], "a": 1 },
+						{ "px": [464,128], "src": [80,128], "f": 0, "t": 197, "d": [285], "a": 1 },
+						{ "px": [480,128], "src": [96,128], "f": 0, "t": 198, "d": [286], "a": 1 },
+						{ "px": [496,128], "src": [112,128], "f": 0, "t": 199, "d": [287], "a": 1 },
+						{ "px": [0,144], "src": [0,144], "f": 0, "t": 216, "d": [288], "a": 1 },
+						{ "px": [16,144], "src": [16,144], "f": 0, "t": 217, "d": [289], "a": 1 },
+						{ "px": [32,144], "src": [32,144], "f": 0, "t": 218, "d": [290], "a": 1 },
+						{ "px": [48,144], "src": [48,144], "f": 0, "t": 219, "d": [291], "a": 1 },
+						{ "px": [64,144], "src": [64,144], "f": 0, "t": 220, "d": [292], "a": 1 },
+						{ "px": [80,144], "src": [80,144], "f": 0, "t": 221, "d": [293], "a": 1 },
+						{ "px": [96,144], "src": [96,144], "f": 0, "t": 222, "d": [294], "a": 1 },
+						{ "px": [112,144], "src": [112,144], "f": 0, "t": 223, "d": [295], "a": 1 },
+						{ "px": [128,144], "src": [128,144], "f": 0, "t": 224, "d": [296], "a": 1 },
+						{ "px": [144,144], "src": [144,144], "f": 0, "t": 225, "d": [297], "a": 1 },
+						{ "px": [160,144], "src": [160,144], "f": 0, "t": 226, "d": [298], "a": 1 },
+						{ "px": [176,144], "src": [176,144], "f": 0, "t": 227, "d": [299], "a": 1 },
+						{ "px": [192,144], "src": [192,144], "f": 0, "t": 228, "d": [300], "a": 1 },
+						{ "px": [208,144], "src": [208,144], "f": 0, "t": 229, "d": [301], "a": 1 },
+						{ "px": [224,144], "src": [224,144], "f": 0, "t": 230, "d": [302], "a": 1 },
+						{ "px": [240,144], "src": [240,144], "f": 0, "t": 231, "d": [303], "a": 1 },
+						{ "px": [256,144], "src": [256,144], "f": 0, "t": 232, "d": [304], "a": 1 },
+						{ "px": [272,144], "src": [272,144], "f": 0, "t": 233, "d": [305], "a": 1 },
+						{ "px": [288,144], "src": [288,144], "f": 0, "t": 234, "d": [306], "a": 1 },
+						{ "px": [304,144], "src": [304,144], "f": 0, "t": 235, "d": [307], "a": 1 },
+						{ "px": [320,144], "src": [320,144], "f": 0, "t": 236, "d": [308], "a": 1 },
+						{ "px": [336,144], "src": [336,144], "f": 0, "t": 237, "d": [309], "a": 1 },
+						{ "px": [352,144], "src": [352,144], "f": 0, "t": 238, "d": [310], "a": 1 },
+						{ "px": [368,144], "src": [368,144], "f": 0, "t": 239, "d": [311], "a": 1 },
+						{ "px": [384,144], "src": [0,144], "f": 0, "t": 216, "d": [312], "a": 1 },
+						{ "px": [400,144], "src": [16,144], "f": 0, "t": 217, "d": [313], "a": 1 },
+						{ "px": [416,144], "src": [32,144], "f": 0, "t": 218, "d": [314], "a": 1 },
+						{ "px": [432,144], "src": [48,144], "f": 0, "t": 219, "d": [315], "a": 1 },
+						{ "px": [448,144], "src": [64,144], "f": 0, "t": 220, "d": [316], "a": 1 },
+						{ "px": [464,144], "src": [80,144], "f": 0, "t": 221, "d": [317], "a": 1 },
+						{ "px": [480,144], "src": [96,144], "f": 0, "t": 222, "d": [318], "a": 1 },
+						{ "px": [496,144], "src": [112,144], "f": 0, "t": 223, "d": [319], "a": 1 },
+						{ "px": [0,160], "src": [0,160], "f": 0, "t": 240, "d": [320], "a": 1 },
+						{ "px": [16,160], "src": [16,160], "f": 0, "t": 241, "d": [321], "a": 1 },
+						{ "px": [32,160], "src": [32,160], "f": 0, "t": 242, "d": [322], "a": 1 },
+						{ "px": [48,160], "src": [48,160], "f": 0, "t": 243, "d": [323], "a": 1 },
+						{ "px": [64,160], "src": [64,160], "f": 0, "t": 244, "d": [324], "a": 1 },
+						{ "px": [80,160], "src": [80,160], "f": 0, "t": 245, "d": [325], "a": 1 },
+						{ "px": [96,160], "src": [96,160], "f": 0, "t": 246, "d": [326], "a": 1 },
+						{ "px": [112,160], "src": [112,160], "f": 0, "t": 247, "d": [327], "a": 1 },
+						{ "px": [128,160], "src": [128,160], "f": 0, "t": 248, "d": [328], "a": 1 },
+						{ "px": [144,160], "src": [144,160], "f": 0, "t": 249, "d": [329], "a": 1 },
+						{ "px": [160,160], "src": [160,160], "f": 0, "t": 250, "d": [330], "a": 1 },
+						{ "px": [176,160], "src": [176,160], "f": 0, "t": 251, "d": [331], "a": 1 },
+						{ "px": [192,160], "src": [192,160], "f": 0, "t": 252, "d": [332], "a": 1 },
+						{ "px": [208,160], "src": [208,160], "f": 0, "t": 253, "d": [333], "a": 1 },
+						{ "px": [224,160], "src": [224,160], "f": 0, "t": 254, "d": [334], "a": 1 },
+						{ "px": [240,160], "src": [240,160], "f": 0, "t": 255, "d": [335], "a": 1 },
+						{ "px": [256,160], "src": [256,160], "f": 0, "t": 256, "d": [336], "a": 1 },
+						{ "px": [272,160], "src": [272,160], "f": 0, "t": 257, "d": [337], "a": 1 },
+						{ "px": [288,160], "src": [288,160], "f": 0, "t": 258, "d": [338], "a": 1 },
+						{ "px": [304,160], "src": [304,160], "f": 0, "t": 259, "d": [339], "a": 1 },
+						{ "px": [320,160], "src": [320,160], "f": 0, "t": 260, "d": [340], "a": 1 },
+						{ "px": [336,160], "src": [336,160], "f": 0, "t": 261, "d": [341], "a": 1 },
+						{ "px": [352,160], "src": [352,160], "f": 0, "t": 262, "d": [342], "a": 1 },
+						{ "px": [368,160], "src": [368,160], "f": 0, "t": 263, "d": [343], "a": 1 },
+						{ "px": [384,160], "src": [0,160], "f": 0, "t": 240, "d": [344], "a": 1 },
+						{ "px": [400,160], "src": [16,160], "f": 0, "t": 241, "d": [345], "a": 1 },
+						{ "px": [416,160], "src": [32,160], "f": 0, "t": 242, "d": [346], "a": 1 },
+						{ "px": [432,160], "src": [48,160], "f": 0, "t": 243, "d": [347], "a": 1 },
+						{ "px": [448,160], "src": [64,160], "f": 0, "t": 244, "d": [348], "a": 1 },
+						{ "px": [464,160], "src": [80,160], "f": 0, "t": 245, "d": [349], "a": 1 },
+						{ "px": [480,160], "src": [96,160], "f": 0, "t": 246, "d": [350], "a": 1 },
+						{ "px": [496,160], "src": [112,160], "f": 0, "t": 247, "d": [351], "a": 1 },
+						{ "px": [0,176], "src": [0,176], "f": 0, "t": 264, "d": [352], "a": 1 },
+						{ "px": [16,176], "src": [16,176], "f": 0, "t": 265, "d": [353], "a": 1 },
+						{ "px": [32,176], "src": [32,176], "f": 0, "t": 266, "d": [354], "a": 1 },
+						{ "px": [48,176], "src": [48,176], "f": 0, "t": 267, "d": [355], "a": 1 },
+						{ "px": [64,176], "src": [64,176], "f": 0, "t": 268, "d": [356], "a": 1 },
+						{ "px": [80,176], "src": [80,176], "f": 0, "t": 269, "d": [357], "a": 1 },
+						{ "px": [96,176], "src": [96,176], "f": 0, "t": 270, "d": [358], "a": 1 },
+						{ "px": [112,176], "src": [112,176], "f": 0, "t": 271, "d": [359], "a": 1 },
+						{ "px": [128,176], "src": [128,176], "f": 0, "t": 272, "d": [360], "a": 1 },
+						{ "px": [144,176], "src": [144,176], "f": 0, "t": 273, "d": [361], "a": 1 },
+						{ "px": [160,176], "src": [160,176], "f": 0, "t": 274, "d": [362], "a": 1 },
+						{ "px": [176,176], "src": [176,176], "f": 0, "t": 275, "d": [363], "a": 1 },
+						{ "px": [192,176], "src": [192,176], "f": 0, "t": 276, "d": [364], "a": 1 },
+						{ "px": [208,176], "src": [208,176], "f": 0, "t": 277, "d": [365], "a": 1 },
+						{ "px": [224,176], "src": [224,176], "f": 0, "t": 278, "d": [366], "a": 1 },
+						{ "px": [240,176], "src": [240,176], "f": 0, "t": 279, "d": [367], "a": 1 },
+						{ "px": [256,176], "src": [256,176], "f": 0, "t": 280, "d": [368], "a": 1 },
+						{ "px": [272,176], "src": [272,176], "f": 0, "t": 281, "d": [369], "a": 1 },
+						{ "px": [288,176], "src": [288,176], "f": 0, "t": 282, "d": [370], "a": 1 },
+						{ "px": [304,176], "src": [304,176], "f": 0, "t": 283, "d": [371], "a": 1 },
+						{ "px": [320,176], "src": [320,176], "f": 0, "t": 284, "d": [372], "a": 1 },
+						{ "px": [336,176], "src": [336,176], "f": 0, "t": 285, "d": [373], "a": 1 },
+						{ "px": [352,176], "src": [352,176], "f": 0, "t": 286, "d": [374], "a": 1 },
+						{ "px": [368,176], "src": [368,176], "f": 0, "t": 287, "d": [375], "a": 1 },
+						{ "px": [384,176], "src": [0,176], "f": 0, "t": 264, "d": [376], "a": 1 },
+						{ "px": [400,176], "src": [16,176], "f": 0, "t": 265, "d": [377], "a": 1 },
+						{ "px": [416,176], "src": [32,176], "f": 0, "t": 266, "d": [378], "a": 1 },
+						{ "px": [432,176], "src": [48,176], "f": 0, "t": 267, "d": [379], "a": 1 },
+						{ "px": [448,176], "src": [64,176], "f": 0, "t": 268, "d": [380], "a": 1 },
+						{ "px": [464,176], "src": [80,176], "f": 0, "t": 269, "d": [381], "a": 1 },
+						{ "px": [480,176], "src": [96,176], "f": 0, "t": 270, "d": [382], "a": 1 },
+						{ "px": [496,176], "src": [112,176], "f": 0, "t": 271, "d": [383], "a": 1 },
+						{ "px": [0,192], "src": [0,192], "f": 0, "t": 288, "d": [384], "a": 1 },
+						{ "px": [16,192], "src": [16,192], "f": 0, "t": 289, "d": [385], "a": 1 },
+						{ "px": [32,192], "src": [32,192], "f": 0, "t": 290, "d": [386], "a": 1 },
+						{ "px": [48,192], "src": [48,192], "f": 0, "t": 291, "d": [387], "a": 1 },
+						{ "px": [64,192], "src": [64,192], "f": 0, "t": 292, "d": [388], "a": 1 },
+						{ "px": [80,192], "src": [80,192], "f": 0, "t": 293, "d": [389], "a": 1 },
+						{ "px": [96,192], "src": [96,192], "f": 0, "t": 294, "d": [390], "a": 1 },
+						{ "px": [112,192], "src": [112,192], "f": 0, "t": 295, "d": [391], "a": 1 },
+						{ "px": [128,192], "src": [128,192], "f": 0, "t": 296, "d": [392], "a": 1 },
+						{ "px": [144,192], "src": [144,192], "f": 0, "t": 297, "d": [393], "a": 1 },
+						{ "px": [160,192], "src": [160,192], "f": 0, "t": 298, "d": [394], "a": 1 },
+						{ "px": [176,192], "src": [176,192], "f": 0, "t": 299, "d": [395], "a": 1 },
+						{ "px": [192,192], "src": [192,192], "f": 0, "t": 300, "d": [396], "a": 1 },
+						{ "px": [208,192], "src": [208,192], "f": 0, "t": 301, "d": [397], "a": 1 },
+						{ "px": [224,192], "src": [224,192], "f": 0, "t": 302, "d": [398], "a": 1 },
+						{ "px": [240,192], "src": [240,192], "f": 0, "t": 303, "d": [399], "a": 1 },
+						{ "px": [256,192], "src": [256,192], "f": 0, "t": 304, "d": [400], "a": 1 },
+						{ "px": [272,192], "src": [272,192], "f": 0, "t": 305, "d": [401], "a": 1 },
+						{ "px": [288,192], "src": [288,192], "f": 0, "t": 306, "d": [402], "a": 1 },
+						{ "px": [304,192], "src": [304,192], "f": 0, "t": 307, "d": [403], "a": 1 },
+						{ "px": [320,192], "src": [320,192], "f": 0, "t": 308, "d": [404], "a": 1 },
+						{ "px": [336,192], "src": [336,192], "f": 0, "t": 309, "d": [405], "a": 1 },
+						{ "px": [352,192], "src": [352,192], "f": 0, "t": 310, "d": [406], "a": 1 },
+						{ "px": [368,192], "src": [368,192], "f": 0, "t": 311, "d": [407], "a": 1 },
+						{ "px": [384,192], "src": [0,192], "f": 0, "t": 288, "d": [408], "a": 1 },
+						{ "px": [400,192], "src": [16,192], "f": 0, "t": 289, "d": [409], "a": 1 },
+						{ "px": [416,192], "src": [32,192], "f": 0, "t": 290, "d": [410], "a": 1 },
+						{ "px": [432,192], "src": [48,192], "f": 0, "t": 291, "d": [411], "a": 1 },
+						{ "px": [448,192], "src": [64,192], "f": 0, "t": 292, "d": [412], "a": 1 },
+						{ "px": [464,192], "src": [80,192], "f": 0, "t": 293, "d": [413], "a": 1 },
+						{ "px": [480,192], "src": [96,192], "f": 0, "t": 294, "d": [414], "a": 1 },
+						{ "px": [496,192], "src": [112,192], "f": 0, "t": 295, "d": [415], "a": 1 },
+						{ "px": [0,208], "src": [0,208], "f": 0, "t": 312, "d": [416], "a": 1 },
+						{ "px": [16,208], "src": [16,208], "f": 0, "t": 313, "d": [417], "a": 1 },
+						{ "px": [32,208], "src": [32,208], "f": 0, "t": 314, "d": [418], "a": 1 },
+						{ "px": [48,208], "src": [48,208], "f": 0, "t": 315, "d": [419], "a": 1 },
+						{ "px": [64,208], "src": [64,208], "f": 0, "t": 316, "d": [420], "a": 1 },
+						{ "px": [80,208], "src": [80,208], "f": 0, "t": 317, "d": [421], "a": 1 },
+						{ "px": [96,208], "src": [96,208], "f": 0, "t": 318, "d": [422], "a": 1 },
+						{ "px": [112,208], "src": [112,208], "f": 0, "t": 319, "d": [423], "a": 1 },
+						{ "px": [128,208], "src": [128,208], "f": 0, "t": 320, "d": [424], "a": 1 },
+						{ "px": [144,208], "src": [144,208], "f": 0, "t": 321, "d": [425], "a": 1 },
+						{ "px": [160,208], "src": [160,208], "f": 0, "t": 322, "d": [426], "a": 1 },
+						{ "px": [176,208], "src": [176,208], "f": 0, "t": 323, "d": [427], "a": 1 },
+						{ "px": [192,208], "src": [192,208], "f": 0, "t": 324, "d": [428], "a": 1 },
+						{ "px": [208,208], "src": [208,208], "f": 0, "t": 325, "d": [429], "a": 1 },
+						{ "px": [224,208], "src": [224,208], "f": 0, "t": 326, "d": [430], "a": 1 },
+						{ "px": [240,208], "src": [240,208], "f": 0, "t": 327, "d": [431], "a": 1 },
+						{ "px": [256,208], "src": [256,208], "f": 0, "t": 328, "d": [432], "a": 1 },
+						{ "px": [272,208], "src": [272,208], "f": 0, "t": 329, "d": [433], "a": 1 },
+						{ "px": [288,208], "src": [288,208], "f": 0, "t": 330, "d": [434], "a": 1 },
+						{ "px": [304,208], "src": [304,208], "f": 0, "t": 331, "d": [435], "a": 1 },
+						{ "px": [320,208], "src": [320,208], "f": 0, "t": 332, "d": [436], "a": 1 },
+						{ "px": [336,208], "src": [336,208], "f": 0, "t": 333, "d": [437], "a": 1 },
+						{ "px": [352,208], "src": [352,208], "f": 0, "t": 334, "d": [438], "a": 1 },
+						{ "px": [368,208], "src": [368,208], "f": 0, "t": 335, "d": [439], "a": 1 },
+						{ "px": [384,208], "src": [0,208], "f": 0, "t": 312, "d": [440], "a": 1 },
+						{ "px": [400,208], "src": [16,208], "f": 0, "t": 313, "d": [441], "a": 1 },
+						{ "px": [416,208], "src": [32,208], "f": 0, "t": 314, "d": [442], "a": 1 },
+						{ "px": [432,208], "src": [48,208], "f": 0, "t": 315, "d": [443], "a": 1 },
+						{ "px": [448,208], "src": [64,208], "f": 0, "t": 316, "d": [444], "a": 1 },
+						{ "px": [464,208], "src": [80,208], "f": 0, "t": 317, "d": [445], "a": 1 },
+						{ "px": [480,208], "src": [96,208], "f": 0, "t": 318, "d": [446], "a": 1 },
+						{ "px": [496,208], "src": [112,208], "f": 0, "t": 319, "d": [447], "a": 1 },
+						{ "px": [0,224], "src": [0,224], "f": 0, "t": 336, "d": [448], "a": 1 },
+						{ "px": [16,224], "src": [16,224], "f": 0, "t": 337, "d": [449], "a": 1 },
+						{ "px": [32,224], "src": [32,224], "f": 0, "t": 338, "d": [450], "a": 1 },
+						{ "px": [48,224], "src": [48,224], "f": 0, "t": 339, "d": [451], "a": 1 },
+						{ "px": [64,224], "src": [64,224], "f": 0, "t": 340, "d": [452], "a": 1 },
+						{ "px": [80,224], "src": [80,224], "f": 0, "t": 341, "d": [453], "a": 1 },
+						{ "px": [96,224], "src": [96,224], "f": 0, "t": 342, "d": [454], "a": 1 },
+						{ "px": [112,224], "src": [112,224], "f": 0, "t": 343, "d": [455], "a": 1 },
+						{ "px": [128,224], "src": [128,224], "f": 0, "t": 344, "d": [456], "a": 1 },
+						{ "px": [144,224], "src": [144,224], "f": 0, "t": 345, "d": [457], "a": 1 },
+						{ "px": [160,224], "src": [160,224], "f": 0, "t": 346, "d": [458], "a": 1 },
+						{ "px": [176,224], "src": [176,224], "f": 0, "t": 347, "d": [459], "a": 1 },
+						{ "px": [192,224], "src": [192,224], "f": 0, "t": 348, "d": [460], "a": 1 },
+						{ "px": [208,224], "src": [208,224], "f": 0, "t": 349, "d": [461], "a": 1 },
+						{ "px": [224,224], "src": [224,224], "f": 0, "t": 350, "d": [462], "a": 1 },
+						{ "px": [240,224], "src": [240,224], "f": 0, "t": 351, "d": [463], "a": 1 },
+						{ "px": [256,224], "src": [256,224], "f": 0, "t": 352, "d": [464], "a": 1 },
+						{ "px": [272,224], "src": [272,224], "f": 0, "t": 353, "d": [465], "a": 1 },
+						{ "px": [288,224], "src": [288,224], "f": 0, "t": 354, "d": [466], "a": 1 },
+						{ "px": [304,224], "src": [304,224], "f": 0, "t": 355, "d": [467], "a": 1 },
+						{ "px": [320,224], "src": [320,224], "f": 0, "t": 356, "d": [468], "a": 1 },
+						{ "px": [336,224], "src": [336,224], "f": 0, "t": 357, "d": [469], "a": 1 },
+						{ "px": [352,224], "src": [352,224], "f": 0, "t": 358, "d": [470], "a": 1 },
+						{ "px": [368,224], "src": [368,224], "f": 0, "t": 359, "d": [471], "a": 1 },
+						{ "px": [384,224], "src": [0,224], "f": 0, "t": 336, "d": [472], "a": 1 },
+						{ "px": [400,224], "src": [16,224], "f": 0, "t": 337, "d": [473], "a": 1 },
+						{ "px": [416,224], "src": [32,224], "f": 0, "t": 338, "d": [474], "a": 1 },
+						{ "px": [432,224], "src": [48,224], "f": 0, "t": 339, "d": [475], "a": 1 },
+						{ "px": [448,224], "src": [64,224], "f": 0, "t": 340, "d": [476], "a": 1 },
+						{ "px": [464,224], "src": [80,224], "f": 0, "t": 341, "d": [477], "a": 1 },
+						{ "px": [480,224], "src": [96,224], "f": 0, "t": 342, "d": [478], "a": 1 },
+						{ "px": [496,224], "src": [112,224], "f": 0, "t": 343, "d": [479], "a": 1 },
+						{ "px": [0,240], "src": [0,224], "f": 0, "t": 336, "d": [480], "a": 1 },
+						{ "px": [16,240], "src": [16,224], "f": 0, "t": 337, "d": [481], "a": 1 },
+						{ "px": [32,240], "src": [32,224], "f": 0, "t": 338, "d": [482], "a": 1 },
+						{ "px": [48,240], "src": [48,224], "f": 0, "t": 339, "d": [483], "a": 1 },
+						{ "px": [64,240], "src": [64,224], "f": 0, "t": 340, "d": [484], "a": 1 },
+						{ "px": [80,240], "src": [80,224], "f": 0, "t": 341, "d": [485], "a": 1 },
+						{ "px": [96,240], "src": [96,224], "f": 0, "t": 342, "d": [486], "a": 1 },
+						{ "px": [112,240], "src": [112,224], "f": 0, "t": 343, "d": [487], "a": 1 },
+						{ "px": [128,240], "src": [128,224], "f": 0, "t": 344, "d": [488], "a": 1 },
+						{ "px": [144,240], "src": [144,224], "f": 0, "t": 345, "d": [489], "a": 1 },
+						{ "px": [160,240], "src": [160,224], "f": 0, "t": 346, "d": [490], "a": 1 },
+						{ "px": [176,240], "src": [176,224], "f": 0, "t": 347, "d": [491], "a": 1 },
+						{ "px": [192,240], "src": [192,224], "f": 0, "t": 348, "d": [492], "a": 1 },
+						{ "px": [208,240], "src": [208,224], "f": 0, "t": 349, "d": [493], "a": 1 },
+						{ "px": [224,240], "src": [224,224], "f": 0, "t": 350, "d": [494], "a": 1 },
+						{ "px": [240,240], "src": [240,224], "f": 0, "t": 351, "d": [495], "a": 1 },
+						{ "px": [256,240], "src": [256,224], "f": 0, "t": 352, "d": [496], "a": 1 },
+						{ "px": [272,240], "src": [272,224], "f": 0, "t": 353, "d": [497], "a": 1 },
+						{ "px": [288,240], "src": [288,224], "f": 0, "t": 354, "d": [498], "a": 1 },
+						{ "px": [304,240], "src": [304,224], "f": 0, "t": 355, "d": [499], "a": 1 },
+						{ "px": [320,240], "src": [320,224], "f": 0, "t": 356, "d": [500], "a": 1 },
+						{ "px": [336,240], "src": [336,224], "f": 0, "t": 357, "d": [501], "a": 1 },
+						{ "px": [352,240], "src": [352,224], "f": 0, "t": 358, "d": [502], "a": 1 },
+						{ "px": [368,240], "src": [368,224], "f": 0, "t": 359, "d": [503], "a": 1 },
+						{ "px": [384,240], "src": [0,224], "f": 0, "t": 336, "d": [504], "a": 1 },
+						{ "px": [400,240], "src": [16,224], "f": 0, "t": 337, "d": [505], "a": 1 },
+						{ "px": [416,240], "src": [32,224], "f": 0, "t": 338, "d": [506], "a": 1 },
+						{ "px": [432,240], "src": [48,224], "f": 0, "t": 339, "d": [507], "a": 1 },
+						{ "px": [448,240], "src": [64,224], "f": 0, "t": 340, "d": [508], "a": 1 },
+						{ "px": [464,240], "src": [80,224], "f": 0, "t": 341, "d": [509], "a": 1 },
+						{ "px": [480,240], "src": [96,224], "f": 0, "t": 342, "d": [510], "a": 1 },
+						{ "px": [496,240], "src": [112,224], "f": 0, "t": 343, "d": [511], "a": 1 }
+					],
+					"entityInstances": []
+				}
+			],
+			"__neighbours": []
+		}
+	],
+	"worlds": [],
+	"dummyWorldIid": "a48e5b90-d380-11f0-a69c-55e16c4c7713"
+}
\ No newline at end of file
diff --git a/py/assets/levels/top_down.ldtk b/py/assets/levels/top_down.ldtk
new file mode 100644
index 0000000..0ea98bf
--- /dev/null
+++ b/py/assets/levels/top_down.ldtk
@@ -0,0 +1,2651 @@
+{
+	"__header__": {
+		"fileType": "LDtk Project JSON",
+		"app": "LDtk",
+		"doc": "https://ldtk.io/json",
+		"schema": "https://ldtk.io/files/JSON_SCHEMA.json",
+		"appAuthor": "Sebastien 'deepnight' Benard",
+		"appVersion": "1.5.3",
+		"url": "https://ldtk.io"
+	},
+	"iid": "2451b2d0-d380-11f0-9ae1-7f8ef9aafb88",
+	"jsonVersion": "1.5.3",
+	"appBuildId": 473703,
+	"nextUid": 79,
+	"identifierStyle": "Capitalize",
+	"toc": [],
+	"worldLayout": "Free",
+	"worldGridWidth": 256,
+	"worldGridHeight": 256,
+	"defaultLevelWidth": 256,
+	"defaultLevelHeight": 256,
+	"defaultPivotX": 0,
+	"defaultPivotY": 0,
+	"defaultGridSize": 16,
+	"defaultEntityWidth": 16,
+	"defaultEntityHeight": 16,
+	"bgColor": "#40465B",
+	"defaultLevelBgColor": "#696A79",
+	"minifyJson": false,
+	"externalLevels": false,
+	"exportTiled": false,
+	"simplifiedExport": false,
+	"imageExportMode": "None",
+	"exportLevelBg": true,
+	"pngFilePattern": null,
+	"backupOnSave": false,
+	"backupLimit": 10,
+	"backupRelPath": null,
+	"levelNamePattern": "Level_%idx",
+	"tutorialDesc": null,
+	"customCommands": [],
+	"flags": [],
+	"defs": { "layers": [
+		{
+			"__type": "Entities",
+			"identifier": "Entities",
+			"type": "Entities",
+			"uid": 77,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 64,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 0.6,
+			"hideInList": false,
+			"hideFieldsWhenInactive": true,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": null,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		},
+		{
+			"__type": "Tiles",
+			"identifier": "Foreground",
+			"type": "Tiles",
+			"uid": 61,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 64,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 1,
+			"hideInList": false,
+			"hideFieldsWhenInactive": false,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": 1,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		},
+		{
+			"__type": "IntGrid",
+			"identifier": "IntGrid",
+			"type": "IntGrid",
+			"uid": 2,
+			"doc": null,
+			"uiColor": null,
+			"gridSize": 64,
+			"guideGridWid": 0,
+			"guideGridHei": 0,
+			"displayOpacity": 1,
+			"inactiveOpacity": 1,
+			"hideInList": false,
+			"hideFieldsWhenInactive": false,
+			"canSelectWhenInactive": true,
+			"renderInWorldView": true,
+			"pxOffsetX": 0,
+			"pxOffsetY": 0,
+			"parallaxFactorX": 0,
+			"parallaxFactorY": 0,
+			"parallaxScaling": true,
+			"requiredTags": [],
+			"excludedTags": [],
+			"autoTilesKilledByOtherLayerUid": null,
+			"uiFilterTags": [],
+			"useAsyncRender": false,
+			"intGridValues": [
+				{ "value": 1, "identifier": "walls", "color": "#B86F50", "tile": null, "groupUid": 0 },
+				{ "value": 3, "identifier": "obstacles", "color": "#A22633", "tile": null, "groupUid": 0 },
+				{ "value": 2, "identifier": "grass", "color": "#63C74D", "tile": null, "groupUid": 0 },
+				{ "value": 4, "identifier": "tile", "color": "#3A4466", "tile": null, "groupUid": 0 }
+			],
+			"intGridValuesGroups": [],
+			"autoRuleGroups": [
+				{
+					"uid": 69,
+					"name": "obstacles",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 75,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [ [0], [1], [2], [3] ],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,2,0,0,3,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 791835,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 74,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[10]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,3,0,0,4,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6879243,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 73,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[10]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,4,0,0,3,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5479555,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 71,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[10]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,3,4,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 8857465,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 70,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[10]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,4,3,0,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4405542,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": false,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 66,
+					"name": "tile",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 67,
+							"active": true,
+							"size": 1,
+							"tileRectsIds": [[10]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [4],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1675224,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": false,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 62,
+					"name": "grass",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 63,
+							"active": true,
+							"size": 1,
+							"tileRectsIds": [ [0], [1], [2], [3] ],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [2],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": null,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 8915025,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": false,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				},
+				{
+					"uid": 3,
+					"name": "walls",
+					"color": null,
+					"icon": null,
+					"active": true,
+					"isOptional": false,
+					"rules": [
+						{
+							"uid": 31,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[204]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 7774931,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 32,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[178]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,-1,1,1,1,-1,1,-1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9893420,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 33,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[117]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,1,0,1,-1],
+							"flipX": true,
+							"flipY": true,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4908586,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 34,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[258]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,1,1,1,1,1,1,-1],
+							"flipX": true,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4749804,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 35,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[227]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,1,-1,-1,1,1,0,1,1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 233522,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 36,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[229]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,1,1,1,-1,1,1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 7354597,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 37,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[225]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,-1,1,1,1,-1,1,1],
+							"flipX": true,
+							"flipY": true,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6862161,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 38,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[228]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,0,1,1,-1,1,1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4839941,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 39,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[230]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,1,1,1,1,1,-1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4662796,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 40,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[257]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [1,1,-1,1,1,1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1840180,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 41,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[255]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [1,1,0,1,1,-1,-1,1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1641611,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 42,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[254]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,1,1,-1,1,1,0,1,-1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6451097,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 43,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[256]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,1,1,1,1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9176901,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 44,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[121]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,-1,1,1,1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9846746,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 45,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[147]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,1,-1,-1,1,1,0,1,-1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2534625,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 46,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[120]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,1,1,1,-1,1,-1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4742475,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 47,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[148]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,0,1,1,-1,-1,1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9160564,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 48,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[201]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [-1,1,1,1,1,1,-1,1,1],
+							"flipX": true,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 8571935,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 49,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[173]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [1,1,1,1,1,1,-1,1,-1],
+							"flipX": false,
+							"flipY": true,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9554225,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 50,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[150]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 3700162,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 51,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[122]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 5775500,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 52,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[119]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,0,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4962963,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 53,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[149]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,-1,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 9922820,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 54,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[123]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-1,1,-1,0,-1,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2544830,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 55,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[146]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-1,1,-1,0,0,0],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4037627,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 56,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[124]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,-1,1,0,0,0,0],
+							"flipX": true,
+							"flipY": true,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 1124818,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 57,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[202]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,-1,0,0,1,0,0,0,0],
+							"flipX": false,
+							"flipY": true,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 8849226,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 58,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[175]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,-1,1,0,0,0,0],
+							"flipX": true,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 6643923,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 59,
+							"active": true,
+							"size": 3,
+							"tileRectsIds": [[171]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [0,0,0,0,1,1,0,1,-1],
+							"flipX": true,
+							"flipY": true,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 2745302,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						},
+						{
+							"uid": 60,
+							"active": true,
+							"size": 1,
+							"tileRectsIds": [[177]],
+							"alpha": 1,
+							"chance": 1,
+							"breakOnMatch": true,
+							"pattern": [1],
+							"flipX": false,
+							"flipY": false,
+							"xModulo": 1,
+							"yModulo": 1,
+							"xOffset": 0,
+							"yOffset": 0,
+							"tileXOffset": 0,
+							"tileYOffset": 0,
+							"tileRandomXMin": 0,
+							"tileRandomXMax": 0,
+							"tileRandomYMin": 0,
+							"tileRandomYMax": 0,
+							"checker": "None",
+							"tileMode": "Single",
+							"pivotX": 0,
+							"pivotY": 0,
+							"outOfBoundsValue": 1,
+							"invalidated": false,
+							"perlinActive": false,
+							"perlinSeed": 4687117,
+							"perlinScale": 0.2,
+							"perlinOctaves": 2
+						}
+					],
+					"usesWizard": true,
+					"requiredBiomeValues": [],
+					"biomeRequirementMode": 0
+				}
+			],
+			"autoSourceLayerDefUid": null,
+			"tilesetDefUid": 1,
+			"tilePivotX": 0,
+			"tilePivotY": 0,
+			"biomeFieldUid": null
+		}
+	], "entities": [
+		{
+			"identifier": "Start",
+			"uid": 76,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 64,
+			"height": 64,
+			"resizableX": false,
+			"resizableY": false,
+			"minWidth": null,
+			"maxWidth": null,
+			"minHeight": null,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 1,
+			"lineOpacity": 1,
+			"hollow": false,
+			"color": "#2F48BE",
+			"renderMode": "Rectangle",
+			"showName": true,
+			"tilesetId": null,
+			"tileRenderMode": "FitInside",
+			"tileRect": null,
+			"uiTileRect": null,
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0.5,
+			"pivotY": 0.5,
+			"fieldDefs": []
+		},
+		{
+			"identifier": "Spawn",
+			"uid": 78,
+			"tags": [],
+			"exportToToc": false,
+			"allowOutOfBounds": false,
+			"doc": null,
+			"width": 64,
+			"height": 64,
+			"resizableX": true,
+			"resizableY": true,
+			"minWidth": 64,
+			"maxWidth": null,
+			"minHeight": 64,
+			"maxHeight": null,
+			"keepAspectRatio": false,
+			"tileOpacity": 1,
+			"fillOpacity": 1,
+			"lineOpacity": 1,
+			"hollow": false,
+			"color": "#E43B44",
+			"renderMode": "Rectangle",
+			"showName": true,
+			"tilesetId": null,
+			"tileRenderMode": "FitInside",
+			"tileRect": null,
+			"uiTileRect": null,
+			"nineSliceBorders": [],
+			"maxCount": 0,
+			"limitScope": "PerLevel",
+			"limitBehavior": "MoveLastOne",
+			"pivotX": 0.5,
+			"pivotY": 0.5,
+			"fieldDefs": []
+		}
+	], "tilesets": [
+		{
+			"__cWid": 27,
+			"__cHei": 20,
+			"identifier": "Tilemap",
+			"uid": 1,
+			"relPath": "../zombie_shooter/tilemap.png",
+			"embedAtlas": null,
+			"pxWid": 1728,
+			"pxHei": 1280,
+			"tileGridSize": 64,
+			"spacing": 0,
+			"padding": 0,
+			"tags": [],
+			"tagsSourceEnumUid": null,
+			"enumTags": [],
+			"customData": [],
+			"savedSelections": [],
+			"cachedPixelData": {
+				"opaqueTiles": "111111111111111111110000000111111111111111111110000000111111111111111111110000000111111111111111111110000000111111111111111111000000000111111111111111111000000000111111110111111110000000000111111100111111100000000000111111100111111100000000000111111100111111100000000000111111111111111111000000000111111111111111111000000000111111110111111110111111000111111100111111100111111010111111100111111100111111000111111100111111100111111000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000",
+				"averageColors": "f2a6f2a6f2a6f2a6fb74fb74f9bbf9bbf9bbf9bbf9bbfeeefc74fc74fd74fd74f2a6f2a6f28bf28b4995499549954c734c734c730000f654f654f654f544f544f664f664f666f666f666f555f555f666f666fb84fb84fb84fb84fb84fb84c695d6a5d6a5cd72dd72dd720000f654f654f654f544f544f664f664f666f666f666f555f555f666f666fd74fd74fd74fd74fd74fd74e4a5f3a6f3a6ed62fd62fd620000f554f554f554f554f444f444f554f555f555f555f555f444f444f555fc96fc96fc96fc96fc96fc96eacafacafacaedb9fdb9fdb90000f854f854f854f754f754f954f954f854f854f864f864f864f864f864f974f974f864f86410001000ba745a74b58a5edb5edb44a60000f854f854f854f754f754f954f954f854f854f864f864f864f864f864f974f974f864f86410001000ba745a74b5a57bde7bde1a740000f544f544f544f544f754f754f444f654aa53f554f554f654f654f754f754f444f754aa7483b783b7c3b68d748d84cd741aaa1aaa0000f544f544f544f544f754f754fa53ca536b63f554f554f654f654f754f754fa74ca746b7483b683b643a68d748d7433a53ddd4ddd0000f654f654f754f754f754f754f5447a537a53f654f654f764f764f764f764f6547a747a7433b63c7438aa28aa38aa15951baa3c748555f654f654f754f754f754f754f5447a537a53f654f654f764f764f764f764f6547a747a7438aa18aa2acd4b742a743b853b853bcc8deef9bbf9bbf9bbf9bbf9bbf9bbf9bbf9bbf9bbf788f788f788f677f677f799f799f788f7883c611c611acd59983a99fcb9fc97fabafcdcf9bbf9bbf9bbf9bbf9bbf9bbf9bbf9bbf9bbf788f788f788f677f677f799f799f788f7883c6138aa3a8878656555fdeefdeefdedfaaaf9bbf9bbf9bbf9bbf9bbf9bbf9bbf9bba9bbf555f555f556f556f677f677f444f666a8aafd95fd94fd95f7b9f6b8f7b9eb84fb84eb84f9bbf9bbf9bbf9bbf9bbf9bbf9bbc9bb69bbf555f555f556f556f677f677f8aac89a69aafd84fe83fd84f6b8f5b7f6b8fb84fb84fb84f9bbf9bbf9bbf9bbf9bbf9bbf9bb79bb79bbf566f566f677f677f677f677f55678aa78aafd73fe61fe83f5b7f2a6f5b7eb84fb84eb84f9bbf9bbf9bbf9bbf9bbf9bbf9bb79bb79bbf566f566f677f677f677f677f55678aa78aafd84fe83fd84f6b8f5b7f6b8ecb9ecb9ecb95bde5bde5bde5bde7dee7dee7a747a747a747a744b744b744b744b74a295c295a2958295727a6a74eb84eb84eb84db847b84000000005bde5bde4bde4bde7dee7dee7a747a747a747a744b744b744b744b74dc73dc73dc73ac737c734b847ca87ca97ca88c97ab84000000004bde4bde7dee7dee7dee6dee79bb79bb79bb79bb49bb49bb49bb49bb9655a555965596558765ab849b849b849b849b84ac73000000004bde4bde7dee7dee7dee6dee79bb79bb79bb79bb49bb49bb49bb49bb8b846b846c846b84377737776b868ca886664666dcb900000000"
+			}
+		}
+	], "enums": [], "externalEnums": [], "levelFields": [] },
+	"levels": [
+		{
+			"identifier": "Level",
+			"iid": "2452eb50-d380-11f0-9ae1-d7a25c5a0db0",
+			"uid": 0,
+			"worldX": 0,
+			"worldY": 0,
+			"worldDepth": 0,
+			"pxWid": 2560,
+			"pxHei": 1440,
+			"__bgColor": "#696A79",
+			"bgColor": null,
+			"useAutoIdentifier": false,
+			"bgRelPath": null,
+			"bgPos": null,
+			"bgPivotX": 0.5,
+			"bgPivotY": 0.5,
+			"__smartColor": "#ADADB5",
+			"__bgPos": null,
+			"externalRelPath": null,
+			"fieldInstances": [],
+			"layerInstances": [
+				{
+					"__identifier": "Entities",
+					"__type": "Entities",
+					"__cWid": 40,
+					"__cHei": 23,
+					"__gridSize": 64,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": null,
+					"__tilesetRelPath": null,
+					"iid": "18a082a0-d380-11f0-9ae1-03f5d4b03633",
+					"levelId": 0,
+					"layerDefUid": 77,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [],
+					"autoLayerTiles": [],
+					"seed": 2737745,
+					"overrideTilesetUid": null,
+					"gridTiles": [],
+					"entityInstances": [
+						{
+							"__identifier": "Start",
+							"__grid": [2,20],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#2F48BE",
+							"iid": "312e8560-d380-11f0-9ae1-a1382736c5df",
+							"width": 64,
+							"height": 64,
+							"defUid": 76,
+							"px": [160,1312],
+							"fieldInstances": [],
+							"__worldX": 160,
+							"__worldY": 1312
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [13,18],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#2F48BE",
+							"iid": "34ffd8b0-d380-11f0-9ae1-35d6329f3b27",
+							"width": 64,
+							"height": 64,
+							"defUid": 76,
+							"px": [864,1184],
+							"fieldInstances": [],
+							"__worldX": 864,
+							"__worldY": 1184
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [25,20],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#2F48BE",
+							"iid": "35c79580-d380-11f0-9ae1-17680d06aecf",
+							"width": 64,
+							"height": 64,
+							"defUid": 76,
+							"px": [1632,1312],
+							"fieldInstances": [],
+							"__worldX": 1632,
+							"__worldY": 1312
+						},
+						{
+							"__identifier": "Start",
+							"__grid": [33,18],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#2F48BE",
+							"iid": "36d86940-d380-11f0-9ae1-5725e8e8d983",
+							"width": 64,
+							"height": 64,
+							"defUid": 76,
+							"px": [2144,1184],
+							"fieldInstances": [],
+							"__worldX": 2144,
+							"__worldY": 1184
+						},
+						{
+							"__identifier": "Spawn",
+							"__grid": [17,1],
+							"__pivot": [0.5,0.5],
+							"__tags": [],
+							"__tile": null,
+							"__smartColor": "#E43B44",
+							"iid": "03544b20-d380-11f0-9ae1-a375bc6f6eb9",
+							"width": 1664,
+							"height": 64,
+							"defUid": 78,
+							"px": [1120,96],
+							"fieldInstances": [],
+							"__worldX": 1120,
+							"__worldY": 96
+						}
+					]
+				},
+				{
+					"__identifier": "Foreground",
+					"__type": "Tiles",
+					"__cWid": 40,
+					"__cHei": 23,
+					"__gridSize": 64,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": 1,
+					"__tilesetRelPath": "../zombie_shooter/tilemap.png",
+					"iid": "7e07a4f0-d380-11f0-9ae1-c1407425fd82",
+					"levelId": 0,
+					"layerDefUid": 61,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [],
+					"autoLayerTiles": [],
+					"seed": 3361326,
+					"overrideTilesetUid": null,
+					"gridTiles": [
+						{ "px": [192,128], "src": [1216,704], "f": 0, "t": 316, "d": [83], "a": 1 },
+						{ "px": [960,128], "src": [1280,320], "f": 0, "t": 155, "d": [95], "a": 1 },
+						{ "px": [1856,128], "src": [1472,384], "f": 0, "t": 185, "d": [109], "a": 1 },
+						{ "px": [448,384], "src": [1280,256], "f": 0, "t": 128, "d": [247], "a": 1 },
+						{ "px": [512,384], "src": [1280,256], "f": 0, "t": 128, "d": [248], "a": 1 },
+						{ "px": [64,448], "src": [1472,384], "f": 0, "t": 185, "d": [281], "a": 1 },
+						{ "px": [1728,512], "src": [1280,320], "f": 0, "t": 155, "d": [347], "a": 1 },
+						{ "px": [2304,640], "src": [1472,384], "f": 0, "t": 185, "d": [436], "a": 1 },
+						{ "px": [768,704], "src": [1344,384], "f": 0, "t": 183, "d": [452], "a": 1 },
+						{ "px": [832,704], "src": [1408,384], "f": 0, "t": 184, "d": [453], "a": 1 },
+						{ "px": [768,768], "src": [1344,448], "f": 0, "t": 210, "d": [492], "a": 1 },
+						{ "px": [832,768], "src": [1408,448], "f": 0, "t": 211, "d": [493], "a": 1 },
+						{ "px": [1408,768], "src": [1216,704], "f": 0, "t": 316, "d": [502], "a": 1 },
+						{ "px": [64,1088], "src": [1472,512], "f": 0, "t": 239, "d": [681], "a": 1 },
+						{ "px": [576,1088], "src": [1472,512], "f": 0, "t": 239, "d": [689], "a": 1 },
+						{ "px": [64,1152], "src": [1408,1216], "f": 0, "t": 535, "d": [721], "a": 1 },
+						{ "px": [384,1216], "src": [896,1088], "f": 0, "t": 473, "d": [766], "a": 1 },
+						{ "px": [448,1216], "src": [960,1088], "f": 0, "t": 474, "d": [767], "a": 1 },
+						{ "px": [512,1216], "src": [1024,1088], "f": 0, "t": 475, "d": [768], "a": 1 },
+						{ "px": [1088,1216], "src": [1472,64], "f": 0, "t": 50, "d": [777], "a": 1 },
+						{ "px": [1344,1216], "src": [1280,64], "f": 0, "t": 47, "d": [781], "a": 1 },
+						{ "px": [2432,1216], "src": [1472,512], "f": 0, "t": 239, "d": [798], "a": 1 },
+						{ "px": [256,1280], "src": [1536,64], "f": 0, "t": 51, "d": [804], "a": 1 },
+						{ "px": [320,1280], "src": [1600,64], "f": 0, "t": 52, "d": [805], "a": 1 },
+						{ "px": [1088,1280], "src": [1472,128], "f": 0, "t": 77, "d": [817], "a": 1 },
+						{ "px": [1344,1280], "src": [1280,128], "f": 0, "t": 74, "d": [821], "a": 1 },
+						{ "px": [1856,1280], "src": [1216,1152], "f": 0, "t": 505, "d": [829], "a": 1 },
+						{ "px": [256,1344], "src": [1536,192], "f": 0, "t": 105, "d": [844], "a": 1 },
+						{ "px": [320,1344], "src": [1600,192], "f": 0, "t": 106, "d": [845], "a": 1 },
+						{ "px": [1088,1344], "src": [1472,192], "f": 0, "t": 104, "d": [857], "a": 1 },
+						{ "px": [1344,1344], "src": [1280,192], "f": 0, "t": 101, "d": [861], "a": 1 },
+						{ "px": [1856,1344], "src": [960,1216], "f": 0, "t": 528, "d": [869], "a": 1 }
+					],
+					"entityInstances": []
+				},
+				{
+					"__identifier": "IntGrid",
+					"__type": "IntGrid",
+					"__cWid": 40,
+					"__cHei": 23,
+					"__gridSize": 64,
+					"__opacity": 1,
+					"__pxTotalOffsetX": 0,
+					"__pxTotalOffsetY": 0,
+					"__tilesetDefUid": 1,
+					"__tilesetRelPath": "../zombie_shooter/tilemap.png",
+					"iid": "49e5c130-d380-11f0-9ae1-4121d35fc153",
+					"levelId": 0,
+					"layerDefUid": 2,
+					"pxOffsetX": 0,
+					"pxOffsetY": 0,
+					"visible": true,
+					"optionalRules": [],
+					"intGridCsv": [
+						1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,1,1,1,1,1,2,2,3,2,2,2,2,2,2,2,2,2,2,2,3,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,2,2,2,2,2,1,1,1,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,1,1,1,1,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,1,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,1,1,1,1,1,1,1,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,2,1,1,1,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,1,2,2,2,2,
+						2,2,3,3,2,2,2,2,2,2,2,2,1,1,1,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,
+						1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,1,1,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,3,2,2,
+						2,2,2,2,2,2,2,2,2,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,1,2,2,2,2,2,2,2,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,1,2,2,2,2,2,2,2,1,2,2,2,2,2,2,
+						2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,1,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,2,2,2,2,2,2,3,2,2,1,1,2,2,2,2,2,2,2,2,2,2,2,2,1,1,2,2,2,2,
+						2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,1,
+						1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,1,1,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,
+						2,2,2,2,2,2,2,2,2,1,1,1,1,1,1,2,2,2,2,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,2,2,1,1,1,1,1,1,1,1,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,
+						4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,1,1,1,1,1,3,4,4,4,4,4,4,4,4,4,4,4,4,4,
+						4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,1,1,1,1,1,4,4,4,4,4,3,3,3,4,
+						4,4,4,4,4,4,4,3,1,1,1,3,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,4,1,1,4,4,4,3,
+						3,1,1,1,4,4,4,4,4,4,4,4,3,1,1,1,3,4,4,4,4,4,4,4,3,4,4,4,4,4,4,4,4,4,1,
+						1,4,4,4,3,3,1,4,1,4,4,4,4,4,4,4,4,3,1,1,1,3,4,4,4,4,4,4,4,3,4,4,4,4,4,
+						4,4,4,4,1,1,1,1,1,1,1,1,4,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,1,
+						1,1,1,1,1,1,1,1,1,1
+					],
+					"autoLayerTiles": [
+						{ "px": [2368,0], "src": [960,384], "f": 0, "t": 177, "d": [60,37], "a": 1 },
+						{ "px": [2432,0], "src": [960,384], "f": 0, "t": 177, "d": [60,38], "a": 1 },
+						{ "px": [2496,0], "src": [960,384], "f": 0, "t": 177, "d": [60,39], "a": 1 },
+						{ "px": [2368,64], "src": [960,384], "f": 0, "t": 177, "d": [60,77], "a": 1 },
+						{ "px": [2432,64], "src": [960,384], "f": 0, "t": 177, "d": [60,78], "a": 1 },
+						{ "px": [2496,64], "src": [960,384], "f": 0, "t": 177, "d": [60,79], "a": 1 },
+						{ "px": [2368,128], "src": [960,384], "f": 0, "t": 177, "d": [60,117], "a": 1 },
+						{ "px": [2432,128], "src": [960,384], "f": 0, "t": 177, "d": [60,118], "a": 1 },
+						{ "px": [2496,128], "src": [960,384], "f": 0, "t": 177, "d": [60,119], "a": 1 },
+						{ "px": [2368,192], "src": [960,384], "f": 0, "t": 177, "d": [60,157], "a": 1 },
+						{ "px": [2432,192], "src": [960,384], "f": 0, "t": 177, "d": [60,158], "a": 1 },
+						{ "px": [2496,192], "src": [960,384], "f": 0, "t": 177, "d": [60,159], "a": 1 },
+						{ "px": [1216,320], "src": [960,384], "f": 0, "t": 177, "d": [60,219], "a": 1 },
+						{ "px": [1152,384], "src": [960,384], "f": 0, "t": 177, "d": [60,258], "a": 1 },
+						{ "px": [1216,384], "src": [960,384], "f": 0, "t": 177, "d": [60,259], "a": 1 },
+						{ "px": [1280,384], "src": [960,384], "f": 0, "t": 177, "d": [60,260], "a": 1 },
+						{ "px": [2368,1088], "src": [960,384], "f": 0, "t": 177, "d": [60,717], "a": 1 },
+						{ "px": [2432,1088], "src": [960,384], "f": 0, "t": 177, "d": [60,718], "a": 1 },
+						{ "px": [2496,1088], "src": [960,384], "f": 0, "t": 177, "d": [60,719], "a": 1 },
+						{ "px": [1216,1280], "src": [960,384], "f": 0, "t": 177, "d": [60,819], "a": 1 },
+						{ "px": [1216,1344], "src": [960,384], "f": 0, "t": 177, "d": [60,859], "a": 1 },
+						{ "px": [1216,1408], "src": [960,384], "f": 0, "t": 177, "d": [60,899], "a": 1 },
+						{ "px": [0,0], "src": [576,384], "f": 0, "t": 171, "d": [59,0], "a": 1 },
+						{ "px": [2304,0], "src": [576,384], "f": 1, "t": 171, "d": [59,36], "a": 1 },
+						{ "px": [2304,192], "src": [576,384], "f": 3, "t": 171, "d": [59,156], "a": 1 },
+						{ "px": [2496,256], "src": [576,384], "f": 1, "t": 171, "d": [59,199], "a": 1 },
+						{ "px": [1152,320], "src": [576,384], "f": 3, "t": 171, "d": [59,218], "a": 1 },
+						{ "px": [1280,320], "src": [576,384], "f": 2, "t": 171, "d": [59,220], "a": 1 },
+						{ "px": [2496,1024], "src": [576,384], "f": 3, "t": 171, "d": [59,679], "a": 1 },
+						{ "px": [2496,1152], "src": [576,384], "f": 1, "t": 171, "d": [59,759], "a": 1 },
+						{ "px": [0,1408], "src": [576,384], "f": 2, "t": 171, "d": [59,880], "a": 1 },
+						{ "px": [1152,1408], "src": [576,384], "f": 3, "t": 171, "d": [59,898], "a": 1 },
+						{ "px": [1280,1408], "src": [576,384], "f": 2, "t": 171, "d": [59,900], "a": 1 },
+						{ "px": [2496,1408], "src": [576,384], "f": 3, "t": 171, "d": [59,919], "a": 1 },
+						{ "px": [0,64], "src": [832,384], "f": 1, "t": 175, "d": [58,40], "a": 1 },
+						{ "px": [2304,64], "src": [832,384], "f": 0, "t": 175, "d": [58,76], "a": 1 },
+						{ "px": [0,128], "src": [832,384], "f": 1, "t": 175, "d": [58,80], "a": 1 },
+						{ "px": [2304,128], "src": [832,384], "f": 0, "t": 175, "d": [58,116], "a": 1 },
+						{ "px": [0,192], "src": [832,384], "f": 1, "t": 175, "d": [58,120], "a": 1 },
+						{ "px": [0,256], "src": [832,384], "f": 1, "t": 175, "d": [58,160], "a": 1 },
+						{ "px": [0,320], "src": [832,384], "f": 1, "t": 175, "d": [58,200], "a": 1 },
+						{ "px": [2496,320], "src": [832,384], "f": 0, "t": 175, "d": [58,239], "a": 1 },
+						{ "px": [0,384], "src": [832,384], "f": 1, "t": 175, "d": [58,240], "a": 1 },
+						{ "px": [1088,384], "src": [832,384], "f": 0, "t": 175, "d": [58,257], "a": 1 },
+						{ "px": [1344,384], "src": [832,384], "f": 1, "t": 175, "d": [58,261], "a": 1 },
+						{ "px": [2496,384], "src": [832,384], "f": 0, "t": 175, "d": [58,279], "a": 1 },
+						{ "px": [0,448], "src": [832,384], "f": 1, "t": 175, "d": [58,280], "a": 1 },
+						{ "px": [2496,448], "src": [832,384], "f": 0, "t": 175, "d": [58,319], "a": 1 },
+						{ "px": [0,512], "src": [832,384], "f": 1, "t": 175, "d": [58,320], "a": 1 },
+						{ "px": [2496,512], "src": [832,384], "f": 0, "t": 175, "d": [58,359], "a": 1 },
+						{ "px": [0,576], "src": [832,384], "f": 1, "t": 175, "d": [58,360], "a": 1 },
+						{ "px": [2496,576], "src": [832,384], "f": 0, "t": 175, "d": [58,399], "a": 1 },
+						{ "px": [0,640], "src": [832,384], "f": 1, "t": 175, "d": [58,400], "a": 1 },
+						{ "px": [2496,640], "src": [832,384], "f": 0, "t": 175, "d": [58,439], "a": 1 },
+						{ "px": [0,704], "src": [832,384], "f": 1, "t": 175, "d": [58,440], "a": 1 },
+						{ "px": [2496,704], "src": [832,384], "f": 0, "t": 175, "d": [58,479], "a": 1 },
+						{ "px": [0,768], "src": [832,384], "f": 1, "t": 175, "d": [58,480], "a": 1 },
+						{ "px": [2496,768], "src": [832,384], "f": 0, "t": 175, "d": [58,519], "a": 1 },
+						{ "px": [0,832], "src": [832,384], "f": 1, "t": 175, "d": [58,520], "a": 1 },
+						{ "px": [2496,832], "src": [832,384], "f": 0, "t": 175, "d": [58,559], "a": 1 },
+						{ "px": [0,896], "src": [832,384], "f": 1, "t": 175, "d": [58,560], "a": 1 },
+						{ "px": [2496,896], "src": [832,384], "f": 0, "t": 175, "d": [58,599], "a": 1 },
+						{ "px": [0,960], "src": [832,384], "f": 1, "t": 175, "d": [58,600], "a": 1 },
+						{ "px": [2496,960], "src": [832,384], "f": 0, "t": 175, "d": [58,639], "a": 1 },
+						{ "px": [0,1088], "src": [832,384], "f": 1, "t": 175, "d": [58,680], "a": 1 },
+						{ "px": [2304,1088], "src": [832,384], "f": 0, "t": 175, "d": [58,716], "a": 1 },
+						{ "px": [0,1152], "src": [832,384], "f": 1, "t": 175, "d": [58,720], "a": 1 },
+						{ "px": [0,1216], "src": [832,384], "f": 1, "t": 175, "d": [58,760], "a": 1 },
+						{ "px": [2496,1216], "src": [832,384], "f": 0, "t": 175, "d": [58,799], "a": 1 },
+						{ "px": [0,1280], "src": [832,384], "f": 1, "t": 175, "d": [58,800], "a": 1 },
+						{ "px": [1152,1280], "src": [832,384], "f": 0, "t": 175, "d": [58,818], "a": 1 },
+						{ "px": [1280,1280], "src": [832,384], "f": 1, "t": 175, "d": [58,820], "a": 1 },
+						{ "px": [2496,1280], "src": [832,384], "f": 0, "t": 175, "d": [58,839], "a": 1 },
+						{ "px": [0,1344], "src": [832,384], "f": 1, "t": 175, "d": [58,840], "a": 1 },
+						{ "px": [1152,1344], "src": [832,384], "f": 0, "t": 175, "d": [58,858], "a": 1 },
+						{ "px": [1280,1344], "src": [832,384], "f": 1, "t": 175, "d": [58,860], "a": 1 },
+						{ "px": [2496,1344], "src": [832,384], "f": 0, "t": 175, "d": [58,879], "a": 1 },
+						{ "px": [64,0], "src": [832,448], "f": 2, "t": 202, "d": [57,1], "a": 1 },
+						{ "px": [128,0], "src": [832,448], "f": 2, "t": 202, "d": [57,2], "a": 1 },
+						{ "px": [192,0], "src": [832,448], "f": 2, "t": 202, "d": [57,3], "a": 1 },
+						{ "px": [256,0], "src": [832,448], "f": 2, "t": 202, "d": [57,4], "a": 1 },
+						{ "px": [320,0], "src": [832,448], "f": 2, "t": 202, "d": [57,5], "a": 1 },
+						{ "px": [384,0], "src": [832,448], "f": 2, "t": 202, "d": [57,6], "a": 1 },
+						{ "px": [448,0], "src": [832,448], "f": 2, "t": 202, "d": [57,7], "a": 1 },
+						{ "px": [512,0], "src": [832,448], "f": 2, "t": 202, "d": [57,8], "a": 1 },
+						{ "px": [576,0], "src": [832,448], "f": 2, "t": 202, "d": [57,9], "a": 1 },
+						{ "px": [640,0], "src": [832,448], "f": 2, "t": 202, "d": [57,10], "a": 1 },
+						{ "px": [704,0], "src": [832,448], "f": 2, "t": 202, "d": [57,11], "a": 1 },
+						{ "px": [768,0], "src": [832,448], "f": 2, "t": 202, "d": [57,12], "a": 1 },
+						{ "px": [832,0], "src": [832,448], "f": 2, "t": 202, "d": [57,13], "a": 1 },
+						{ "px": [896,0], "src": [832,448], "f": 2, "t": 202, "d": [57,14], "a": 1 },
+						{ "px": [960,0], "src": [832,448], "f": 2, "t": 202, "d": [57,15], "a": 1 },
+						{ "px": [1024,0], "src": [832,448], "f": 2, "t": 202, "d": [57,16], "a": 1 },
+						{ "px": [1088,0], "src": [832,448], "f": 2, "t": 202, "d": [57,17], "a": 1 },
+						{ "px": [1152,0], "src": [832,448], "f": 2, "t": 202, "d": [57,18], "a": 1 },
+						{ "px": [1216,0], "src": [832,448], "f": 2, "t": 202, "d": [57,19], "a": 1 },
+						{ "px": [1280,0], "src": [832,448], "f": 2, "t": 202, "d": [57,20], "a": 1 },
+						{ "px": [1344,0], "src": [832,448], "f": 2, "t": 202, "d": [57,21], "a": 1 },
+						{ "px": [1408,0], "src": [832,448], "f": 2, "t": 202, "d": [57,22], "a": 1 },
+						{ "px": [1472,0], "src": [832,448], "f": 2, "t": 202, "d": [57,23], "a": 1 },
+						{ "px": [1536,0], "src": [832,448], "f": 2, "t": 202, "d": [57,24], "a": 1 },
+						{ "px": [1600,0], "src": [832,448], "f": 2, "t": 202, "d": [57,25], "a": 1 },
+						{ "px": [1664,0], "src": [832,448], "f": 2, "t": 202, "d": [57,26], "a": 1 },
+						{ "px": [1728,0], "src": [832,448], "f": 2, "t": 202, "d": [57,27], "a": 1 },
+						{ "px": [1792,0], "src": [832,448], "f": 2, "t": 202, "d": [57,28], "a": 1 },
+						{ "px": [1856,0], "src": [832,448], "f": 2, "t": 202, "d": [57,29], "a": 1 },
+						{ "px": [1920,0], "src": [832,448], "f": 2, "t": 202, "d": [57,30], "a": 1 },
+						{ "px": [1984,0], "src": [832,448], "f": 2, "t": 202, "d": [57,31], "a": 1 },
+						{ "px": [2048,0], "src": [832,448], "f": 2, "t": 202, "d": [57,32], "a": 1 },
+						{ "px": [2112,0], "src": [832,448], "f": 2, "t": 202, "d": [57,33], "a": 1 },
+						{ "px": [2176,0], "src": [832,448], "f": 2, "t": 202, "d": [57,34], "a": 1 },
+						{ "px": [2240,0], "src": [832,448], "f": 2, "t": 202, "d": [57,35], "a": 1 },
+						{ "px": [2240,192], "src": [832,448], "f": 0, "t": 202, "d": [57,155], "a": 1 },
+						{ "px": [1216,256], "src": [832,448], "f": 0, "t": 202, "d": [57,179], "a": 1 },
+						{ "px": [2240,256], "src": [832,448], "f": 2, "t": 202, "d": [57,195], "a": 1 },
+						{ "px": [2304,256], "src": [832,448], "f": 2, "t": 202, "d": [57,196], "a": 1 },
+						{ "px": [2368,256], "src": [832,448], "f": 2, "t": 202, "d": [57,197], "a": 1 },
+						{ "px": [2432,256], "src": [832,448], "f": 2, "t": 202, "d": [57,198], "a": 1 },
+						{ "px": [1152,448], "src": [832,448], "f": 2, "t": 202, "d": [57,298], "a": 1 },
+						{ "px": [1216,448], "src": [832,448], "f": 2, "t": 202, "d": [57,299], "a": 1 },
+						{ "px": [1280,448], "src": [832,448], "f": 2, "t": 202, "d": [57,300], "a": 1 },
+						{ "px": [2368,1024], "src": [832,448], "f": 0, "t": 202, "d": [57,677], "a": 1 },
+						{ "px": [2432,1024], "src": [832,448], "f": 0, "t": 202, "d": [57,678], "a": 1 },
+						{ "px": [2368,1152], "src": [832,448], "f": 2, "t": 202, "d": [57,757], "a": 1 },
+						{ "px": [2432,1152], "src": [832,448], "f": 2, "t": 202, "d": [57,758], "a": 1 },
+						{ "px": [1216,1216], "src": [832,448], "f": 0, "t": 202, "d": [57,779], "a": 1 },
+						{ "px": [64,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,881], "a": 1 },
+						{ "px": [128,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,882], "a": 1 },
+						{ "px": [192,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,883], "a": 1 },
+						{ "px": [256,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,884], "a": 1 },
+						{ "px": [320,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,885], "a": 1 },
+						{ "px": [576,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,889], "a": 1 },
+						{ "px": [640,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,890], "a": 1 },
+						{ "px": [704,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,891], "a": 1 },
+						{ "px": [768,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,892], "a": 1 },
+						{ "px": [832,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,893], "a": 1 },
+						{ "px": [896,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,894], "a": 1 },
+						{ "px": [960,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,895], "a": 1 },
+						{ "px": [1024,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,896], "a": 1 },
+						{ "px": [1088,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,897], "a": 1 },
+						{ "px": [1344,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,901], "a": 1 },
+						{ "px": [1408,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,902], "a": 1 },
+						{ "px": [1472,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,903], "a": 1 },
+						{ "px": [1536,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,904], "a": 1 },
+						{ "px": [1600,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,905], "a": 1 },
+						{ "px": [1664,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,906], "a": 1 },
+						{ "px": [1728,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,907], "a": 1 },
+						{ "px": [1792,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,908], "a": 1 },
+						{ "px": [1856,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,909], "a": 1 },
+						{ "px": [1920,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,910], "a": 1 },
+						{ "px": [1984,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,911], "a": 1 },
+						{ "px": [2048,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,912], "a": 1 },
+						{ "px": [2112,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,913], "a": 1 },
+						{ "px": [2176,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,914], "a": 1 },
+						{ "px": [2240,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,915], "a": 1 },
+						{ "px": [2304,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,916], "a": 1 },
+						{ "px": [2368,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,917], "a": 1 },
+						{ "px": [2432,1408], "src": [832,448], "f": 0, "t": 202, "d": [57,918], "a": 1 },
+						{ "px": [2176,192], "src": [1024,256], "f": 0, "t": 124, "d": [56,154], "a": 1 },
+						{ "px": [1152,256], "src": [1024,256], "f": 0, "t": 124, "d": [56,178], "a": 1 },
+						{ "px": [1280,256], "src": [1024,256], "f": 1, "t": 124, "d": [56,180], "a": 1 },
+						{ "px": [2176,256], "src": [1024,256], "f": 2, "t": 124, "d": [56,194], "a": 1 },
+						{ "px": [1088,320], "src": [1024,256], "f": 0, "t": 124, "d": [56,217], "a": 1 },
+						{ "px": [1344,320], "src": [1024,256], "f": 1, "t": 124, "d": [56,221], "a": 1 },
+						{ "px": [1088,448], "src": [1024,256], "f": 2, "t": 124, "d": [56,297], "a": 1 },
+						{ "px": [1344,448], "src": [1024,256], "f": 3, "t": 124, "d": [56,301], "a": 1 },
+						{ "px": [2304,1152], "src": [1024,256], "f": 2, "t": 124, "d": [56,756], "a": 1 },
+						{ "px": [1152,1216], "src": [1024,256], "f": 0, "t": 124, "d": [56,778], "a": 1 },
+						{ "px": [1280,1216], "src": [1024,256], "f": 1, "t": 124, "d": [56,780], "a": 1 },
+						{ "px": [384,1344], "src": [704,320], "f": 0, "t": 146, "d": [55,846], "a": 1 },
+						{ "px": [512,1344], "src": [704,320], "f": 0, "t": 146, "d": [55,848], "a": 1 },
+						{ "px": [64,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,641], "a": 1 },
+						{ "px": [128,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,642], "a": 1 },
+						{ "px": [192,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,643], "a": 1 },
+						{ "px": [640,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,650], "a": 1 },
+						{ "px": [704,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,651], "a": 1 },
+						{ "px": [768,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,652], "a": 1 },
+						{ "px": [832,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,653], "a": 1 },
+						{ "px": [896,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,654], "a": 1 },
+						{ "px": [960,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,655], "a": 1 },
+						{ "px": [1024,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,656], "a": 1 },
+						{ "px": [1088,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,657], "a": 1 },
+						{ "px": [1152,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,658], "a": 1 },
+						{ "px": [1216,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,659], "a": 1 },
+						{ "px": [1280,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,660], "a": 1 },
+						{ "px": [1344,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,661], "a": 1 },
+						{ "px": [1408,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,662], "a": 1 },
+						{ "px": [1472,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,663], "a": 1 },
+						{ "px": [1536,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,664], "a": 1 },
+						{ "px": [1600,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,665], "a": 1 },
+						{ "px": [1664,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,666], "a": 1 },
+						{ "px": [1728,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,667], "a": 1 },
+						{ "px": [1792,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,668], "a": 1 },
+						{ "px": [1856,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,669], "a": 1 },
+						{ "px": [2176,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,674], "a": 1 },
+						{ "px": [2240,1024], "src": [704,256], "f": 0, "t": 119, "d": [52,675], "a": 1 },
+						{ "px": [448,1280], "src": [704,256], "f": 0, "t": 119, "d": [52,807], "a": 1 },
+						{ "px": [1664,768], "src": [896,256], "f": 0, "t": 122, "d": [51,506], "a": 1 },
+						{ "px": [256,1024], "src": [896,256], "f": 0, "t": 122, "d": [51,644], "a": 1 },
+						{ "px": [1920,1024], "src": [896,256], "f": 0, "t": 122, "d": [51,670], "a": 1 },
+						{ "px": [1600,768], "src": [960,320], "f": 0, "t": 150, "d": [50,505], "a": 1 },
+						{ "px": [576,1024], "src": [960,320], "f": 0, "t": 150, "d": [50,649], "a": 1 },
+						{ "px": [2112,1024], "src": [960,320], "f": 0, "t": 150, "d": [50,673], "a": 1 },
+						{ "px": [0,1024], "src": [768,448], "f": 1, "t": 201, "d": [48,640], "a": 1 },
+						{ "px": [384,1408], "src": [768,512], "f": 0, "t": 228, "d": [38,886], "a": 1 },
+						{ "px": [2304,1024], "src": [832,512], "f": 0, "t": 229, "d": [36,676], "a": 1 },
+						{ "px": [512,1408], "src": [704,512], "f": 0, "t": 227, "d": [35,888], "a": 1 },
+						{ "px": [384,1280], "src": [576,256], "f": 0, "t": 117, "d": [33,806], "a": 1 },
+						{ "px": [512,1280], "src": [576,256], "f": 1, "t": 117, "d": [33,808], "a": 1 },
+						{ "px": [1984,576], "src": [960,448], "f": 0, "t": 204, "d": [31,391], "a": 1 },
+						{ "px": [512,704], "src": [960,448], "f": 0, "t": 204, "d": [31,448], "a": 1 },
+						{ "px": [64,64], "src": [192,0], "f": 0, "t": 3, "d": [63,41], "a": 1 },
+						{ "px": [128,64], "src": [64,0], "f": 0, "t": 1, "d": [63,42], "a": 1 },
+						{ "px": [192,64], "src": [128,0], "f": 0, "t": 2, "d": [63,43], "a": 1 },
+						{ "px": [256,64], "src": [192,0], "f": 0, "t": 3, "d": [63,44], "a": 1 },
+						{ "px": [320,64], "src": [64,0], "f": 0, "t": 1, "d": [63,45], "a": 1 },
+						{ "px": [384,64], "src": [0,0], "f": 0, "t": 0, "d": [63,46], "a": 1 },
+						{ "px": [448,64], "src": [0,0], "f": 0, "t": 0, "d": [63,47], "a": 1 },
+						{ "px": [512,64], "src": [128,0], "f": 0, "t": 2, "d": [63,48], "a": 1 },
+						{ "px": [576,64], "src": [64,0], "f": 0, "t": 1, "d": [63,49], "a": 1 },
+						{ "px": [640,64], "src": [128,0], "f": 0, "t": 2, "d": [63,50], "a": 1 },
+						{ "px": [704,64], "src": [192,0], "f": 0, "t": 3, "d": [63,51], "a": 1 },
+						{ "px": [768,64], "src": [128,0], "f": 0, "t": 2, "d": [63,52], "a": 1 },
+						{ "px": [832,64], "src": [128,0], "f": 0, "t": 2, "d": [63,53], "a": 1 },
+						{ "px": [896,64], "src": [64,0], "f": 0, "t": 1, "d": [63,54], "a": 1 },
+						{ "px": [960,64], "src": [192,0], "f": 0, "t": 3, "d": [63,55], "a": 1 },
+						{ "px": [1024,64], "src": [192,0], "f": 0, "t": 3, "d": [63,56], "a": 1 },
+						{ "px": [1088,64], "src": [64,0], "f": 0, "t": 1, "d": [63,57], "a": 1 },
+						{ "px": [1152,64], "src": [64,0], "f": 0, "t": 1, "d": [63,58], "a": 1 },
+						{ "px": [1216,64], "src": [0,0], "f": 0, "t": 0, "d": [63,59], "a": 1 },
+						{ "px": [1280,64], "src": [128,0], "f": 0, "t": 2, "d": [63,60], "a": 1 },
+						{ "px": [1344,64], "src": [64,0], "f": 0, "t": 1, "d": [63,61], "a": 1 },
+						{ "px": [1408,64], "src": [64,0], "f": 0, "t": 1, "d": [63,62], "a": 1 },
+						{ "px": [1472,64], "src": [192,0], "f": 0, "t": 3, "d": [63,63], "a": 1 },
+						{ "px": [1536,64], "src": [64,0], "f": 0, "t": 1, "d": [63,64], "a": 1 },
+						{ "px": [1600,64], "src": [192,0], "f": 0, "t": 3, "d": [63,65], "a": 1 },
+						{ "px": [1664,64], "src": [192,0], "f": 0, "t": 3, "d": [63,66], "a": 1 },
+						{ "px": [1728,64], "src": [0,0], "f": 0, "t": 0, "d": [63,67], "a": 1 },
+						{ "px": [1792,64], "src": [0,0], "f": 0, "t": 0, "d": [63,68], "a": 1 },
+						{ "px": [1856,64], "src": [0,0], "f": 0, "t": 0, "d": [63,69], "a": 1 },
+						{ "px": [1920,64], "src": [64,0], "f": 0, "t": 1, "d": [63,70], "a": 1 },
+						{ "px": [1984,64], "src": [64,0], "f": 0, "t": 1, "d": [63,71], "a": 1 },
+						{ "px": [2048,64], "src": [128,0], "f": 0, "t": 2, "d": [63,72], "a": 1 },
+						{ "px": [2112,64], "src": [128,0], "f": 0, "t": 2, "d": [63,73], "a": 1 },
+						{ "px": [2176,64], "src": [0,0], "f": 0, "t": 0, "d": [63,74], "a": 1 },
+						{ "px": [2240,64], "src": [128,0], "f": 0, "t": 2, "d": [63,75], "a": 1 },
+						{ "px": [64,128], "src": [128,0], "f": 0, "t": 2, "d": [63,81], "a": 1 },
+						{ "px": [128,128], "src": [64,0], "f": 0, "t": 1, "d": [63,82], "a": 1 },
+						{ "px": [256,128], "src": [128,0], "f": 0, "t": 2, "d": [63,84], "a": 1 },
+						{ "px": [320,128], "src": [0,0], "f": 0, "t": 0, "d": [63,85], "a": 1 },
+						{ "px": [384,128], "src": [64,0], "f": 0, "t": 1, "d": [63,86], "a": 1 },
+						{ "px": [448,128], "src": [0,0], "f": 0, "t": 0, "d": [63,87], "a": 1 },
+						{ "px": [512,128], "src": [128,0], "f": 0, "t": 2, "d": [63,88], "a": 1 },
+						{ "px": [576,128], "src": [192,0], "f": 0, "t": 3, "d": [63,89], "a": 1 },
+						{ "px": [640,128], "src": [64,0], "f": 0, "t": 1, "d": [63,90], "a": 1 },
+						{ "px": [704,128], "src": [64,0], "f": 0, "t": 1, "d": [63,91], "a": 1 },
+						{ "px": [768,128], "src": [128,0], "f": 0, "t": 2, "d": [63,92], "a": 1 },
+						{ "px": [832,128], "src": [64,0], "f": 0, "t": 1, "d": [63,93], "a": 1 },
+						{ "px": [896,128], "src": [0,0], "f": 0, "t": 0, "d": [63,94], "a": 1 },
+						{ "px": [1024,128], "src": [192,0], "f": 0, "t": 3, "d": [63,96], "a": 1 },
+						{ "px": [1088,128], "src": [192,0], "f": 0, "t": 3, "d": [63,97], "a": 1 },
+						{ "px": [1152,128], "src": [192,0], "f": 0, "t": 3, "d": [63,98], "a": 1 },
+						{ "px": [1216,128], "src": [192,0], "f": 0, "t": 3, "d": [63,99], "a": 1 },
+						{ "px": [1280,128], "src": [128,0], "f": 0, "t": 2, "d": [63,100], "a": 1 },
+						{ "px": [1344,128], "src": [0,0], "f": 0, "t": 0, "d": [63,101], "a": 1 },
+						{ "px": [1408,128], "src": [0,0], "f": 0, "t": 0, "d": [63,102], "a": 1 },
+						{ "px": [1472,128], "src": [0,0], "f": 0, "t": 0, "d": [63,103], "a": 1 },
+						{ "px": [1536,128], "src": [64,0], "f": 0, "t": 1, "d": [63,104], "a": 1 },
+						{ "px": [1600,128], "src": [192,0], "f": 0, "t": 3, "d": [63,105], "a": 1 },
+						{ "px": [1664,128], "src": [64,0], "f": 0, "t": 1, "d": [63,106], "a": 1 },
+						{ "px": [1728,128], "src": [64,0], "f": 0, "t": 1, "d": [63,107], "a": 1 },
+						{ "px": [1792,128], "src": [64,0], "f": 0, "t": 1, "d": [63,108], "a": 1 },
+						{ "px": [1856,128], "src": [64,0], "f": 0, "t": 1, "d": [63,109], "a": 1 },
+						{ "px": [1920,128], "src": [64,0], "f": 0, "t": 1, "d": [63,110], "a": 1 },
+						{ "px": [1984,128], "src": [0,0], "f": 0, "t": 0, "d": [63,111], "a": 1 },
+						{ "px": [2048,128], "src": [192,0], "f": 0, "t": 3, "d": [63,112], "a": 1 },
+						{ "px": [2112,128], "src": [192,0], "f": 0, "t": 3, "d": [63,113], "a": 1 },
+						{ "px": [2176,128], "src": [64,0], "f": 0, "t": 1, "d": [63,114], "a": 1 },
+						{ "px": [2240,128], "src": [192,0], "f": 0, "t": 3, "d": [63,115], "a": 1 },
+						{ "px": [64,192], "src": [0,0], "f": 0, "t": 0, "d": [63,121], "a": 1 },
+						{ "px": [128,192], "src": [64,0], "f": 0, "t": 1, "d": [63,122], "a": 1 },
+						{ "px": [192,192], "src": [64,0], "f": 0, "t": 1, "d": [63,123], "a": 1 },
+						{ "px": [256,192], "src": [192,0], "f": 0, "t": 3, "d": [63,124], "a": 1 },
+						{ "px": [320,192], "src": [64,0], "f": 0, "t": 1, "d": [63,125], "a": 1 },
+						{ "px": [384,192], "src": [0,0], "f": 0, "t": 0, "d": [63,126], "a": 1 },
+						{ "px": [448,192], "src": [0,0], "f": 0, "t": 0, "d": [63,127], "a": 1 },
+						{ "px": [512,192], "src": [64,0], "f": 0, "t": 1, "d": [63,128], "a": 1 },
+						{ "px": [576,192], "src": [128,0], "f": 0, "t": 2, "d": [63,129], "a": 1 },
+						{ "px": [640,192], "src": [64,0], "f": 0, "t": 1, "d": [63,130], "a": 1 },
+						{ "px": [704,192], "src": [192,0], "f": 0, "t": 3, "d": [63,131], "a": 1 },
+						{ "px": [768,192], "src": [64,0], "f": 0, "t": 1, "d": [63,132], "a": 1 },
+						{ "px": [832,192], "src": [192,0], "f": 0, "t": 3, "d": [63,133], "a": 1 },
+						{ "px": [896,192], "src": [128,0], "f": 0, "t": 2, "d": [63,134], "a": 1 },
+						{ "px": [960,192], "src": [64,0], "f": 0, "t": 1, "d": [63,135], "a": 1 },
+						{ "px": [1024,192], "src": [128,0], "f": 0, "t": 2, "d": [63,136], "a": 1 },
+						{ "px": [1088,192], "src": [0,0], "f": 0, "t": 0, "d": [63,137], "a": 1 },
+						{ "px": [1152,192], "src": [64,0], "f": 0, "t": 1, "d": [63,138], "a": 1 },
+						{ "px": [1216,192], "src": [0,0], "f": 0, "t": 0, "d": [63,139], "a": 1 },
+						{ "px": [1280,192], "src": [64,0], "f": 0, "t": 1, "d": [63,140], "a": 1 },
+						{ "px": [1344,192], "src": [192,0], "f": 0, "t": 3, "d": [63,141], "a": 1 },
+						{ "px": [1408,192], "src": [128,0], "f": 0, "t": 2, "d": [63,142], "a": 1 },
+						{ "px": [1472,192], "src": [0,0], "f": 0, "t": 0, "d": [63,143], "a": 1 },
+						{ "px": [1536,192], "src": [192,0], "f": 0, "t": 3, "d": [63,144], "a": 1 },
+						{ "px": [1600,192], "src": [128,0], "f": 0, "t": 2, "d": [63,145], "a": 1 },
+						{ "px": [1664,192], "src": [192,0], "f": 0, "t": 3, "d": [63,146], "a": 1 },
+						{ "px": [1728,192], "src": [0,0], "f": 0, "t": 0, "d": [63,147], "a": 1 },
+						{ "px": [1792,192], "src": [0,0], "f": 0, "t": 0, "d": [63,148], "a": 1 },
+						{ "px": [1856,192], "src": [64,0], "f": 0, "t": 1, "d": [63,149], "a": 1 },
+						{ "px": [1920,192], "src": [0,0], "f": 0, "t": 0, "d": [63,150], "a": 1 },
+						{ "px": [1984,192], "src": [0,0], "f": 0, "t": 0, "d": [63,151], "a": 1 },
+						{ "px": [2048,192], "src": [64,0], "f": 0, "t": 1, "d": [63,152], "a": 1 },
+						{ "px": [2112,192], "src": [0,0], "f": 0, "t": 0, "d": [63,153], "a": 1 },
+						{ "px": [64,256], "src": [0,0], "f": 0, "t": 0, "d": [63,161], "a": 1 },
+						{ "px": [128,256], "src": [192,0], "f": 0, "t": 3, "d": [63,162], "a": 1 },
+						{ "px": [192,256], "src": [0,0], "f": 0, "t": 0, "d": [63,163], "a": 1 },
+						{ "px": [256,256], "src": [192,0], "f": 0, "t": 3, "d": [63,164], "a": 1 },
+						{ "px": [320,256], "src": [0,0], "f": 0, "t": 0, "d": [63,165], "a": 1 },
+						{ "px": [384,256], "src": [128,0], "f": 0, "t": 2, "d": [63,166], "a": 1 },
+						{ "px": [448,256], "src": [192,0], "f": 0, "t": 3, "d": [63,167], "a": 1 },
+						{ "px": [512,256], "src": [192,0], "f": 0, "t": 3, "d": [63,168], "a": 1 },
+						{ "px": [576,256], "src": [192,0], "f": 0, "t": 3, "d": [63,169], "a": 1 },
+						{ "px": [640,256], "src": [192,0], "f": 0, "t": 3, "d": [63,170], "a": 1 },
+						{ "px": [704,256], "src": [64,0], "f": 0, "t": 1, "d": [63,171], "a": 1 },
+						{ "px": [768,256], "src": [128,0], "f": 0, "t": 2, "d": [63,172], "a": 1 },
+						{ "px": [832,256], "src": [192,0], "f": 0, "t": 3, "d": [63,173], "a": 1 },
+						{ "px": [896,256], "src": [64,0], "f": 0, "t": 1, "d": [63,174], "a": 1 },
+						{ "px": [960,256], "src": [64,0], "f": 0, "t": 1, "d": [63,175], "a": 1 },
+						{ "px": [1024,256], "src": [0,0], "f": 0, "t": 0, "d": [63,176], "a": 1 },
+						{ "px": [1088,256], "src": [128,0], "f": 0, "t": 2, "d": [63,177], "a": 1 },
+						{ "px": [1344,256], "src": [64,0], "f": 0, "t": 1, "d": [63,181], "a": 1 },
+						{ "px": [1408,256], "src": [128,0], "f": 0, "t": 2, "d": [63,182], "a": 1 },
+						{ "px": [1472,256], "src": [128,0], "f": 0, "t": 2, "d": [63,183], "a": 1 },
+						{ "px": [1536,256], "src": [128,0], "f": 0, "t": 2, "d": [63,184], "a": 1 },
+						{ "px": [1600,256], "src": [192,0], "f": 0, "t": 3, "d": [63,185], "a": 1 },
+						{ "px": [1664,256], "src": [128,0], "f": 0, "t": 2, "d": [63,186], "a": 1 },
+						{ "px": [1728,256], "src": [0,0], "f": 0, "t": 0, "d": [63,187], "a": 1 },
+						{ "px": [1792,256], "src": [128,0], "f": 0, "t": 2, "d": [63,188], "a": 1 },
+						{ "px": [1856,256], "src": [192,0], "f": 0, "t": 3, "d": [63,189], "a": 1 },
+						{ "px": [1920,256], "src": [64,0], "f": 0, "t": 1, "d": [63,190], "a": 1 },
+						{ "px": [1984,256], "src": [192,0], "f": 0, "t": 3, "d": [63,191], "a": 1 },
+						{ "px": [2048,256], "src": [128,0], "f": 0, "t": 2, "d": [63,192], "a": 1 },
+						{ "px": [2112,256], "src": [64,0], "f": 0, "t": 1, "d": [63,193], "a": 1 },
+						{ "px": [64,320], "src": [192,0], "f": 0, "t": 3, "d": [63,201], "a": 1 },
+						{ "px": [128,320], "src": [128,0], "f": 0, "t": 2, "d": [63,202], "a": 1 },
+						{ "px": [192,320], "src": [128,0], "f": 0, "t": 2, "d": [63,203], "a": 1 },
+						{ "px": [256,320], "src": [0,0], "f": 0, "t": 0, "d": [63,204], "a": 1 },
+						{ "px": [320,320], "src": [0,0], "f": 0, "t": 0, "d": [63,205], "a": 1 },
+						{ "px": [384,320], "src": [128,0], "f": 0, "t": 2, "d": [63,206], "a": 1 },
+						{ "px": [448,320], "src": [192,0], "f": 0, "t": 3, "d": [63,207], "a": 1 },
+						{ "px": [512,320], "src": [0,0], "f": 0, "t": 0, "d": [63,208], "a": 1 },
+						{ "px": [576,320], "src": [128,0], "f": 0, "t": 2, "d": [63,209], "a": 1 },
+						{ "px": [640,320], "src": [128,0], "f": 0, "t": 2, "d": [63,210], "a": 1 },
+						{ "px": [704,320], "src": [0,0], "f": 0, "t": 0, "d": [63,211], "a": 1 },
+						{ "px": [768,320], "src": [64,0], "f": 0, "t": 1, "d": [63,212], "a": 1 },
+						{ "px": [832,320], "src": [128,0], "f": 0, "t": 2, "d": [63,213], "a": 1 },
+						{ "px": [896,320], "src": [128,0], "f": 0, "t": 2, "d": [63,214], "a": 1 },
+						{ "px": [960,320], "src": [64,0], "f": 0, "t": 1, "d": [63,215], "a": 1 },
+						{ "px": [1024,320], "src": [192,0], "f": 0, "t": 3, "d": [63,216], "a": 1 },
+						{ "px": [1408,320], "src": [128,0], "f": 0, "t": 2, "d": [63,222], "a": 1 },
+						{ "px": [1472,320], "src": [0,0], "f": 0, "t": 0, "d": [63,223], "a": 1 },
+						{ "px": [1536,320], "src": [0,0], "f": 0, "t": 0, "d": [63,224], "a": 1 },
+						{ "px": [1600,320], "src": [128,0], "f": 0, "t": 2, "d": [63,225], "a": 1 },
+						{ "px": [1664,320], "src": [64,0], "f": 0, "t": 1, "d": [63,226], "a": 1 },
+						{ "px": [1728,320], "src": [64,0], "f": 0, "t": 1, "d": [63,227], "a": 1 },
+						{ "px": [1792,320], "src": [0,0], "f": 0, "t": 0, "d": [63,228], "a": 1 },
+						{ "px": [1856,320], "src": [0,0], "f": 0, "t": 0, "d": [63,229], "a": 1 },
+						{ "px": [1920,320], "src": [0,0], "f": 0, "t": 0, "d": [63,230], "a": 1 },
+						{ "px": [1984,320], "src": [64,0], "f": 0, "t": 1, "d": [63,231], "a": 1 },
+						{ "px": [2048,320], "src": [64,0], "f": 0, "t": 1, "d": [63,232], "a": 1 },
+						{ "px": [2112,320], "src": [64,0], "f": 0, "t": 1, "d": [63,233], "a": 1 },
+						{ "px": [2176,320], "src": [128,0], "f": 0, "t": 2, "d": [63,234], "a": 1 },
+						{ "px": [2240,320], "src": [0,0], "f": 0, "t": 0, "d": [63,235], "a": 1 },
+						{ "px": [2304,320], "src": [64,0], "f": 0, "t": 1, "d": [63,236], "a": 1 },
+						{ "px": [2368,320], "src": [64,0], "f": 0, "t": 1, "d": [63,237], "a": 1 },
+						{ "px": [2432,320], "src": [0,0], "f": 0, "t": 0, "d": [63,238], "a": 1 },
+						{ "px": [64,384], "src": [192,0], "f": 0, "t": 3, "d": [63,241], "a": 1 },
+						{ "px": [128,384], "src": [0,0], "f": 0, "t": 0, "d": [63,242], "a": 1 },
+						{ "px": [192,384], "src": [192,0], "f": 0, "t": 3, "d": [63,243], "a": 1 },
+						{ "px": [256,384], "src": [0,0], "f": 0, "t": 0, "d": [63,244], "a": 1 },
+						{ "px": [320,384], "src": [192,0], "f": 0, "t": 3, "d": [63,245], "a": 1 },
+						{ "px": [384,384], "src": [64,0], "f": 0, "t": 1, "d": [63,246], "a": 1 },
+						{ "px": [576,384], "src": [64,0], "f": 0, "t": 1, "d": [63,249], "a": 1 },
+						{ "px": [640,384], "src": [128,0], "f": 0, "t": 2, "d": [63,250], "a": 1 },
+						{ "px": [704,384], "src": [192,0], "f": 0, "t": 3, "d": [63,251], "a": 1 },
+						{ "px": [768,384], "src": [64,0], "f": 0, "t": 1, "d": [63,252], "a": 1 },
+						{ "px": [832,384], "src": [192,0], "f": 0, "t": 3, "d": [63,253], "a": 1 },
+						{ "px": [896,384], "src": [0,0], "f": 0, "t": 0, "d": [63,254], "a": 1 },
+						{ "px": [960,384], "src": [64,0], "f": 0, "t": 1, "d": [63,255], "a": 1 },
+						{ "px": [1024,384], "src": [128,0], "f": 0, "t": 2, "d": [63,256], "a": 1 },
+						{ "px": [1408,384], "src": [192,0], "f": 0, "t": 3, "d": [63,262], "a": 1 },
+						{ "px": [1472,384], "src": [64,0], "f": 0, "t": 1, "d": [63,263], "a": 1 },
+						{ "px": [1536,384], "src": [128,0], "f": 0, "t": 2, "d": [63,264], "a": 1 },
+						{ "px": [1600,384], "src": [64,0], "f": 0, "t": 1, "d": [63,265], "a": 1 },
+						{ "px": [1664,384], "src": [128,0], "f": 0, "t": 2, "d": [63,266], "a": 1 },
+						{ "px": [1728,384], "src": [64,0], "f": 0, "t": 1, "d": [63,267], "a": 1 },
+						{ "px": [1792,384], "src": [0,0], "f": 0, "t": 0, "d": [63,268], "a": 1 },
+						{ "px": [1856,384], "src": [192,0], "f": 0, "t": 3, "d": [63,269], "a": 1 },
+						{ "px": [1920,384], "src": [0,0], "f": 0, "t": 0, "d": [63,270], "a": 1 },
+						{ "px": [1984,384], "src": [192,0], "f": 0, "t": 3, "d": [63,271], "a": 1 },
+						{ "px": [2048,384], "src": [0,0], "f": 0, "t": 0, "d": [63,272], "a": 1 },
+						{ "px": [2112,384], "src": [192,0], "f": 0, "t": 3, "d": [63,273], "a": 1 },
+						{ "px": [2176,384], "src": [192,0], "f": 0, "t": 3, "d": [63,274], "a": 1 },
+						{ "px": [2240,384], "src": [0,0], "f": 0, "t": 0, "d": [63,275], "a": 1 },
+						{ "px": [2304,384], "src": [64,0], "f": 0, "t": 1, "d": [63,276], "a": 1 },
+						{ "px": [2368,384], "src": [0,0], "f": 0, "t": 0, "d": [63,277], "a": 1 },
+						{ "px": [2432,384], "src": [0,0], "f": 0, "t": 0, "d": [63,278], "a": 1 },
+						{ "px": [64,448], "src": [192,0], "f": 0, "t": 3, "d": [63,281], "a": 1 },
+						{ "px": [128,448], "src": [0,0], "f": 0, "t": 0, "d": [63,282], "a": 1 },
+						{ "px": [192,448], "src": [0,0], "f": 0, "t": 0, "d": [63,283], "a": 1 },
+						{ "px": [256,448], "src": [192,0], "f": 0, "t": 3, "d": [63,284], "a": 1 },
+						{ "px": [320,448], "src": [0,0], "f": 0, "t": 0, "d": [63,285], "a": 1 },
+						{ "px": [384,448], "src": [64,0], "f": 0, "t": 1, "d": [63,286], "a": 1 },
+						{ "px": [448,448], "src": [192,0], "f": 0, "t": 3, "d": [63,287], "a": 1 },
+						{ "px": [512,448], "src": [192,0], "f": 0, "t": 3, "d": [63,288], "a": 1 },
+						{ "px": [576,448], "src": [128,0], "f": 0, "t": 2, "d": [63,289], "a": 1 },
+						{ "px": [640,448], "src": [128,0], "f": 0, "t": 2, "d": [63,290], "a": 1 },
+						{ "px": [704,448], "src": [64,0], "f": 0, "t": 1, "d": [63,291], "a": 1 },
+						{ "px": [768,448], "src": [192,0], "f": 0, "t": 3, "d": [63,292], "a": 1 },
+						{ "px": [832,448], "src": [128,0], "f": 0, "t": 2, "d": [63,293], "a": 1 },
+						{ "px": [896,448], "src": [64,0], "f": 0, "t": 1, "d": [63,294], "a": 1 },
+						{ "px": [960,448], "src": [192,0], "f": 0, "t": 3, "d": [63,295], "a": 1 },
+						{ "px": [1024,448], "src": [0,0], "f": 0, "t": 0, "d": [63,296], "a": 1 },
+						{ "px": [1408,448], "src": [64,0], "f": 0, "t": 1, "d": [63,302], "a": 1 },
+						{ "px": [1472,448], "src": [128,0], "f": 0, "t": 2, "d": [63,303], "a": 1 },
+						{ "px": [1536,448], "src": [192,0], "f": 0, "t": 3, "d": [63,304], "a": 1 },
+						{ "px": [1600,448], "src": [0,0], "f": 0, "t": 0, "d": [63,305], "a": 1 },
+						{ "px": [1664,448], "src": [192,0], "f": 0, "t": 3, "d": [63,306], "a": 1 },
+						{ "px": [1728,448], "src": [192,0], "f": 0, "t": 3, "d": [63,307], "a": 1 },
+						{ "px": [1792,448], "src": [192,0], "f": 0, "t": 3, "d": [63,308], "a": 1 },
+						{ "px": [1856,448], "src": [192,0], "f": 0, "t": 3, "d": [63,309], "a": 1 },
+						{ "px": [1920,448], "src": [128,0], "f": 0, "t": 2, "d": [63,310], "a": 1 },
+						{ "px": [1984,448], "src": [64,0], "f": 0, "t": 1, "d": [63,311], "a": 1 },
+						{ "px": [2048,448], "src": [128,0], "f": 0, "t": 2, "d": [63,312], "a": 1 },
+						{ "px": [2112,448], "src": [0,0], "f": 0, "t": 0, "d": [63,313], "a": 1 },
+						{ "px": [2176,448], "src": [128,0], "f": 0, "t": 2, "d": [63,314], "a": 1 },
+						{ "px": [2240,448], "src": [128,0], "f": 0, "t": 2, "d": [63,315], "a": 1 },
+						{ "px": [2304,448], "src": [192,0], "f": 0, "t": 3, "d": [63,316], "a": 1 },
+						{ "px": [2368,448], "src": [64,0], "f": 0, "t": 1, "d": [63,317], "a": 1 },
+						{ "px": [2432,448], "src": [192,0], "f": 0, "t": 3, "d": [63,318], "a": 1 },
+						{ "px": [64,512], "src": [192,0], "f": 0, "t": 3, "d": [63,321], "a": 1 },
+						{ "px": [128,512], "src": [64,0], "f": 0, "t": 1, "d": [63,322], "a": 1 },
+						{ "px": [192,512], "src": [128,0], "f": 0, "t": 2, "d": [63,323], "a": 1 },
+						{ "px": [256,512], "src": [128,0], "f": 0, "t": 2, "d": [63,324], "a": 1 },
+						{ "px": [320,512], "src": [0,0], "f": 0, "t": 0, "d": [63,325], "a": 1 },
+						{ "px": [384,512], "src": [192,0], "f": 0, "t": 3, "d": [63,326], "a": 1 },
+						{ "px": [448,512], "src": [0,0], "f": 0, "t": 0, "d": [63,327], "a": 1 },
+						{ "px": [512,512], "src": [192,0], "f": 0, "t": 3, "d": [63,328], "a": 1 },
+						{ "px": [576,512], "src": [128,0], "f": 0, "t": 2, "d": [63,329], "a": 1 },
+						{ "px": [640,512], "src": [0,0], "f": 0, "t": 0, "d": [63,330], "a": 1 },
+						{ "px": [704,512], "src": [0,0], "f": 0, "t": 0, "d": [63,331], "a": 1 },
+						{ "px": [768,512], "src": [64,0], "f": 0, "t": 1, "d": [63,332], "a": 1 },
+						{ "px": [832,512], "src": [64,0], "f": 0, "t": 1, "d": [63,333], "a": 1 },
+						{ "px": [896,512], "src": [192,0], "f": 0, "t": 3, "d": [63,334], "a": 1 },
+						{ "px": [960,512], "src": [128,0], "f": 0, "t": 2, "d": [63,335], "a": 1 },
+						{ "px": [1024,512], "src": [64,0], "f": 0, "t": 1, "d": [63,336], "a": 1 },
+						{ "px": [1088,512], "src": [128,0], "f": 0, "t": 2, "d": [63,337], "a": 1 },
+						{ "px": [1152,512], "src": [0,0], "f": 0, "t": 0, "d": [63,338], "a": 1 },
+						{ "px": [1216,512], "src": [0,0], "f": 0, "t": 0, "d": [63,339], "a": 1 },
+						{ "px": [1280,512], "src": [0,0], "f": 0, "t": 0, "d": [63,340], "a": 1 },
+						{ "px": [1344,512], "src": [64,0], "f": 0, "t": 1, "d": [63,341], "a": 1 },
+						{ "px": [1408,512], "src": [128,0], "f": 0, "t": 2, "d": [63,342], "a": 1 },
+						{ "px": [1472,512], "src": [192,0], "f": 0, "t": 3, "d": [63,343], "a": 1 },
+						{ "px": [1536,512], "src": [192,0], "f": 0, "t": 3, "d": [63,344], "a": 1 },
+						{ "px": [1600,512], "src": [0,0], "f": 0, "t": 0, "d": [63,345], "a": 1 },
+						{ "px": [1664,512], "src": [0,0], "f": 0, "t": 0, "d": [63,346], "a": 1 },
+						{ "px": [1792,512], "src": [64,0], "f": 0, "t": 1, "d": [63,348], "a": 1 },
+						{ "px": [1856,512], "src": [128,0], "f": 0, "t": 2, "d": [63,349], "a": 1 },
+						{ "px": [1920,512], "src": [0,0], "f": 0, "t": 0, "d": [63,350], "a": 1 },
+						{ "px": [1984,512], "src": [0,0], "f": 0, "t": 0, "d": [63,351], "a": 1 },
+						{ "px": [2048,512], "src": [64,0], "f": 0, "t": 1, "d": [63,352], "a": 1 },
+						{ "px": [2112,512], "src": [192,0], "f": 0, "t": 3, "d": [63,353], "a": 1 },
+						{ "px": [2176,512], "src": [0,0], "f": 0, "t": 0, "d": [63,354], "a": 1 },
+						{ "px": [2240,512], "src": [64,0], "f": 0, "t": 1, "d": [63,355], "a": 1 },
+						{ "px": [2304,512], "src": [128,0], "f": 0, "t": 2, "d": [63,356], "a": 1 },
+						{ "px": [2368,512], "src": [64,0], "f": 0, "t": 1, "d": [63,357], "a": 1 },
+						{ "px": [2432,512], "src": [64,0], "f": 0, "t": 1, "d": [63,358], "a": 1 },
+						{ "px": [64,576], "src": [64,0], "f": 0, "t": 1, "d": [63,361], "a": 1 },
+						{ "px": [128,576], "src": [0,0], "f": 0, "t": 0, "d": [63,362], "a": 1 },
+						{ "px": [192,576], "src": [192,0], "f": 0, "t": 3, "d": [63,363], "a": 1 },
+						{ "px": [256,576], "src": [0,0], "f": 0, "t": 0, "d": [63,364], "a": 1 },
+						{ "px": [320,576], "src": [128,0], "f": 0, "t": 2, "d": [63,365], "a": 1 },
+						{ "px": [384,576], "src": [0,0], "f": 0, "t": 0, "d": [63,366], "a": 1 },
+						{ "px": [448,576], "src": [192,0], "f": 0, "t": 3, "d": [63,367], "a": 1 },
+						{ "px": [512,576], "src": [128,0], "f": 0, "t": 2, "d": [63,368], "a": 1 },
+						{ "px": [576,576], "src": [192,0], "f": 0, "t": 3, "d": [63,369], "a": 1 },
+						{ "px": [640,576], "src": [64,0], "f": 0, "t": 1, "d": [63,370], "a": 1 },
+						{ "px": [704,576], "src": [0,0], "f": 0, "t": 0, "d": [63,371], "a": 1 },
+						{ "px": [768,576], "src": [0,0], "f": 0, "t": 0, "d": [63,372], "a": 1 },
+						{ "px": [832,576], "src": [128,0], "f": 0, "t": 2, "d": [63,373], "a": 1 },
+						{ "px": [896,576], "src": [0,0], "f": 0, "t": 0, "d": [63,374], "a": 1 },
+						{ "px": [960,576], "src": [192,0], "f": 0, "t": 3, "d": [63,375], "a": 1 },
+						{ "px": [1024,576], "src": [64,0], "f": 0, "t": 1, "d": [63,376], "a": 1 },
+						{ "px": [1088,576], "src": [192,0], "f": 0, "t": 3, "d": [63,377], "a": 1 },
+						{ "px": [1152,576], "src": [192,0], "f": 0, "t": 3, "d": [63,378], "a": 1 },
+						{ "px": [1216,576], "src": [0,0], "f": 0, "t": 0, "d": [63,379], "a": 1 },
+						{ "px": [1280,576], "src": [0,0], "f": 0, "t": 0, "d": [63,380], "a": 1 },
+						{ "px": [1344,576], "src": [0,0], "f": 0, "t": 0, "d": [63,381], "a": 1 },
+						{ "px": [1408,576], "src": [128,0], "f": 0, "t": 2, "d": [63,382], "a": 1 },
+						{ "px": [1472,576], "src": [128,0], "f": 0, "t": 2, "d": [63,383], "a": 1 },
+						{ "px": [1536,576], "src": [0,0], "f": 0, "t": 0, "d": [63,384], "a": 1 },
+						{ "px": [1600,576], "src": [0,0], "f": 0, "t": 0, "d": [63,385], "a": 1 },
+						{ "px": [1664,576], "src": [192,0], "f": 0, "t": 3, "d": [63,386], "a": 1 },
+						{ "px": [1728,576], "src": [64,0], "f": 0, "t": 1, "d": [63,387], "a": 1 },
+						{ "px": [1792,576], "src": [0,0], "f": 0, "t": 0, "d": [63,388], "a": 1 },
+						{ "px": [1856,576], "src": [64,0], "f": 0, "t": 1, "d": [63,389], "a": 1 },
+						{ "px": [1920,576], "src": [128,0], "f": 0, "t": 2, "d": [63,390], "a": 1 },
+						{ "px": [2048,576], "src": [0,0], "f": 0, "t": 0, "d": [63,392], "a": 1 },
+						{ "px": [2112,576], "src": [128,0], "f": 0, "t": 2, "d": [63,393], "a": 1 },
+						{ "px": [2176,576], "src": [64,0], "f": 0, "t": 1, "d": [63,394], "a": 1 },
+						{ "px": [2240,576], "src": [0,0], "f": 0, "t": 0, "d": [63,395], "a": 1 },
+						{ "px": [2304,576], "src": [128,0], "f": 0, "t": 2, "d": [63,396], "a": 1 },
+						{ "px": [2368,576], "src": [192,0], "f": 0, "t": 3, "d": [63,397], "a": 1 },
+						{ "px": [2432,576], "src": [0,0], "f": 0, "t": 0, "d": [63,398], "a": 1 },
+						{ "px": [64,640], "src": [64,0], "f": 0, "t": 1, "d": [63,401], "a": 1 },
+						{ "px": [128,640], "src": [64,0], "f": 0, "t": 1, "d": [63,402], "a": 1 },
+						{ "px": [192,640], "src": [0,0], "f": 0, "t": 0, "d": [63,403], "a": 1 },
+						{ "px": [256,640], "src": [0,0], "f": 0, "t": 0, "d": [63,404], "a": 1 },
+						{ "px": [320,640], "src": [64,0], "f": 0, "t": 1, "d": [63,405], "a": 1 },
+						{ "px": [384,640], "src": [192,0], "f": 0, "t": 3, "d": [63,406], "a": 1 },
+						{ "px": [448,640], "src": [128,0], "f": 0, "t": 2, "d": [63,407], "a": 1 },
+						{ "px": [512,640], "src": [64,0], "f": 0, "t": 1, "d": [63,408], "a": 1 },
+						{ "px": [576,640], "src": [192,0], "f": 0, "t": 3, "d": [63,409], "a": 1 },
+						{ "px": [640,640], "src": [64,0], "f": 0, "t": 1, "d": [63,410], "a": 1 },
+						{ "px": [704,640], "src": [128,0], "f": 0, "t": 2, "d": [63,411], "a": 1 },
+						{ "px": [768,640], "src": [64,0], "f": 0, "t": 1, "d": [63,412], "a": 1 },
+						{ "px": [832,640], "src": [0,0], "f": 0, "t": 0, "d": [63,413], "a": 1 },
+						{ "px": [896,640], "src": [0,0], "f": 0, "t": 0, "d": [63,414], "a": 1 },
+						{ "px": [960,640], "src": [192,0], "f": 0, "t": 3, "d": [63,415], "a": 1 },
+						{ "px": [1024,640], "src": [0,0], "f": 0, "t": 0, "d": [63,416], "a": 1 },
+						{ "px": [1088,640], "src": [0,0], "f": 0, "t": 0, "d": [63,417], "a": 1 },
+						{ "px": [1152,640], "src": [128,0], "f": 0, "t": 2, "d": [63,418], "a": 1 },
+						{ "px": [1216,640], "src": [0,0], "f": 0, "t": 0, "d": [63,419], "a": 1 },
+						{ "px": [1280,640], "src": [192,0], "f": 0, "t": 3, "d": [63,420], "a": 1 },
+						{ "px": [1344,640], "src": [64,0], "f": 0, "t": 1, "d": [63,421], "a": 1 },
+						{ "px": [1408,640], "src": [0,0], "f": 0, "t": 0, "d": [63,422], "a": 1 },
+						{ "px": [1472,640], "src": [128,0], "f": 0, "t": 2, "d": [63,423], "a": 1 },
+						{ "px": [1536,640], "src": [64,0], "f": 0, "t": 1, "d": [63,424], "a": 1 },
+						{ "px": [1600,640], "src": [64,0], "f": 0, "t": 1, "d": [63,425], "a": 1 },
+						{ "px": [1664,640], "src": [0,0], "f": 0, "t": 0, "d": [63,426], "a": 1 },
+						{ "px": [1728,640], "src": [128,0], "f": 0, "t": 2, "d": [63,427], "a": 1 },
+						{ "px": [1792,640], "src": [0,0], "f": 0, "t": 0, "d": [63,428], "a": 1 },
+						{ "px": [1856,640], "src": [192,0], "f": 0, "t": 3, "d": [63,429], "a": 1 },
+						{ "px": [1920,640], "src": [128,0], "f": 0, "t": 2, "d": [63,430], "a": 1 },
+						{ "px": [1984,640], "src": [0,0], "f": 0, "t": 0, "d": [63,431], "a": 1 },
+						{ "px": [2048,640], "src": [192,0], "f": 0, "t": 3, "d": [63,432], "a": 1 },
+						{ "px": [2112,640], "src": [192,0], "f": 0, "t": 3, "d": [63,433], "a": 1 },
+						{ "px": [2176,640], "src": [192,0], "f": 0, "t": 3, "d": [63,434], "a": 1 },
+						{ "px": [2240,640], "src": [128,0], "f": 0, "t": 2, "d": [63,435], "a": 1 },
+						{ "px": [2304,640], "src": [64,0], "f": 0, "t": 1, "d": [63,436], "a": 1 },
+						{ "px": [2368,640], "src": [0,0], "f": 0, "t": 0, "d": [63,437], "a": 1 },
+						{ "px": [2432,640], "src": [0,0], "f": 0, "t": 0, "d": [63,438], "a": 1 },
+						{ "px": [64,704], "src": [0,0], "f": 0, "t": 0, "d": [63,441], "a": 1 },
+						{ "px": [128,704], "src": [64,0], "f": 0, "t": 1, "d": [63,442], "a": 1 },
+						{ "px": [192,704], "src": [128,0], "f": 0, "t": 2, "d": [63,443], "a": 1 },
+						{ "px": [256,704], "src": [0,0], "f": 0, "t": 0, "d": [63,444], "a": 1 },
+						{ "px": [320,704], "src": [64,0], "f": 0, "t": 1, "d": [63,445], "a": 1 },
+						{ "px": [384,704], "src": [0,0], "f": 0, "t": 0, "d": [63,446], "a": 1 },
+						{ "px": [448,704], "src": [192,0], "f": 0, "t": 3, "d": [63,447], "a": 1 },
+						{ "px": [576,704], "src": [64,0], "f": 0, "t": 1, "d": [63,449], "a": 1 },
+						{ "px": [640,704], "src": [0,0], "f": 0, "t": 0, "d": [63,450], "a": 1 },
+						{ "px": [704,704], "src": [192,0], "f": 0, "t": 3, "d": [63,451], "a": 1 },
+						{ "px": [768,704], "src": [128,0], "f": 0, "t": 2, "d": [63,452], "a": 1 },
+						{ "px": [832,704], "src": [64,0], "f": 0, "t": 1, "d": [63,453], "a": 1 },
+						{ "px": [896,704], "src": [128,0], "f": 0, "t": 2, "d": [63,454], "a": 1 },
+						{ "px": [960,704], "src": [64,0], "f": 0, "t": 1, "d": [63,455], "a": 1 },
+						{ "px": [1024,704], "src": [192,0], "f": 0, "t": 3, "d": [63,456], "a": 1 },
+						{ "px": [1088,704], "src": [128,0], "f": 0, "t": 2, "d": [63,457], "a": 1 },
+						{ "px": [1152,704], "src": [64,0], "f": 0, "t": 1, "d": [63,458], "a": 1 },
+						{ "px": [1216,704], "src": [64,0], "f": 0, "t": 1, "d": [63,459], "a": 1 },
+						{ "px": [1280,704], "src": [0,0], "f": 0, "t": 0, "d": [63,460], "a": 1 },
+						{ "px": [1344,704], "src": [192,0], "f": 0, "t": 3, "d": [63,461], "a": 1 },
+						{ "px": [1408,704], "src": [192,0], "f": 0, "t": 3, "d": [63,462], "a": 1 },
+						{ "px": [1472,704], "src": [192,0], "f": 0, "t": 3, "d": [63,463], "a": 1 },
+						{ "px": [1536,704], "src": [0,0], "f": 0, "t": 0, "d": [63,464], "a": 1 },
+						{ "px": [1600,704], "src": [192,0], "f": 0, "t": 3, "d": [63,465], "a": 1 },
+						{ "px": [1664,704], "src": [64,0], "f": 0, "t": 1, "d": [63,466], "a": 1 },
+						{ "px": [1728,704], "src": [192,0], "f": 0, "t": 3, "d": [63,467], "a": 1 },
+						{ "px": [1792,704], "src": [128,0], "f": 0, "t": 2, "d": [63,468], "a": 1 },
+						{ "px": [1856,704], "src": [128,0], "f": 0, "t": 2, "d": [63,469], "a": 1 },
+						{ "px": [1920,704], "src": [0,0], "f": 0, "t": 0, "d": [63,470], "a": 1 },
+						{ "px": [1984,704], "src": [64,0], "f": 0, "t": 1, "d": [63,471], "a": 1 },
+						{ "px": [2048,704], "src": [192,0], "f": 0, "t": 3, "d": [63,472], "a": 1 },
+						{ "px": [2112,704], "src": [192,0], "f": 0, "t": 3, "d": [63,473], "a": 1 },
+						{ "px": [2176,704], "src": [64,0], "f": 0, "t": 1, "d": [63,474], "a": 1 },
+						{ "px": [2240,704], "src": [192,0], "f": 0, "t": 3, "d": [63,475], "a": 1 },
+						{ "px": [2304,704], "src": [64,0], "f": 0, "t": 1, "d": [63,476], "a": 1 },
+						{ "px": [2368,704], "src": [128,0], "f": 0, "t": 2, "d": [63,477], "a": 1 },
+						{ "px": [2432,704], "src": [64,0], "f": 0, "t": 1, "d": [63,478], "a": 1 },
+						{ "px": [64,768], "src": [0,0], "f": 0, "t": 0, "d": [63,481], "a": 1 },
+						{ "px": [128,768], "src": [0,0], "f": 0, "t": 0, "d": [63,482], "a": 1 },
+						{ "px": [192,768], "src": [64,0], "f": 0, "t": 1, "d": [63,483], "a": 1 },
+						{ "px": [256,768], "src": [0,0], "f": 0, "t": 0, "d": [63,484], "a": 1 },
+						{ "px": [320,768], "src": [192,0], "f": 0, "t": 3, "d": [63,485], "a": 1 },
+						{ "px": [384,768], "src": [128,0], "f": 0, "t": 2, "d": [63,486], "a": 1 },
+						{ "px": [448,768], "src": [128,0], "f": 0, "t": 2, "d": [63,487], "a": 1 },
+						{ "px": [512,768], "src": [64,0], "f": 0, "t": 1, "d": [63,488], "a": 1 },
+						{ "px": [576,768], "src": [0,0], "f": 0, "t": 0, "d": [63,489], "a": 1 },
+						{ "px": [640,768], "src": [128,0], "f": 0, "t": 2, "d": [63,490], "a": 1 },
+						{ "px": [704,768], "src": [0,0], "f": 0, "t": 0, "d": [63,491], "a": 1 },
+						{ "px": [768,768], "src": [192,0], "f": 0, "t": 3, "d": [63,492], "a": 1 },
+						{ "px": [832,768], "src": [64,0], "f": 0, "t": 1, "d": [63,493], "a": 1 },
+						{ "px": [896,768], "src": [64,0], "f": 0, "t": 1, "d": [63,494], "a": 1 },
+						{ "px": [960,768], "src": [128,0], "f": 0, "t": 2, "d": [63,495], "a": 1 },
+						{ "px": [1024,768], "src": [0,0], "f": 0, "t": 0, "d": [63,496], "a": 1 },
+						{ "px": [1088,768], "src": [128,0], "f": 0, "t": 2, "d": [63,497], "a": 1 },
+						{ "px": [1152,768], "src": [128,0], "f": 0, "t": 2, "d": [63,498], "a": 1 },
+						{ "px": [1216,768], "src": [192,0], "f": 0, "t": 3, "d": [63,499], "a": 1 },
+						{ "px": [1280,768], "src": [0,0], "f": 0, "t": 0, "d": [63,500], "a": 1 },
+						{ "px": [1344,768], "src": [128,0], "f": 0, "t": 2, "d": [63,501], "a": 1 },
+						{ "px": [1472,768], "src": [192,0], "f": 0, "t": 3, "d": [63,503], "a": 1 },
+						{ "px": [1536,768], "src": [192,0], "f": 0, "t": 3, "d": [63,504], "a": 1 },
+						{ "px": [1728,768], "src": [0,0], "f": 0, "t": 0, "d": [63,507], "a": 1 },
+						{ "px": [1792,768], "src": [0,0], "f": 0, "t": 0, "d": [63,508], "a": 1 },
+						{ "px": [1856,768], "src": [64,0], "f": 0, "t": 1, "d": [63,509], "a": 1 },
+						{ "px": [1920,768], "src": [0,0], "f": 0, "t": 0, "d": [63,510], "a": 1 },
+						{ "px": [1984,768], "src": [0,0], "f": 0, "t": 0, "d": [63,511], "a": 1 },
+						{ "px": [2048,768], "src": [0,0], "f": 0, "t": 0, "d": [63,512], "a": 1 },
+						{ "px": [2112,768], "src": [128,0], "f": 0, "t": 2, "d": [63,513], "a": 1 },
+						{ "px": [2176,768], "src": [192,0], "f": 0, "t": 3, "d": [63,514], "a": 1 },
+						{ "px": [2240,768], "src": [64,0], "f": 0, "t": 1, "d": [63,515], "a": 1 },
+						{ "px": [2304,768], "src": [0,0], "f": 0, "t": 0, "d": [63,516], "a": 1 },
+						{ "px": [2368,768], "src": [192,0], "f": 0, "t": 3, "d": [63,517], "a": 1 },
+						{ "px": [2432,768], "src": [0,0], "f": 0, "t": 0, "d": [63,518], "a": 1 },
+						{ "px": [64,832], "src": [64,0], "f": 0, "t": 1, "d": [63,521], "a": 1 },
+						{ "px": [128,832], "src": [128,0], "f": 0, "t": 2, "d": [63,522], "a": 1 },
+						{ "px": [192,832], "src": [0,0], "f": 0, "t": 0, "d": [63,523], "a": 1 },
+						{ "px": [256,832], "src": [128,0], "f": 0, "t": 2, "d": [63,524], "a": 1 },
+						{ "px": [320,832], "src": [0,0], "f": 0, "t": 0, "d": [63,525], "a": 1 },
+						{ "px": [384,832], "src": [192,0], "f": 0, "t": 3, "d": [63,526], "a": 1 },
+						{ "px": [448,832], "src": [0,0], "f": 0, "t": 0, "d": [63,527], "a": 1 },
+						{ "px": [512,832], "src": [0,0], "f": 0, "t": 0, "d": [63,528], "a": 1 },
+						{ "px": [576,832], "src": [192,0], "f": 0, "t": 3, "d": [63,529], "a": 1 },
+						{ "px": [640,832], "src": [192,0], "f": 0, "t": 3, "d": [63,530], "a": 1 },
+						{ "px": [704,832], "src": [192,0], "f": 0, "t": 3, "d": [63,531], "a": 1 },
+						{ "px": [768,832], "src": [0,0], "f": 0, "t": 0, "d": [63,532], "a": 1 },
+						{ "px": [832,832], "src": [192,0], "f": 0, "t": 3, "d": [63,533], "a": 1 },
+						{ "px": [896,832], "src": [0,0], "f": 0, "t": 0, "d": [63,534], "a": 1 },
+						{ "px": [960,832], "src": [192,0], "f": 0, "t": 3, "d": [63,535], "a": 1 },
+						{ "px": [1024,832], "src": [128,0], "f": 0, "t": 2, "d": [63,536], "a": 1 },
+						{ "px": [1088,832], "src": [0,0], "f": 0, "t": 0, "d": [63,537], "a": 1 },
+						{ "px": [1152,832], "src": [128,0], "f": 0, "t": 2, "d": [63,538], "a": 1 },
+						{ "px": [1216,832], "src": [64,0], "f": 0, "t": 1, "d": [63,539], "a": 1 },
+						{ "px": [1280,832], "src": [0,0], "f": 0, "t": 0, "d": [63,540], "a": 1 },
+						{ "px": [1344,832], "src": [64,0], "f": 0, "t": 1, "d": [63,541], "a": 1 },
+						{ "px": [1408,832], "src": [64,0], "f": 0, "t": 1, "d": [63,542], "a": 1 },
+						{ "px": [1472,832], "src": [128,0], "f": 0, "t": 2, "d": [63,543], "a": 1 },
+						{ "px": [1536,832], "src": [64,0], "f": 0, "t": 1, "d": [63,544], "a": 1 },
+						{ "px": [1600,832], "src": [192,0], "f": 0, "t": 3, "d": [63,545], "a": 1 },
+						{ "px": [1664,832], "src": [64,0], "f": 0, "t": 1, "d": [63,546], "a": 1 },
+						{ "px": [1728,832], "src": [0,0], "f": 0, "t": 0, "d": [63,547], "a": 1 },
+						{ "px": [1792,832], "src": [64,0], "f": 0, "t": 1, "d": [63,548], "a": 1 },
+						{ "px": [1856,832], "src": [192,0], "f": 0, "t": 3, "d": [63,549], "a": 1 },
+						{ "px": [1920,832], "src": [128,0], "f": 0, "t": 2, "d": [63,550], "a": 1 },
+						{ "px": [1984,832], "src": [0,0], "f": 0, "t": 0, "d": [63,551], "a": 1 },
+						{ "px": [2048,832], "src": [0,0], "f": 0, "t": 0, "d": [63,552], "a": 1 },
+						{ "px": [2112,832], "src": [192,0], "f": 0, "t": 3, "d": [63,553], "a": 1 },
+						{ "px": [2176,832], "src": [128,0], "f": 0, "t": 2, "d": [63,554], "a": 1 },
+						{ "px": [2240,832], "src": [128,0], "f": 0, "t": 2, "d": [63,555], "a": 1 },
+						{ "px": [2304,832], "src": [128,0], "f": 0, "t": 2, "d": [63,556], "a": 1 },
+						{ "px": [2368,832], "src": [64,0], "f": 0, "t": 1, "d": [63,557], "a": 1 },
+						{ "px": [2432,832], "src": [192,0], "f": 0, "t": 3, "d": [63,558], "a": 1 },
+						{ "px": [64,896], "src": [0,0], "f": 0, "t": 0, "d": [63,561], "a": 1 },
+						{ "px": [128,896], "src": [128,0], "f": 0, "t": 2, "d": [63,562], "a": 1 },
+						{ "px": [192,896], "src": [64,0], "f": 0, "t": 1, "d": [63,563], "a": 1 },
+						{ "px": [256,896], "src": [128,0], "f": 0, "t": 2, "d": [63,564], "a": 1 },
+						{ "px": [320,896], "src": [64,0], "f": 0, "t": 1, "d": [63,565], "a": 1 },
+						{ "px": [384,896], "src": [64,0], "f": 0, "t": 1, "d": [63,566], "a": 1 },
+						{ "px": [448,896], "src": [64,0], "f": 0, "t": 1, "d": [63,567], "a": 1 },
+						{ "px": [512,896], "src": [192,0], "f": 0, "t": 3, "d": [63,568], "a": 1 },
+						{ "px": [576,896], "src": [192,0], "f": 0, "t": 3, "d": [63,569], "a": 1 },
+						{ "px": [640,896], "src": [0,0], "f": 0, "t": 0, "d": [63,570], "a": 1 },
+						{ "px": [704,896], "src": [192,0], "f": 0, "t": 3, "d": [63,571], "a": 1 },
+						{ "px": [768,896], "src": [192,0], "f": 0, "t": 3, "d": [63,572], "a": 1 },
+						{ "px": [832,896], "src": [192,0], "f": 0, "t": 3, "d": [63,573], "a": 1 },
+						{ "px": [896,896], "src": [128,0], "f": 0, "t": 2, "d": [63,574], "a": 1 },
+						{ "px": [960,896], "src": [0,0], "f": 0, "t": 0, "d": [63,575], "a": 1 },
+						{ "px": [1024,896], "src": [128,0], "f": 0, "t": 2, "d": [63,576], "a": 1 },
+						{ "px": [1088,896], "src": [192,0], "f": 0, "t": 3, "d": [63,577], "a": 1 },
+						{ "px": [1152,896], "src": [0,0], "f": 0, "t": 0, "d": [63,578], "a": 1 },
+						{ "px": [1216,896], "src": [192,0], "f": 0, "t": 3, "d": [63,579], "a": 1 },
+						{ "px": [1280,896], "src": [192,0], "f": 0, "t": 3, "d": [63,580], "a": 1 },
+						{ "px": [1344,896], "src": [0,0], "f": 0, "t": 0, "d": [63,581], "a": 1 },
+						{ "px": [1408,896], "src": [128,0], "f": 0, "t": 2, "d": [63,582], "a": 1 },
+						{ "px": [1472,896], "src": [192,0], "f": 0, "t": 3, "d": [63,583], "a": 1 },
+						{ "px": [1536,896], "src": [192,0], "f": 0, "t": 3, "d": [63,584], "a": 1 },
+						{ "px": [1600,896], "src": [64,0], "f": 0, "t": 1, "d": [63,585], "a": 1 },
+						{ "px": [1664,896], "src": [128,0], "f": 0, "t": 2, "d": [63,586], "a": 1 },
+						{ "px": [1728,896], "src": [128,0], "f": 0, "t": 2, "d": [63,587], "a": 1 },
+						{ "px": [1792,896], "src": [192,0], "f": 0, "t": 3, "d": [63,588], "a": 1 },
+						{ "px": [1856,896], "src": [0,0], "f": 0, "t": 0, "d": [63,589], "a": 1 },
+						{ "px": [1920,896], "src": [192,0], "f": 0, "t": 3, "d": [63,590], "a": 1 },
+						{ "px": [1984,896], "src": [64,0], "f": 0, "t": 1, "d": [63,591], "a": 1 },
+						{ "px": [2048,896], "src": [64,0], "f": 0, "t": 1, "d": [63,592], "a": 1 },
+						{ "px": [2112,896], "src": [192,0], "f": 0, "t": 3, "d": [63,593], "a": 1 },
+						{ "px": [2176,896], "src": [0,0], "f": 0, "t": 0, "d": [63,594], "a": 1 },
+						{ "px": [2240,896], "src": [0,0], "f": 0, "t": 0, "d": [63,595], "a": 1 },
+						{ "px": [2304,896], "src": [192,0], "f": 0, "t": 3, "d": [63,596], "a": 1 },
+						{ "px": [2368,896], "src": [128,0], "f": 0, "t": 2, "d": [63,597], "a": 1 },
+						{ "px": [2432,896], "src": [64,0], "f": 0, "t": 1, "d": [63,598], "a": 1 },
+						{ "px": [64,960], "src": [192,0], "f": 0, "t": 3, "d": [63,601], "a": 1 },
+						{ "px": [128,960], "src": [0,0], "f": 0, "t": 0, "d": [63,602], "a": 1 },
+						{ "px": [192,960], "src": [0,0], "f": 0, "t": 0, "d": [63,603], "a": 1 },
+						{ "px": [256,960], "src": [64,0], "f": 0, "t": 1, "d": [63,604], "a": 1 },
+						{ "px": [320,960], "src": [192,0], "f": 0, "t": 3, "d": [63,605], "a": 1 },
+						{ "px": [384,960], "src": [0,0], "f": 0, "t": 0, "d": [63,606], "a": 1 },
+						{ "px": [448,960], "src": [0,0], "f": 0, "t": 0, "d": [63,607], "a": 1 },
+						{ "px": [512,960], "src": [128,0], "f": 0, "t": 2, "d": [63,608], "a": 1 },
+						{ "px": [576,960], "src": [128,0], "f": 0, "t": 2, "d": [63,609], "a": 1 },
+						{ "px": [640,960], "src": [192,0], "f": 0, "t": 3, "d": [63,610], "a": 1 },
+						{ "px": [704,960], "src": [192,0], "f": 0, "t": 3, "d": [63,611], "a": 1 },
+						{ "px": [768,960], "src": [0,0], "f": 0, "t": 0, "d": [63,612], "a": 1 },
+						{ "px": [832,960], "src": [0,0], "f": 0, "t": 0, "d": [63,613], "a": 1 },
+						{ "px": [896,960], "src": [192,0], "f": 0, "t": 3, "d": [63,614], "a": 1 },
+						{ "px": [960,960], "src": [0,0], "f": 0, "t": 0, "d": [63,615], "a": 1 },
+						{ "px": [1024,960], "src": [192,0], "f": 0, "t": 3, "d": [63,616], "a": 1 },
+						{ "px": [1088,960], "src": [64,0], "f": 0, "t": 1, "d": [63,617], "a": 1 },
+						{ "px": [1152,960], "src": [128,0], "f": 0, "t": 2, "d": [63,618], "a": 1 },
+						{ "px": [1216,960], "src": [64,0], "f": 0, "t": 1, "d": [63,619], "a": 1 },
+						{ "px": [1280,960], "src": [0,0], "f": 0, "t": 0, "d": [63,620], "a": 1 },
+						{ "px": [1344,960], "src": [64,0], "f": 0, "t": 1, "d": [63,621], "a": 1 },
+						{ "px": [1408,960], "src": [128,0], "f": 0, "t": 2, "d": [63,622], "a": 1 },
+						{ "px": [1472,960], "src": [192,0], "f": 0, "t": 3, "d": [63,623], "a": 1 },
+						{ "px": [1536,960], "src": [64,0], "f": 0, "t": 1, "d": [63,624], "a": 1 },
+						{ "px": [1600,960], "src": [64,0], "f": 0, "t": 1, "d": [63,625], "a": 1 },
+						{ "px": [1664,960], "src": [128,0], "f": 0, "t": 2, "d": [63,626], "a": 1 },
+						{ "px": [1728,960], "src": [128,0], "f": 0, "t": 2, "d": [63,627], "a": 1 },
+						{ "px": [1792,960], "src": [0,0], "f": 0, "t": 0, "d": [63,628], "a": 1 },
+						{ "px": [1856,960], "src": [192,0], "f": 0, "t": 3, "d": [63,629], "a": 1 },
+						{ "px": [1920,960], "src": [64,0], "f": 0, "t": 1, "d": [63,630], "a": 1 },
+						{ "px": [1984,960], "src": [0,0], "f": 0, "t": 0, "d": [63,631], "a": 1 },
+						{ "px": [2048,960], "src": [0,0], "f": 0, "t": 0, "d": [63,632], "a": 1 },
+						{ "px": [2112,960], "src": [64,0], "f": 0, "t": 1, "d": [63,633], "a": 1 },
+						{ "px": [2176,960], "src": [192,0], "f": 0, "t": 3, "d": [63,634], "a": 1 },
+						{ "px": [2240,960], "src": [0,0], "f": 0, "t": 0, "d": [63,635], "a": 1 },
+						{ "px": [2304,960], "src": [64,0], "f": 0, "t": 1, "d": [63,636], "a": 1 },
+						{ "px": [2368,960], "src": [128,0], "f": 0, "t": 2, "d": [63,637], "a": 1 },
+						{ "px": [2432,960], "src": [64,0], "f": 0, "t": 1, "d": [63,638], "a": 1 },
+						{ "px": [320,1024], "src": [128,0], "f": 0, "t": 2, "d": [63,645], "a": 1 },
+						{ "px": [384,1024], "src": [128,0], "f": 0, "t": 2, "d": [63,646], "a": 1 },
+						{ "px": [448,1024], "src": [64,0], "f": 0, "t": 1, "d": [63,647], "a": 1 },
+						{ "px": [512,1024], "src": [128,0], "f": 0, "t": 2, "d": [63,648], "a": 1 },
+						{ "px": [1984,1024], "src": [64,0], "f": 0, "t": 1, "d": [63,671], "a": 1 },
+						{ "px": [2048,1024], "src": [128,0], "f": 0, "t": 2, "d": [63,672], "a": 1 },
+						{ "px": [64,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,681], "a": 1 },
+						{ "px": [128,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,682], "a": 1 },
+						{ "px": [192,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,683], "a": 1 },
+						{ "px": [256,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,684], "a": 1 },
+						{ "px": [320,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,685], "a": 1 },
+						{ "px": [384,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,686], "a": 1 },
+						{ "px": [448,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,687], "a": 1 },
+						{ "px": [512,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,688], "a": 1 },
+						{ "px": [576,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,689], "a": 1 },
+						{ "px": [640,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,690], "a": 1 },
+						{ "px": [704,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,691], "a": 1 },
+						{ "px": [768,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,692], "a": 1 },
+						{ "px": [832,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,693], "a": 1 },
+						{ "px": [896,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,694], "a": 1 },
+						{ "px": [960,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,695], "a": 1 },
+						{ "px": [1024,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,696], "a": 1 },
+						{ "px": [1088,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,697], "a": 1 },
+						{ "px": [1152,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,698], "a": 1 },
+						{ "px": [1216,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,699], "a": 1 },
+						{ "px": [1280,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,700], "a": 1 },
+						{ "px": [1344,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,701], "a": 1 },
+						{ "px": [1408,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,702], "a": 1 },
+						{ "px": [1472,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,703], "a": 1 },
+						{ "px": [1536,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,704], "a": 1 },
+						{ "px": [1600,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,705], "a": 1 },
+						{ "px": [1664,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,706], "a": 1 },
+						{ "px": [1728,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,707], "a": 1 },
+						{ "px": [1792,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,708], "a": 1 },
+						{ "px": [1856,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,709], "a": 1 },
+						{ "px": [1920,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,710], "a": 1 },
+						{ "px": [1984,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,711], "a": 1 },
+						{ "px": [2048,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,712], "a": 1 },
+						{ "px": [2112,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,713], "a": 1 },
+						{ "px": [2176,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,714], "a": 1 },
+						{ "px": [2240,1088], "src": [640,0], "f": 0, "t": 10, "d": [67,715], "a": 1 },
+						{ "px": [128,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,722], "a": 1 },
+						{ "px": [192,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,723], "a": 1 },
+						{ "px": [256,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,724], "a": 1 },
+						{ "px": [320,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,725], "a": 1 },
+						{ "px": [384,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,726], "a": 1 },
+						{ "px": [448,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,727], "a": 1 },
+						{ "px": [512,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,728], "a": 1 },
+						{ "px": [576,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,729], "a": 1 },
+						{ "px": [640,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,730], "a": 1 },
+						{ "px": [704,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,731], "a": 1 },
+						{ "px": [768,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,732], "a": 1 },
+						{ "px": [832,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,733], "a": 1 },
+						{ "px": [896,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,734], "a": 1 },
+						{ "px": [960,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,735], "a": 1 },
+						{ "px": [1024,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,736], "a": 1 },
+						{ "px": [1088,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,737], "a": 1 },
+						{ "px": [1152,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,738], "a": 1 },
+						{ "px": [1216,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,739], "a": 1 },
+						{ "px": [1280,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,740], "a": 1 },
+						{ "px": [1344,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,741], "a": 1 },
+						{ "px": [1408,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,742], "a": 1 },
+						{ "px": [1472,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,743], "a": 1 },
+						{ "px": [1536,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,744], "a": 1 },
+						{ "px": [1600,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,745], "a": 1 },
+						{ "px": [1664,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,746], "a": 1 },
+						{ "px": [1728,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,747], "a": 1 },
+						{ "px": [1792,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,748], "a": 1 },
+						{ "px": [1856,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,749], "a": 1 },
+						{ "px": [1920,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,750], "a": 1 },
+						{ "px": [1984,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,751], "a": 1 },
+						{ "px": [2048,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,752], "a": 1 },
+						{ "px": [2112,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,753], "a": 1 },
+						{ "px": [2176,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,754], "a": 1 },
+						{ "px": [2240,1152], "src": [640,0], "f": 0, "t": 10, "d": [67,755], "a": 1 },
+						{ "px": [64,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,761], "a": 1 },
+						{ "px": [128,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,762], "a": 1 },
+						{ "px": [192,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,763], "a": 1 },
+						{ "px": [256,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,764], "a": 1 },
+						{ "px": [320,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,765], "a": 1 },
+						{ "px": [576,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,769], "a": 1 },
+						{ "px": [640,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,770], "a": 1 },
+						{ "px": [704,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,771], "a": 1 },
+						{ "px": [768,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,772], "a": 1 },
+						{ "px": [832,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,773], "a": 1 },
+						{ "px": [896,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,774], "a": 1 },
+						{ "px": [960,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,775], "a": 1 },
+						{ "px": [1024,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,776], "a": 1 },
+						{ "px": [1408,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,782], "a": 1 },
+						{ "px": [1472,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,783], "a": 1 },
+						{ "px": [1536,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,784], "a": 1 },
+						{ "px": [1600,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,785], "a": 1 },
+						{ "px": [1664,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,786], "a": 1 },
+						{ "px": [1728,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,787], "a": 1 },
+						{ "px": [1792,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,788], "a": 1 },
+						{ "px": [1856,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,789], "a": 1 },
+						{ "px": [1920,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,790], "a": 1 },
+						{ "px": [1984,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,791], "a": 1 },
+						{ "px": [2048,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,792], "a": 1 },
+						{ "px": [2112,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,793], "a": 1 },
+						{ "px": [2176,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,794], "a": 1 },
+						{ "px": [2240,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,795], "a": 1 },
+						{ "px": [2304,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,796], "a": 1 },
+						{ "px": [2368,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,797], "a": 1 },
+						{ "px": [2432,1216], "src": [640,0], "f": 0, "t": 10, "d": [67,798], "a": 1 },
+						{ "px": [64,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,801], "a": 1 },
+						{ "px": [128,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,802], "a": 1 },
+						{ "px": [192,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,803], "a": 1 },
+						{ "px": [576,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,809], "a": 1 },
+						{ "px": [640,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,810], "a": 1 },
+						{ "px": [704,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,811], "a": 1 },
+						{ "px": [768,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,812], "a": 1 },
+						{ "px": [832,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,813], "a": 1 },
+						{ "px": [896,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,814], "a": 1 },
+						{ "px": [960,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,815], "a": 1 },
+						{ "px": [1024,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,816], "a": 1 },
+						{ "px": [1408,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,822], "a": 1 },
+						{ "px": [1472,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,823], "a": 1 },
+						{ "px": [1536,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,824], "a": 1 },
+						{ "px": [1600,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,825], "a": 1 },
+						{ "px": [1664,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,826], "a": 1 },
+						{ "px": [1728,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,827], "a": 1 },
+						{ "px": [1792,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,828], "a": 1 },
+						{ "px": [1920,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,830], "a": 1 },
+						{ "px": [1984,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,831], "a": 1 },
+						{ "px": [2048,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,832], "a": 1 },
+						{ "px": [2112,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,833], "a": 1 },
+						{ "px": [2176,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,834], "a": 1 },
+						{ "px": [2240,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,835], "a": 1 },
+						{ "px": [2304,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,836], "a": 1 },
+						{ "px": [2368,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,837], "a": 1 },
+						{ "px": [2432,1280], "src": [640,0], "f": 0, "t": 10, "d": [67,838], "a": 1 },
+						{ "px": [64,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,841], "a": 1 },
+						{ "px": [128,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,842], "a": 1 },
+						{ "px": [192,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,843], "a": 1 },
+						{ "px": [448,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,847], "a": 1 },
+						{ "px": [576,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,849], "a": 1 },
+						{ "px": [640,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,850], "a": 1 },
+						{ "px": [704,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,851], "a": 1 },
+						{ "px": [768,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,852], "a": 1 },
+						{ "px": [832,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,853], "a": 1 },
+						{ "px": [896,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,854], "a": 1 },
+						{ "px": [960,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,855], "a": 1 },
+						{ "px": [1024,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,856], "a": 1 },
+						{ "px": [1408,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,862], "a": 1 },
+						{ "px": [1472,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,863], "a": 1 },
+						{ "px": [1536,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,864], "a": 1 },
+						{ "px": [1600,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,865], "a": 1 },
+						{ "px": [1664,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,866], "a": 1 },
+						{ "px": [1728,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,867], "a": 1 },
+						{ "px": [1792,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,868], "a": 1 },
+						{ "px": [1920,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,870], "a": 1 },
+						{ "px": [1984,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,871], "a": 1 },
+						{ "px": [2048,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,872], "a": 1 },
+						{ "px": [2112,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,873], "a": 1 },
+						{ "px": [2176,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,874], "a": 1 },
+						{ "px": [2240,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,875], "a": 1 },
+						{ "px": [2304,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,876], "a": 1 },
+						{ "px": [2368,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,877], "a": 1 },
+						{ "px": [2432,1344], "src": [640,0], "f": 0, "t": 10, "d": [67,878], "a": 1 },
+						{ "px": [448,1408], "src": [640,0], "f": 0, "t": 10, "d": [67,887], "a": 1 },
+						{ "px": [1088,1280], "src": [640,0], "f": 0, "t": 10, "d": [70,817], "a": 1 },
+						{ "px": [256,1344], "src": [640,0], "f": 0, "t": 10, "d": [70,844], "a": 1 },
+						{ "px": [1088,1344], "src": [640,0], "f": 0, "t": 10, "d": [70,857], "a": 1 },
+						{ "px": [1344,1280], "src": [640,0], "f": 0, "t": 10, "d": [71,821], "a": 1 },
+						{ "px": [1344,1344], "src": [640,0], "f": 0, "t": 10, "d": [71,861], "a": 1 },
+						{ "px": [1856,1344], "src": [640,0], "f": 0, "t": 10, "d": [71,869], "a": 1 },
+						{ "px": [384,1216], "src": [640,0], "f": 0, "t": 10, "d": [73,766], "a": 1 },
+						{ "px": [448,1216], "src": [640,0], "f": 0, "t": 10, "d": [73,767], "a": 1 },
+						{ "px": [512,1216], "src": [640,0], "f": 0, "t": 10, "d": [73,768], "a": 1 },
+						{ "px": [1088,1216], "src": [640,0], "f": 0, "t": 10, "d": [73,777], "a": 1 },
+						{ "px": [1344,1216], "src": [640,0], "f": 0, "t": 10, "d": [73,781], "a": 1 },
+						{ "px": [256,1280], "src": [640,0], "f": 0, "t": 10, "d": [73,804], "a": 1 },
+						{ "px": [320,1280], "src": [640,0], "f": 0, "t": 10, "d": [73,805], "a": 1 },
+						{ "px": [1856,1280], "src": [640,0], "f": 0, "t": 10, "d": [73,829], "a": 1 },
+						{ "px": [64,1152], "src": [640,0], "f": 0, "t": 10, "d": [74,721], "a": 1 },
+						{ "px": [192,128], "src": [192,0], "f": 0, "t": 3, "d": [75,83], "a": 1 },
+						{ "px": [960,128], "src": [0,0], "f": 0, "t": 0, "d": [75,95], "a": 1 },
+						{ "px": [448,384], "src": [64,0], "f": 0, "t": 1, "d": [75,247], "a": 1 },
+						{ "px": [512,384], "src": [0,0], "f": 0, "t": 0, "d": [75,248], "a": 1 },
+						{ "px": [1728,512], "src": [64,0], "f": 0, "t": 1, "d": [75,347], "a": 1 },
+						{ "px": [1408,768], "src": [192,0], "f": 0, "t": 3, "d": [75,502], "a": 1 }
+					],
+					"seed": 9289703,
+					"overrideTilesetUid": null,
+					"gridTiles": [],
+					"entityInstances": []
+				}
+			],
+			"__neighbours": []
+		}
+	],
+	"worlds": [],
+	"dummyWorldIid": "24522800-d380-11f0-9ae1-a31d61a14ed0"
+}
\ No newline at end of file
diff --git a/py/assets/pixel_platformer/backgrounds.png b/py/assets/pixel_platformer/backgrounds.png
new file mode 100644
index 0000000..821ddfc
Binary files /dev/null and b/py/assets/pixel_platformer/backgrounds.png differ
diff --git a/py/assets/pixel_platformer/characters.png b/py/assets/pixel_platformer/characters.png
new file mode 100644
index 0000000..ae1f329
Binary files /dev/null and b/py/assets/pixel_platformer/characters.png differ
diff --git a/py/assets/pixel_platformer/characters/blue_1.png b/py/assets/pixel_platformer/characters/blue_1.png
new file mode 100644
index 0000000..1acdd37
Binary files /dev/null and b/py/assets/pixel_platformer/characters/blue_1.png differ
diff --git a/py/assets/pixel_platformer/characters/blue_2.png b/py/assets/pixel_platformer/characters/blue_2.png
new file mode 100644
index 0000000..691f497
Binary files /dev/null and b/py/assets/pixel_platformer/characters/blue_2.png differ
diff --git a/py/assets/pixel_platformer/characters/green_1.png b/py/assets/pixel_platformer/characters/green_1.png
new file mode 100644
index 0000000..c6d7d7f
Binary files /dev/null and b/py/assets/pixel_platformer/characters/green_1.png differ
diff --git a/py/assets/pixel_platformer/characters/green_2.png b/py/assets/pixel_platformer/characters/green_2.png
new file mode 100644
index 0000000..a6c81e0
Binary files /dev/null and b/py/assets/pixel_platformer/characters/green_2.png differ
diff --git a/py/assets/pixel_platformer/characters/pink_1.png b/py/assets/pixel_platformer/characters/pink_1.png
new file mode 100644
index 0000000..99d7f63
Binary files /dev/null and b/py/assets/pixel_platformer/characters/pink_1.png differ
diff --git a/py/assets/pixel_platformer/characters/pink_2.png b/py/assets/pixel_platformer/characters/pink_2.png
new file mode 100644
index 0000000..5c95202
Binary files /dev/null and b/py/assets/pixel_platformer/characters/pink_2.png differ
diff --git a/py/assets/pixel_platformer/characters/yellow_1.png b/py/assets/pixel_platformer/characters/yellow_1.png
new file mode 100644
index 0000000..6b177a0
Binary files /dev/null and b/py/assets/pixel_platformer/characters/yellow_1.png differ
diff --git a/py/assets/pixel_platformer/characters/yellow_2.png b/py/assets/pixel_platformer/characters/yellow_2.png
new file mode 100644
index 0000000..607b9a8
Binary files /dev/null and b/py/assets/pixel_platformer/characters/yellow_2.png differ
diff --git a/py/assets/pixel_platformer/enemies/bat_1.png b/py/assets/pixel_platformer/enemies/bat_1.png
new file mode 100644
index 0000000..8c8e276
Binary files /dev/null and b/py/assets/pixel_platformer/enemies/bat_1.png differ
diff --git a/py/assets/pixel_platformer/enemies/bat_2.png b/py/assets/pixel_platformer/enemies/bat_2.png
new file mode 100644
index 0000000..d4ac52d
Binary files /dev/null and b/py/assets/pixel_platformer/enemies/bat_2.png differ
diff --git a/py/assets/pixel_platformer/enemies/bat_3.png b/py/assets/pixel_platformer/enemies/bat_3.png
new file mode 100644
index 0000000..7372c35
Binary files /dev/null and b/py/assets/pixel_platformer/enemies/bat_3.png differ
diff --git a/py/assets/pixel_platformer/enemies/block_head_1.png b/py/assets/pixel_platformer/enemies/block_head_1.png
new file mode 100644
index 0000000..33182eb
Binary files /dev/null and b/py/assets/pixel_platformer/enemies/block_head_1.png differ
diff --git a/py/assets/pixel_platformer/enemies/block_head_2.png b/py/assets/pixel_platformer/enemies/block_head_2.png
new file mode 100644
index 0000000..a57c0ce
Binary files /dev/null and b/py/assets/pixel_platformer/enemies/block_head_2.png differ
diff --git a/py/assets/pixel_platformer/enemies/drill_head_1.png b/py/assets/pixel_platformer/enemies/drill_head_1.png
new file mode 100644
index 0000000..81a5921
Binary files /dev/null and b/py/assets/pixel_platformer/enemies/drill_head_1.png differ
diff --git a/py/assets/pixel_platformer/enemies/drill_head_2.png b/py/assets/pixel_platformer/enemies/drill_head_2.png
new file mode 100644
index 0000000..37357d6
Binary files /dev/null and b/py/assets/pixel_platformer/enemies/drill_head_2.png differ
diff --git a/py/assets/pixel_platformer/items/coin_1.png b/py/assets/pixel_platformer/items/coin_1.png
new file mode 100644
index 0000000..25b9044
Binary files /dev/null and b/py/assets/pixel_platformer/items/coin_1.png differ
diff --git a/py/assets/pixel_platformer/items/coin_2.png b/py/assets/pixel_platformer/items/coin_2.png
new file mode 100644
index 0000000..d563c89
Binary files /dev/null and b/py/assets/pixel_platformer/items/coin_2.png differ
diff --git a/py/assets/pixel_platformer/tilemap.png b/py/assets/pixel_platformer/tilemap.png
new file mode 100644
index 0000000..901a785
Binary files /dev/null and b/py/assets/pixel_platformer/tilemap.png differ
diff --git a/py/assets/sounds/coin.wav b/py/assets/sounds/coin.wav
new file mode 100644
index 0000000..bd4835d
Binary files /dev/null and b/py/assets/sounds/coin.wav differ
diff --git a/py/assets/sounds/die.wav b/py/assets/sounds/die.wav
new file mode 100644
index 0000000..0ead6b5
Binary files /dev/null and b/py/assets/sounds/die.wav differ
diff --git a/py/assets/sounds/hit.wav b/py/assets/sounds/hit.wav
new file mode 100644
index 0000000..85531dd
Binary files /dev/null and b/py/assets/sounds/hit.wav differ
diff --git a/py/assets/sounds/jump.wav b/py/assets/sounds/jump.wav
new file mode 100644
index 0000000..25c80bf
Binary files /dev/null and b/py/assets/sounds/jump.wav differ
diff --git a/py/assets/sounds/shoot.wav b/py/assets/sounds/shoot.wav
new file mode 100644
index 0000000..d3a4b9c
Binary files /dev/null and b/py/assets/sounds/shoot.wav differ
diff --git a/py/assets/sunnyland/back.png b/py/assets/sunnyland/back.png
new file mode 100644
index 0000000..5b9bfd8
Binary files /dev/null and b/py/assets/sunnyland/back.png differ
diff --git a/py/assets/sunnyland/bunny/idle-1.png b/py/assets/sunnyland/bunny/idle-1.png
new file mode 100644
index 0000000..82b4865
Binary files /dev/null and b/py/assets/sunnyland/bunny/idle-1.png differ
diff --git a/py/assets/sunnyland/bunny/idle-2.png b/py/assets/sunnyland/bunny/idle-2.png
new file mode 100644
index 0000000..ac2b6e8
Binary files /dev/null and b/py/assets/sunnyland/bunny/idle-2.png differ
diff --git a/py/assets/sunnyland/bunny/idle-3.png b/py/assets/sunnyland/bunny/idle-3.png
new file mode 100644
index 0000000..cea7dc0
Binary files /dev/null and b/py/assets/sunnyland/bunny/idle-3.png differ
diff --git a/py/assets/sunnyland/bunny/idle-4.png b/py/assets/sunnyland/bunny/idle-4.png
new file mode 100644
index 0000000..c37607c
Binary files /dev/null and b/py/assets/sunnyland/bunny/idle-4.png differ
diff --git a/py/assets/sunnyland/bunny/jump-1.png b/py/assets/sunnyland/bunny/jump-1.png
new file mode 100644
index 0000000..ae99485
Binary files /dev/null and b/py/assets/sunnyland/bunny/jump-1.png differ
diff --git a/py/assets/sunnyland/bunny/jump-2.png b/py/assets/sunnyland/bunny/jump-2.png
new file mode 100644
index 0000000..32f9df4
Binary files /dev/null and b/py/assets/sunnyland/bunny/jump-2.png differ
diff --git a/py/assets/sunnyland/bunny/run-1.png b/py/assets/sunnyland/bunny/run-1.png
new file mode 100644
index 0000000..4403711
Binary files /dev/null and b/py/assets/sunnyland/bunny/run-1.png differ
diff --git a/py/assets/sunnyland/bunny/run-2.png b/py/assets/sunnyland/bunny/run-2.png
new file mode 100644
index 0000000..7a1dedd
Binary files /dev/null and b/py/assets/sunnyland/bunny/run-2.png differ
diff --git a/py/assets/sunnyland/bunny/run-3.png b/py/assets/sunnyland/bunny/run-3.png
new file mode 100644
index 0000000..6ae103b
Binary files /dev/null and b/py/assets/sunnyland/bunny/run-3.png differ
diff --git a/py/assets/sunnyland/bunny/run-4.png b/py/assets/sunnyland/bunny/run-4.png
new file mode 100644
index 0000000..1e93aa0
Binary files /dev/null and b/py/assets/sunnyland/bunny/run-4.png differ
diff --git a/py/assets/sunnyland/bunny/run-5.png b/py/assets/sunnyland/bunny/run-5.png
new file mode 100644
index 0000000..9029c9e
Binary files /dev/null and b/py/assets/sunnyland/bunny/run-5.png differ
diff --git a/py/assets/sunnyland/bunny/run-6.png b/py/assets/sunnyland/bunny/run-6.png
new file mode 100644
index 0000000..e174da1
Binary files /dev/null and b/py/assets/sunnyland/bunny/run-6.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-1.png b/py/assets/sunnyland/fireball/fireball-1.png
new file mode 100644
index 0000000..c93702d
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-1.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-2.png b/py/assets/sunnyland/fireball/fireball-2.png
new file mode 100644
index 0000000..be316b9
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-2.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-3.png b/py/assets/sunnyland/fireball/fireball-3.png
new file mode 100644
index 0000000..ab8f39d
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-3.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-4.png b/py/assets/sunnyland/fireball/fireball-4.png
new file mode 100644
index 0000000..7907a66
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-4.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-5.png b/py/assets/sunnyland/fireball/fireball-5.png
new file mode 100644
index 0000000..535eb65
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-5.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-hit-1.png b/py/assets/sunnyland/fireball/fireball-hit-1.png
new file mode 100644
index 0000000..b0277e5
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-hit-1.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-hit-2.png b/py/assets/sunnyland/fireball/fireball-hit-2.png
new file mode 100644
index 0000000..4f521e8
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-hit-2.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-hit-3.png b/py/assets/sunnyland/fireball/fireball-hit-3.png
new file mode 100644
index 0000000..ee3843d
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-hit-3.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-hit-4.png b/py/assets/sunnyland/fireball/fireball-hit-4.png
new file mode 100644
index 0000000..16e58a8
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-hit-4.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-hit-5.png b/py/assets/sunnyland/fireball/fireball-hit-5.png
new file mode 100644
index 0000000..20fc216
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-hit-5.png differ
diff --git a/py/assets/sunnyland/fireball/fireball-hit-6.png b/py/assets/sunnyland/fireball/fireball-hit-6.png
new file mode 100644
index 0000000..055b4f5
Binary files /dev/null and b/py/assets/sunnyland/fireball/fireball-hit-6.png differ
diff --git a/py/assets/sunnyland/fox/hurt-1.png b/py/assets/sunnyland/fox/hurt-1.png
new file mode 100644
index 0000000..2d944ab
Binary files /dev/null and b/py/assets/sunnyland/fox/hurt-1.png differ
diff --git a/py/assets/sunnyland/fox/hurt-2.png b/py/assets/sunnyland/fox/hurt-2.png
new file mode 100644
index 0000000..18e8bca
Binary files /dev/null and b/py/assets/sunnyland/fox/hurt-2.png differ
diff --git a/py/assets/sunnyland/fox/idle-1.png b/py/assets/sunnyland/fox/idle-1.png
new file mode 100644
index 0000000..7a3210b
Binary files /dev/null and b/py/assets/sunnyland/fox/idle-1.png differ
diff --git a/py/assets/sunnyland/fox/idle-2.png b/py/assets/sunnyland/fox/idle-2.png
new file mode 100644
index 0000000..c6e0212
Binary files /dev/null and b/py/assets/sunnyland/fox/idle-2.png differ
diff --git a/py/assets/sunnyland/fox/idle-3.png b/py/assets/sunnyland/fox/idle-3.png
new file mode 100644
index 0000000..f1c0f44
Binary files /dev/null and b/py/assets/sunnyland/fox/idle-3.png differ
diff --git a/py/assets/sunnyland/fox/idle-4.png b/py/assets/sunnyland/fox/idle-4.png
new file mode 100644
index 0000000..8bde279
Binary files /dev/null and b/py/assets/sunnyland/fox/idle-4.png differ
diff --git a/py/assets/sunnyland/fox/jump-1.png b/py/assets/sunnyland/fox/jump-1.png
new file mode 100644
index 0000000..036b46e
Binary files /dev/null and b/py/assets/sunnyland/fox/jump-1.png differ
diff --git a/py/assets/sunnyland/fox/jump-2.png b/py/assets/sunnyland/fox/jump-2.png
new file mode 100644
index 0000000..de416ae
Binary files /dev/null and b/py/assets/sunnyland/fox/jump-2.png differ
diff --git a/py/assets/sunnyland/fox/roll-1.png b/py/assets/sunnyland/fox/roll-1.png
new file mode 100644
index 0000000..76a41a8
Binary files /dev/null and b/py/assets/sunnyland/fox/roll-1.png differ
diff --git a/py/assets/sunnyland/fox/roll-2.png b/py/assets/sunnyland/fox/roll-2.png
new file mode 100644
index 0000000..08d7d75
Binary files /dev/null and b/py/assets/sunnyland/fox/roll-2.png differ
diff --git a/py/assets/sunnyland/fox/roll-3.png b/py/assets/sunnyland/fox/roll-3.png
new file mode 100644
index 0000000..add166b
Binary files /dev/null and b/py/assets/sunnyland/fox/roll-3.png differ
diff --git a/py/assets/sunnyland/fox/roll-4.png b/py/assets/sunnyland/fox/roll-4.png
new file mode 100644
index 0000000..58ff431
Binary files /dev/null and b/py/assets/sunnyland/fox/roll-4.png differ
diff --git a/py/assets/sunnyland/fox/run-1.png b/py/assets/sunnyland/fox/run-1.png
new file mode 100644
index 0000000..ff5d2dd
Binary files /dev/null and b/py/assets/sunnyland/fox/run-1.png differ
diff --git a/py/assets/sunnyland/fox/run-2.png b/py/assets/sunnyland/fox/run-2.png
new file mode 100644
index 0000000..b428145
Binary files /dev/null and b/py/assets/sunnyland/fox/run-2.png differ
diff --git a/py/assets/sunnyland/fox/run-3.png b/py/assets/sunnyland/fox/run-3.png
new file mode 100644
index 0000000..987b8f1
Binary files /dev/null and b/py/assets/sunnyland/fox/run-3.png differ
diff --git a/py/assets/sunnyland/fox/run-4.png b/py/assets/sunnyland/fox/run-4.png
new file mode 100644
index 0000000..a4e6f14
Binary files /dev/null and b/py/assets/sunnyland/fox/run-4.png differ
diff --git a/py/assets/sunnyland/fox/run-5.png b/py/assets/sunnyland/fox/run-5.png
new file mode 100644
index 0000000..2b915ee
Binary files /dev/null and b/py/assets/sunnyland/fox/run-5.png differ
diff --git a/py/assets/sunnyland/fox/run-6.png b/py/assets/sunnyland/fox/run-6.png
new file mode 100644
index 0000000..762e1cf
Binary files /dev/null and b/py/assets/sunnyland/fox/run-6.png differ
diff --git a/py/assets/sunnyland/imp/hurt-1.png b/py/assets/sunnyland/imp/hurt-1.png
new file mode 100644
index 0000000..a251789
Binary files /dev/null and b/py/assets/sunnyland/imp/hurt-1.png differ
diff --git a/py/assets/sunnyland/imp/hurt-2.png b/py/assets/sunnyland/imp/hurt-2.png
new file mode 100644
index 0000000..84ed54d
Binary files /dev/null and b/py/assets/sunnyland/imp/hurt-2.png differ
diff --git a/py/assets/sunnyland/imp/idle-1.png b/py/assets/sunnyland/imp/idle-1.png
new file mode 100644
index 0000000..5f12fbb
Binary files /dev/null and b/py/assets/sunnyland/imp/idle-1.png differ
diff --git a/py/assets/sunnyland/imp/idle-2.png b/py/assets/sunnyland/imp/idle-2.png
new file mode 100644
index 0000000..92b03da
Binary files /dev/null and b/py/assets/sunnyland/imp/idle-2.png differ
diff --git a/py/assets/sunnyland/imp/idle-3.png b/py/assets/sunnyland/imp/idle-3.png
new file mode 100644
index 0000000..b220c04
Binary files /dev/null and b/py/assets/sunnyland/imp/idle-3.png differ
diff --git a/py/assets/sunnyland/imp/idle-4.png b/py/assets/sunnyland/imp/idle-4.png
new file mode 100644
index 0000000..c8992ee
Binary files /dev/null and b/py/assets/sunnyland/imp/idle-4.png differ
diff --git a/py/assets/sunnyland/imp/jump-1.png b/py/assets/sunnyland/imp/jump-1.png
new file mode 100644
index 0000000..45c6a56
Binary files /dev/null and b/py/assets/sunnyland/imp/jump-1.png differ
diff --git a/py/assets/sunnyland/imp/jump-2.png b/py/assets/sunnyland/imp/jump-2.png
new file mode 100644
index 0000000..bd40e86
Binary files /dev/null and b/py/assets/sunnyland/imp/jump-2.png differ
diff --git a/py/assets/sunnyland/imp/jump-3.png b/py/assets/sunnyland/imp/jump-3.png
new file mode 100644
index 0000000..9a59b1b
Binary files /dev/null and b/py/assets/sunnyland/imp/jump-3.png differ
diff --git a/py/assets/sunnyland/imp/jump-4.png b/py/assets/sunnyland/imp/jump-4.png
new file mode 100644
index 0000000..99371a8
Binary files /dev/null and b/py/assets/sunnyland/imp/jump-4.png differ
diff --git a/py/assets/sunnyland/imp/jump-5.png b/py/assets/sunnyland/imp/jump-5.png
new file mode 100644
index 0000000..fadeb70
Binary files /dev/null and b/py/assets/sunnyland/imp/jump-5.png differ
diff --git a/py/assets/sunnyland/imp/run-1.png b/py/assets/sunnyland/imp/run-1.png
new file mode 100644
index 0000000..d4aef63
Binary files /dev/null and b/py/assets/sunnyland/imp/run-1.png differ
diff --git a/py/assets/sunnyland/imp/run-2.png b/py/assets/sunnyland/imp/run-2.png
new file mode 100644
index 0000000..6e8f2a7
Binary files /dev/null and b/py/assets/sunnyland/imp/run-2.png differ
diff --git a/py/assets/sunnyland/imp/run-3.png b/py/assets/sunnyland/imp/run-3.png
new file mode 100644
index 0000000..ff53781
Binary files /dev/null and b/py/assets/sunnyland/imp/run-3.png differ
diff --git a/py/assets/sunnyland/imp/run-4.png b/py/assets/sunnyland/imp/run-4.png
new file mode 100644
index 0000000..60491b8
Binary files /dev/null and b/py/assets/sunnyland/imp/run-4.png differ
diff --git a/py/assets/sunnyland/imp/run-5.png b/py/assets/sunnyland/imp/run-5.png
new file mode 100644
index 0000000..cc69e28
Binary files /dev/null and b/py/assets/sunnyland/imp/run-5.png differ
diff --git a/py/assets/sunnyland/imp/run-6.png b/py/assets/sunnyland/imp/run-6.png
new file mode 100644
index 0000000..204ece9
Binary files /dev/null and b/py/assets/sunnyland/imp/run-6.png differ
diff --git a/py/assets/sunnyland/imp/run-7.png b/py/assets/sunnyland/imp/run-7.png
new file mode 100644
index 0000000..18373d6
Binary files /dev/null and b/py/assets/sunnyland/imp/run-7.png differ
diff --git a/py/assets/sunnyland/imp/run-8.png b/py/assets/sunnyland/imp/run-8.png
new file mode 100644
index 0000000..43fd6f3
Binary files /dev/null and b/py/assets/sunnyland/imp/run-8.png differ
diff --git a/py/assets/sunnyland/imp/shot-1.png b/py/assets/sunnyland/imp/shot-1.png
new file mode 100644
index 0000000..f1a76ee
Binary files /dev/null and b/py/assets/sunnyland/imp/shot-1.png differ
diff --git a/py/assets/sunnyland/imp/shot-2.png b/py/assets/sunnyland/imp/shot-2.png
new file mode 100644
index 0000000..6396b0c
Binary files /dev/null and b/py/assets/sunnyland/imp/shot-2.png differ
diff --git a/py/assets/sunnyland/imp/shot-3.png b/py/assets/sunnyland/imp/shot-3.png
new file mode 100644
index 0000000..07ccd00
Binary files /dev/null and b/py/assets/sunnyland/imp/shot-3.png differ
diff --git a/py/assets/sunnyland/imp/shot-4.png b/py/assets/sunnyland/imp/shot-4.png
new file mode 100644
index 0000000..97dc8f6
Binary files /dev/null and b/py/assets/sunnyland/imp/shot-4.png differ
diff --git a/py/assets/sunnyland/middle.png b/py/assets/sunnyland/middle.png
new file mode 100644
index 0000000..3e74b1d
Binary files /dev/null and b/py/assets/sunnyland/middle.png differ
diff --git a/py/assets/sunnyland/squirrel/hurt-1.png b/py/assets/sunnyland/squirrel/hurt-1.png
new file mode 100644
index 0000000..df3e183
Binary files /dev/null and b/py/assets/sunnyland/squirrel/hurt-1.png differ
diff --git a/py/assets/sunnyland/squirrel/hurt-2.png b/py/assets/sunnyland/squirrel/hurt-2.png
new file mode 100644
index 0000000..f822d3f
Binary files /dev/null and b/py/assets/sunnyland/squirrel/hurt-2.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-1.png b/py/assets/sunnyland/squirrel/idle-1.png
new file mode 100644
index 0000000..8e8a8f1
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-1.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-2.png b/py/assets/sunnyland/squirrel/idle-2.png
new file mode 100644
index 0000000..3642a29
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-2.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-3.png b/py/assets/sunnyland/squirrel/idle-3.png
new file mode 100644
index 0000000..4c2bad7
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-3.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-4.png b/py/assets/sunnyland/squirrel/idle-4.png
new file mode 100644
index 0000000..2520d21
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-4.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-5.png b/py/assets/sunnyland/squirrel/idle-5.png
new file mode 100644
index 0000000..65b76ed
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-5.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-6.png b/py/assets/sunnyland/squirrel/idle-6.png
new file mode 100644
index 0000000..bbfe049
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-6.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-7.png b/py/assets/sunnyland/squirrel/idle-7.png
new file mode 100644
index 0000000..87064de
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-7.png differ
diff --git a/py/assets/sunnyland/squirrel/idle-8.png b/py/assets/sunnyland/squirrel/idle-8.png
new file mode 100644
index 0000000..3b47b77
Binary files /dev/null and b/py/assets/sunnyland/squirrel/idle-8.png differ
diff --git a/py/assets/sunnyland/squirrel/jump-1.png b/py/assets/sunnyland/squirrel/jump-1.png
new file mode 100644
index 0000000..857c598
Binary files /dev/null and b/py/assets/sunnyland/squirrel/jump-1.png differ
diff --git a/py/assets/sunnyland/squirrel/jump-2.png b/py/assets/sunnyland/squirrel/jump-2.png
new file mode 100644
index 0000000..d757774
Binary files /dev/null and b/py/assets/sunnyland/squirrel/jump-2.png differ
diff --git a/py/assets/sunnyland/squirrel/jump-3.png b/py/assets/sunnyland/squirrel/jump-3.png
new file mode 100644
index 0000000..20b939c
Binary files /dev/null and b/py/assets/sunnyland/squirrel/jump-3.png differ
diff --git a/py/assets/sunnyland/squirrel/jump-4.png b/py/assets/sunnyland/squirrel/jump-4.png
new file mode 100644
index 0000000..3746d0a
Binary files /dev/null and b/py/assets/sunnyland/squirrel/jump-4.png differ
diff --git a/py/assets/sunnyland/squirrel/run-1.png b/py/assets/sunnyland/squirrel/run-1.png
new file mode 100644
index 0000000..4222411
Binary files /dev/null and b/py/assets/sunnyland/squirrel/run-1.png differ
diff --git a/py/assets/sunnyland/squirrel/run-2.png b/py/assets/sunnyland/squirrel/run-2.png
new file mode 100644
index 0000000..a2604fc
Binary files /dev/null and b/py/assets/sunnyland/squirrel/run-2.png differ
diff --git a/py/assets/sunnyland/squirrel/run-3.png b/py/assets/sunnyland/squirrel/run-3.png
new file mode 100644
index 0000000..4595640
Binary files /dev/null and b/py/assets/sunnyland/squirrel/run-3.png differ
diff --git a/py/assets/sunnyland/squirrel/run-4.png b/py/assets/sunnyland/squirrel/run-4.png
new file mode 100644
index 0000000..2455a81
Binary files /dev/null and b/py/assets/sunnyland/squirrel/run-4.png differ
diff --git a/py/assets/sunnyland/squirrel/run-5.png b/py/assets/sunnyland/squirrel/run-5.png
new file mode 100644
index 0000000..1a965e2
Binary files /dev/null and b/py/assets/sunnyland/squirrel/run-5.png differ
diff --git a/py/assets/sunnyland/squirrel/run-6.png b/py/assets/sunnyland/squirrel/run-6.png
new file mode 100644
index 0000000..1702cad
Binary files /dev/null and b/py/assets/sunnyland/squirrel/run-6.png differ
diff --git a/py/assets/sunnyland/tileset.png b/py/assets/sunnyland/tileset.png
new file mode 100644
index 0000000..f44abc3
Binary files /dev/null and b/py/assets/sunnyland/tileset.png differ
diff --git a/py/assets/zombie_shooter/bullet.png b/py/assets/zombie_shooter/bullet.png
new file mode 100644
index 0000000..fd38525
Binary files /dev/null and b/py/assets/zombie_shooter/bullet.png differ
diff --git a/py/assets/zombie_shooter/light.png b/py/assets/zombie_shooter/light.png
new file mode 100644
index 0000000..c40411b
Binary files /dev/null and b/py/assets/zombie_shooter/light.png differ
diff --git a/py/assets/zombie_shooter/player_1.png b/py/assets/zombie_shooter/player_1.png
new file mode 100644
index 0000000..3cebeb7
Binary files /dev/null and b/py/assets/zombie_shooter/player_1.png differ
diff --git a/py/assets/zombie_shooter/player_2.png b/py/assets/zombie_shooter/player_2.png
new file mode 100644
index 0000000..9c966d3
Binary files /dev/null and b/py/assets/zombie_shooter/player_2.png differ
diff --git a/py/assets/zombie_shooter/player_3.png b/py/assets/zombie_shooter/player_3.png
new file mode 100644
index 0000000..11d3e71
Binary files /dev/null and b/py/assets/zombie_shooter/player_3.png differ
diff --git a/py/assets/zombie_shooter/player_4.png b/py/assets/zombie_shooter/player_4.png
new file mode 100644
index 0000000..2e00169
Binary files /dev/null and b/py/assets/zombie_shooter/player_4.png differ
diff --git a/py/assets/zombie_shooter/tilemap.png b/py/assets/zombie_shooter/tilemap.png
new file mode 100644
index 0000000..53a8dda
Binary files /dev/null and b/py/assets/zombie_shooter/tilemap.png differ
diff --git a/py/assets/zombie_shooter/zombie.png b/py/assets/zombie_shooter/zombie.png
new file mode 100644
index 0000000..79eca07
Binary files /dev/null and b/py/assets/zombie_shooter/zombie.png differ
diff --git a/py/engine/LdtkJson.py b/py/engine/LdtkJson.py
new file mode 100644
index 0000000..c816f39
--- /dev/null
+++ b/py/engine/LdtkJson.py
@@ -0,0 +1,2831 @@
+from enum import Enum
+from typing import Any, List, Optional, Dict, TypeVar, Type, Callable, cast
+
+
+T = TypeVar("T")
+EnumT = TypeVar("EnumT", bound=Enum)
+
+
+def from_str(x: Any) -> str:
+    assert isinstance(x, str)
+    return x
+
+
+def to_enum(c: Type[EnumT], x: Any) -> EnumT:
+    assert isinstance(x, c)
+    return x.value
+
+
+def from_none(x: Any) -> Any:
+    assert x is None
+    return x
+
+
+def from_list(f: Callable[[Any], T], x: Any) -> List[T]:
+    assert isinstance(x, list)
+    return [f(y) for y in x]
+
+
+def from_union(fs, x):
+    for f in fs:
+        try:
+            return f(x)
+        except:
+            pass
+    assert False
+
+
+def from_int(x: Any) -> int:
+    assert isinstance(x, int) and not isinstance(x, bool)
+    return x
+
+
+def from_bool(x: Any) -> bool:
+    assert isinstance(x, bool)
+    return x
+
+
+def from_float(x: Any) -> float:
+    assert isinstance(x, (float, int)) and not isinstance(x, bool)
+    return float(x)
+
+
+def to_float(x: Any) -> float:
+    assert isinstance(x, float)
+    return x
+
+
+def to_class(c: Type[T], x: Any) -> dict:
+    assert isinstance(x, c)
+    return cast(Any, x).to_dict()
+
+
+def from_dict(f: Callable[[Any], T], x: Any) -> Dict[str, T]:
+    assert isinstance(x, dict)
+    return { k: f(v) for (k, v) in x.items() }
+
+
+class When(Enum):
+    """Possible values: `Manual`, `AfterLoad`, `BeforeSave`, `AfterSave`"""
+    AFTER_LOAD = "AfterLoad"
+    AFTER_SAVE = "AfterSave"
+    BEFORE_SAVE = "BeforeSave"
+    MANUAL = "Manual"
+
+
+class LdtkCustomCommand:
+    command: str
+    when: When
+    """Possible values: `Manual`, `AfterLoad`, `BeforeSave`, `AfterSave`"""
+
+    def __init__(self, command: str, when: When) -> None:
+        self.command = command
+        self.when = when
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'LdtkCustomCommand':
+        assert isinstance(obj, dict)
+        command = from_str(obj.get("command"))
+        when = When(obj.get("when"))
+        return LdtkCustomCommand(command, when)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["command"] = from_str(self.command)
+        result["when"] = to_enum(When, self.when)
+        return result
+
+
+class AllowedRefs(Enum):
+    """Possible values: `Any`, `OnlySame`, `OnlyTags`, `OnlySpecificEntity`"""
+    ANY = "Any"
+    ONLY_SAME = "OnlySame"
+    ONLY_SPECIFIC_ENTITY = "OnlySpecificEntity"
+    ONLY_TAGS = "OnlyTags"
+
+
+class EditorDisplayMode(Enum):
+    """Possible values: `Hidden`, `ValueOnly`, `NameAndValue`, `EntityTile`, `LevelTile`,
+    `Points`, `PointStar`, `PointPath`, `PointPathLoop`, `RadiusPx`, `RadiusGrid`,
+    `ArrayCountWithLabel`, `ArrayCountNoLabel`, `RefLinkBetweenPivots`,
+    `RefLinkBetweenCenters`
+    """
+    ARRAY_COUNT_NO_LABEL = "ArrayCountNoLabel"
+    ARRAY_COUNT_WITH_LABEL = "ArrayCountWithLabel"
+    ENTITY_TILE = "EntityTile"
+    HIDDEN = "Hidden"
+    LEVEL_TILE = "LevelTile"
+    NAME_AND_VALUE = "NameAndValue"
+    POINTS = "Points"
+    POINT_PATH = "PointPath"
+    POINT_PATH_LOOP = "PointPathLoop"
+    POINT_STAR = "PointStar"
+    RADIUS_GRID = "RadiusGrid"
+    RADIUS_PX = "RadiusPx"
+    REF_LINK_BETWEEN_CENTERS = "RefLinkBetweenCenters"
+    REF_LINK_BETWEEN_PIVOTS = "RefLinkBetweenPivots"
+    VALUE_ONLY = "ValueOnly"
+
+
+class EditorDisplayPos(Enum):
+    """Possible values: `Above`, `Center`, `Beneath`"""
+    ABOVE = "Above"
+    BENEATH = "Beneath"
+    CENTER = "Center"
+
+
+class EditorLinkStyle(Enum):
+    """Possible values: `ZigZag`, `StraightArrow`, `CurvedArrow`, `ArrowsLine`, `DashedLine`"""
+    ARROWS_LINE = "ArrowsLine"
+    CURVED_ARROW = "CurvedArrow"
+    DASHED_LINE = "DashedLine"
+    STRAIGHT_ARROW = "StraightArrow"
+    ZIG_ZAG = "ZigZag"
+
+
+class TextLanguageMode(Enum):
+    LANG_C = "LangC"
+    LANG_HAXE = "LangHaxe"
+    LANG_JS = "LangJS"
+    LANG_JSON = "LangJson"
+    LANG_LOG = "LangLog"
+    LANG_LUA = "LangLua"
+    LANG_MARKDOWN = "LangMarkdown"
+    LANG_PYTHON = "LangPython"
+    LANG_RUBY = "LangRuby"
+    LANG_XML = "LangXml"
+
+
+class FieldDefinition:
+    """This section is mostly only intended for the LDtk editor app itself. You can safely
+    ignore it.
+    """
+    type: str
+    """Human readable value type. Possible values: `Int, Float, String, Bool, rl.Color,
+    ExternEnum.XXX, LocalEnum.XXX, Point, FilePath`.<br/>  If the field is an array, this
+    field will look like `Array<...>` (eg. `Array<Int>`, `Array<Point>` etc.)<br/>  NOTE: if
+    you enable the advanced option **Use Multilines type**, you will have "*Multilines*"
+    instead of "*String*" when relevant.
+    """
+    accept_file_types: Optional[List[str]]
+    """Optional list of accepted file extensions for FilePath value type. Includes the dot:
+    `.ext`
+    """
+    allowed_refs: AllowedRefs
+    """Possible values: `Any`, `OnlySame`, `OnlyTags`, `OnlySpecificEntity`"""
+    allowed_refs_entity_uid: Optional[int]
+    allowed_ref_tags: List[str]
+    allow_out_of_level_ref: bool
+    array_max_length: Optional[int]
+    """Array max length"""
+    array_min_length: Optional[int]
+    """Array min length"""
+    auto_chain_ref: bool
+    can_be_null: bool
+    """TRUE if the value can be null. For arrays, TRUE means it can contain null values
+    (exception: array of Points can't have null values).
+    """
+    default_override: Any
+    """Default value if selected value is null or invalid."""
+    doc: Optional[str]
+    """User defined documentation for this field to provide help/tips to level designers about
+    accepted values.
+    """
+    editor_always_show: bool
+    editor_cut_long_values: bool
+    editor_display_color: Optional[str]
+    editor_display_mode: EditorDisplayMode
+    """Possible values: `Hidden`, `ValueOnly`, `NameAndValue`, `EntityTile`, `LevelTile`,
+    `Points`, `PointStar`, `PointPath`, `PointPathLoop`, `RadiusPx`, `RadiusGrid`,
+    `ArrayCountWithLabel`, `ArrayCountNoLabel`, `RefLinkBetweenPivots`,
+    `RefLinkBetweenCenters`
+    """
+    editor_display_pos: EditorDisplayPos
+    """Possible values: `Above`, `Center`, `Beneath`"""
+    editor_display_scale: float
+    editor_link_style: EditorLinkStyle
+    """Possible values: `ZigZag`, `StraightArrow`, `CurvedArrow`, `ArrowsLine`, `DashedLine`"""
+    editor_show_in_world: bool
+    editor_text_prefix: Optional[str]
+    editor_text_suffix: Optional[str]
+    export_to_toc: bool
+    """If TRUE, the field value will be exported to the `toc` project JSON field. Only applies
+    to Entity fields.
+    """
+    identifier: str
+    """User defined unique identifier"""
+    is_array: bool
+    """TRUE if the value is an array of multiple values"""
+    max: Optional[float]
+    """Max limit for value, if applicable"""
+    min: Optional[float]
+    """Min limit for value, if applicable"""
+    regex: Optional[str]
+    """Optional regular expression that needs to be matched to accept values. Expected format:
+    `/some_reg_ex/g`, with optional "i" flag.
+    """
+    searchable: bool
+    """If enabled, this field will be searchable through LDtk command palette"""
+    symmetrical_ref: bool
+    text_language_mode: Optional[TextLanguageMode]
+    """Possible values: &lt;`null`&gt;, `LangPython`, `LangRuby`, `LangJS`, `LangLua`, `LangC`,
+    `LangHaxe`, `LangMarkdown`, `LangJson`, `LangXml`, `LangLog`
+    """
+    tileset_uid: Optional[int]
+    """UID of the tileset used for a Tile"""
+    field_definition_type: str
+    """Internal enum representing the possible field types. Possible values: F_Int, F_Float,
+    F_String, F_Text, F_Bool, F_Color, F_Enum(...), F_Point, F_Path, F_EntityRef, F_Tile
+    """
+    uid: int
+    """Unique Int identifier"""
+    use_for_smart_color: bool
+    """If TRUE, the color associated with this field will override the Entity or Level default
+    color in the editor UI. For Enum fields, this would be the color associated to their
+    values.
+    """
+
+    def __init__(self, type: str, accept_file_types: Optional[List[str]], allowed_refs: AllowedRefs, allowed_refs_entity_uid: Optional[int], allowed_ref_tags: List[str], allow_out_of_level_ref: bool, array_max_length: Optional[int], array_min_length: Optional[int], auto_chain_ref: bool, can_be_null: bool, default_override: Any, doc: Optional[str], editor_always_show: bool, editor_cut_long_values: bool, editor_display_color: Optional[str], editor_display_mode: EditorDisplayMode, editor_display_pos: EditorDisplayPos, editor_display_scale: float, editor_link_style: EditorLinkStyle, editor_show_in_world: bool, editor_text_prefix: Optional[str], editor_text_suffix: Optional[str], export_to_toc: bool, identifier: str, is_array: bool, max: Optional[float], min: Optional[float], regex: Optional[str], searchable: bool, symmetrical_ref: bool, text_language_mode: Optional[TextLanguageMode], tileset_uid: Optional[int], field_definition_type: str, uid: int, use_for_smart_color: bool) -> None:
+        self.type = type
+        self.accept_file_types = accept_file_types
+        self.allowed_refs = allowed_refs
+        self.allowed_refs_entity_uid = allowed_refs_entity_uid
+        self.allowed_ref_tags = allowed_ref_tags
+        self.allow_out_of_level_ref = allow_out_of_level_ref
+        self.array_max_length = array_max_length
+        self.array_min_length = array_min_length
+        self.auto_chain_ref = auto_chain_ref
+        self.can_be_null = can_be_null
+        self.default_override = default_override
+        self.doc = doc
+        self.editor_always_show = editor_always_show
+        self.editor_cut_long_values = editor_cut_long_values
+        self.editor_display_color = editor_display_color
+        self.editor_display_mode = editor_display_mode
+        self.editor_display_pos = editor_display_pos
+        self.editor_display_scale = editor_display_scale
+        self.editor_link_style = editor_link_style
+        self.editor_show_in_world = editor_show_in_world
+        self.editor_text_prefix = editor_text_prefix
+        self.editor_text_suffix = editor_text_suffix
+        self.export_to_toc = export_to_toc
+        self.identifier = identifier
+        self.is_array = is_array
+        self.max = max
+        self.min = min
+        self.regex = regex
+        self.searchable = searchable
+        self.symmetrical_ref = symmetrical_ref
+        self.text_language_mode = text_language_mode
+        self.tileset_uid = tileset_uid
+        self.field_definition_type = field_definition_type
+        self.uid = uid
+        self.use_for_smart_color = use_for_smart_color
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'FieldDefinition':
+        assert isinstance(obj, dict)
+        type = from_str(obj.get("__type"))
+        accept_file_types = from_union([from_none, lambda x: from_list(from_str, x)], obj.get("acceptFileTypes"))
+        allowed_refs = AllowedRefs(obj.get("allowedRefs"))
+        allowed_refs_entity_uid = from_union([from_none, from_int], obj.get("allowedRefsEntityUid"))
+        allowed_ref_tags = from_list(from_str, obj.get("allowedRefTags"))
+        allow_out_of_level_ref = from_bool(obj.get("allowOutOfLevelRef"))
+        array_max_length = from_union([from_none, from_int], obj.get("arrayMaxLength"))
+        array_min_length = from_union([from_none, from_int], obj.get("arrayMinLength"))
+        auto_chain_ref = from_bool(obj.get("autoChainRef"))
+        can_be_null = from_bool(obj.get("canBeNull"))
+        default_override = obj.get("defaultOverride")
+        doc = from_union([from_none, from_str], obj.get("doc"))
+        editor_always_show = from_bool(obj.get("editorAlwaysShow"))
+        editor_cut_long_values = from_bool(obj.get("editorCutLongValues"))
+        editor_display_color = from_union([from_none, from_str], obj.get("editorDisplayColor"))
+        editor_display_mode = EditorDisplayMode(obj.get("editorDisplayMode"))
+        editor_display_pos = EditorDisplayPos(obj.get("editorDisplayPos"))
+        editor_display_scale = from_float(obj.get("editorDisplayScale"))
+        editor_link_style = EditorLinkStyle(obj.get("editorLinkStyle"))
+        editor_show_in_world = from_bool(obj.get("editorShowInWorld"))
+        editor_text_prefix = from_union([from_none, from_str], obj.get("editorTextPrefix"))
+        editor_text_suffix = from_union([from_none, from_str], obj.get("editorTextSuffix"))
+        export_to_toc = from_bool(obj.get("exportToToc"))
+        identifier = from_str(obj.get("identifier"))
+        is_array = from_bool(obj.get("isArray"))
+        max = from_union([from_none, from_float], obj.get("max"))
+        min = from_union([from_none, from_float], obj.get("min"))
+        regex = from_union([from_none, from_str], obj.get("regex"))
+        searchable = from_bool(obj.get("searchable"))
+        symmetrical_ref = from_bool(obj.get("symmetricalRef"))
+        text_language_mode = from_union([from_none, TextLanguageMode], obj.get("textLanguageMode"))
+        tileset_uid = from_union([from_none, from_int], obj.get("tilesetUid"))
+        field_definition_type = from_str(obj.get("type"))
+        uid = from_int(obj.get("uid"))
+        use_for_smart_color = from_bool(obj.get("useForSmartColor"))
+        return FieldDefinition(type, accept_file_types, allowed_refs, allowed_refs_entity_uid, allowed_ref_tags, allow_out_of_level_ref, array_max_length, array_min_length, auto_chain_ref, can_be_null, default_override, doc, editor_always_show, editor_cut_long_values, editor_display_color, editor_display_mode, editor_display_pos, editor_display_scale, editor_link_style, editor_show_in_world, editor_text_prefix, editor_text_suffix, export_to_toc, identifier, is_array, max, min, regex, searchable, symmetrical_ref, text_language_mode, tileset_uid, field_definition_type, uid, use_for_smart_color)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["__type"] = from_str(self.type)
+        if self.accept_file_types is not None:
+            result["acceptFileTypes"] = from_union([from_none, lambda x: from_list(from_str, x)], self.accept_file_types)
+        result["allowedRefs"] = to_enum(AllowedRefs, self.allowed_refs)
+        if self.allowed_refs_entity_uid is not None:
+            result["allowedRefsEntityUid"] = from_union([from_none, from_int], self.allowed_refs_entity_uid)
+        result["allowedRefTags"] = from_list(from_str, self.allowed_ref_tags)
+        result["allowOutOfLevelRef"] = from_bool(self.allow_out_of_level_ref)
+        if self.array_max_length is not None:
+            result["arrayMaxLength"] = from_union([from_none, from_int], self.array_max_length)
+        if self.array_min_length is not None:
+            result["arrayMinLength"] = from_union([from_none, from_int], self.array_min_length)
+        result["autoChainRef"] = from_bool(self.auto_chain_ref)
+        result["canBeNull"] = from_bool(self.can_be_null)
+        if self.default_override is not None:
+            result["defaultOverride"] = self.default_override
+        if self.doc is not None:
+            result["doc"] = from_union([from_none, from_str], self.doc)
+        result["editorAlwaysShow"] = from_bool(self.editor_always_show)
+        result["editorCutLongValues"] = from_bool(self.editor_cut_long_values)
+        if self.editor_display_color is not None:
+            result["editorDisplayColor"] = from_union([from_none, from_str], self.editor_display_color)
+        result["editorDisplayMode"] = to_enum(EditorDisplayMode, self.editor_display_mode)
+        result["editorDisplayPos"] = to_enum(EditorDisplayPos, self.editor_display_pos)
+        result["editorDisplayScale"] = to_float(self.editor_display_scale)
+        result["editorLinkStyle"] = to_enum(EditorLinkStyle, self.editor_link_style)
+        result["editorShowInWorld"] = from_bool(self.editor_show_in_world)
+        if self.editor_text_prefix is not None:
+            result["editorTextPrefix"] = from_union([from_none, from_str], self.editor_text_prefix)
+        if self.editor_text_suffix is not None:
+            result["editorTextSuffix"] = from_union([from_none, from_str], self.editor_text_suffix)
+        result["exportToToc"] = from_bool(self.export_to_toc)
+        result["identifier"] = from_str(self.identifier)
+        result["isArray"] = from_bool(self.is_array)
+        if self.max is not None:
+            result["max"] = from_union([from_none, to_float], self.max)
+        if self.min is not None:
+            result["min"] = from_union([from_none, to_float], self.min)
+        if self.regex is not None:
+            result["regex"] = from_union([from_none, from_str], self.regex)
+        result["searchable"] = from_bool(self.searchable)
+        result["symmetricalRef"] = from_bool(self.symmetrical_ref)
+        if self.text_language_mode is not None:
+            result["textLanguageMode"] = from_union([from_none, lambda x: to_enum(TextLanguageMode, x)], self.text_language_mode)
+        if self.tileset_uid is not None:
+            result["tilesetUid"] = from_union([from_none, from_int], self.tileset_uid)
+        result["type"] = from_str(self.field_definition_type)
+        result["uid"] = from_int(self.uid)
+        result["useForSmartColor"] = from_bool(self.use_for_smart_color)
+        return result
+
+
+class LimitBehavior(Enum):
+    """Possible values: `DiscardOldOnes`, `PreventAdding`, `MoveLastOne`"""
+    DISCARD_OLD_ONES = "DiscardOldOnes"
+    MOVE_LAST_ONE = "MoveLastOne"
+    PREVENT_ADDING = "PreventAdding"
+
+
+class LimitScope(Enum):
+    """If TRUE, the maxCount is a "per world" limit, if FALSE, it's a "per level". Possible
+    values: `PerLayer`, `PerLevel`, `PerWorld`
+    """
+    PER_LAYER = "PerLayer"
+    PER_LEVEL = "PerLevel"
+    PER_WORLD = "PerWorld"
+
+
+class RenderMode(Enum):
+    """Possible values: `Rectangle`, `Ellipse`, `Tile`, `Cross`"""
+    CROSS = "Cross"
+    ELLIPSE = "Ellipse"
+    RECTANGLE = "Rectangle"
+    TILE = "Tile"
+
+
+class TilesetRectangle:
+    """This object represents a custom sub rectangle in a Tileset image."""
+    h: int
+    """Height in pixels"""
+    tileset_uid: int
+    """UID of the tileset"""
+    w: int
+    """Width in pixels"""
+    x: int
+    """X pixels coordinate of the top-left corner in the Tileset image"""
+    y: int
+    """Y pixels coordinate of the top-left corner in the Tileset image"""
+
+    def __init__(self, h: int, tileset_uid: int, w: int, x: int, y: int) -> None:
+        self.h = h
+        self.tileset_uid = tileset_uid
+        self.w = w
+        self.x = x
+        self.y = y
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'TilesetRectangle':
+        assert isinstance(obj, dict)
+        h = from_int(obj.get("h"))
+        tileset_uid = from_int(obj.get("tilesetUid"))
+        w = from_int(obj.get("w"))
+        x = from_int(obj.get("x"))
+        y = from_int(obj.get("y"))
+        return TilesetRectangle(h, tileset_uid, w, x, y)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["h"] = from_int(self.h)
+        result["tilesetUid"] = from_int(self.tileset_uid)
+        result["w"] = from_int(self.w)
+        result["x"] = from_int(self.x)
+        result["y"] = from_int(self.y)
+        return result
+
+
+class TileRenderMode(Enum):
+    """An enum describing how the the Entity tile is rendered inside the Entity bounds. Possible
+    values: `Cover`, `FitInside`, `Repeat`, `Stretch`, `FullSizeCropped`,
+    `FullSizeUncropped`, `NineSlice`
+    """
+    COVER = "Cover"
+    FIT_INSIDE = "FitInside"
+    FULL_SIZE_CROPPED = "FullSizeCropped"
+    FULL_SIZE_UNCROPPED = "FullSizeUncropped"
+    NINE_SLICE = "NineSlice"
+    REPEAT = "Repeat"
+    STRETCH = "Stretch"
+
+
+class EntityDefinition:
+    allow_out_of_bounds: bool
+    """If enabled, this entity is allowed to stay outside of the current level bounds"""
+    color: str
+    """Base entity color"""
+    doc: Optional[str]
+    """User defined documentation for this element to provide help/tips to level designers."""
+    export_to_toc: bool
+    """If enabled, all instances of this entity will be listed in the project "Table of content"
+    object.
+    """
+    field_defs: List[FieldDefinition]
+    """Array of field definitions"""
+    fill_opacity: float
+    height: int
+    """Pixel height"""
+    hollow: bool
+    identifier: str
+    """User defined unique identifier"""
+    keep_aspect_ratio: bool
+    """Only applies to entities resizable on both X/Y. If TRUE, the entity instance width/height
+    will keep the same aspect ratio as the definition.
+    """
+    limit_behavior: LimitBehavior
+    """Possible values: `DiscardOldOnes`, `PreventAdding`, `MoveLastOne`"""
+    limit_scope: LimitScope
+    """If TRUE, the maxCount is a "per world" limit, if FALSE, it's a "per level". Possible
+    values: `PerLayer`, `PerLevel`, `PerWorld`
+    """
+    line_opacity: float
+    max_count: int
+    """Max instances count"""
+    max_height: Optional[int]
+    """Max pixel height (only applies if the entity is resizable on Y)"""
+    max_width: Optional[int]
+    """Max pixel width (only applies if the entity is resizable on X)"""
+    min_height: Optional[int]
+    """Min pixel height (only applies if the entity is resizable on Y)"""
+    min_width: Optional[int]
+    """Min pixel width (only applies if the entity is resizable on X)"""
+    nine_slice_borders: List[int]
+    """An array of 4 dimensions for the up/right/down/left borders (in this order) when using
+    9-slice mode for `tileRenderMode`.<br/>  If the tileRenderMode is not NineSlice, then
+    this array is empty.<br/>  See: https://en.wikipedia.org/wiki/9-slice_scaling
+    """
+    pivot_x: float
+    """Pivot X coordinate (from 0 to 1.0)"""
+    pivot_y: float
+    """Pivot Y coordinate (from 0 to 1.0)"""
+    render_mode: RenderMode
+    """Possible values: `rl.Rectangle`, `Ellipse`, `Tile`, `Cross`"""
+    resizable_x: bool
+    """If TRUE, the entity instances will be resizable horizontally"""
+    resizable_y: bool
+    """If TRUE, the entity instances will be resizable vertically"""
+    show_name: bool
+    """Display entity name in editor"""
+    tags: List[str]
+    """An array of strings that classifies this entity"""
+    tile_id: Optional[int]
+    """**WARNING**: this deprecated value is no longer exported since version 1.2.0  Replaced
+    by: `tileRect`
+    """
+    tile_opacity: float
+    tile_rect: Optional[TilesetRectangle]
+    """An object representing a rectangle from an existing Tileset"""
+    tile_render_mode: TileRenderMode
+    """An enum describing how the the Entity tile is rendered inside the Entity bounds. Possible
+    values: `Cover`, `FitInside`, `Repeat`, `Stretch`, `FullSizeCropped`,
+    `FullSizeUncropped`, `NineSlice`
+    """
+    tileset_id: Optional[int]
+    """Tileset ID used for optional tile display"""
+    uid: int
+    """Unique Int identifier"""
+    ui_tile_rect: Optional[TilesetRectangle]
+    """This tile overrides the one defined in `tileRect` in the UI"""
+    width: int
+    """Pixel width"""
+
+    def __init__(self, allow_out_of_bounds: bool, color: str, doc: Optional[str], export_to_toc: bool, field_defs: List[FieldDefinition], fill_opacity: float, height: int, hollow: bool, identifier: str, keep_aspect_ratio: bool, limit_behavior: LimitBehavior, limit_scope: LimitScope, line_opacity: float, max_count: int, max_height: Optional[int], max_width: Optional[int], min_height: Optional[int], min_width: Optional[int], nine_slice_borders: List[int], pivot_x: float, pivot_y: float, render_mode: RenderMode, resizable_x: bool, resizable_y: bool, show_name: bool, tags: List[str], tile_id: Optional[int], tile_opacity: float, tile_rect: Optional[TilesetRectangle], tile_render_mode: TileRenderMode, tileset_id: Optional[int], uid: int, ui_tile_rect: Optional[TilesetRectangle], width: int) -> None:
+        self.allow_out_of_bounds = allow_out_of_bounds
+        self.color = color
+        self.doc = doc
+        self.export_to_toc = export_to_toc
+        self.field_defs = field_defs
+        self.fill_opacity = fill_opacity
+        self.height = height
+        self.hollow = hollow
+        self.identifier = identifier
+        self.keep_aspect_ratio = keep_aspect_ratio
+        self.limit_behavior = limit_behavior
+        self.limit_scope = limit_scope
+        self.line_opacity = line_opacity
+        self.max_count = max_count
+        self.max_height = max_height
+        self.max_width = max_width
+        self.min_height = min_height
+        self.min_width = min_width
+        self.nine_slice_borders = nine_slice_borders
+        self.pivot_x = pivot_x
+        self.pivot_y = pivot_y
+        self.render_mode = render_mode
+        self.resizable_x = resizable_x
+        self.resizable_y = resizable_y
+        self.show_name = show_name
+        self.tags = tags
+        self.tile_id = tile_id
+        self.tile_opacity = tile_opacity
+        self.tile_rect = tile_rect
+        self.tile_render_mode = tile_render_mode
+        self.tileset_id = tileset_id
+        self.uid = uid
+        self.ui_tile_rect = ui_tile_rect
+        self.width = width
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'EntityDefinition':
+        assert isinstance(obj, dict)
+        allow_out_of_bounds = from_bool(obj.get("allowOutOfBounds"))
+        color = from_str(obj.get("color"))
+        doc = from_union([from_none, from_str], obj.get("doc"))
+        export_to_toc = from_bool(obj.get("exportToToc"))
+        field_defs = from_list(FieldDefinition.from_dict, obj.get("fieldDefs"))
+        fill_opacity = from_float(obj.get("fillOpacity"))
+        height = from_int(obj.get("height"))
+        hollow = from_bool(obj.get("hollow"))
+        identifier = from_str(obj.get("identifier"))
+        keep_aspect_ratio = from_bool(obj.get("keepAspectRatio"))
+        limit_behavior = LimitBehavior(obj.get("limitBehavior"))
+        limit_scope = LimitScope(obj.get("limitScope"))
+        line_opacity = from_float(obj.get("lineOpacity"))
+        max_count = from_int(obj.get("maxCount"))
+        max_height = from_union([from_none, from_int], obj.get("maxHeight"))
+        max_width = from_union([from_none, from_int], obj.get("maxWidth"))
+        min_height = from_union([from_none, from_int], obj.get("minHeight"))
+        min_width = from_union([from_none, from_int], obj.get("minWidth"))
+        nine_slice_borders = from_list(from_int, obj.get("nineSliceBorders"))
+        pivot_x = from_float(obj.get("pivotX"))
+        pivot_y = from_float(obj.get("pivotY"))
+        render_mode = RenderMode(obj.get("renderMode"))
+        resizable_x = from_bool(obj.get("resizableX"))
+        resizable_y = from_bool(obj.get("resizableY"))
+        show_name = from_bool(obj.get("showName"))
+        tags = from_list(from_str, obj.get("tags"))
+        tile_id = from_union([from_none, from_int], obj.get("tileId"))
+        tile_opacity = from_float(obj.get("tileOpacity"))
+        tile_rect = from_union([from_none, TilesetRectangle.from_dict], obj.get("tileRect"))
+        tile_render_mode = TileRenderMode(obj.get("tileRenderMode"))
+        tileset_id = from_union([from_none, from_int], obj.get("tilesetId"))
+        uid = from_int(obj.get("uid"))
+        ui_tile_rect = from_union([from_none, TilesetRectangle.from_dict], obj.get("uiTileRect"))
+        width = from_int(obj.get("width"))
+        return EntityDefinition(allow_out_of_bounds, color, doc, export_to_toc, field_defs, fill_opacity, height, hollow, identifier, keep_aspect_ratio, limit_behavior, limit_scope, line_opacity, max_count, max_height, max_width, min_height, min_width, nine_slice_borders, pivot_x, pivot_y, render_mode, resizable_x, resizable_y, show_name, tags, tile_id, tile_opacity, tile_rect, tile_render_mode, tileset_id, uid, ui_tile_rect, width)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["allowOutOfBounds"] = from_bool(self.allow_out_of_bounds)
+        result["color"] = from_str(self.color)
+        if self.doc is not None:
+            result["doc"] = from_union([from_none, from_str], self.doc)
+        result["exportToToc"] = from_bool(self.export_to_toc)
+        result["fieldDefs"] = from_list(lambda x: to_class(FieldDefinition, x), self.field_defs)
+        result["fillOpacity"] = to_float(self.fill_opacity)
+        result["height"] = from_int(self.height)
+        result["hollow"] = from_bool(self.hollow)
+        result["identifier"] = from_str(self.identifier)
+        result["keepAspectRatio"] = from_bool(self.keep_aspect_ratio)
+        result["limitBehavior"] = to_enum(LimitBehavior, self.limit_behavior)
+        result["limitScope"] = to_enum(LimitScope, self.limit_scope)
+        result["lineOpacity"] = to_float(self.line_opacity)
+        result["maxCount"] = from_int(self.max_count)
+        if self.max_height is not None:
+            result["maxHeight"] = from_union([from_none, from_int], self.max_height)
+        if self.max_width is not None:
+            result["maxWidth"] = from_union([from_none, from_int], self.max_width)
+        if self.min_height is not None:
+            result["minHeight"] = from_union([from_none, from_int], self.min_height)
+        if self.min_width is not None:
+            result["minWidth"] = from_union([from_none, from_int], self.min_width)
+        result["nineSliceBorders"] = from_list(from_int, self.nine_slice_borders)
+        result["pivotX"] = to_float(self.pivot_x)
+        result["pivotY"] = to_float(self.pivot_y)
+        result["renderMode"] = to_enum(RenderMode, self.render_mode)
+        result["resizableX"] = from_bool(self.resizable_x)
+        result["resizableY"] = from_bool(self.resizable_y)
+        result["showName"] = from_bool(self.show_name)
+        result["tags"] = from_list(from_str, self.tags)
+        if self.tile_id is not None:
+            result["tileId"] = from_union([from_none, from_int], self.tile_id)
+        result["tileOpacity"] = to_float(self.tile_opacity)
+        if self.tile_rect is not None:
+            result["tileRect"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.tile_rect)
+        result["tileRenderMode"] = to_enum(TileRenderMode, self.tile_render_mode)
+        if self.tileset_id is not None:
+            result["tilesetId"] = from_union([from_none, from_int], self.tileset_id)
+        result["uid"] = from_int(self.uid)
+        if self.ui_tile_rect is not None:
+            result["uiTileRect"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.ui_tile_rect)
+        result["width"] = from_int(self.width)
+        return result
+
+
+class EnumValueDefinition:
+    tile_src_rect: Optional[List[int]]
+    """**WARNING**: this deprecated value is no longer exported since version 1.4.0  Replaced
+    by: `tileRect`
+    """
+    color: int
+    """Optional color"""
+    id: str
+    """Enum value"""
+    tile_id: Optional[int]
+    """**WARNING**: this deprecated value is no longer exported since version 1.4.0  Replaced
+    by: `tileRect`
+    """
+    tile_rect: Optional[TilesetRectangle]
+    """Optional tileset rectangle to represents this value"""
+
+    def __init__(self, tile_src_rect: Optional[List[int]], color: int, id: str, tile_id: Optional[int], tile_rect: Optional[TilesetRectangle]) -> None:
+        self.tile_src_rect = tile_src_rect
+        self.color = color
+        self.id = id
+        self.tile_id = tile_id
+        self.tile_rect = tile_rect
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'EnumValueDefinition':
+        assert isinstance(obj, dict)
+        tile_src_rect = from_union([from_none, lambda x: from_list(from_int, x)], obj.get("__tileSrcRect"))
+        color = from_int(obj.get("color"))
+        id = from_str(obj.get("id"))
+        tile_id = from_union([from_none, from_int], obj.get("tileId"))
+        tile_rect = from_union([from_none, TilesetRectangle.from_dict], obj.get("tileRect"))
+        return EnumValueDefinition(tile_src_rect, color, id, tile_id, tile_rect)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        if self.tile_src_rect is not None:
+            result["__tileSrcRect"] = from_union([from_none, lambda x: from_list(from_int, x)], self.tile_src_rect)
+        result["color"] = from_int(self.color)
+        result["id"] = from_str(self.id)
+        if self.tile_id is not None:
+            result["tileId"] = from_union([from_none, from_int], self.tile_id)
+        if self.tile_rect is not None:
+            result["tileRect"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.tile_rect)
+        return result
+
+
+class EnumDefinition:
+    external_file_checksum: Optional[str]
+    external_rel_path: Optional[str]
+    """Relative path to the external file providing this Enum"""
+    icon_tileset_uid: Optional[int]
+    """Tileset UID if provided"""
+    identifier: str
+    """User defined unique identifier"""
+    tags: List[str]
+    """An array of user-defined tags to organize the Enums"""
+    uid: int
+    """Unique Int identifier"""
+    values: List[EnumValueDefinition]
+    """All possible enum values, with their optional Tile infos."""
+
+    def __init__(self, external_file_checksum: Optional[str], external_rel_path: Optional[str], icon_tileset_uid: Optional[int], identifier: str, tags: List[str], uid: int, values: List[EnumValueDefinition]) -> None:
+        self.external_file_checksum = external_file_checksum
+        self.external_rel_path = external_rel_path
+        self.icon_tileset_uid = icon_tileset_uid
+        self.identifier = identifier
+        self.tags = tags
+        self.uid = uid
+        self.values = values
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'EnumDefinition':
+        assert isinstance(obj, dict)
+        external_file_checksum = from_union([from_none, from_str], obj.get("externalFileChecksum"))
+        external_rel_path = from_union([from_none, from_str], obj.get("externalRelPath"))
+        icon_tileset_uid = from_union([from_none, from_int], obj.get("iconTilesetUid"))
+        identifier = from_str(obj.get("identifier"))
+        tags = from_list(from_str, obj.get("tags"))
+        uid = from_int(obj.get("uid"))
+        values = from_list(EnumValueDefinition.from_dict, obj.get("values"))
+        return EnumDefinition(external_file_checksum, external_rel_path, icon_tileset_uid, identifier, tags, uid, values)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        if self.external_file_checksum is not None:
+            result["externalFileChecksum"] = from_union([from_none, from_str], self.external_file_checksum)
+        if self.external_rel_path is not None:
+            result["externalRelPath"] = from_union([from_none, from_str], self.external_rel_path)
+        if self.icon_tileset_uid is not None:
+            result["iconTilesetUid"] = from_union([from_none, from_int], self.icon_tileset_uid)
+        result["identifier"] = from_str(self.identifier)
+        result["tags"] = from_list(from_str, self.tags)
+        result["uid"] = from_int(self.uid)
+        result["values"] = from_list(lambda x: to_class(EnumValueDefinition, x), self.values)
+        return result
+
+
+class Checker(Enum):
+    """Checker mode Possible values: `None`, `Horizontal`, `Vertical`"""
+    HORIZONTAL = "Horizontal"
+    NONE = "None"
+    VERTICAL = "Vertical"
+
+
+class TileMode(Enum):
+    """Defines how tileIds array is used Possible values: `Single`, `Stamp`"""
+    SINGLE = "Single"
+    STAMP = "Stamp"
+
+
+class AutoLayerRuleDefinition:
+    """This complex section isn't meant to be used by game devs at all, as these rules are
+    completely resolved internally by the editor before any saving. You should just ignore
+    this part.
+    """
+    active: bool
+    """If FALSE, the rule effect isn't applied, and no tiles are generated."""
+    alpha: float
+    break_on_match: bool
+    """When TRUE, the rule will prevent other rules to be applied in the same cell if it matches
+    (TRUE by default).
+    """
+    chance: float
+    """Chances for this rule to be applied (0 to 1)"""
+    checker: Checker
+    """Checker mode Possible values: `None`, `Horizontal`, `Vertical`"""
+    flip_x: bool
+    """If TRUE, allow rule to be matched by flipping its pattern horizontally"""
+    flip_y: bool
+    """If TRUE, allow rule to be matched by flipping its pattern vertically"""
+    invalidated: bool
+    """If TRUE, then the rule should be re-evaluated by the editor at one point"""
+    out_of_bounds_value: Optional[int]
+    """Default IntGrid value when checking cells outside of level bounds"""
+    pattern: List[int]
+    """Rule pattern (size x size)"""
+    perlin_active: bool
+    """If TRUE, enable Perlin filtering to only apply rule on specific random area"""
+    perlin_octaves: float
+    perlin_scale: float
+    perlin_seed: float
+    pivot_x: float
+    """X pivot of a tile stamp (0-1)"""
+    pivot_y: float
+    """Y pivot of a tile stamp (0-1)"""
+    size: int
+    """Pattern width & height. Should only be 1,3,5 or 7."""
+    tile_ids: Optional[List[int]]
+    """**WARNING**: this deprecated value is no longer exported since version 1.5.0  Replaced
+    by: `tileRectsIds`
+    """
+    tile_mode: TileMode
+    """Defines how tileIds array is used Possible values: `Single`, `Stamp`"""
+    tile_random_x_max: int
+    """Max random offset for X tile pos"""
+    tile_random_x_min: int
+    """Min random offset for X tile pos"""
+    tile_random_y_max: int
+    """Max random offset for Y tile pos"""
+    tile_random_y_min: int
+    """Min random offset for Y tile pos"""
+    tile_rects_ids: List[List[int]]
+    """Array containing all the possible tile IDs rectangles (picked randomly)."""
+    tile_x_offset: int
+    """Tile X offset"""
+    tile_y_offset: int
+    """Tile Y offset"""
+    uid: int
+    """Unique Int identifier"""
+    x_modulo: int
+    """X cell coord modulo"""
+    x_offset: int
+    """X cell start offset"""
+    y_modulo: int
+    """Y cell coord modulo"""
+    y_offset: int
+    """Y cell start offset"""
+
+    def __init__(self, active: bool, alpha: float, break_on_match: bool, chance: float, checker: Checker, flip_x: bool, flip_y: bool, invalidated: bool, out_of_bounds_value: Optional[int], pattern: List[int], perlin_active: bool, perlin_octaves: float, perlin_scale: float, perlin_seed: float, pivot_x: float, pivot_y: float, size: int, tile_ids: Optional[List[int]], tile_mode: TileMode, tile_random_x_max: int, tile_random_x_min: int, tile_random_y_max: int, tile_random_y_min: int, tile_rects_ids: List[List[int]], tile_x_offset: int, tile_y_offset: int, uid: int, x_modulo: int, x_offset: int, y_modulo: int, y_offset: int) -> None:
+        self.active = active
+        self.alpha = alpha
+        self.break_on_match = break_on_match
+        self.chance = chance
+        self.checker = checker
+        self.flip_x = flip_x
+        self.flip_y = flip_y
+        self.invalidated = invalidated
+        self.out_of_bounds_value = out_of_bounds_value
+        self.pattern = pattern
+        self.perlin_active = perlin_active
+        self.perlin_octaves = perlin_octaves
+        self.perlin_scale = perlin_scale
+        self.perlin_seed = perlin_seed
+        self.pivot_x = pivot_x
+        self.pivot_y = pivot_y
+        self.size = size
+        self.tile_ids = tile_ids
+        self.tile_mode = tile_mode
+        self.tile_random_x_max = tile_random_x_max
+        self.tile_random_x_min = tile_random_x_min
+        self.tile_random_y_max = tile_random_y_max
+        self.tile_random_y_min = tile_random_y_min
+        self.tile_rects_ids = tile_rects_ids
+        self.tile_x_offset = tile_x_offset
+        self.tile_y_offset = tile_y_offset
+        self.uid = uid
+        self.x_modulo = x_modulo
+        self.x_offset = x_offset
+        self.y_modulo = y_modulo
+        self.y_offset = y_offset
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'AutoLayerRuleDefinition':
+        assert isinstance(obj, dict)
+        active = from_bool(obj.get("active"))
+        alpha = from_float(obj.get("alpha"))
+        break_on_match = from_bool(obj.get("breakOnMatch"))
+        chance = from_float(obj.get("chance"))
+        checker = Checker(obj.get("checker"))
+        flip_x = from_bool(obj.get("flipX"))
+        flip_y = from_bool(obj.get("flipY"))
+        invalidated = from_bool(obj.get("invalidated"))
+        out_of_bounds_value = from_union([from_none, from_int], obj.get("outOfBoundsValue"))
+        pattern = from_list(from_int, obj.get("pattern"))
+        perlin_active = from_bool(obj.get("perlinActive"))
+        perlin_octaves = from_float(obj.get("perlinOctaves"))
+        perlin_scale = from_float(obj.get("perlinScale"))
+        perlin_seed = from_float(obj.get("perlinSeed"))
+        pivot_x = from_float(obj.get("pivotX"))
+        pivot_y = from_float(obj.get("pivotY"))
+        size = from_int(obj.get("size"))
+        tile_ids = from_union([from_none, lambda x: from_list(from_int, x)], obj.get("tileIds"))
+        tile_mode = TileMode(obj.get("tileMode"))
+        tile_random_x_max = from_int(obj.get("tileRandomXMax"))
+        tile_random_x_min = from_int(obj.get("tileRandomXMin"))
+        tile_random_y_max = from_int(obj.get("tileRandomYMax"))
+        tile_random_y_min = from_int(obj.get("tileRandomYMin"))
+        tile_rects_ids = from_list(lambda x: from_list(from_int, x), obj.get("tileRectsIds"))
+        tile_x_offset = from_int(obj.get("tileXOffset"))
+        tile_y_offset = from_int(obj.get("tileYOffset"))
+        uid = from_int(obj.get("uid"))
+        x_modulo = from_int(obj.get("xModulo"))
+        x_offset = from_int(obj.get("xOffset"))
+        y_modulo = from_int(obj.get("yModulo"))
+        y_offset = from_int(obj.get("yOffset"))
+        return AutoLayerRuleDefinition(active, alpha, break_on_match, chance, checker, flip_x, flip_y, invalidated, out_of_bounds_value, pattern, perlin_active, perlin_octaves, perlin_scale, perlin_seed, pivot_x, pivot_y, size, tile_ids, tile_mode, tile_random_x_max, tile_random_x_min, tile_random_y_max, tile_random_y_min, tile_rects_ids, tile_x_offset, tile_y_offset, uid, x_modulo, x_offset, y_modulo, y_offset)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["active"] = from_bool(self.active)
+        result["alpha"] = to_float(self.alpha)
+        result["breakOnMatch"] = from_bool(self.break_on_match)
+        result["chance"] = to_float(self.chance)
+        result["checker"] = to_enum(Checker, self.checker)
+        result["flipX"] = from_bool(self.flip_x)
+        result["flipY"] = from_bool(self.flip_y)
+        result["invalidated"] = from_bool(self.invalidated)
+        if self.out_of_bounds_value is not None:
+            result["outOfBoundsValue"] = from_union([from_none, from_int], self.out_of_bounds_value)
+        result["pattern"] = from_list(from_int, self.pattern)
+        result["perlinActive"] = from_bool(self.perlin_active)
+        result["perlinOctaves"] = to_float(self.perlin_octaves)
+        result["perlinScale"] = to_float(self.perlin_scale)
+        result["perlinSeed"] = to_float(self.perlin_seed)
+        result["pivotX"] = to_float(self.pivot_x)
+        result["pivotY"] = to_float(self.pivot_y)
+        result["size"] = from_int(self.size)
+        if self.tile_ids is not None:
+            result["tileIds"] = from_union([from_none, lambda x: from_list(from_int, x)], self.tile_ids)
+        result["tileMode"] = to_enum(TileMode, self.tile_mode)
+        result["tileRandomXMax"] = from_int(self.tile_random_x_max)
+        result["tileRandomXMin"] = from_int(self.tile_random_x_min)
+        result["tileRandomYMax"] = from_int(self.tile_random_y_max)
+        result["tileRandomYMin"] = from_int(self.tile_random_y_min)
+        result["tileRectsIds"] = from_list(lambda x: from_list(from_int, x), self.tile_rects_ids)
+        result["tileXOffset"] = from_int(self.tile_x_offset)
+        result["tileYOffset"] = from_int(self.tile_y_offset)
+        result["uid"] = from_int(self.uid)
+        result["xModulo"] = from_int(self.x_modulo)
+        result["xOffset"] = from_int(self.x_offset)
+        result["yModulo"] = from_int(self.y_modulo)
+        result["yOffset"] = from_int(self.y_offset)
+        return result
+
+
+class AutoLayerRuleGroup:
+    active: bool
+    biome_requirement_mode: int
+    collapsed: Optional[bool]
+    """*This field was removed in 1.0.0 and should no longer be used.*"""
+    color: Optional[str]
+    icon: Optional[TilesetRectangle]
+    is_optional: bool
+    name: str
+    required_biome_values: List[str]
+    rules: List[AutoLayerRuleDefinition]
+    uid: int
+    uses_wizard: bool
+
+    def __init__(self, active: bool, biome_requirement_mode: int, collapsed: Optional[bool], color: Optional[str], icon: Optional[TilesetRectangle], is_optional: bool, name: str, required_biome_values: List[str], rules: List[AutoLayerRuleDefinition], uid: int, uses_wizard: bool) -> None:
+        self.active = active
+        self.biome_requirement_mode = biome_requirement_mode
+        self.collapsed = collapsed
+        self.color = color
+        self.icon = icon
+        self.is_optional = is_optional
+        self.name = name
+        self.required_biome_values = required_biome_values
+        self.rules = rules
+        self.uid = uid
+        self.uses_wizard = uses_wizard
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'AutoLayerRuleGroup':
+        assert isinstance(obj, dict)
+        active = from_bool(obj.get("active"))
+        biome_requirement_mode = from_int(obj.get("biomeRequirementMode"))
+        collapsed = from_union([from_none, from_bool], obj.get("collapsed"))
+        color = from_union([from_none, from_str], obj.get("color"))
+        icon = from_union([from_none, TilesetRectangle.from_dict], obj.get("icon"))
+        is_optional = from_bool(obj.get("isOptional"))
+        name = from_str(obj.get("name"))
+        required_biome_values = from_list(from_str, obj.get("requiredBiomeValues"))
+        rules = from_list(AutoLayerRuleDefinition.from_dict, obj.get("rules"))
+        uid = from_int(obj.get("uid"))
+        uses_wizard = from_bool(obj.get("usesWizard"))
+        return AutoLayerRuleGroup(active, biome_requirement_mode, collapsed, color, icon, is_optional, name, required_biome_values, rules, uid, uses_wizard)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["active"] = from_bool(self.active)
+        result["biomeRequirementMode"] = from_int(self.biome_requirement_mode)
+        if self.collapsed is not None:
+            result["collapsed"] = from_union([from_none, from_bool], self.collapsed)
+        if self.color is not None:
+            result["color"] = from_union([from_none, from_str], self.color)
+        if self.icon is not None:
+            result["icon"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.icon)
+        result["isOptional"] = from_bool(self.is_optional)
+        result["name"] = from_str(self.name)
+        result["requiredBiomeValues"] = from_list(from_str, self.required_biome_values)
+        result["rules"] = from_list(lambda x: to_class(AutoLayerRuleDefinition, x), self.rules)
+        result["uid"] = from_int(self.uid)
+        result["usesWizard"] = from_bool(self.uses_wizard)
+        return result
+
+
+class IntGridValueDefinition:
+    """IntGrid value definition"""
+    color: str
+    group_uid: int
+    """Parent group identifier (0 if none)"""
+    identifier: Optional[str]
+    """User defined unique identifier"""
+    tile: Optional[TilesetRectangle]
+    value: int
+    """The IntGrid value itself"""
+
+    def __init__(self, color: str, group_uid: int, identifier: Optional[str], tile: Optional[TilesetRectangle], value: int) -> None:
+        self.color = color
+        self.group_uid = group_uid
+        self.identifier = identifier
+        self.tile = tile
+        self.value = value
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'IntGridValueDefinition':
+        assert isinstance(obj, dict)
+        color = from_str(obj.get("color"))
+        group_uid = from_int(obj.get("groupUid"))
+        identifier = from_union([from_none, from_str], obj.get("identifier"))
+        tile = from_union([from_none, TilesetRectangle.from_dict], obj.get("tile"))
+        value = from_int(obj.get("value"))
+        return IntGridValueDefinition(color, group_uid, identifier, tile, value)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["color"] = from_str(self.color)
+        result["groupUid"] = from_int(self.group_uid)
+        if self.identifier is not None:
+            result["identifier"] = from_union([from_none, from_str], self.identifier)
+        if self.tile is not None:
+            result["tile"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.tile)
+        result["value"] = from_int(self.value)
+        return result
+
+
+class IntGridValueGroupDefinition:
+    """IntGrid value group definition"""
+    color: Optional[str]
+    """User defined color"""
+    identifier: Optional[str]
+    """User defined string identifier"""
+    uid: int
+    """Group unique ID"""
+
+    def __init__(self, color: Optional[str], identifier: Optional[str], uid: int) -> None:
+        self.color = color
+        self.identifier = identifier
+        self.uid = uid
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'IntGridValueGroupDefinition':
+        assert isinstance(obj, dict)
+        color = from_union([from_none, from_str], obj.get("color"))
+        identifier = from_union([from_none, from_str], obj.get("identifier"))
+        uid = from_int(obj.get("uid"))
+        return IntGridValueGroupDefinition(color, identifier, uid)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        if self.color is not None:
+            result["color"] = from_union([from_none, from_str], self.color)
+        if self.identifier is not None:
+            result["identifier"] = from_union([from_none, from_str], self.identifier)
+        result["uid"] = from_int(self.uid)
+        return result
+
+
+class TypeEnum(Enum):
+    """Type of the layer as Haxe Enum Possible values: `IntGrid`, `Entities`, `Tiles`,
+    `AutoLayer`
+    """
+    AUTO_LAYER = "AutoLayer"
+    ENTITIES = "Entities"
+    INT_GRID = "IntGrid"
+    TILES = "Tiles"
+
+
+class LayerDefinition:
+    type: str
+    """Type of the layer (*IntGrid, Entities, Tiles or AutoLayer*)"""
+    auto_rule_groups: List[AutoLayerRuleGroup]
+    """Contains all the auto-layer rule definitions."""
+    auto_source_layer_def_uid: Optional[int]
+    auto_tileset_def_uid: Optional[int]
+    """**WARNING**: this deprecated value is no longer exported since version 1.2.0  Replaced
+    by: `tilesetDefUid`
+    """
+    auto_tiles_killed_by_other_layer_uid: Optional[int]
+    biome_field_uid: Optional[int]
+    can_select_when_inactive: bool
+    """Allow editor selections when the layer is not currently active."""
+    display_opacity: float
+    """Opacity of the layer (0 to 1.0)"""
+    doc: Optional[str]
+    """User defined documentation for this element to provide help/tips to level designers."""
+    excluded_tags: List[str]
+    """An array of tags to forbid some Entities in this layer"""
+    grid_size: int
+    """Width and height of the grid in pixels"""
+    guide_grid_hei: int
+    """Height of the optional "guide" grid in pixels"""
+    guide_grid_wid: int
+    """Width of the optional "guide" grid in pixels"""
+    hide_fields_when_inactive: bool
+    hide_in_list: bool
+    """Hide the layer from the list on the side of the editor view."""
+    identifier: str
+    """User defined unique identifier"""
+    inactive_opacity: float
+    """Alpha of this layer when it is not the active one."""
+    int_grid_values: List[IntGridValueDefinition]
+    """An array that defines extra optional info for each IntGrid value.<br/>  WARNING: the
+    array order is not related to actual IntGrid values! As user can re-order IntGrid values
+    freely, you may value "2" before value "1" in this array.
+    """
+    int_grid_values_groups: List[IntGridValueGroupDefinition]
+    """Group informations for IntGrid values"""
+    parallax_factor_x: float
+    """Parallax horizontal factor (from -1 to 1, defaults to 0) which affects the scrolling
+    speed of this layer, creating a fake 3D (parallax) effect.
+    """
+    parallax_factor_y: float
+    """Parallax vertical factor (from -1 to 1, defaults to 0) which affects the scrolling speed
+    of this layer, creating a fake 3D (parallax) effect.
+    """
+    parallax_scaling: bool
+    """If true (default), a layer with a parallax factor will also be scaled up/down accordingly."""
+    px_offset_x: int
+    """X offset of the layer, in pixels (IMPORTANT: this should be added to the `LayerInstance`
+    optional offset)
+    """
+    px_offset_y: int
+    """Y offset of the layer, in pixels (IMPORTANT: this should be added to the `LayerInstance`
+    optional offset)
+    """
+    render_in_world_view: bool
+    """If TRUE, the content of this layer will be used when rendering levels in a simplified way
+    for the world view
+    """
+    required_tags: List[str]
+    """An array of tags to filter Entities that can be added to this layer"""
+    tile_pivot_x: float
+    """If the tiles are smaller or larger than the layer grid, the pivot value will be used to
+    position the tile relatively its grid cell.
+    """
+    tile_pivot_y: float
+    """If the tiles are smaller or larger than the layer grid, the pivot value will be used to
+    position the tile relatively its grid cell.
+    """
+    tileset_def_uid: Optional[int]
+    """Reference to the default Tileset UID being used by this layer definition.<br/>
+    **WARNING**: some layer *instances* might use a different tileset. So most of the time,
+    you should probably use the `__tilesetDefUid` value found in layer instances.<br/>  Note:
+    since version 1.0.0, the old `autoTilesetDefUid` was removed and merged into this value.
+    """
+    layer_definition_type: TypeEnum
+    """Type of the layer as Haxe Enum Possible values: `IntGrid`, `Entities`, `Tiles`,
+    `AutoLayer`
+    """
+    ui_color: Optional[str]
+    """User defined color for the UI"""
+    uid: int
+    """Unique Int identifier"""
+    ui_filter_tags: List[str]
+    """Display tags"""
+    use_async_render: bool
+    """Asynchronous rendering option for large/complex layers"""
+
+    def __init__(self, type: str, auto_rule_groups: List[AutoLayerRuleGroup], auto_source_layer_def_uid: Optional[int], auto_tileset_def_uid: Optional[int], auto_tiles_killed_by_other_layer_uid: Optional[int], biome_field_uid: Optional[int], can_select_when_inactive: bool, display_opacity: float, doc: Optional[str], excluded_tags: List[str], grid_size: int, guide_grid_hei: int, guide_grid_wid: int, hide_fields_when_inactive: bool, hide_in_list: bool, identifier: str, inactive_opacity: float, int_grid_values: List[IntGridValueDefinition], int_grid_values_groups: List[IntGridValueGroupDefinition], parallax_factor_x: float, parallax_factor_y: float, parallax_scaling: bool, px_offset_x: int, px_offset_y: int, render_in_world_view: bool, required_tags: List[str], tile_pivot_x: float, tile_pivot_y: float, tileset_def_uid: Optional[int], layer_definition_type: TypeEnum, ui_color: Optional[str], uid: int, ui_filter_tags: List[str], use_async_render: bool) -> None:
+        self.type = type
+        self.auto_rule_groups = auto_rule_groups
+        self.auto_source_layer_def_uid = auto_source_layer_def_uid
+        self.auto_tileset_def_uid = auto_tileset_def_uid
+        self.auto_tiles_killed_by_other_layer_uid = auto_tiles_killed_by_other_layer_uid
+        self.biome_field_uid = biome_field_uid
+        self.can_select_when_inactive = can_select_when_inactive
+        self.display_opacity = display_opacity
+        self.doc = doc
+        self.excluded_tags = excluded_tags
+        self.grid_size = grid_size
+        self.guide_grid_hei = guide_grid_hei
+        self.guide_grid_wid = guide_grid_wid
+        self.hide_fields_when_inactive = hide_fields_when_inactive
+        self.hide_in_list = hide_in_list
+        self.identifier = identifier
+        self.inactive_opacity = inactive_opacity
+        self.int_grid_values = int_grid_values
+        self.int_grid_values_groups = int_grid_values_groups
+        self.parallax_factor_x = parallax_factor_x
+        self.parallax_factor_y = parallax_factor_y
+        self.parallax_scaling = parallax_scaling
+        self.px_offset_x = px_offset_x
+        self.px_offset_y = px_offset_y
+        self.render_in_world_view = render_in_world_view
+        self.required_tags = required_tags
+        self.tile_pivot_x = tile_pivot_x
+        self.tile_pivot_y = tile_pivot_y
+        self.tileset_def_uid = tileset_def_uid
+        self.layer_definition_type = layer_definition_type
+        self.ui_color = ui_color
+        self.uid = uid
+        self.ui_filter_tags = ui_filter_tags
+        self.use_async_render = use_async_render
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'LayerDefinition':
+        assert isinstance(obj, dict)
+        type = from_str(obj.get("__type"))
+        auto_rule_groups = from_list(AutoLayerRuleGroup.from_dict, obj.get("autoRuleGroups"))
+        auto_source_layer_def_uid = from_union([from_none, from_int], obj.get("autoSourceLayerDefUid"))
+        auto_tileset_def_uid = from_union([from_none, from_int], obj.get("autoTilesetDefUid"))
+        auto_tiles_killed_by_other_layer_uid = from_union([from_none, from_int], obj.get("autoTilesKilledByOtherLayerUid"))
+        biome_field_uid = from_union([from_none, from_int], obj.get("biomeFieldUid"))
+        can_select_when_inactive = from_bool(obj.get("canSelectWhenInactive"))
+        display_opacity = from_float(obj.get("displayOpacity"))
+        doc = from_union([from_none, from_str], obj.get("doc"))
+        excluded_tags = from_list(from_str, obj.get("excludedTags"))
+        grid_size = from_int(obj.get("gridSize"))
+        guide_grid_hei = from_int(obj.get("guideGridHei"))
+        guide_grid_wid = from_int(obj.get("guideGridWid"))
+        hide_fields_when_inactive = from_bool(obj.get("hideFieldsWhenInactive"))
+        hide_in_list = from_bool(obj.get("hideInList"))
+        identifier = from_str(obj.get("identifier"))
+        inactive_opacity = from_float(obj.get("inactiveOpacity"))
+        int_grid_values = from_list(IntGridValueDefinition.from_dict, obj.get("intGridValues"))
+        int_grid_values_groups = from_list(IntGridValueGroupDefinition.from_dict, obj.get("intGridValuesGroups"))
+        parallax_factor_x = from_float(obj.get("parallaxFactorX"))
+        parallax_factor_y = from_float(obj.get("parallaxFactorY"))
+        parallax_scaling = from_bool(obj.get("parallaxScaling"))
+        px_offset_x = from_int(obj.get("pxOffsetX"))
+        px_offset_y = from_int(obj.get("pxOffsetY"))
+        render_in_world_view = from_bool(obj.get("renderInWorldView"))
+        required_tags = from_list(from_str, obj.get("requiredTags"))
+        tile_pivot_x = from_float(obj.get("tilePivotX"))
+        tile_pivot_y = from_float(obj.get("tilePivotY"))
+        tileset_def_uid = from_union([from_none, from_int], obj.get("tilesetDefUid"))
+        layer_definition_type = TypeEnum(obj.get("type"))
+        ui_color = from_union([from_none, from_str], obj.get("uiColor"))
+        uid = from_int(obj.get("uid"))
+        ui_filter_tags = from_list(from_str, obj.get("uiFilterTags"))
+        use_async_render = from_bool(obj.get("useAsyncRender"))
+        return LayerDefinition(type, auto_rule_groups, auto_source_layer_def_uid, auto_tileset_def_uid, auto_tiles_killed_by_other_layer_uid, biome_field_uid, can_select_when_inactive, display_opacity, doc, excluded_tags, grid_size, guide_grid_hei, guide_grid_wid, hide_fields_when_inactive, hide_in_list, identifier, inactive_opacity, int_grid_values, int_grid_values_groups, parallax_factor_x, parallax_factor_y, parallax_scaling, px_offset_x, px_offset_y, render_in_world_view, required_tags, tile_pivot_x, tile_pivot_y, tileset_def_uid, layer_definition_type, ui_color, uid, ui_filter_tags, use_async_render)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["__type"] = from_str(self.type)
+        result["autoRuleGroups"] = from_list(lambda x: to_class(AutoLayerRuleGroup, x), self.auto_rule_groups)
+        if self.auto_source_layer_def_uid is not None:
+            result["autoSourceLayerDefUid"] = from_union([from_none, from_int], self.auto_source_layer_def_uid)
+        if self.auto_tileset_def_uid is not None:
+            result["autoTilesetDefUid"] = from_union([from_none, from_int], self.auto_tileset_def_uid)
+        if self.auto_tiles_killed_by_other_layer_uid is not None:
+            result["autoTilesKilledByOtherLayerUid"] = from_union([from_none, from_int], self.auto_tiles_killed_by_other_layer_uid)
+        if self.biome_field_uid is not None:
+            result["biomeFieldUid"] = from_union([from_none, from_int], self.biome_field_uid)
+        result["canSelectWhenInactive"] = from_bool(self.can_select_when_inactive)
+        result["displayOpacity"] = to_float(self.display_opacity)
+        if self.doc is not None:
+            result["doc"] = from_union([from_none, from_str], self.doc)
+        result["excludedTags"] = from_list(from_str, self.excluded_tags)
+        result["gridSize"] = from_int(self.grid_size)
+        result["guideGridHei"] = from_int(self.guide_grid_hei)
+        result["guideGridWid"] = from_int(self.guide_grid_wid)
+        result["hideFieldsWhenInactive"] = from_bool(self.hide_fields_when_inactive)
+        result["hideInList"] = from_bool(self.hide_in_list)
+        result["identifier"] = from_str(self.identifier)
+        result["inactiveOpacity"] = to_float(self.inactive_opacity)
+        result["intGridValues"] = from_list(lambda x: to_class(IntGridValueDefinition, x), self.int_grid_values)
+        result["intGridValuesGroups"] = from_list(lambda x: to_class(IntGridValueGroupDefinition, x), self.int_grid_values_groups)
+        result["parallaxFactorX"] = to_float(self.parallax_factor_x)
+        result["parallaxFactorY"] = to_float(self.parallax_factor_y)
+        result["parallaxScaling"] = from_bool(self.parallax_scaling)
+        result["pxOffsetX"] = from_int(self.px_offset_x)
+        result["pxOffsetY"] = from_int(self.px_offset_y)
+        result["renderInWorldView"] = from_bool(self.render_in_world_view)
+        result["requiredTags"] = from_list(from_str, self.required_tags)
+        result["tilePivotX"] = to_float(self.tile_pivot_x)
+        result["tilePivotY"] = to_float(self.tile_pivot_y)
+        if self.tileset_def_uid is not None:
+            result["tilesetDefUid"] = from_union([from_none, from_int], self.tileset_def_uid)
+        result["type"] = to_enum(TypeEnum, self.layer_definition_type)
+        if self.ui_color is not None:
+            result["uiColor"] = from_union([from_none, from_str], self.ui_color)
+        result["uid"] = from_int(self.uid)
+        result["uiFilterTags"] = from_list(from_str, self.ui_filter_tags)
+        result["useAsyncRender"] = from_bool(self.use_async_render)
+        return result
+
+
+class TileCustomMetadata:
+    """In a tileset definition, user defined meta-data of a tile."""
+    data: str
+    tile_id: int
+
+    def __init__(self, data: str, tile_id: int) -> None:
+        self.data = data
+        self.tile_id = tile_id
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'TileCustomMetadata':
+        assert isinstance(obj, dict)
+        data = from_str(obj.get("data"))
+        tile_id = from_int(obj.get("tileId"))
+        return TileCustomMetadata(data, tile_id)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["data"] = from_str(self.data)
+        result["tileId"] = from_int(self.tile_id)
+        return result
+
+
+class EmbedAtlas(Enum):
+    LDTK_ICONS = "LdtkIcons"
+
+
+class EnumTagValue:
+    """In a tileset definition, enum based tag infos"""
+    enum_value_id: str
+    tile_ids: List[int]
+
+    def __init__(self, enum_value_id: str, tile_ids: List[int]) -> None:
+        self.enum_value_id = enum_value_id
+        self.tile_ids = tile_ids
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'EnumTagValue':
+        assert isinstance(obj, dict)
+        enum_value_id = from_str(obj.get("enumValueId"))
+        tile_ids = from_list(from_int, obj.get("tileIds"))
+        return EnumTagValue(enum_value_id, tile_ids)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["enumValueId"] = from_str(self.enum_value_id)
+        result["tileIds"] = from_list(from_int, self.tile_ids)
+        return result
+
+
+class TilesetDefinition:
+    """The `Tileset` definition is the most important part among project definitions. It
+    contains some extra informations about each integrated tileset. If you only had to parse
+    one definition section, that would be the one.
+    """
+    c_hei: int
+    """Grid-based height"""
+    c_wid: int
+    """Grid-based width"""
+    cached_pixel_data: Optional[Dict[str, Any]]
+    """The following data is used internally for various optimizations. It's always synced with
+    source image changes.
+    """
+    custom_data: List[TileCustomMetadata]
+    """An array of custom tile metadata"""
+    embed_atlas: Optional[EmbedAtlas]
+    """If this value is set, then it means that this atlas uses an internal LDtk atlas image
+    instead of a loaded one. Possible values: &lt;`null`&gt;, `LdtkIcons`
+    """
+    enum_tags: List[EnumTagValue]
+    """Tileset tags using Enum values specified by `tagsSourceEnumId`. This array contains 1
+    element per Enum value, which contains an array of all Tile IDs that are tagged with it.
+    """
+    identifier: str
+    """User defined unique identifier"""
+    padding: int
+    """Distance in pixels from image borders"""
+    px_hei: int
+    """Image height in pixels"""
+    px_wid: int
+    """Image width in pixels"""
+    rel_path: Optional[str]
+    """Path to the source file, relative to the current project JSON file<br/>  It can be null
+    if no image was provided, or when using an embed atlas.
+    """
+    saved_selections: List[Dict[str, Any]]
+    """Array of group of tiles selections, only meant to be used in the editor"""
+    spacing: int
+    """Space in pixels between all tiles"""
+    tags: List[str]
+    """An array of user-defined tags to organize the Tilesets"""
+    tags_source_enum_uid: Optional[int]
+    """Optional Enum definition UID used for this tileset meta-data"""
+    tile_grid_size: int
+    uid: int
+    """Unique Intidentifier"""
+
+    def __init__(self, c_hei: int, c_wid: int, cached_pixel_data: Optional[Dict[str, Any]], custom_data: List[TileCustomMetadata], embed_atlas: Optional[EmbedAtlas], enum_tags: List[EnumTagValue], identifier: str, padding: int, px_hei: int, px_wid: int, rel_path: Optional[str], saved_selections: List[Dict[str, Any]], spacing: int, tags: List[str], tags_source_enum_uid: Optional[int], tile_grid_size: int, uid: int) -> None:
+        self.c_hei = c_hei
+        self.c_wid = c_wid
+        self.cached_pixel_data = cached_pixel_data
+        self.custom_data = custom_data
+        self.embed_atlas = embed_atlas
+        self.enum_tags = enum_tags
+        self.identifier = identifier
+        self.padding = padding
+        self.px_hei = px_hei
+        self.px_wid = px_wid
+        self.rel_path = rel_path
+        self.saved_selections = saved_selections
+        self.spacing = spacing
+        self.tags = tags
+        self.tags_source_enum_uid = tags_source_enum_uid
+        self.tile_grid_size = tile_grid_size
+        self.uid = uid
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'TilesetDefinition':
+        assert isinstance(obj, dict)
+        c_hei = from_int(obj.get("__cHei"))
+        c_wid = from_int(obj.get("__cWid"))
+        cached_pixel_data = from_union([from_none, lambda x: from_dict(lambda x: x, x)], obj.get("cachedPixelData"))
+        custom_data = from_list(TileCustomMetadata.from_dict, obj.get("customData"))
+        embed_atlas = from_union([from_none, EmbedAtlas], obj.get("embedAtlas"))
+        enum_tags = from_list(EnumTagValue.from_dict, obj.get("enumTags"))
+        identifier = from_str(obj.get("identifier"))
+        padding = from_int(obj.get("padding"))
+        px_hei = from_int(obj.get("pxHei"))
+        px_wid = from_int(obj.get("pxWid"))
+        rel_path = from_union([from_none, from_str], obj.get("relPath"))
+        saved_selections = from_list(lambda x: from_dict(lambda x: x, x), obj.get("savedSelections"))
+        spacing = from_int(obj.get("spacing"))
+        tags = from_list(from_str, obj.get("tags"))
+        tags_source_enum_uid = from_union([from_none, from_int], obj.get("tagsSourceEnumUid"))
+        tile_grid_size = from_int(obj.get("tileGridSize"))
+        uid = from_int(obj.get("uid"))
+        return TilesetDefinition(c_hei, c_wid, cached_pixel_data, custom_data, embed_atlas, enum_tags, identifier, padding, px_hei, px_wid, rel_path, saved_selections, spacing, tags, tags_source_enum_uid, tile_grid_size, uid)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["__cHei"] = from_int(self.c_hei)
+        result["__cWid"] = from_int(self.c_wid)
+        if self.cached_pixel_data is not None:
+            result["cachedPixelData"] = from_union([from_none, lambda x: from_dict(lambda x: x, x)], self.cached_pixel_data)
+        result["customData"] = from_list(lambda x: to_class(TileCustomMetadata, x), self.custom_data)
+        if self.embed_atlas is not None:
+            result["embedAtlas"] = from_union([from_none, lambda x: to_enum(EmbedAtlas, x)], self.embed_atlas)
+        result["enumTags"] = from_list(lambda x: to_class(EnumTagValue, x), self.enum_tags)
+        result["identifier"] = from_str(self.identifier)
+        result["padding"] = from_int(self.padding)
+        result["pxHei"] = from_int(self.px_hei)
+        result["pxWid"] = from_int(self.px_wid)
+        if self.rel_path is not None:
+            result["relPath"] = from_union([from_none, from_str], self.rel_path)
+        result["savedSelections"] = from_list(lambda x: from_dict(lambda x: x, x), self.saved_selections)
+        result["spacing"] = from_int(self.spacing)
+        result["tags"] = from_list(from_str, self.tags)
+        if self.tags_source_enum_uid is not None:
+            result["tagsSourceEnumUid"] = from_union([from_none, from_int], self.tags_source_enum_uid)
+        result["tileGridSize"] = from_int(self.tile_grid_size)
+        result["uid"] = from_int(self.uid)
+        return result
+
+
+class Definitions:
+    """If you're writing your own LDtk importer, you should probably just ignore *most* stuff in
+    the `defs` section, as it contains data that are mostly important to the editor. To keep
+    you away from the `defs` section and avoid some unnecessary JSON parsing, important data
+    from definitions is often duplicated in fields prefixed with a double underscore (eg.
+    `__identifier` or `__type`).  The 2 only definition types you might need here are
+    **Tilesets** and **Enums**.
+
+    A structure containing all the definitions of this project
+    """
+    entities: List[EntityDefinition]
+    """All entities definitions, including their custom fields"""
+    enums: List[EnumDefinition]
+    """All internal enums"""
+    external_enums: List[EnumDefinition]
+    """Note: external enums are exactly the same as `enums`, except they have a `relPath` to
+    point to an external source file.
+    """
+    layers: List[LayerDefinition]
+    """All layer definitions"""
+    level_fields: List[FieldDefinition]
+    """All custom fields available to all levels."""
+    tilesets: List[TilesetDefinition]
+    """All tilesets"""
+
+    def __init__(self, entities: List[EntityDefinition], enums: List[EnumDefinition], external_enums: List[EnumDefinition], layers: List[LayerDefinition], level_fields: List[FieldDefinition], tilesets: List[TilesetDefinition]) -> None:
+        self.entities = entities
+        self.enums = enums
+        self.external_enums = external_enums
+        self.layers = layers
+        self.level_fields = level_fields
+        self.tilesets = tilesets
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'Definitions':
+        assert isinstance(obj, dict)
+        entities = from_list(EntityDefinition.from_dict, obj.get("entities"))
+        enums = from_list(EnumDefinition.from_dict, obj.get("enums"))
+        external_enums = from_list(EnumDefinition.from_dict, obj.get("externalEnums"))
+        layers = from_list(LayerDefinition.from_dict, obj.get("layers"))
+        level_fields = from_list(FieldDefinition.from_dict, obj.get("levelFields"))
+        tilesets = from_list(TilesetDefinition.from_dict, obj.get("tilesets"))
+        return Definitions(entities, enums, external_enums, layers, level_fields, tilesets)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["entities"] = from_list(lambda x: to_class(EntityDefinition, x), self.entities)
+        result["enums"] = from_list(lambda x: to_class(EnumDefinition, x), self.enums)
+        result["externalEnums"] = from_list(lambda x: to_class(EnumDefinition, x), self.external_enums)
+        result["layers"] = from_list(lambda x: to_class(LayerDefinition, x), self.layers)
+        result["levelFields"] = from_list(lambda x: to_class(FieldDefinition, x), self.level_fields)
+        result["tilesets"] = from_list(lambda x: to_class(TilesetDefinition, x), self.tilesets)
+        return result
+
+
+class Flag(Enum):
+    DISCARD_PRE_CSV_INT_GRID = "DiscardPreCsvIntGrid"
+    EXPORT_OLD_TABLE_OF_CONTENT_DATA = "ExportOldTableOfContentData"
+    EXPORT_PRE_CSV_INT_GRID_FORMAT = "ExportPreCsvIntGridFormat"
+    IGNORE_BACKUP_SUGGEST = "IgnoreBackupSuggest"
+    MULTI_WORLDS = "MultiWorlds"
+    PREPEND_INDEX_TO_LEVEL_FILE_NAMES = "PrependIndexToLevelFileNames"
+    USE_MULTILINES_TYPE = "UseMultilinesType"
+
+
+class FieldInstance:
+    identifier: str
+    """Field definition identifier"""
+    tile: Optional[TilesetRectangle]
+    """Optional TilesetRect used to display this field (this can be the field own Tile, or some
+    other Tile guessed from the value, like an Enum).
+    """
+    type: str
+    """Type of the field, such as `Int`, `Float`, `String`, `Enum(my_enum_name)`, `Bool`,
+    etc.<br/>  NOTE: if you enable the advanced option **Use Multilines type**, you will have
+    "*Multilines*" instead of "*String*" when relevant.
+    """
+    value: Any
+    """Actual value of the field instance. The value type varies, depending on `__type`:<br/>
+    - For **classic types** (ie. Integer, Float, Boolean, String, Text and FilePath), you
+    just get the actual value with the expected type.<br/>   - For **rl.Color**, the value is an
+    hexadecimal string using "#rrggbb" format.<br/>   - For **Enum**, the value is a String
+    representing the selected enum value.<br/>   - For **Point**, the value is a
+    [GridPoint](#ldtk-GridPoint) object.<br/>   - For **Tile**, the value is a
+    [TilesetRect](#ldtk-TilesetRect) object.<br/>   - For **EntityRef**, the value is an
+    [EntityReferenceInfos](#ldtk-EntityReferenceInfos) object.<br/><br/>  If the field is an
+    array, then this `__value` will also be a JSON array.
+    """
+    def_uid: int
+    """Reference of the **Field definition** UID"""
+    real_editor_values: List[Any]
+    """Editor internal raw values"""
+
+    def __init__(self, identifier: str, tile: Optional[TilesetRectangle], type: str, value: Any, def_uid: int, real_editor_values: List[Any]) -> None:
+        self.identifier = identifier
+        self.tile = tile
+        self.type = type
+        self.value = value
+        self.def_uid = def_uid
+        self.real_editor_values = real_editor_values
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'FieldInstance':
+        assert isinstance(obj, dict)
+        identifier = from_str(obj.get("__identifier"))
+        tile = from_union([from_none, TilesetRectangle.from_dict], obj.get("__tile"))
+        type = from_str(obj.get("__type"))
+        value = obj.get("__value")
+        def_uid = from_int(obj.get("defUid"))
+        real_editor_values = from_list(lambda x: x, obj.get("realEditorValues"))
+        return FieldInstance(identifier, tile, type, value, def_uid, real_editor_values)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["__identifier"] = from_str(self.identifier)
+        if self.tile is not None:
+            result["__tile"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.tile)
+        result["__type"] = from_str(self.type)
+        result["__value"] = self.value
+        result["defUid"] = from_int(self.def_uid)
+        result["realEditorValues"] = from_list(lambda x: x, self.real_editor_values)
+        return result
+
+
+class EntityInstance:
+    grid: List[int]
+    """Grid-based coordinates (`[x,y]` format)"""
+    identifier: str
+    """Entity definition identifier"""
+    pivot: List[float]
+    """Pivot coordinates  (`[x,y]` format, values are from 0 to 1) of the Entity"""
+    smart_color: str
+    """The entity "smart" color, guessed from either Entity definition, or one its field
+    instances.
+    """
+    tags: List[str]
+    """Array of tags defined in this Entity definition"""
+    tile: Optional[TilesetRectangle]
+    """Optional TilesetRect used to display this entity (it could either be the default Entity
+    tile, or some tile provided by a field value, like an Enum).
+    """
+    world_x: Optional[int]
+    """X world coordinate in pixels. Only available in GridVania or Free world layouts."""
+    world_y: Optional[int]
+    """Y world coordinate in pixels Only available in GridVania or Free world layouts."""
+    def_uid: int
+    """Reference of the **Entity definition** UID"""
+    field_instances: List[FieldInstance]
+    """An array of all custom fields and their values."""
+    height: int
+    """Entity height in pixels. For non-resizable entities, it will be the same as Entity
+    definition.
+    """
+    iid: str
+    """Unique instance identifier"""
+    px: List[int]
+    """Pixel coordinates (`[x,y]` format) in current level coordinate space. Don't forget
+    optional layer offsets, if they exist!
+    """
+    width: int
+    """Entity width in pixels. For non-resizable entities, it will be the same as Entity
+    definition.
+    """
+
+    def __init__(self, grid: List[int], identifier: str, pivot: List[float], smart_color: str, tags: List[str], tile: Optional[TilesetRectangle], world_x: Optional[int], world_y: Optional[int], def_uid: int, field_instances: List[FieldInstance], height: int, iid: str, px: List[int], width: int) -> None:
+        self.grid = grid
+        self.identifier = identifier
+        self.pivot = pivot
+        self.smart_color = smart_color
+        self.tags = tags
+        self.tile = tile
+        self.world_x = world_x
+        self.world_y = world_y
+        self.def_uid = def_uid
+        self.field_instances = field_instances
+        self.height = height
+        self.iid = iid
+        self.px = px
+        self.width = width
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'EntityInstance':
+        assert isinstance(obj, dict)
+        grid = from_list(from_int, obj.get("__grid"))
+        identifier = from_str(obj.get("__identifier"))
+        pivot = from_list(from_float, obj.get("__pivot"))
+        smart_color = from_str(obj.get("__smartColor"))
+        tags = from_list(from_str, obj.get("__tags"))
+        tile = from_union([from_none, TilesetRectangle.from_dict], obj.get("__tile"))
+        world_x = from_union([from_none, from_int], obj.get("__worldX"))
+        world_y = from_union([from_none, from_int], obj.get("__worldY"))
+        def_uid = from_int(obj.get("defUid"))
+        field_instances = from_list(FieldInstance.from_dict, obj.get("fieldInstances"))
+        height = from_int(obj.get("height"))
+        iid = from_str(obj.get("iid"))
+        px = from_list(from_int, obj.get("px"))
+        width = from_int(obj.get("width"))
+        return EntityInstance(grid, identifier, pivot, smart_color, tags, tile, world_x, world_y, def_uid, field_instances, height, iid, px, width)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["__grid"] = from_list(from_int, self.grid)
+        result["__identifier"] = from_str(self.identifier)
+        result["__pivot"] = from_list(to_float, self.pivot)
+        result["__smartColor"] = from_str(self.smart_color)
+        result["__tags"] = from_list(from_str, self.tags)
+        if self.tile is not None:
+            result["__tile"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.tile)
+        if self.world_x is not None:
+            result["__worldX"] = from_union([from_none, from_int], self.world_x)
+        if self.world_y is not None:
+            result["__worldY"] = from_union([from_none, from_int], self.world_y)
+        result["defUid"] = from_int(self.def_uid)
+        result["fieldInstances"] = from_list(lambda x: to_class(FieldInstance, x), self.field_instances)
+        result["height"] = from_int(self.height)
+        result["iid"] = from_str(self.iid)
+        result["px"] = from_list(from_int, self.px)
+        result["width"] = from_int(self.width)
+        return result
+
+
+class ReferenceToAnEntityInstance:
+    """This object describes the "location" of an Entity instance in the project worlds.
+
+    IID information of this instance
+    """
+    entity_iid: str
+    """IID of the refered EntityInstance"""
+    layer_iid: str
+    """IID of the LayerInstance containing the refered EntityInstance"""
+    level_iid: str
+    """IID of the Level containing the refered EntityInstance"""
+    world_iid: str
+    """IID of the World containing the refered EntityInstance"""
+
+    def __init__(self, entity_iid: str, layer_iid: str, level_iid: str, world_iid: str) -> None:
+        self.entity_iid = entity_iid
+        self.layer_iid = layer_iid
+        self.level_iid = level_iid
+        self.world_iid = world_iid
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'ReferenceToAnEntityInstance':
+        assert isinstance(obj, dict)
+        entity_iid = from_str(obj.get("entityIid"))
+        layer_iid = from_str(obj.get("layerIid"))
+        level_iid = from_str(obj.get("levelIid"))
+        world_iid = from_str(obj.get("worldIid"))
+        return ReferenceToAnEntityInstance(entity_iid, layer_iid, level_iid, world_iid)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["entityIid"] = from_str(self.entity_iid)
+        result["layerIid"] = from_str(self.layer_iid)
+        result["levelIid"] = from_str(self.level_iid)
+        result["worldIid"] = from_str(self.world_iid)
+        return result
+
+
+class GridPoint:
+    """This object is just a grid-based coordinate used in Field values."""
+    cx: int
+    """X grid-based coordinate"""
+    cy: int
+    """Y grid-based coordinate"""
+
+    def __init__(self, cx: int, cy: int) -> None:
+        self.cx = cx
+        self.cy = cy
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'GridPoint':
+        assert isinstance(obj, dict)
+        cx = from_int(obj.get("cx"))
+        cy = from_int(obj.get("cy"))
+        return GridPoint(cx, cy)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["cx"] = from_int(self.cx)
+        result["cy"] = from_int(self.cy)
+        return result
+
+
+class IntGridValueInstance:
+    """IntGrid value instance"""
+    coord_id: int
+    """Coordinate ID in the layer grid"""
+    v: int
+    """IntGrid value"""
+
+    def __init__(self, coord_id: int, v: int) -> None:
+        self.coord_id = coord_id
+        self.v = v
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'IntGridValueInstance':
+        assert isinstance(obj, dict)
+        coord_id = from_int(obj.get("coordId"))
+        v = from_int(obj.get("v"))
+        return IntGridValueInstance(coord_id, v)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["coordId"] = from_int(self.coord_id)
+        result["v"] = from_int(self.v)
+        return result
+
+
+class TileInstance:
+    """This structure represents a single tile from a given Tileset."""
+    a: float
+    """Alpha/opacity of the tile (0-1, defaults to 1)"""
+    d: List[int]
+    """Internal data used by the editor.<br/>  For auto-layer tiles: `[ruleId, coordId]`.<br/>
+    For tile-layer tiles: `[coordId]`.
+    """
+    f: int
+    """"Flip bits", a 2-bits integer to represent the mirror transformations of the tile.<br/>
+    - Bit 0 = X flip<br/>   - Bit 1 = Y flip<br/>   Examples: f=0 (no flip), f=1 (X flip
+    only), f=2 (Y flip only), f=3 (both flips)
+    """
+    px: List[int]
+    """Pixel coordinates of the tile in the **layer** (`[x,y]` format). Don't forget optional
+    layer offsets, if they exist!
+    """
+    src: List[int]
+    """Pixel coordinates of the tile in the **tileset** (`[x,y]` format)"""
+    t: int
+    """The *Tile ID* in the corresponding tileset."""
+
+    def __init__(self, a: float, d: List[int], f: int, px: List[int], src: List[int], t: int) -> None:
+        self.a = a
+        self.d = d
+        self.f = f
+        self.px = px
+        self.src = src
+        self.t = t
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'TileInstance':
+        assert isinstance(obj, dict)
+        a = from_float(obj.get("a"))
+        d = from_list(from_int, obj.get("d"))
+        f = from_int(obj.get("f"))
+        px = from_list(from_int, obj.get("px"))
+        src = from_list(from_int, obj.get("src"))
+        t = from_int(obj.get("t"))
+        return TileInstance(a, d, f, px, src, t)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["a"] = to_float(self.a)
+        result["d"] = from_list(from_int, self.d)
+        result["f"] = from_int(self.f)
+        result["px"] = from_list(from_int, self.px)
+        result["src"] = from_list(from_int, self.src)
+        result["t"] = from_int(self.t)
+        return result
+
+
+class LayerInstance:
+    c_hei: int
+    """Grid-based height"""
+    c_wid: int
+    """Grid-based width"""
+    grid_size: int
+    """Grid size"""
+    identifier: str
+    """Layer definition identifier"""
+    opacity: float
+    """Layer opacity as Float [0-1]"""
+    px_total_offset_x: int
+    """Total layer X pixel offset, including both instance and definition offsets."""
+    px_total_offset_y: int
+    """Total layer Y pixel offset, including both instance and definition offsets."""
+    tileset_def_uid: Optional[int]
+    """The definition UID of corresponding Tileset, if any."""
+    tileset_rel_path: Optional[str]
+    """The relative path to corresponding Tileset, if any."""
+    type: str
+    """Layer type (possible values: IntGrid, Entities, Tiles or AutoLayer)"""
+    auto_layer_tiles: List[TileInstance]
+    """An array containing all tiles generated by Auto-layer rules. The array is already sorted
+    in display order (ie. 1st tile is beneath 2nd, which is beneath 3rd etc.).<br/><br/>
+    Note: if multiple tiles are stacked in the same cell as the result of different rules,
+    all tiles behind opaque ones will be discarded.
+    """
+    entity_instances: List[EntityInstance]
+    grid_tiles: List[TileInstance]
+    iid: str
+    """Unique layer instance identifier"""
+    int_grid: Optional[List[IntGridValueInstance]]
+    """**WARNING**: this deprecated value is no longer exported since version 1.0.0  Replaced
+    by: `intGridCsv`
+    """
+    int_grid_csv: List[int]
+    """A list of all values in the IntGrid layer, stored in CSV format (Comma Separated
+    Values).<br/>  Order is from left to right, and top to bottom (ie. first row from left to
+    right, followed by second row, etc).<br/>  `0` means "empty cell" and IntGrid values
+    start at 1.<br/>  The array size is `__cWid` x `__cHei` cells.
+    """
+    layer_def_uid: int
+    """Reference the Layer definition UID"""
+    level_id: int
+    """Reference to the UID of the level containing this layer instance"""
+    optional_rules: List[int]
+    """An Array containing the UIDs of optional rules that were enabled in this specific layer
+    instance.
+    """
+    override_tileset_uid: Optional[int]
+    """This layer can use another tileset by overriding the tileset UID here."""
+    px_offset_x: int
+    """X offset in pixels to render this layer, usually 0 (IMPORTANT: this should be added to
+    the `LayerDef` optional offset, so you should probably prefer using `__pxTotalOffsetX`
+    which contains the total offset value)
+    """
+    px_offset_y: int
+    """Y offset in pixels to render this layer, usually 0 (IMPORTANT: this should be added to
+    the `LayerDef` optional offset, so you should probably prefer using `__pxTotalOffsetX`
+    which contains the total offset value)
+    """
+    seed: int
+    """Random seed used for Auto-Layers rendering"""
+    visible: bool
+    """Layer instance visibility"""
+
+    def __init__(self, c_hei: int, c_wid: int, grid_size: int, identifier: str, opacity: float, px_total_offset_x: int, px_total_offset_y: int, tileset_def_uid: Optional[int], tileset_rel_path: Optional[str], type: str, auto_layer_tiles: List[TileInstance], entity_instances: List[EntityInstance], grid_tiles: List[TileInstance], iid: str, int_grid: Optional[List[IntGridValueInstance]], int_grid_csv: List[int], layer_def_uid: int, level_id: int, optional_rules: List[int], override_tileset_uid: Optional[int], px_offset_x: int, px_offset_y: int, seed: int, visible: bool) -> None:
+        self.c_hei = c_hei
+        self.c_wid = c_wid
+        self.grid_size = grid_size
+        self.identifier = identifier
+        self.opacity = opacity
+        self.px_total_offset_x = px_total_offset_x
+        self.px_total_offset_y = px_total_offset_y
+        self.tileset_def_uid = tileset_def_uid
+        self.tileset_rel_path = tileset_rel_path
+        self.type = type
+        self.auto_layer_tiles = auto_layer_tiles
+        self.entity_instances = entity_instances
+        self.grid_tiles = grid_tiles
+        self.iid = iid
+        self.int_grid = int_grid
+        self.int_grid_csv = int_grid_csv
+        self.layer_def_uid = layer_def_uid
+        self.level_id = level_id
+        self.optional_rules = optional_rules
+        self.override_tileset_uid = override_tileset_uid
+        self.px_offset_x = px_offset_x
+        self.px_offset_y = px_offset_y
+        self.seed = seed
+        self.visible = visible
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'LayerInstance':
+        assert isinstance(obj, dict)
+        c_hei = from_int(obj.get("__cHei"))
+        c_wid = from_int(obj.get("__cWid"))
+        grid_size = from_int(obj.get("__gridSize"))
+        identifier = from_str(obj.get("__identifier"))
+        opacity = from_float(obj.get("__opacity"))
+        px_total_offset_x = from_int(obj.get("__pxTotalOffsetX"))
+        px_total_offset_y = from_int(obj.get("__pxTotalOffsetY"))
+        tileset_def_uid = from_union([from_none, from_int], obj.get("__tilesetDefUid"))
+        tileset_rel_path = from_union([from_none, from_str], obj.get("__tilesetRelPath"))
+        type = from_str(obj.get("__type"))
+        auto_layer_tiles = from_list(TileInstance.from_dict, obj.get("autoLayerTiles"))
+        entity_instances = from_list(EntityInstance.from_dict, obj.get("entityInstances"))
+        grid_tiles = from_list(TileInstance.from_dict, obj.get("gridTiles"))
+        iid = from_str(obj.get("iid"))
+        int_grid = from_union([from_none, lambda x: from_list(IntGridValueInstance.from_dict, x)], obj.get("intGrid"))
+        int_grid_csv = from_list(from_int, obj.get("intGridCsv"))
+        layer_def_uid = from_int(obj.get("layerDefUid"))
+        level_id = from_int(obj.get("levelId"))
+        optional_rules = from_list(from_int, obj.get("optionalRules"))
+        override_tileset_uid = from_union([from_none, from_int], obj.get("overrideTilesetUid"))
+        px_offset_x = from_int(obj.get("pxOffsetX"))
+        px_offset_y = from_int(obj.get("pxOffsetY"))
+        seed = from_int(obj.get("seed"))
+        visible = from_bool(obj.get("visible"))
+        return LayerInstance(c_hei, c_wid, grid_size, identifier, opacity, px_total_offset_x, px_total_offset_y, tileset_def_uid, tileset_rel_path, type, auto_layer_tiles, entity_instances, grid_tiles, iid, int_grid, int_grid_csv, layer_def_uid, level_id, optional_rules, override_tileset_uid, px_offset_x, px_offset_y, seed, visible)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["__cHei"] = from_int(self.c_hei)
+        result["__cWid"] = from_int(self.c_wid)
+        result["__gridSize"] = from_int(self.grid_size)
+        result["__identifier"] = from_str(self.identifier)
+        result["__opacity"] = to_float(self.opacity)
+        result["__pxTotalOffsetX"] = from_int(self.px_total_offset_x)
+        result["__pxTotalOffsetY"] = from_int(self.px_total_offset_y)
+        if self.tileset_def_uid is not None:
+            result["__tilesetDefUid"] = from_union([from_none, from_int], self.tileset_def_uid)
+        if self.tileset_rel_path is not None:
+            result["__tilesetRelPath"] = from_union([from_none, from_str], self.tileset_rel_path)
+        result["__type"] = from_str(self.type)
+        result["autoLayerTiles"] = from_list(lambda x: to_class(TileInstance, x), self.auto_layer_tiles)
+        result["entityInstances"] = from_list(lambda x: to_class(EntityInstance, x), self.entity_instances)
+        result["gridTiles"] = from_list(lambda x: to_class(TileInstance, x), self.grid_tiles)
+        result["iid"] = from_str(self.iid)
+        if self.int_grid is not None:
+            result["intGrid"] = from_union([from_none, lambda x: from_list(lambda x: to_class(IntGridValueInstance, x), x)], self.int_grid)
+        result["intGridCsv"] = from_list(from_int, self.int_grid_csv)
+        result["layerDefUid"] = from_int(self.layer_def_uid)
+        result["levelId"] = from_int(self.level_id)
+        result["optionalRules"] = from_list(from_int, self.optional_rules)
+        if self.override_tileset_uid is not None:
+            result["overrideTilesetUid"] = from_union([from_none, from_int], self.override_tileset_uid)
+        result["pxOffsetX"] = from_int(self.px_offset_x)
+        result["pxOffsetY"] = from_int(self.px_offset_y)
+        result["seed"] = from_int(self.seed)
+        result["visible"] = from_bool(self.visible)
+        return result
+
+
+class LevelBackgroundPosition:
+    """Level background image position info"""
+    crop_rect: List[float]
+    """An array of 4 float values describing the cropped sub-rectangle of the displayed
+    background image. This cropping happens when original is larger than the level bounds.
+    Array format: `[ cropX, cropY, cropWidth, cropHeight ]`
+    """
+    scale: List[float]
+    """An array containing the `[scaleX,scaleY]` values of the **cropped** background image,
+    depending on `bgPos` option.
+    """
+    top_left_px: List[int]
+    """An array containing the `[x,y]` pixel coordinates of the top-left corner of the
+    **cropped** background image, depending on `bgPos` option.
+    """
+
+    def __init__(self, crop_rect: List[float], scale: List[float], top_left_px: List[int]) -> None:
+        self.crop_rect = crop_rect
+        self.scale = scale
+        self.top_left_px = top_left_px
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'LevelBackgroundPosition':
+        assert isinstance(obj, dict)
+        crop_rect = from_list(from_float, obj.get("cropRect"))
+        scale = from_list(from_float, obj.get("scale"))
+        top_left_px = from_list(from_int, obj.get("topLeftPx"))
+        return LevelBackgroundPosition(crop_rect, scale, top_left_px)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["cropRect"] = from_list(to_float, self.crop_rect)
+        result["scale"] = from_list(to_float, self.scale)
+        result["topLeftPx"] = from_list(from_int, self.top_left_px)
+        return result
+
+
+class BgPos(Enum):
+    CONTAIN = "Contain"
+    COVER = "Cover"
+    COVER_DIRTY = "CoverDirty"
+    REPEAT = "Repeat"
+    UNSCALED = "Unscaled"
+
+
+class NeighbourLevel:
+    """Nearby level info"""
+    dir: str
+    """A lowercase string tipping on the level location (`n`orth, `s`outh, `w`est,
+    `e`ast).<br/>  Since 1.4.0, this value can also be `<` (neighbour depth is lower), `>`
+    (neighbour depth is greater) or `o` (levels overlap and share the same world
+    depth).<br/>  Since 1.5.3, this value can also be `nw`,`ne`,`sw` or `se` for levels only
+    touching corners.
+    """
+    level_iid: str
+    """Neighbour Instance Identifier"""
+    level_uid: Optional[int]
+    """**WARNING**: this deprecated value is no longer exported since version 1.2.0  Replaced
+    by: `levelIid`
+    """
+
+    def __init__(self, dir: str, level_iid: str, level_uid: Optional[int]) -> None:
+        self.dir = dir
+        self.level_iid = level_iid
+        self.level_uid = level_uid
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'NeighbourLevel':
+        assert isinstance(obj, dict)
+        dir = from_str(obj.get("dir"))
+        level_iid = from_str(obj.get("levelIid"))
+        level_uid = from_union([from_none, from_int], obj.get("levelUid"))
+        return NeighbourLevel(dir, level_iid, level_uid)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["dir"] = from_str(self.dir)
+        result["levelIid"] = from_str(self.level_iid)
+        if self.level_uid is not None:
+            result["levelUid"] = from_union([from_none, from_int], self.level_uid)
+        return result
+
+
+class Level:
+    """This section contains all the level data. It can be found in 2 distinct forms, depending
+    on Project current settings:  - If "*Separate level files*" is **disabled** (default):
+    full level data is *embedded* inside the main Project JSON file, - If "*Separate level
+    files*" is **enabled**: level data is stored in *separate* standalone `.ldtkl` files (one
+    per level). In this case, the main Project JSON file will still contain most level data,
+    except heavy sections, like the `layerInstances` array (which will be null). The
+    `externalRelPath` string points to the `ldtkl` file.  A `ldtkl` file is just a JSON file
+    containing exactly what is described below.
+    """
+    bg_color: str
+    """Background color of the level (same as `bgColor`, except the default value is
+    automatically used here if its value is `null`)
+    """
+    bg_pos: Optional[LevelBackgroundPosition]
+    """Position informations of the background image, if there is one."""
+    neighbours: List[NeighbourLevel]
+    """An array listing all other levels touching this one on the world map. Since 1.4.0, this
+    includes levels that overlap in the same world layer, or in nearby world layers.<br/>
+    Only relevant for world layouts where level spatial positioning is manual (ie. GridVania,
+    Free). For Horizontal and Vertical layouts, this array is always empty.
+    """
+    smart_color: str
+    """The "guessed" color for this level in the editor, decided using either the background
+    color or an existing custom field.
+    """
+    level_bg_color: Optional[str]
+    """Background color of the level. If `null`, the project `defaultLevelBgColor` should be
+    used.
+    """
+    bg_pivot_x: float
+    """Background image X pivot (0-1)"""
+    bg_pivot_y: float
+    """Background image Y pivot (0-1)"""
+    level_bg_pos: Optional[BgPos]
+    """An enum defining the way the background image (if any) is positioned on the level. See
+    `__bgPos` for resulting position info. Possible values: &lt;`null`&gt;, `Unscaled`,
+    `Contain`, `Cover`, `CoverDirty`, `Repeat`
+    """
+    bg_rel_path: Optional[str]
+    """The *optional* relative path to the level background image."""
+    external_rel_path: Optional[str]
+    """This value is not null if the project option "*Save levels separately*" is enabled. In
+    this case, this **relative** path points to the level Json file.
+    """
+    field_instances: List[FieldInstance]
+    """An array containing this level custom field values."""
+    identifier: str
+    """User defined unique identifier"""
+    iid: str
+    """Unique instance identifier"""
+    layer_instances: Optional[List[LayerInstance]]
+    """An array containing all Layer instances. **IMPORTANT**: if the project option "*Save
+    levels separately*" is enabled, this field will be `null`.<br/>  This array is **sorted
+    in display order**: the 1st layer is the top-most and the last is behind.
+    """
+    px_hei: int
+    """Height of the level in pixels"""
+    px_wid: int
+    """Width of the level in pixels"""
+    uid: int
+    """Unique Int identifier"""
+    use_auto_identifier: bool
+    """If TRUE, the level identifier will always automatically use the naming pattern as defined
+    in `Project.levelNamePattern`. Becomes FALSE if the identifier is manually modified by
+    user.
+    """
+    world_depth: int
+    """Index that represents the "depth" of the level in the world. Default is 0, greater means
+    "above", lower means "below".<br/>  This value is mostly used for display only and is
+    intended to make stacking of levels easier to manage.
+    """
+    world_x: int
+    """World X coordinate in pixels.<br/>  Only relevant for world layouts where level spatial
+    positioning is manual (ie. GridVania, Free). For Horizontal and Vertical layouts, the
+    value is always -1 here.
+    """
+    world_y: int
+    """World Y coordinate in pixels.<br/>  Only relevant for world layouts where level spatial
+    positioning is manual (ie. GridVania, Free). For Horizontal and Vertical layouts, the
+    value is always -1 here.
+    """
+
+    def __init__(self, bg_color: str, bg_pos: Optional[LevelBackgroundPosition], neighbours: List[NeighbourLevel], smart_color: str, level_bg_color: Optional[str], bg_pivot_x: float, bg_pivot_y: float, level_bg_pos: Optional[BgPos], bg_rel_path: Optional[str], external_rel_path: Optional[str], field_instances: List[FieldInstance], identifier: str, iid: str, layer_instances: Optional[List[LayerInstance]], px_hei: int, px_wid: int, uid: int, use_auto_identifier: bool, world_depth: int, world_x: int, world_y: int) -> None:
+        self.bg_color = bg_color
+        self.bg_pos = bg_pos
+        self.neighbours = neighbours
+        self.smart_color = smart_color
+        self.level_bg_color = level_bg_color
+        self.bg_pivot_x = bg_pivot_x
+        self.bg_pivot_y = bg_pivot_y
+        self.level_bg_pos = level_bg_pos
+        self.bg_rel_path = bg_rel_path
+        self.external_rel_path = external_rel_path
+        self.field_instances = field_instances
+        self.identifier = identifier
+        self.iid = iid
+        self.layer_instances = layer_instances
+        self.px_hei = px_hei
+        self.px_wid = px_wid
+        self.uid = uid
+        self.use_auto_identifier = use_auto_identifier
+        self.world_depth = world_depth
+        self.world_x = world_x
+        self.world_y = world_y
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'Level':
+        assert isinstance(obj, dict)
+        bg_color = from_str(obj.get("__bgColor"))
+        bg_pos = from_union([from_none, LevelBackgroundPosition.from_dict], obj.get("__bgPos"))
+        neighbours = from_list(NeighbourLevel.from_dict, obj.get("__neighbours"))
+        smart_color = from_str(obj.get("__smartColor"))
+        level_bg_color = from_union([from_none, from_str], obj.get("bgColor"))
+        bg_pivot_x = from_float(obj.get("bgPivotX"))
+        bg_pivot_y = from_float(obj.get("bgPivotY"))
+        level_bg_pos = from_union([from_none, BgPos], obj.get("bgPos"))
+        bg_rel_path = from_union([from_none, from_str], obj.get("bgRelPath"))
+        external_rel_path = from_union([from_none, from_str], obj.get("externalRelPath"))
+        field_instances = from_list(FieldInstance.from_dict, obj.get("fieldInstances"))
+        identifier = from_str(obj.get("identifier"))
+        iid = from_str(obj.get("iid"))
+        layer_instances = from_union([from_none, lambda x: from_list(LayerInstance.from_dict, x)], obj.get("layerInstances"))
+        px_hei = from_int(obj.get("pxHei"))
+        px_wid = from_int(obj.get("pxWid"))
+        uid = from_int(obj.get("uid"))
+        use_auto_identifier = from_bool(obj.get("useAutoIdentifier"))
+        world_depth = from_int(obj.get("worldDepth"))
+        world_x = from_int(obj.get("worldX"))
+        world_y = from_int(obj.get("worldY"))
+        return Level(bg_color, bg_pos, neighbours, smart_color, level_bg_color, bg_pivot_x, bg_pivot_y, level_bg_pos, bg_rel_path, external_rel_path, field_instances, identifier, iid, layer_instances, px_hei, px_wid, uid, use_auto_identifier, world_depth, world_x, world_y)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["__bgColor"] = from_str(self.bg_color)
+        if self.bg_pos is not None:
+            result["__bgPos"] = from_union([from_none, lambda x: to_class(LevelBackgroundPosition, x)], self.bg_pos)
+        result["__neighbours"] = from_list(lambda x: to_class(NeighbourLevel, x), self.neighbours)
+        result["__smartColor"] = from_str(self.smart_color)
+        if self.level_bg_color is not None:
+            result["bgColor"] = from_union([from_none, from_str], self.level_bg_color)
+        result["bgPivotX"] = to_float(self.bg_pivot_x)
+        result["bgPivotY"] = to_float(self.bg_pivot_y)
+        if self.level_bg_pos is not None:
+            result["bgPos"] = from_union([from_none, lambda x: to_enum(BgPos, x)], self.level_bg_pos)
+        if self.bg_rel_path is not None:
+            result["bgRelPath"] = from_union([from_none, from_str], self.bg_rel_path)
+        if self.external_rel_path is not None:
+            result["externalRelPath"] = from_union([from_none, from_str], self.external_rel_path)
+        result["fieldInstances"] = from_list(lambda x: to_class(FieldInstance, x), self.field_instances)
+        result["identifier"] = from_str(self.identifier)
+        result["iid"] = from_str(self.iid)
+        if self.layer_instances is not None:
+            result["layerInstances"] = from_union([from_none, lambda x: from_list(lambda x: to_class(LayerInstance, x), x)], self.layer_instances)
+        result["pxHei"] = from_int(self.px_hei)
+        result["pxWid"] = from_int(self.px_wid)
+        result["uid"] = from_int(self.uid)
+        result["useAutoIdentifier"] = from_bool(self.use_auto_identifier)
+        result["worldDepth"] = from_int(self.world_depth)
+        result["worldX"] = from_int(self.world_x)
+        result["worldY"] = from_int(self.world_y)
+        return result
+
+
+class LdtkTocInstanceData:
+    fields: Any
+    """An object containing the values of all entity fields with the `exportToToc` option
+    enabled. This object typing depends on actual field value types.
+    """
+    hei_px: int
+    iids: ReferenceToAnEntityInstance
+    """IID information of this instance"""
+    wid_px: int
+    world_x: int
+    world_y: int
+
+    def __init__(self, fields: Any, hei_px: int, iids: ReferenceToAnEntityInstance, wid_px: int, world_x: int, world_y: int) -> None:
+        self.fields = fields
+        self.hei_px = hei_px
+        self.iids = iids
+        self.wid_px = wid_px
+        self.world_x = world_x
+        self.world_y = world_y
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'LdtkTocInstanceData':
+        assert isinstance(obj, dict)
+        fields = obj.get("fields")
+        hei_px = from_int(obj.get("heiPx"))
+        iids = ReferenceToAnEntityInstance.from_dict(obj.get("iids"))
+        wid_px = from_int(obj.get("widPx"))
+        world_x = from_int(obj.get("worldX"))
+        world_y = from_int(obj.get("worldY"))
+        return LdtkTocInstanceData(fields, hei_px, iids, wid_px, world_x, world_y)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["fields"] = self.fields
+        result["heiPx"] = from_int(self.hei_px)
+        result["iids"] = to_class(ReferenceToAnEntityInstance, self.iids)
+        result["widPx"] = from_int(self.wid_px)
+        result["worldX"] = from_int(self.world_x)
+        result["worldY"] = from_int(self.world_y)
+        return result
+
+
+class LdtkTableOfContentEntry:
+    identifier: str
+    instances: Optional[List[ReferenceToAnEntityInstance]]
+    """**WARNING**: this deprecated value will be *removed* completely on version 1.7.0+
+    Replaced by: `instancesData`
+    """
+    instances_data: List[LdtkTocInstanceData]
+
+    def __init__(self, identifier: str, instances: Optional[List[ReferenceToAnEntityInstance]], instances_data: List[LdtkTocInstanceData]) -> None:
+        self.identifier = identifier
+        self.instances = instances
+        self.instances_data = instances_data
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'LdtkTableOfContentEntry':
+        assert isinstance(obj, dict)
+        identifier = from_str(obj.get("identifier"))
+        instances = from_union([lambda x: from_list(ReferenceToAnEntityInstance.from_dict, x), from_none], obj.get("instances"))
+        instances_data = from_list(LdtkTocInstanceData.from_dict, obj.get("instancesData"))
+        return LdtkTableOfContentEntry(identifier, instances, instances_data)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["identifier"] = from_str(self.identifier)
+        if self.instances is not None:
+            result["instances"] = from_union([lambda x: from_list(lambda x: to_class(ReferenceToAnEntityInstance, x), x), from_none], self.instances)
+        result["instancesData"] = from_list(lambda x: to_class(LdtkTocInstanceData, x), self.instances_data)
+        return result
+
+
+class WorldLayout(Enum):
+    FREE = "Free"
+    GRID_VANIA = "GridVania"
+    LINEAR_HORIZONTAL = "LinearHorizontal"
+    LINEAR_VERTICAL = "LinearVertical"
+
+
+class World:
+    """**IMPORTANT**: this type is available as a preview. You can rely on it to update your
+    importers, for when it will be officially available.  A World contains multiple levels,
+    and it has its own layout settings.
+    """
+    default_level_height: int
+    """Default new level height"""
+    default_level_width: int
+    """Default new level width"""
+    identifier: str
+    """User defined unique identifier"""
+    iid: str
+    """Unique instance identifer"""
+    levels: List[Level]
+    """All levels from this world. The order of this array is only relevant in
+    `LinearHorizontal` and `linearVertical` world layouts (see `worldLayout` value).
+    Otherwise, you should refer to the `worldX`,`worldY` coordinates of each Level.
+    """
+    world_grid_height: int
+    """Height of the world grid in pixels."""
+    world_grid_width: int
+    """Width of the world grid in pixels."""
+    world_layout: Optional[WorldLayout]
+    """An enum that describes how levels are organized in this project (ie. linearly or in a 2D
+    space). Possible values: `Free`, `GridVania`, `LinearHorizontal`, `LinearVertical`, `null`
+    """
+
+    def __init__(self, default_level_height: int, default_level_width: int, identifier: str, iid: str, levels: List[Level], world_grid_height: int, world_grid_width: int, world_layout: Optional[WorldLayout]) -> None:
+        self.default_level_height = default_level_height
+        self.default_level_width = default_level_width
+        self.identifier = identifier
+        self.iid = iid
+        self.levels = levels
+        self.world_grid_height = world_grid_height
+        self.world_grid_width = world_grid_width
+        self.world_layout = world_layout
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'World':
+        assert isinstance(obj, dict)
+        default_level_height = from_int(obj.get("defaultLevelHeight"))
+        default_level_width = from_int(obj.get("defaultLevelWidth"))
+        identifier = from_str(obj.get("identifier"))
+        iid = from_str(obj.get("iid"))
+        levels = from_list(Level.from_dict, obj.get("levels"))
+        world_grid_height = from_int(obj.get("worldGridHeight"))
+        world_grid_width = from_int(obj.get("worldGridWidth"))
+        world_layout = from_union([from_none, WorldLayout], obj.get("worldLayout"))
+        return World(default_level_height, default_level_width, identifier, iid, levels, world_grid_height, world_grid_width, world_layout)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        result["defaultLevelHeight"] = from_int(self.default_level_height)
+        result["defaultLevelWidth"] = from_int(self.default_level_width)
+        result["identifier"] = from_str(self.identifier)
+        result["iid"] = from_str(self.iid)
+        result["levels"] = from_list(lambda x: to_class(Level, x), self.levels)
+        result["worldGridHeight"] = from_int(self.world_grid_height)
+        result["worldGridWidth"] = from_int(self.world_grid_width)
+        result["worldLayout"] = from_union([from_none, lambda x: to_enum(WorldLayout, x)], self.world_layout)
+        return result
+
+
+class ForcedRefs:
+    """This object is not actually used by LDtk. It ONLY exists to force explicit references to
+    all types, to make sure QuickType finds them and integrate all of them. Otherwise,
+    Quicktype will drop types that are not explicitely used.
+    """
+    auto_layer_rule_group: Optional[AutoLayerRuleGroup]
+    auto_rule_def: Optional[AutoLayerRuleDefinition]
+    custom_command: Optional[LdtkCustomCommand]
+    definitions: Optional[Definitions]
+    entity_def: Optional[EntityDefinition]
+    entity_instance: Optional[EntityInstance]
+    entity_reference_infos: Optional[ReferenceToAnEntityInstance]
+    enum_def: Optional[EnumDefinition]
+    enum_def_values: Optional[EnumValueDefinition]
+    enum_tag_value: Optional[EnumTagValue]
+    field_def: Optional[FieldDefinition]
+    field_instance: Optional[FieldInstance]
+    grid_point: Optional[GridPoint]
+    int_grid_value_def: Optional[IntGridValueDefinition]
+    int_grid_value_group_def: Optional[IntGridValueGroupDefinition]
+    int_grid_value_instance: Optional[IntGridValueInstance]
+    layer_def: Optional[LayerDefinition]
+    layer_instance: Optional[LayerInstance]
+    level: Optional[Level]
+    level_bg_pos_infos: Optional[LevelBackgroundPosition]
+    neighbour_level: Optional[NeighbourLevel]
+    table_of_content_entry: Optional[LdtkTableOfContentEntry]
+    tile: Optional[TileInstance]
+    tile_custom_metadata: Optional[TileCustomMetadata]
+    tileset_def: Optional[TilesetDefinition]
+    tileset_rect: Optional[TilesetRectangle]
+    toc_instance_data: Optional[LdtkTocInstanceData]
+    world: Optional[World]
+
+    def __init__(self, auto_layer_rule_group: Optional[AutoLayerRuleGroup], auto_rule_def: Optional[AutoLayerRuleDefinition], custom_command: Optional[LdtkCustomCommand], definitions: Optional[Definitions], entity_def: Optional[EntityDefinition], entity_instance: Optional[EntityInstance], entity_reference_infos: Optional[ReferenceToAnEntityInstance], enum_def: Optional[EnumDefinition], enum_def_values: Optional[EnumValueDefinition], enum_tag_value: Optional[EnumTagValue], field_def: Optional[FieldDefinition], field_instance: Optional[FieldInstance], grid_point: Optional[GridPoint], int_grid_value_def: Optional[IntGridValueDefinition], int_grid_value_group_def: Optional[IntGridValueGroupDefinition], int_grid_value_instance: Optional[IntGridValueInstance], layer_def: Optional[LayerDefinition], layer_instance: Optional[LayerInstance], level: Optional[Level], level_bg_pos_infos: Optional[LevelBackgroundPosition], neighbour_level: Optional[NeighbourLevel], table_of_content_entry: Optional[LdtkTableOfContentEntry], tile: Optional[TileInstance], tile_custom_metadata: Optional[TileCustomMetadata], tileset_def: Optional[TilesetDefinition], tileset_rect: Optional[TilesetRectangle], toc_instance_data: Optional[LdtkTocInstanceData], world: Optional[World]) -> None:
+        self.auto_layer_rule_group = auto_layer_rule_group
+        self.auto_rule_def = auto_rule_def
+        self.custom_command = custom_command
+        self.definitions = definitions
+        self.entity_def = entity_def
+        self.entity_instance = entity_instance
+        self.entity_reference_infos = entity_reference_infos
+        self.enum_def = enum_def
+        self.enum_def_values = enum_def_values
+        self.enum_tag_value = enum_tag_value
+        self.field_def = field_def
+        self.field_instance = field_instance
+        self.grid_point = grid_point
+        self.int_grid_value_def = int_grid_value_def
+        self.int_grid_value_group_def = int_grid_value_group_def
+        self.int_grid_value_instance = int_grid_value_instance
+        self.layer_def = layer_def
+        self.layer_instance = layer_instance
+        self.level = level
+        self.level_bg_pos_infos = level_bg_pos_infos
+        self.neighbour_level = neighbour_level
+        self.table_of_content_entry = table_of_content_entry
+        self.tile = tile
+        self.tile_custom_metadata = tile_custom_metadata
+        self.tileset_def = tileset_def
+        self.tileset_rect = tileset_rect
+        self.toc_instance_data = toc_instance_data
+        self.world = world
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'ForcedRefs':
+        assert isinstance(obj, dict)
+        auto_layer_rule_group = from_union([AutoLayerRuleGroup.from_dict, from_none], obj.get("AutoLayerRuleGroup"))
+        auto_rule_def = from_union([AutoLayerRuleDefinition.from_dict, from_none], obj.get("AutoRuleDef"))
+        custom_command = from_union([LdtkCustomCommand.from_dict, from_none], obj.get("CustomCommand"))
+        definitions = from_union([Definitions.from_dict, from_none], obj.get("Definitions"))
+        entity_def = from_union([EntityDefinition.from_dict, from_none], obj.get("EntityDef"))
+        entity_instance = from_union([EntityInstance.from_dict, from_none], obj.get("EntityInstance"))
+        entity_reference_infos = from_union([ReferenceToAnEntityInstance.from_dict, from_none], obj.get("EntityReferenceInfos"))
+        enum_def = from_union([EnumDefinition.from_dict, from_none], obj.get("EnumDef"))
+        enum_def_values = from_union([EnumValueDefinition.from_dict, from_none], obj.get("EnumDefValues"))
+        enum_tag_value = from_union([EnumTagValue.from_dict, from_none], obj.get("EnumTagValue"))
+        field_def = from_union([FieldDefinition.from_dict, from_none], obj.get("FieldDef"))
+        field_instance = from_union([FieldInstance.from_dict, from_none], obj.get("FieldInstance"))
+        grid_point = from_union([GridPoint.from_dict, from_none], obj.get("GridPoint"))
+        int_grid_value_def = from_union([IntGridValueDefinition.from_dict, from_none], obj.get("IntGridValueDef"))
+        int_grid_value_group_def = from_union([IntGridValueGroupDefinition.from_dict, from_none], obj.get("IntGridValueGroupDef"))
+        int_grid_value_instance = from_union([IntGridValueInstance.from_dict, from_none], obj.get("IntGridValueInstance"))
+        layer_def = from_union([LayerDefinition.from_dict, from_none], obj.get("LayerDef"))
+        layer_instance = from_union([LayerInstance.from_dict, from_none], obj.get("LayerInstance"))
+        level = from_union([Level.from_dict, from_none], obj.get("Level"))
+        level_bg_pos_infos = from_union([from_none, LevelBackgroundPosition.from_dict], obj.get("LevelBgPosInfos"))
+        neighbour_level = from_union([NeighbourLevel.from_dict, from_none], obj.get("NeighbourLevel"))
+        table_of_content_entry = from_union([LdtkTableOfContentEntry.from_dict, from_none], obj.get("TableOfContentEntry"))
+        tile = from_union([TileInstance.from_dict, from_none], obj.get("Tile"))
+        tile_custom_metadata = from_union([TileCustomMetadata.from_dict, from_none], obj.get("TileCustomMetadata"))
+        tileset_def = from_union([TilesetDefinition.from_dict, from_none], obj.get("TilesetDef"))
+        tileset_rect = from_union([from_none, TilesetRectangle.from_dict], obj.get("TilesetRect"))
+        toc_instance_data = from_union([LdtkTocInstanceData.from_dict, from_none], obj.get("TocInstanceData"))
+        world = from_union([World.from_dict, from_none], obj.get("World"))
+        return ForcedRefs(auto_layer_rule_group, auto_rule_def, custom_command, definitions, entity_def, entity_instance, entity_reference_infos, enum_def, enum_def_values, enum_tag_value, field_def, field_instance, grid_point, int_grid_value_def, int_grid_value_group_def, int_grid_value_instance, layer_def, layer_instance, level, level_bg_pos_infos, neighbour_level, table_of_content_entry, tile, tile_custom_metadata, tileset_def, tileset_rect, toc_instance_data, world)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        if self.auto_layer_rule_group is not None:
+            result["AutoLayerRuleGroup"] = from_union([lambda x: to_class(AutoLayerRuleGroup, x), from_none], self.auto_layer_rule_group)
+        if self.auto_rule_def is not None:
+            result["AutoRuleDef"] = from_union([lambda x: to_class(AutoLayerRuleDefinition, x), from_none], self.auto_rule_def)
+        if self.custom_command is not None:
+            result["CustomCommand"] = from_union([lambda x: to_class(LdtkCustomCommand, x), from_none], self.custom_command)
+        if self.definitions is not None:
+            result["Definitions"] = from_union([lambda x: to_class(Definitions, x), from_none], self.definitions)
+        if self.entity_def is not None:
+            result["EntityDef"] = from_union([lambda x: to_class(EntityDefinition, x), from_none], self.entity_def)
+        if self.entity_instance is not None:
+            result["EntityInstance"] = from_union([lambda x: to_class(EntityInstance, x), from_none], self.entity_instance)
+        if self.entity_reference_infos is not None:
+            result["EntityReferenceInfos"] = from_union([lambda x: to_class(ReferenceToAnEntityInstance, x), from_none], self.entity_reference_infos)
+        if self.enum_def is not None:
+            result["EnumDef"] = from_union([lambda x: to_class(EnumDefinition, x), from_none], self.enum_def)
+        if self.enum_def_values is not None:
+            result["EnumDefValues"] = from_union([lambda x: to_class(EnumValueDefinition, x), from_none], self.enum_def_values)
+        if self.enum_tag_value is not None:
+            result["EnumTagValue"] = from_union([lambda x: to_class(EnumTagValue, x), from_none], self.enum_tag_value)
+        if self.field_def is not None:
+            result["FieldDef"] = from_union([lambda x: to_class(FieldDefinition, x), from_none], self.field_def)
+        if self.field_instance is not None:
+            result["FieldInstance"] = from_union([lambda x: to_class(FieldInstance, x), from_none], self.field_instance)
+        if self.grid_point is not None:
+            result["GridPoint"] = from_union([lambda x: to_class(GridPoint, x), from_none], self.grid_point)
+        if self.int_grid_value_def is not None:
+            result["IntGridValueDef"] = from_union([lambda x: to_class(IntGridValueDefinition, x), from_none], self.int_grid_value_def)
+        if self.int_grid_value_group_def is not None:
+            result["IntGridValueGroupDef"] = from_union([lambda x: to_class(IntGridValueGroupDefinition, x), from_none], self.int_grid_value_group_def)
+        if self.int_grid_value_instance is not None:
+            result["IntGridValueInstance"] = from_union([lambda x: to_class(IntGridValueInstance, x), from_none], self.int_grid_value_instance)
+        if self.layer_def is not None:
+            result["LayerDef"] = from_union([lambda x: to_class(LayerDefinition, x), from_none], self.layer_def)
+        if self.layer_instance is not None:
+            result["LayerInstance"] = from_union([lambda x: to_class(LayerInstance, x), from_none], self.layer_instance)
+        if self.level is not None:
+            result["Level"] = from_union([lambda x: to_class(Level, x), from_none], self.level)
+        if self.level_bg_pos_infos is not None:
+            result["LevelBgPosInfos"] = from_union([from_none, lambda x: to_class(LevelBackgroundPosition, x)], self.level_bg_pos_infos)
+        if self.neighbour_level is not None:
+            result["NeighbourLevel"] = from_union([lambda x: to_class(NeighbourLevel, x), from_none], self.neighbour_level)
+        if self.table_of_content_entry is not None:
+            result["TableOfContentEntry"] = from_union([lambda x: to_class(LdtkTableOfContentEntry, x), from_none], self.table_of_content_entry)
+        if self.tile is not None:
+            result["Tile"] = from_union([lambda x: to_class(TileInstance, x), from_none], self.tile)
+        if self.tile_custom_metadata is not None:
+            result["TileCustomMetadata"] = from_union([lambda x: to_class(TileCustomMetadata, x), from_none], self.tile_custom_metadata)
+        if self.tileset_def is not None:
+            result["TilesetDef"] = from_union([lambda x: to_class(TilesetDefinition, x), from_none], self.tileset_def)
+        if self.tileset_rect is not None:
+            result["TilesetRect"] = from_union([from_none, lambda x: to_class(TilesetRectangle, x)], self.tileset_rect)
+        if self.toc_instance_data is not None:
+            result["TocInstanceData"] = from_union([lambda x: to_class(LdtkTocInstanceData, x), from_none], self.toc_instance_data)
+        if self.world is not None:
+            result["World"] = from_union([lambda x: to_class(World, x), from_none], self.world)
+        return result
+
+
+class IdentifierStyle(Enum):
+    """Naming convention for Identifiers (first-letter uppercase, full uppercase etc.) Possible
+    values: `Capitalize`, `Uppercase`, `Lowercase`, `Free`
+    """
+    CAPITALIZE = "Capitalize"
+    FREE = "Free"
+    LOWERCASE = "Lowercase"
+    UPPERCASE = "Uppercase"
+
+
+class ImageExportMode(Enum):
+    """"Image export" option when saving project. Possible values: `None`, `OneImagePerLayer`,
+    `OneImagePerLevel`, `LayersAndLevels`
+    """
+    LAYERS_AND_LEVELS = "LayersAndLevels"
+    NONE = "None"
+    ONE_IMAGE_PER_LAYER = "OneImagePerLayer"
+    ONE_IMAGE_PER_LEVEL = "OneImagePerLevel"
+
+
+class LdtkJSON:
+    """This file is a JSON schema of files created by LDtk level editor (https://ldtk.io).
+
+    This is the root of any Project JSON file. It contains:  - the project settings, - an
+    array of levels, - a group of definitions (that can probably be safely ignored for most
+    users).
+    """
+    forced_refs: Optional[ForcedRefs]
+    """This object is not actually used by LDtk. It ONLY exists to force explicit references to
+    all types, to make sure QuickType finds them and integrate all of them. Otherwise,
+    Quicktype will drop types that are not explicitely used.
+    """
+    app_build_id: float
+    """LDtk application build identifier.<br/>  This is only used to identify the LDtk version
+    that generated this particular project file, which can be useful for specific bug fixing.
+    Note that the build identifier is just the date of the release, so it's not unique to
+    each user (one single global ID per LDtk public release), and as a result, completely
+    anonymous.
+    """
+    backup_limit: int
+    """Number of backup files to keep, if the `backupOnSave` is TRUE"""
+    backup_on_save: bool
+    """If TRUE, an extra copy of the project will be created in a sub folder, when saving."""
+    backup_rel_path: Optional[str]
+    """Target relative path to store backup files"""
+    bg_color: str
+    """Project background color"""
+    custom_commands: List[LdtkCustomCommand]
+    """An array of command lines that can be ran manually by the user"""
+    default_entity_height: int
+    """Default height for new entities"""
+    default_entity_width: int
+    """Default width for new entities"""
+    default_grid_size: int
+    """Default grid size for new layers"""
+    default_level_bg_color: str
+    """Default background color of levels"""
+    default_level_height: Optional[int]
+    """**WARNING**: this field will move to the `worlds` array after the "multi-worlds" update.
+    It will then be `null`. You can enable the Multi-worlds advanced project option to enable
+    the change immediately.<br/><br/>  Default new level height
+    """
+    default_level_width: Optional[int]
+    """**WARNING**: this field will move to the `worlds` array after the "multi-worlds" update.
+    It will then be `null`. You can enable the Multi-worlds advanced project option to enable
+    the change immediately.<br/><br/>  Default new level width
+    """
+    default_pivot_x: float
+    """Default X pivot (0 to 1) for new entities"""
+    default_pivot_y: float
+    """Default Y pivot (0 to 1) for new entities"""
+    defs: Definitions
+    """A structure containing all the definitions of this project"""
+    dummy_world_iid: str
+    """If the project isn't in MultiWorlds mode, this is the IID of the internal "dummy" World."""
+    export_level_bg: bool
+    """If TRUE, the exported PNGs will include the level background (color or image)."""
+    export_png: Optional[bool]
+    """**WARNING**: this deprecated value is no longer exported since version 0.9.3  Replaced
+    by: `imageExportMode`
+    """
+    export_tiled: bool
+    """If TRUE, a Tiled compatible file will also be generated along with the LDtk JSON file
+    (default is FALSE)
+    """
+    external_levels: bool
+    """If TRUE, one file will be saved for the project (incl. all its definitions) and one file
+    in a sub-folder for each level.
+    """
+    flags: List[Flag]
+    """An array containing various advanced flags (ie. options or other states). Possible
+    values: `DiscardPreCsvIntGrid`, `ExportOldTableOfContentData`,
+    `ExportPreCsvIntGridFormat`, `IgnoreBackupSuggest`, `PrependIndexToLevelFileNames`,
+    `MultiWorlds`, `UseMultilinesType`
+    """
+    identifier_style: IdentifierStyle
+    """Naming convention for Identifiers (first-letter uppercase, full uppercase etc.) Possible
+    values: `Capitalize`, `Uppercase`, `Lowercase`, `Free`
+    """
+    iid: str
+    """Unique project identifier"""
+    image_export_mode: ImageExportMode
+    """"Image export" option when saving project. Possible values: `None`, `OneImagePerLayer`,
+    `OneImagePerLevel`, `LayersAndLevels`
+    """
+    json_version: str
+    """File format version"""
+    level_name_pattern: str
+    """The default naming convention for level identifiers."""
+    levels: List[Level]
+    """All levels. The order of this array is only relevant in `LinearHorizontal` and
+    `linearVertical` world layouts (see `worldLayout` value).<br/>  Otherwise, you should
+    refer to the `worldX`,`worldY` coordinates of each Level.
+    """
+    minify_json: bool
+    """If TRUE, the Json is partially minified (no indentation, nor line breaks, default is
+    FALSE)
+    """
+    next_uid: int
+    """Next Unique integer ID available"""
+    png_file_pattern: Optional[str]
+    """File naming pattern for exported PNGs"""
+    simplified_export: bool
+    """If TRUE, a very simplified will be generated on saving, for quicker & easier engine
+    integration.
+    """
+    toc: List[LdtkTableOfContentEntry]
+    """All instances of entities that have their `exportToToc` flag enabled are listed in this
+    array.
+    """
+    tutorial_desc: Optional[str]
+    """This optional description is used by LDtk Samples to show up some informations and
+    instructions.
+    """
+    world_grid_height: Optional[int]
+    """**WARNING**: this field will move to the `worlds` array after the "multi-worlds" update.
+    It will then be `null`. You can enable the Multi-worlds advanced project option to enable
+    the change immediately.<br/><br/>  Height of the world grid in pixels.
+    """
+    world_grid_width: Optional[int]
+    """**WARNING**: this field will move to the `worlds` array after the "multi-worlds" update.
+    It will then be `null`. You can enable the Multi-worlds advanced project option to enable
+    the change immediately.<br/><br/>  Width of the world grid in pixels.
+    """
+    world_layout: Optional[WorldLayout]
+    """**WARNING**: this field will move to the `worlds` array after the "multi-worlds" update.
+    It will then be `null`. You can enable the Multi-worlds advanced project option to enable
+    the change immediately.<br/><br/>  An enum that describes how levels are organized in
+    this project (ie. linearly or in a 2D space). Possible values: &lt;`null`&gt;, `Free`,
+    `GridVania`, `LinearHorizontal`, `LinearVertical`
+    """
+    worlds: List[World]
+    """This array will be empty, unless you enable the Multi-Worlds in the project advanced
+    settings.<br/><br/> - in current version, a LDtk project file can only contain a single
+    world with multiple levels in it. In this case, levels and world layout related settings
+    are stored in the root of the JSON.<br/> - with "Multi-worlds" enabled, there will be a
+    `worlds` array in root, each world containing levels and layout settings. Basically, it's
+    pretty much only about moving the `levels` array to the `worlds` array, along with world
+    layout related values (eg. `worldGridWidth` etc).<br/><br/>If you want to start
+    supporting this future update easily, please refer to this documentation:
+    https://github.com/deepnight/ldtk/issues/231
+    """
+
+    def __init__(self, forced_refs: Optional[ForcedRefs], app_build_id: float, backup_limit: int, backup_on_save: bool, backup_rel_path: Optional[str], bg_color: str, custom_commands: List[LdtkCustomCommand], default_entity_height: int, default_entity_width: int, default_grid_size: int, default_level_bg_color: str, default_level_height: Optional[int], default_level_width: Optional[int], default_pivot_x: float, default_pivot_y: float, defs: Definitions, dummy_world_iid: str, export_level_bg: bool, export_png: Optional[bool], export_tiled: bool, external_levels: bool, flags: List[Flag], identifier_style: IdentifierStyle, iid: str, image_export_mode: ImageExportMode, json_version: str, level_name_pattern: str, levels: List[Level], minify_json: bool, next_uid: int, png_file_pattern: Optional[str], simplified_export: bool, toc: List[LdtkTableOfContentEntry], tutorial_desc: Optional[str], world_grid_height: Optional[int], world_grid_width: Optional[int], world_layout: Optional[WorldLayout], worlds: List[World]) -> None:
+        self.forced_refs = forced_refs
+        self.app_build_id = app_build_id
+        self.backup_limit = backup_limit
+        self.backup_on_save = backup_on_save
+        self.backup_rel_path = backup_rel_path
+        self.bg_color = bg_color
+        self.custom_commands = custom_commands
+        self.default_entity_height = default_entity_height
+        self.default_entity_width = default_entity_width
+        self.default_grid_size = default_grid_size
+        self.default_level_bg_color = default_level_bg_color
+        self.default_level_height = default_level_height
+        self.default_level_width = default_level_width
+        self.default_pivot_x = default_pivot_x
+        self.default_pivot_y = default_pivot_y
+        self.defs = defs
+        self.dummy_world_iid = dummy_world_iid
+        self.export_level_bg = export_level_bg
+        self.export_png = export_png
+        self.export_tiled = export_tiled
+        self.external_levels = external_levels
+        self.flags = flags
+        self.identifier_style = identifier_style
+        self.iid = iid
+        self.image_export_mode = image_export_mode
+        self.json_version = json_version
+        self.level_name_pattern = level_name_pattern
+        self.levels = levels
+        self.minify_json = minify_json
+        self.next_uid = next_uid
+        self.png_file_pattern = png_file_pattern
+        self.simplified_export = simplified_export
+        self.toc = toc
+        self.tutorial_desc = tutorial_desc
+        self.world_grid_height = world_grid_height
+        self.world_grid_width = world_grid_width
+        self.world_layout = world_layout
+        self.worlds = worlds
+
+    @staticmethod
+    def from_dict(obj: Any) -> 'LdtkJSON':
+        assert isinstance(obj, dict)
+        forced_refs = from_union([ForcedRefs.from_dict, from_none], obj.get("__FORCED_REFS"))
+        app_build_id = from_float(obj.get("appBuildId"))
+        backup_limit = from_int(obj.get("backupLimit"))
+        backup_on_save = from_bool(obj.get("backupOnSave"))
+        backup_rel_path = from_union([from_none, from_str], obj.get("backupRelPath"))
+        bg_color = from_str(obj.get("bgColor"))
+        custom_commands = from_list(LdtkCustomCommand.from_dict, obj.get("customCommands"))
+        default_entity_height = from_int(obj.get("defaultEntityHeight"))
+        default_entity_width = from_int(obj.get("defaultEntityWidth"))
+        default_grid_size = from_int(obj.get("defaultGridSize"))
+        default_level_bg_color = from_str(obj.get("defaultLevelBgColor"))
+        default_level_height = from_union([from_none, from_int], obj.get("defaultLevelHeight"))
+        default_level_width = from_union([from_none, from_int], obj.get("defaultLevelWidth"))
+        default_pivot_x = from_float(obj.get("defaultPivotX"))
+        default_pivot_y = from_float(obj.get("defaultPivotY"))
+        defs = Definitions.from_dict(obj.get("defs"))
+        dummy_world_iid = from_str(obj.get("dummyWorldIid"))
+        export_level_bg = from_bool(obj.get("exportLevelBg"))
+        export_png = from_union([from_none, from_bool], obj.get("exportPng"))
+        export_tiled = from_bool(obj.get("exportTiled"))
+        external_levels = from_bool(obj.get("externalLevels"))
+        flags = from_list(Flag, obj.get("flags"))
+        identifier_style = IdentifierStyle(obj.get("identifierStyle"))
+        iid = from_str(obj.get("iid"))
+        image_export_mode = ImageExportMode(obj.get("imageExportMode"))
+        json_version = from_str(obj.get("jsonVersion"))
+        level_name_pattern = from_str(obj.get("levelNamePattern"))
+        levels = from_list(Level.from_dict, obj.get("levels"))
+        minify_json = from_bool(obj.get("minifyJson"))
+        next_uid = from_int(obj.get("nextUid"))
+        png_file_pattern = from_union([from_none, from_str], obj.get("pngFilePattern"))
+        simplified_export = from_bool(obj.get("simplifiedExport"))
+        toc = from_list(LdtkTableOfContentEntry.from_dict, obj.get("toc"))
+        tutorial_desc = from_union([from_none, from_str], obj.get("tutorialDesc"))
+        world_grid_height = from_union([from_none, from_int], obj.get("worldGridHeight"))
+        world_grid_width = from_union([from_none, from_int], obj.get("worldGridWidth"))
+        world_layout = from_union([from_none, WorldLayout], obj.get("worldLayout"))
+        worlds = from_list(World.from_dict, obj.get("worlds"))
+        return LdtkJSON(forced_refs, app_build_id, backup_limit, backup_on_save, backup_rel_path, bg_color, custom_commands, default_entity_height, default_entity_width, default_grid_size, default_level_bg_color, default_level_height, default_level_width, default_pivot_x, default_pivot_y, defs, dummy_world_iid, export_level_bg, export_png, export_tiled, external_levels, flags, identifier_style, iid, image_export_mode, json_version, level_name_pattern, levels, minify_json, next_uid, png_file_pattern, simplified_export, toc, tutorial_desc, world_grid_height, world_grid_width, world_layout, worlds)
+
+    def to_dict(self) -> dict:
+        result: dict = {}
+        if self.forced_refs is not None:
+            result["__FORCED_REFS"] = from_union([lambda x: to_class(ForcedRefs, x), from_none], self.forced_refs)
+        result["appBuildId"] = to_float(self.app_build_id)
+        result["backupLimit"] = from_int(self.backup_limit)
+        result["backupOnSave"] = from_bool(self.backup_on_save)
+        if self.backup_rel_path is not None:
+            result["backupRelPath"] = from_union([from_none, from_str], self.backup_rel_path)
+        result["bgColor"] = from_str(self.bg_color)
+        result["customCommands"] = from_list(lambda x: to_class(LdtkCustomCommand, x), self.custom_commands)
+        result["defaultEntityHeight"] = from_int(self.default_entity_height)
+        result["defaultEntityWidth"] = from_int(self.default_entity_width)
+        result["defaultGridSize"] = from_int(self.default_grid_size)
+        result["defaultLevelBgColor"] = from_str(self.default_level_bg_color)
+        if self.default_level_height is not None:
+            result["defaultLevelHeight"] = from_union([from_none, from_int], self.default_level_height)
+        if self.default_level_width is not None:
+            result["defaultLevelWidth"] = from_union([from_none, from_int], self.default_level_width)
+        result["defaultPivotX"] = to_float(self.default_pivot_x)
+        result["defaultPivotY"] = to_float(self.default_pivot_y)
+        result["defs"] = to_class(Definitions, self.defs)
+        result["dummyWorldIid"] = from_str(self.dummy_world_iid)
+        result["exportLevelBg"] = from_bool(self.export_level_bg)
+        if self.export_png is not None:
+            result["exportPng"] = from_union([from_none, from_bool], self.export_png)
+        result["exportTiled"] = from_bool(self.export_tiled)
+        result["externalLevels"] = from_bool(self.external_levels)
+        result["flags"] = from_list(lambda x: to_enum(Flag, x), self.flags)
+        result["identifierStyle"] = to_enum(IdentifierStyle, self.identifier_style)
+        result["iid"] = from_str(self.iid)
+        result["imageExportMode"] = to_enum(ImageExportMode, self.image_export_mode)
+        result["jsonVersion"] = from_str(self.json_version)
+        result["levelNamePattern"] = from_str(self.level_name_pattern)
+        result["levels"] = from_list(lambda x: to_class(Level, x), self.levels)
+        result["minifyJson"] = from_bool(self.minify_json)
+        result["nextUid"] = from_int(self.next_uid)
+        if self.png_file_pattern is not None:
+            result["pngFilePattern"] = from_union([from_none, from_str], self.png_file_pattern)
+        result["simplifiedExport"] = from_bool(self.simplified_export)
+        result["toc"] = from_list(lambda x: to_class(LdtkTableOfContentEntry, x), self.toc)
+        if self.tutorial_desc is not None:
+            result["tutorialDesc"] = from_union([from_none, from_str], self.tutorial_desc)
+        if self.world_grid_height is not None:
+            result["worldGridHeight"] = from_union([from_none, from_int], self.world_grid_height)
+        if self.world_grid_width is not None:
+            result["worldGridWidth"] = from_union([from_none, from_int], self.world_grid_width)
+        if self.world_layout is not None:
+            result["worldLayout"] = from_union([from_none, lambda x: to_enum(WorldLayout, x)], self.world_layout)
+        result["worlds"] = from_list(lambda x: to_class(World, x), self.worlds)
+        return result
+
+
+def ldtk_json_from_dict(s: Any) -> LdtkJSON:
+    return LdtkJSON.from_dict(s)
+
+
+def ldtk_json_to_dict(x: LdtkJSON) -> Any:
+    return to_class(LdtkJSON, x)
diff --git a/py/engine/__init__.py b/py/engine/__init__.py
new file mode 100644
index 0000000..8b13789
--- /dev/null
+++ b/py/engine/__init__.py
@@ -0,0 +1 @@
+
diff --git a/py/engine/__pycache__/LdtkJson.cpython-313.pyc b/py/engine/__pycache__/LdtkJson.cpython-313.pyc
new file mode 100644
index 0000000..d6d8f18
Binary files /dev/null and b/py/engine/__pycache__/LdtkJson.cpython-313.pyc differ
diff --git a/py/engine/__pycache__/__init__.cpython-313.pyc b/py/engine/__pycache__/__init__.cpython-313.pyc
new file mode 100644
index 0000000..e7cb349
Binary files /dev/null and b/py/engine/__pycache__/__init__.cpython-313.pyc differ
diff --git a/py/engine/__pycache__/framework.cpython-313.pyc b/py/engine/__pycache__/framework.cpython-313.pyc
new file mode 100644
index 0000000..f3ab1a1
Binary files /dev/null and b/py/engine/__pycache__/framework.cpython-313.pyc differ
diff --git a/py/engine/__pycache__/math_extensions.cpython-313.pyc b/py/engine/__pycache__/math_extensions.cpython-313.pyc
new file mode 100644
index 0000000..e4efc7d
Binary files /dev/null and b/py/engine/__pycache__/math_extensions.cpython-313.pyc differ
diff --git a/py/engine/__pycache__/physics_debug.cpython-313.pyc b/py/engine/__pycache__/physics_debug.cpython-313.pyc
new file mode 100644
index 0000000..e7a5cf1
Binary files /dev/null and b/py/engine/__pycache__/physics_debug.cpython-313.pyc differ
diff --git a/py/engine/__pycache__/raycasts.cpython-313.pyc b/py/engine/__pycache__/raycasts.cpython-313.pyc
new file mode 100644
index 0000000..368e40b
Binary files /dev/null and b/py/engine/__pycache__/raycasts.cpython-313.pyc differ
diff --git a/py/engine/framework.py b/py/engine/framework.py
new file mode 100644
index 0000000..47f88fa
--- /dev/null
+++ b/py/engine/framework.py
@@ -0,0 +1,629 @@
+from __future__ import annotations
+
+from typing import Any, Dict, List, Optional, Tuple, Type, TypeVar
+import pyray as rl
+
+T = TypeVar("T")
+
+
+class Component:
+    """Base class for all game object components.
+
+    Attributes:
+        owner: The GameObject that owns this component, or None if unassigned.
+    """
+    def __init__(self) -> None:
+        self.owner: Optional[GameObject] = None
+
+    def init(self) -> None:
+        """Lifecycle hook called when the component is initialized.
+
+        Returns:
+            None
+        """
+        pass
+
+    def update(self, delta_time: float) -> None:
+        """Lifecycle hook called every frame to update the component.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        pass
+
+    def draw(self) -> None:
+        """Lifecycle hook called every frame to draw the component.
+
+        Returns:
+            None
+        """
+        pass
+
+
+class GameObject:
+    """Base class for all game objects (entities) in a scene.
+
+    Attributes:
+        scene: The Scene this object belongs to.
+        components: Mapping of component type to component instance.
+        tags: Set of string tags for lookup/filtering.
+        is_active: If False, update/draw are skipped.
+    """
+    def __init__(self) -> None:
+        self.scene: Optional[Scene] = None
+        self.components: Dict[Type[Any], Component] = {}
+        self.tags: set[str] = set()
+        self.is_active: bool = True
+
+    def init(self) -> None:
+        """Lifecycle hook called when the object is initialized.
+
+        Returns:
+            None
+        """
+        pass
+
+    def update(self, delta_time: float) -> None:
+        """Lifecycle hook called every frame to update the object.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        pass
+
+    def draw(self) -> None:
+        """Lifecycle hook called every frame to draw the object.
+
+        Returns:
+            None
+        """
+        pass
+
+    def init_object(self) -> None:
+        """Initialize the object and its components.
+
+        Returns:
+            None
+        """
+        self.init()
+        for component in list(self.components.values()):
+            component.init()
+
+    def update_object(self, delta_time: float) -> None:
+        """Update the object and its components if active.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        if not self.is_active:
+            return
+        self.update(delta_time)
+        for component in list(self.components.values()):
+            component.update(delta_time)
+
+    def draw_object(self) -> None:
+        """Draw the object and its components if active.
+
+        Returns:
+            None
+        """
+        if not self.is_active:
+            return
+        self.draw()
+        for component in list(self.components.values()):
+            component.draw()
+
+    def add_component(self, component_or_cls: Any, *args: Any, **kwargs: Any) -> Component:
+        """Add a component instance or construct one from a class.
+
+        Args:
+            component_or_cls: A Component instance or a Component class.
+            *args: Positional args forwarded to the component constructor.
+            **kwargs: Keyword args forwarded to the component constructor.
+
+        Returns:
+            The component instance added.
+        """
+        if isinstance(component_or_cls, Component):
+            component = component_or_cls
+        else:
+            component = component_or_cls(*args, **kwargs)
+        component.owner = self
+        key = component.__class__
+        if key in self.components:
+            print(f"Duplicate component added: {key.__name__}")
+        self.components[key] = component
+        return component
+
+    def get_component(self, cls: Type[T]) -> Optional[T]:
+        """Get a component by type, if present.
+
+        Args:
+            cls: Component class to look up.
+
+        Returns:
+            The component instance if found, otherwise None.
+        """
+        component = self.components.get(cls)
+        return component if component is None else component  # type: ignore[return-value]
+
+    def add_tag(self, tag: str) -> None:
+        """Add a tag to this object.
+
+        Args:
+            tag: Tag string to add.
+
+        Returns:
+            None
+        """
+        self.tags.add(tag)
+
+    def remove_tag(self, tag: str) -> None:
+        """Remove a tag from this object.
+
+        Args:
+            tag: Tag string to remove.
+
+        Returns:
+            None
+        """
+        self.tags.discard(tag)
+
+    def has_tag(self, tag: str) -> bool:
+        """Check if a tag is present.
+
+        Args:
+            tag: Tag string to check.
+
+        Returns:
+            True if the tag is present, otherwise False.
+        """
+        return tag in self.tags
+
+
+class Service:
+    """Base class for scene-level services.
+
+    Attributes:
+        scene: The Scene this service is attached to.
+        is_init: True once init_service has been run.
+        is_visible: If False, draw_service is skipped.
+    """
+    def __init__(self) -> None:
+        self.scene: Optional[Scene] = None
+        self.is_init: bool = False
+        self.is_visible: bool = True
+
+    def init(self) -> None:
+        """Lifecycle hook called when the service is initialized.
+
+        Returns:
+            None
+        """
+        pass
+
+    def update(self, delta_time: float) -> None:
+        """Lifecycle hook called every frame to update the service.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        pass
+
+    def draw(self) -> None:
+        """Lifecycle hook called every frame to draw the service.
+
+        Returns:
+            None
+        """
+        pass
+
+    def init_service(self) -> None:
+        """Initialize the service once.
+
+        Returns:
+            None
+        """
+        if self.is_init:
+            return
+        self.init()
+        self.is_init = True
+
+    def draw_service(self) -> None:
+        """Draw the service if visible.
+
+        Returns:
+            None
+        """
+        if self.is_visible:
+            self.draw()
+
+
+class Manager:
+    """Base class for global managers.
+
+    Attributes:
+        is_init: True once init_manager has been run.
+    """
+    def __init__(self) -> None:
+        self.is_init: bool = False
+
+    def init(self) -> None:
+        """Lifecycle hook called when the manager is initialized.
+
+        Returns:
+            None
+        """
+        pass
+
+    def init_manager(self) -> None:
+        """Initialize the manager once.
+
+        Returns:
+            None
+        """
+        if self.is_init:
+            return
+        self.init()
+        self.is_init = True
+
+
+class Scene:
+    """Base class for scenes that contain objects and services.
+
+    Attributes:
+        game_objects: List of GameObjects in the scene.
+        services: List of (type, Service) pairs.
+        game: Owning Game instance.
+        is_init: True once init_scene has been run.
+    """
+    def __init__(self) -> None:
+        self.game_objects: List[GameObject] = []
+        self.services: List[Tuple[Type[Any], Service]] = []
+        self.game: Optional[Game] = None
+        self.is_init: bool = False
+
+    def init_services(self) -> None:
+        """Hook to add services before scene init.
+
+        Returns:
+            None
+        """
+        pass
+
+    def init(self) -> None:
+        """Lifecycle hook called when the scene initializes.
+
+        Returns:
+            None
+        """
+        pass
+
+    def update(self, delta_time: float) -> None:
+        """Lifecycle hook called every frame to update the scene.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        pass
+
+    def draw(self) -> None:
+        """Lifecycle hook called every frame to draw the scene.
+
+        Returns:
+            None
+        """
+        pass
+
+    def init_scene(self) -> None:
+        """Initialize services, scene, and objects.
+
+        Returns:
+            None
+        """
+        if self.is_init:
+            return
+        self.init_services()
+        for _, service in self.services:
+            service.init_service()
+        self.init()
+        for game_object in list(self.game_objects):
+            game_object.init_object()
+        self.is_init = True
+
+    def update_scene(self, delta_time: float) -> None:
+        """Update the scene, services, and objects.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        self.update(delta_time)
+        for _, service in self.services:
+            service.update(delta_time)
+        for game_object in list(self.game_objects):
+            game_object.update_object(delta_time)
+
+    def draw_scene(self) -> None:
+        """Draw the scene, services, and objects.
+
+        Returns:
+            None
+        """
+        self.draw()
+        for _, service in self.services:
+            service.draw_service()
+        for game_object in list(self.game_objects):
+            game_object.draw_object()
+
+    def on_enter(self) -> None:
+        """Hook called when the scene becomes active.
+
+        Returns:
+            None
+        """
+        pass
+
+    def on_exit(self) -> None:
+        """Hook called when the scene is exited.
+
+        Returns:
+            None
+        """
+        pass
+
+    def add_game_object(self, game_object: GameObject) -> GameObject:
+        """Add an existing object to this scene.
+
+        Args:
+            game_object: The object to add.
+
+        Returns:
+            The same object, after being attached to the scene.
+        """
+        game_object.scene = self
+        self.game_objects.append(game_object)
+        return game_object
+
+    def add_game_object_type(self, cls: Type[T], *args: Any, **kwargs: Any) -> T:
+        """Create and add a new object of a given type.
+
+        Args:
+            cls: GameObject class to instantiate.
+            *args: Positional args forwarded to the constructor.
+            **kwargs: Keyword args forwarded to the constructor.
+
+        Returns:
+            The newly created object.
+        """
+        game_object = cls(*args, **kwargs)
+        self.add_game_object(game_object)
+        return game_object
+
+    def add_service(self, service_or_cls: Any, *args: Any, **kwargs: Any) -> Service:
+        """Add a service instance or construct one from a class.
+
+        Args:
+            service_or_cls: A Service instance or a Service class.
+            *args: Positional args forwarded to the constructor.
+            **kwargs: Keyword args forwarded to the constructor.
+
+        Returns:
+            The service instance added.
+        """
+        if isinstance(service_or_cls, Service):
+            service = service_or_cls
+        else:
+            service = service_or_cls(*args, **kwargs)
+        service.scene = self
+        key = service.__class__
+        for svc_key, _ in self.services:
+            if svc_key == key:
+                print(f"Duplicate service added: {key.__name__}")
+                return service
+        self.services.append((key, service))
+        return service
+
+    def get_service(self, cls: Type[T]) -> T:
+        """Get a service by type.
+
+        Args:
+            cls: Service class to look up.
+
+        Returns:
+            The service instance.
+
+        Raises:
+            RuntimeError: If no matching service exists.
+        """
+        for svc_key, svc in self.services:
+            if svc_key == cls:
+                if not svc.is_init:
+                    print(f"Service not initialized: {cls.__name__}")
+                return svc  # type: ignore[return-value]
+        print(f"Service of requested type not found in scene: {cls.__name__}")
+        raise RuntimeError(f"Service not found: {cls.__name__}")
+
+    def get_game_objects_with_tag(self, tag: str) -> List[GameObject]:
+        """Get all objects that contain a tag.
+
+        Args:
+            tag: Tag string to match.
+
+        Returns:
+            List of matching game objects.
+        """
+        return [obj for obj in self.game_objects if obj.has_tag(tag)]
+
+
+class Game:
+    """Main game class that owns managers and scenes.
+
+    Attributes:
+        managers: Mapping of manager type to instance.
+        scenes: Mapping of scene name to instance.
+        scene_order: Ordered list of scene names.
+        current_scene: Active scene.
+        next_scene: Scene queued for transition.
+    """
+    def __init__(self) -> None:
+        self.managers: Dict[Type[Any], Manager] = {}
+        self.scenes: Dict[str, Scene] = {}
+        self.scene_order: List[str] = []
+        self.current_scene: Optional[Scene] = None
+        self.next_scene: Optional[Scene] = None
+
+    def init(self) -> None:
+        """Initialize all managers.
+
+        Returns:
+            None
+        """
+        for manager in self.managers.values():
+            manager.init_manager()
+
+    def update(self, delta_time: float) -> None:
+        """Update the active scene and render it.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        if self.current_scene:
+            self.current_scene.init_scene()
+            self.current_scene.update_scene(delta_time)
+
+            rl.begin_drawing()
+            rl.clear_background(rl.RAYWHITE)
+            self.current_scene.draw_scene()
+            rl.end_drawing()
+
+        if self.next_scene:
+            if self.current_scene:
+                self.current_scene.on_exit()
+            self.current_scene = self.next_scene
+            self.current_scene.on_enter()
+            self.next_scene = None
+
+    def add_manager(self, manager_or_cls: Any, *args: Any, **kwargs: Any) -> Manager:
+        """Add a manager instance or construct one from a class.
+
+        Args:
+            manager_or_cls: A Manager instance or a Manager class.
+            *args: Positional args forwarded to the constructor.
+            **kwargs: Keyword args forwarded to the constructor.
+
+        Returns:
+            The manager instance added.
+        """
+        if isinstance(manager_or_cls, Manager):
+            manager = manager_or_cls
+        else:
+            manager = manager_or_cls(*args, **kwargs)
+        key = manager.__class__
+        if key in self.managers:
+            print(f"Duplicate manager added: {key.__name__}")
+        self.managers[key] = manager
+        return manager
+
+    def get_manager(self, cls: Type[T]) -> T:
+        """Get a manager by type.
+
+        Args:
+            cls: Manager class to look up.
+
+        Returns:
+            The manager instance.
+
+        Raises:
+            RuntimeError: If no matching manager exists.
+        """
+        manager = self.managers.get(cls)
+        if manager is None:
+            print(f"Manager of requested type not found: {cls.__name__}")
+            raise RuntimeError(f"Manager not found: {cls.__name__}")
+        if not manager.is_init:
+            print(f"Manager not initialized: {cls.__name__}")
+        return manager  # type: ignore[return-value]
+
+    def add_scene(self, name: str, scene_or_cls: Any, *args: Any, **kwargs: Any) -> Scene:
+        """Add a scene instance or construct one from a class.
+
+        Args:
+            name: Name to register the scene under.
+            scene_or_cls: A Scene instance or a Scene class.
+            *args: Positional args forwarded to the constructor.
+            **kwargs: Keyword args forwarded to the constructor.
+
+        Returns:
+            The scene instance added.
+        """
+        if isinstance(scene_or_cls, Scene):
+            scene = scene_or_cls
+        else:
+            scene = scene_or_cls(*args, **kwargs)
+        self.scenes[name] = scene
+        scene.game = self
+        self.scene_order.append(name)
+        if not self.current_scene:
+            self.current_scene = scene
+        return scene
+
+    def go_to_scene(self, name: str) -> Optional[Scene]:
+        """Queue a transition to a named scene.
+
+        Args:
+            name: Registered name of the scene.
+
+        Returns:
+            The target scene if found, otherwise None.
+        """
+        scene = self.scenes.get(name)
+        if not scene:
+            print(f"Scene not found: {name}")
+            return None
+        self.next_scene = scene
+        return scene
+
+    def go_to_scene_next(self) -> Optional[Scene]:
+        """Queue a transition to the next scene in order.
+
+        Returns:
+            The next scene if one is available, otherwise None.
+        """
+        if not self.current_scene:
+            return None
+        current_name = None
+        for name, scene in self.scenes.items():
+            if scene == self.current_scene:
+                current_name = name
+                break
+        if current_name is None:
+            return None
+        if current_name in self.scene_order:
+            idx = self.scene_order.index(current_name)
+            if idx + 1 < len(self.scene_order):
+                next_name = self.scene_order[idx + 1]
+            else:
+                next_name = self.scene_order[0]
+            self.next_scene = self.scenes[next_name]
+        return self.next_scene
diff --git a/py/engine/math_extensions.py b/py/engine/math_extensions.py
new file mode 100644
index 0000000..d2de7ca
--- /dev/null
+++ b/py/engine/math_extensions.py
@@ -0,0 +1,49 @@
+from __future__ import annotations
+
+import math
+from typing import Iterable
+import pyray as rl
+
+
+def v2(x: float, y: float) -> rl.Vector2:
+    return rl.Vector2(x, y)
+
+
+def vec_add(a: rl.Vector2, b: rl.Vector2) -> rl.Vector2:
+    return rl.Vector2(a.x + b.x, a.y + b.y)
+
+
+def vec_sub(a: rl.Vector2, b: rl.Vector2) -> rl.Vector2:
+    return rl.Vector2(a.x - b.x, a.y - b.y)
+
+
+def vec_mul(a: rl.Vector2, scalar: float) -> rl.Vector2:
+    return rl.Vector2(a.x * scalar, a.y * scalar)
+
+
+def vec_div(a: rl.Vector2, scalar: float) -> rl.Vector2:
+    return rl.Vector2(a.x / scalar, a.y / scalar)
+
+
+def vec_neg(a: rl.Vector2) -> rl.Vector2:
+    return rl.Vector2(-a.x, -a.y)
+
+
+def vec_eq(a: rl.Vector2, b: rl.Vector2) -> bool:
+    return a.x == b.x and a.y == b.y
+
+
+def vec_len(a: rl.Vector2) -> float:
+    return math.sqrt(a.x * a.x + a.y * a.y)
+
+
+def vec_normalize(a: rl.Vector2) -> rl.Vector2:
+    length = vec_len(a)
+    if length <= 1e-8:
+        return rl.Vector2(0.0, 0.0)
+    return rl.Vector2(a.x / length, a.y / length)
+
+
+def vec_from_iter(values: Iterable[float]) -> rl.Vector2:
+    x, y = values
+    return rl.Vector2(float(x), float(y))
diff --git a/py/engine/physics_debug.py b/py/engine/physics_debug.py
new file mode 100644
index 0000000..dcf1ace
--- /dev/null
+++ b/py/engine/physics_debug.py
@@ -0,0 +1,94 @@
+from __future__ import annotations
+
+from dataclasses import dataclass
+from typing import Tuple
+
+from Box2D import b2Color, b2Draw
+import pyray as rl
+
+
+@dataclass
+class DebugDrawCtx:
+    meters_to_pixels: float = 30.0
+    line_thickness: float = 1.0
+
+
+def _to_raylib_color(color: b2Color, alpha: float = 1.0) -> rl.Color:
+    r = int(max(0, min(255, color.r * 255)))
+    g = int(max(0, min(255, color.g * 255)))
+    b = int(max(0, min(255, color.b * 255)))
+    a = int(max(0, min(255, alpha * 255)))
+    return rl.Color(r, g, b, a)
+
+
+class PhysicsDebugRenderer(b2Draw):
+    def __init__(self, meters_to_pixels: float = 30.0, line_thickness: float = 1.0) -> None:
+        super().__init__()
+        self.ctx = DebugDrawCtx(meters_to_pixels=meters_to_pixels, line_thickness=line_thickness)
+
+    def DrawPolygon(self, vertices, color):
+        count = len(vertices)
+        if count < 2:
+            return
+        c = _to_raylib_color(color)
+        for i in range(count):
+            p0 = vertices[i]
+            p1 = vertices[(i + 1) % count]
+            a = rl.Vector2(p0[0] * self.ctx.meters_to_pixels, p0[1] * self.ctx.meters_to_pixels)
+            b = rl.Vector2(p1[0] * self.ctx.meters_to_pixels, p1[1] * self.ctx.meters_to_pixels)
+            rl.draw_line_ex(a, b, self.ctx.line_thickness, c)
+
+    def DrawSolidPolygon(self, vertices, color):
+        count = len(vertices)
+        if count < 2:
+            return
+        fill = _to_raylib_color(color, 0.8)
+        line = _to_raylib_color(color, 1.0)
+        pts = [rl.Vector2(v[0] * self.ctx.meters_to_pixels, v[1] * self.ctx.meters_to_pixels) for v in vertices]
+        center = rl.Vector2(0.0, 0.0)
+        for p in pts:
+            center.x += p.x
+            center.y += p.y
+        center.x /= count
+        center.y /= count
+        for i in range(count - 1):
+            rl.draw_triangle(pts[i], center, pts[i + 1], fill)
+        rl.draw_triangle(pts[count - 1], center, pts[0], fill)
+        for i in range(count):
+            rl.draw_line_ex(pts[i], pts[(i + 1) % count], self.ctx.line_thickness, line)
+
+    def DrawCircle(self, center, radius, color):
+        c = _to_raylib_color(color)
+        rl.draw_circle_lines(int(center[0] * self.ctx.meters_to_pixels),
+                        int(center[1] * self.ctx.meters_to_pixels),
+                        radius * self.ctx.meters_to_pixels,
+                        c)
+
+    def DrawSolidCircle(self, center, radius, axis, color):
+        fill = _to_raylib_color(color, 0.8)
+        line = _to_raylib_color(color, 1.0)
+        c = rl.Vector2(center[0] * self.ctx.meters_to_pixels, center[1] * self.ctx.meters_to_pixels)
+        rl.draw_circle_v(c, radius * self.ctx.meters_to_pixels, fill)
+        axis_end = rl.Vector2((center[0] + axis[0] * radius) * self.ctx.meters_to_pixels,
+                           (center[1] + axis[1] * radius) * self.ctx.meters_to_pixels)
+        rl.draw_line_ex(c, axis_end, self.ctx.line_thickness, line)
+
+    def DrawSegment(self, p1, p2, color):
+        c = _to_raylib_color(color)
+        a = rl.Vector2(p1[0] * self.ctx.meters_to_pixels, p1[1] * self.ctx.meters_to_pixels)
+        b = rl.Vector2(p2[0] * self.ctx.meters_to_pixels, p2[1] * self.ctx.meters_to_pixels)
+        rl.draw_line_ex(a, b, self.ctx.line_thickness, c)
+
+    def DrawTransform(self, xf):
+        p = xf.position
+        x_axis = xf.R.x_axis
+        y_axis = xf.R.y_axis
+        origin = rl.Vector2(p[0] * self.ctx.meters_to_pixels, p[1] * self.ctx.meters_to_pixels)
+        x_end = rl.Vector2((p[0] + x_axis[0]) * self.ctx.meters_to_pixels, (p[1] + x_axis[1]) * self.ctx.meters_to_pixels)
+        y_end = rl.Vector2((p[0] + y_axis[0]) * self.ctx.meters_to_pixels, (p[1] + y_axis[1]) * self.ctx.meters_to_pixels)
+        rl.draw_line_ex(origin, x_end, self.ctx.line_thickness, rl.RED)
+        rl.draw_line_ex(origin, y_end, self.ctx.line_thickness, rl.GREEN)
+
+    def DrawPoint(self, p, size, color):
+        c = _to_raylib_color(color)
+        rl.draw_circle_v(rl.Vector2(p[0] * self.ctx.meters_to_pixels, p[1] * self.ctx.meters_to_pixels), size, c)
diff --git a/py/engine/prefabs/__init__.py b/py/engine/prefabs/__init__.py
new file mode 100644
index 0000000..8b13789
--- /dev/null
+++ b/py/engine/prefabs/__init__.py
@@ -0,0 +1 @@
+
diff --git a/py/engine/prefabs/__pycache__/__init__.cpython-313.pyc b/py/engine/prefabs/__pycache__/__init__.cpython-313.pyc
new file mode 100644
index 0000000..74ce241
Binary files /dev/null and b/py/engine/prefabs/__pycache__/__init__.cpython-313.pyc differ
diff --git a/py/engine/prefabs/__pycache__/components.cpython-313.pyc b/py/engine/prefabs/__pycache__/components.cpython-313.pyc
new file mode 100644
index 0000000..dccee03
Binary files /dev/null and b/py/engine/prefabs/__pycache__/components.cpython-313.pyc differ
diff --git a/py/engine/prefabs/__pycache__/game_objects.cpython-313.pyc b/py/engine/prefabs/__pycache__/game_objects.cpython-313.pyc
new file mode 100644
index 0000000..c541a81
Binary files /dev/null and b/py/engine/prefabs/__pycache__/game_objects.cpython-313.pyc differ
diff --git a/py/engine/prefabs/__pycache__/includes.cpython-313.pyc b/py/engine/prefabs/__pycache__/includes.cpython-313.pyc
new file mode 100644
index 0000000..07cfbd6
Binary files /dev/null and b/py/engine/prefabs/__pycache__/includes.cpython-313.pyc differ
diff --git a/py/engine/prefabs/__pycache__/managers.cpython-313.pyc b/py/engine/prefabs/__pycache__/managers.cpython-313.pyc
new file mode 100644
index 0000000..cbdab72
Binary files /dev/null and b/py/engine/prefabs/__pycache__/managers.cpython-313.pyc differ
diff --git a/py/engine/prefabs/__pycache__/services.cpython-313.pyc b/py/engine/prefabs/__pycache__/services.cpython-313.pyc
new file mode 100644
index 0000000..b5fda48
Binary files /dev/null and b/py/engine/prefabs/__pycache__/services.cpython-313.pyc differ
diff --git a/py/engine/prefabs/components.h b/py/engine/prefabs/components.h
new file mode 100644
index 0000000..ff44f81
--- /dev/null
+++ b/py/engine/prefabs/components.h
@@ -0,0 +1,1392 @@
+#pragma once
+
+#include "engine/framework.h"
+#include "engine/prefabs/managers.h"
+#include "engine/prefabs/services.h"
+#include "engine/raycasts.h"
+
+/**
+ * For when you want a GameObject to have multiple of the same component.
+ */
+template <typename T>
+class MultiComponent : public Component
+{
+public:
+    std::unordered_map<std::string, std::unique_ptr<T>> components;
+
+    MultiComponent() {}
+
+    /**
+     * Initialize all components.
+     */
+    void init() override
+    {
+        for (auto& component : components)
+        {
+            component.second->init();
+        }
+    }
+
+    /**
+     * Update all components.
+     *
+     * @param delta_time The time elapsed since the last frame.
+     */
+    void update(float delta_time) override
+    {
+        for (auto& component : components)
+        {
+            component.second->update(delta_time);
+        }
+    }
+
+    /**
+     * Draw all components.
+     */
+    void draw() override
+    {
+        for (auto& component : components)
+        {
+            component.second->draw();
+        }
+    }
+
+    /**
+     * Add a component to the MultiComponent.
+     *
+     * @param name The name to give the component.
+     * @param component The component to add.
+     */
+    void add_component(std::string name, std::unique_ptr<T> component)
+    {
+        static_assert(std::is_base_of<Component, T>::value, "T must derive from Component");
+        components[name] = std::move(component);
+        components[name]->owner = owner;
+    }
+
+    /**
+     * Create a component and add it to the MultiComponent.
+     *
+     * @param name The name to give the component.
+     * @param args The arguments to forward to the component constructor.
+     * @return A pointer to the added component.
+     */
+    template <typename... TArgs>
+    T* add_component(std::string name, TArgs&&... args)
+    {
+        static_assert(std::is_base_of<Component, T>::value, "T must derive from Component");
+        auto new_component = std::make_unique<T>(std::forward<TArgs>(args)...);
+        T* component_ptr = new_component.get();
+        add_component(name, std::move(new_component));
+        return component_ptr;
+    }
+
+    /**
+     * Get a component by name.
+     *
+     * @param name The name of the component.
+     * @return A pointer to the component.
+     */
+    T* get_component(std::string name)
+    {
+        return components[name].get();
+    }
+};
+
+/**
+ * A component for rendering text.
+ * Depends on FontManager.
+ */
+class TextComponent : public Component
+{
+public:
+    FontManager* font_manager;
+    std::string text;
+    std::string font_name;
+    int font_size = 20;
+    Color color = WHITE;
+    Vector2 position = {0, 0};
+    float rotation = 0.0f;
+
+    /**
+     * Constructor for TextComponent.
+     *
+     * @param text The text to display.
+     * @param font_name The name of the font to use.
+     * @param font_size The size of the font.
+     * @param color The color of the text.
+     */
+    TextComponent(std::string text, std::string font_name = "default", int font_size = 20, Color color = WHITE) :
+        text(text),
+        font_name(font_name),
+        font_size(font_size),
+        color(color)
+    {
+    }
+
+    /**
+     * Initialize the text component.
+     */
+    void init() override
+    {
+        font_manager = owner->scene->game->get_manager<FontManager>();
+    }
+
+    /**
+     * Draw the text.
+     */
+    void draw() override
+    {
+        DrawTextEx(font_manager->get_font(font_name),
+                   text.c_str(),
+                   position,
+                   static_cast<float>(font_size),
+                   1.0f,
+                   color);
+    }
+
+    /**
+     * Set the text to display.
+     *
+     * @param text The text to display.
+     */
+    void set_text(const std::string& text)
+    {
+        this->text = text;
+    }
+
+    /**
+     * Set the color of the text.
+     *
+     * @param color The color to set.
+     */
+    void set_color(Color color)
+    {
+        this->color = color;
+    }
+
+    /**
+     * Set the font size.
+     *
+     * @param font_size The font size to set.
+     */
+    void set_font_size(int font_size)
+    {
+        this->font_size = font_size;
+    }
+
+    /**
+     * Set the font by name.
+     *
+     * @param font_name The name of the font to set.
+     */
+    void set_font(const std::string& font_name)
+    {
+        this->font_name = font_name;
+    }
+
+    /**
+     * Set the position of the text.
+     *
+     * @param position The position to set.
+     */
+    void set_position(Vector2 position)
+    {
+        this->position = position;
+    }
+
+    /**
+     * Set the rotation of the text.
+     *
+     * @param rotation The rotation to set.
+     */
+    void set_rotation(float rotation)
+    {
+        this->rotation = rotation;
+    }
+};
+
+/**
+ * A component for playing sounds.
+ * Depends on SoundService.
+ */
+class SoundComponent : public Component
+{
+public:
+    std::string filename;
+    Sound sound;
+    float volume = 1.0f;
+    float pitch = 1.0f;
+    float pan = 0.5f;
+
+    /**
+     * Constructor for SoundComponent.
+     *
+     * @param filename The filename of the sound to load.
+     * @param volume The initial volume of the sound.
+     * @param pitch The initial pitch of the sound.
+     */
+    SoundComponent(std::string filename, float volume = 1.0f, float pitch = 1.0f, float pan = 0.5f) :
+        filename(filename),
+        volume(volume),
+        pitch(pitch),
+        pan(pan)
+    {
+    }
+
+    /**
+     * Initialize the sound component.
+     */
+    void init() override
+    {
+        auto sound_service = owner->scene->get_service<SoundService>();
+        sound = sound_service->get_sound(filename);
+    }
+
+    /**
+     * Play the sound.
+     */
+    void play()
+    {
+        PlaySound(sound);
+    }
+
+    /**
+     * Stop the sound.
+     */
+    void stop()
+    {
+        StopSound(sound);
+    }
+
+    /**
+     * Set the volume of the sound.
+     *
+     * @param volume The volume to set.
+     */
+    void set_volume(float volume)
+    {
+        this->volume = volume;
+        SetSoundVolume(sound, volume);
+    }
+
+    /**
+     * Set the pitch of the sound.
+     *
+     * @param pitch The pitch to set.
+     */
+    void set_pitch(float pitch)
+    {
+        this->pitch = pitch;
+        SetSoundPitch(sound, pitch);
+    }
+
+    /**
+     * Set the pan of the sound.
+     *
+     * @param pan The pan to set, between 0.0 (left) and 1.0 (right).
+     */
+    void set_pan(float pan)
+    {
+        this->pan = pan;
+        SetSoundPan(sound, pan);
+    }
+
+    /**
+     * Check if the sound is currently playing.
+     *
+     * @return True if the sound is playing, false otherwise.
+     */
+    bool is_playing()
+    {
+        return IsSoundPlaying(sound);
+    }
+};
+
+/**
+ * A component for a Box2D physics body.
+ * Depends on PhysicsService.
+ */
+class BodyComponent : public Component
+{
+public:
+    b2BodyId id = b2_nullBodyId;
+    std::function<void(BodyComponent&)> build;
+    PhysicsService* physics;
+
+    BodyComponent() {}
+
+    /**
+     * Constructor for BodyComponent with existing body ID.
+     *
+     * @param id The Box2D body ID.
+     */
+    BodyComponent(b2BodyId id) : id(id) {}
+
+    /**
+     * Specify a lambda for creating the physics body which will be called during init.
+     * It is the user's responsibility to assign the body id to id in this function.
+     *
+     * @param build A user provided function for creating a physics body.
+     */
+    BodyComponent(std::function<void(BodyComponent&)> build = {}) : build(std::move(build)) {}
+
+    ~BodyComponent()
+    {
+        if (b2Body_IsValid(id))
+        {
+            b2DestroyBody(id);
+        }
+    }
+
+    /**
+     * Initialize the body component.
+     */
+    void init() override
+    {
+        physics = owner->scene->get_service<PhysicsService>();
+        if (build)
+        {
+            build(*this);
+        }
+    }
+
+    /**
+     * Enable the body in the physics simulation.
+     */
+    void enable()
+    {
+        b2Body_Enable(id);
+    }
+
+    /**
+     * Disable the body in the physics simulation.
+     */
+    void disable()
+    {
+        b2Body_Disable(id);
+    }
+
+    /**
+     * Get the position of the body in meters.
+     */
+    b2Vec2 get_position_meters() const
+    {
+        return b2Body_GetPosition(id);
+    }
+
+    /**
+     * Get the position of the body in pixels.
+     */
+    Vector2 get_position_pixels() const
+    {
+        return physics->convert_to_pixels(get_position_meters());
+    }
+
+    /**
+     * Set the position of the body in meters.
+     *
+     * @param meters The position in meters.
+     */
+    void set_position(b2Vec2 meters)
+    {
+        b2Rot rotation = b2Body_GetRotation(id);
+        b2Body_SetTransform(id, meters, rotation);
+    }
+
+    /**
+     * Set the position of the body in pixels.
+     *
+     * @param pixels The position in pixels.
+     */
+    void set_position(Vector2 pixels)
+    {
+        set_position(physics->convert_to_meters(pixels));
+    }
+
+    /**
+     * Set the rotation of the body in degrees.
+     *
+     * @param degrees The rotation in degrees.
+     */
+    void set_rotation(float degrees)
+    {
+        b2Vec2 position = b2Body_GetPosition(id);
+        b2Rot rotation = b2MakeRot(degrees * DEG2RAD);
+        b2Body_SetTransform(id, position, rotation);
+    }
+
+    /**
+     * Get the velocity of the body in meters per second.
+     *
+     * @return The velocity in meters per second.
+     */
+    b2Vec2 get_velocity_meters() const
+    {
+        return b2Body_GetLinearVelocity(id);
+    }
+
+    /**
+     * Get the velocity of the body in pixels per second.
+     *
+     * @return The velocity in pixels per second.
+     */
+    Vector2 get_velocity_pixels() const
+    {
+        return physics->convert_to_pixels(get_velocity_meters());
+    }
+
+    /**
+     * Set the velocity of the body in meters per second.
+     *
+     * @param meters_per_second The velocity in meters per second.
+     */
+    void set_velocity(b2Vec2 meters_per_second)
+    {
+        b2Body_SetLinearVelocity(id, meters_per_second);
+    }
+
+    /**
+     * Set the velocity of the body in pixels per second.
+     *
+     * @param pixels_per_second The velocity in pixels per second.
+     */
+    void set_velocity(Vector2 pixels_per_second)
+    {
+        set_velocity(physics->convert_to_meters(pixels_per_second));
+    }
+
+    /**
+     * Get the rotation of the body in degrees.
+     *
+     * @return The rotation in degrees.
+     */
+    float get_rotation() const
+    {
+        auto rot = b2Body_GetRotation(id);
+        return b2Rot_GetAngle(rot) * RAD2DEG;
+    }
+
+    /**
+     * Get a list of all bodies colliding with this one.
+     * https://box2d.org/documentation/md_simulation.html#autotoc_md94
+     *
+     * @return A list of b2BodyIds that are touching this one. Combine with User Data to get your objects.
+     */
+    std::vector<b2BodyId> get_contacts()
+    {
+        // Choose 10 as an arbitrary max number of contacts on the body.
+        constexpr int capacity = 10;
+        b2ContactData contact_data[capacity];
+
+        int count = b2Body_GetContactData(id, contact_data, capacity);
+        std::vector<b2BodyId> contacts;
+        for (int i = 0; i < count; i++)
+        {
+            auto contact = contact_data[i];
+            auto body_a = b2Shape_GetBody(contact.shapeIdA);
+            auto body_b = b2Shape_GetBody(contact.shapeIdB);
+            auto body = body_a == id ? body_b : body_a;
+            contacts.push_back(body);
+        }
+
+        // Remove duplicate bodies.
+        std::sort(contacts.begin(), contacts.end());
+        contacts.erase(std::unique(contacts.begin(), contacts.end()), contacts.end());
+        return contacts;
+    }
+
+    /**
+     * Get a list of all bodies overlapping with sensors in this body.
+     * The shape definitions must have isSensor and enableSensorEvents set.
+     * https://box2d.org/documentation/md_simulation.html#autotoc_md81
+     *
+     * @return A list of b2BodyIds that are overlapping the sensor shapes in this body. Combine with User Data to get
+     * your objects.
+     */
+    std::vector<b2BodyId> get_sensor_overlaps()
+    {
+        // Choose 10 as an arbitrary max number of shapes on the body.
+        constexpr int shape_capacity = 10;
+        b2ShapeId shapes[shape_capacity];
+        int shape_count = b2Body_GetShapes(id, shapes, shape_capacity);
+
+        std::vector<b2BodyId> contacts;
+        for (int i = 0; i < shape_count; i++)
+        {
+            auto shape = shapes[i];
+            if (b2Shape_IsSensor(shape))
+            {
+                // Choose 10 as an arbitrary max number of contacts on the sensor shape.
+                constexpr int shape_capacity = 10;
+                b2ShapeId shapes[shape_capacity];
+                int shape_count = b2Shape_GetSensorOverlaps(shape, shapes, shape_capacity);
+
+                for (int j = 0; j < shape_count; j++)
+                {
+                    auto shape = shapes[j];
+                    auto body = b2Shape_GetBody(shape);
+                    // Check if body is already in contacts to avoid duplicates.
+                    if (std::find(contacts.begin(), contacts.end(), body) == contacts.end())
+                    {
+                        contacts.push_back(body);
+                    }
+                }
+            }
+        }
+
+        // Remove duplicate bodies.
+        std::sort(contacts.begin(), contacts.end());
+        contacts.erase(std::unique(contacts.begin(), contacts.end()), contacts.end());
+        return contacts;
+    }
+};
+
+/**
+ * A component for rendering a sprite.
+ * Depends on TextureService.
+ */
+class SpriteComponent : public Component
+{
+public:
+    std::string filename;
+    BodyComponent* body = nullptr;
+
+    Texture2D sprite;
+    Vector2 position = {0, 0};
+    float rotation = 0.0f;
+    float scale = 1.0f;
+    Color tint = WHITE;
+    bool is_active = true;
+
+    /**
+     * Constructor for SpriteComponent.
+     *
+     * @param filename The filename of the texture to load.
+     */
+    SpriteComponent(std::string filename) : filename(filename) {}
+
+    /**
+     * Constructor for SpriteComponent with optional BodyComponent to follow.
+     *
+     * @param body The BodyComponent to follow for position and rotation.
+     * @param filename The filename of the texture to load.
+     */
+    SpriteComponent(std::string filename, BodyComponent* body) : filename(filename), body(body) {}
+
+    /**
+     * Initialize the sprite component.
+     */
+    void init() override
+    {
+        auto texture_service = owner->scene->get_service<TextureService>();
+        sprite = texture_service->get_texture(filename);
+    }
+
+    /**
+     * Draw the sprite.
+     */
+    void draw() override
+    {
+        if (!is_active)
+        {
+            return;
+        }
+
+        if (body)
+        {
+            position = body->get_position_pixels();
+            rotation = body->get_rotation();
+        }
+
+        Rectangle source = {0, 0, (float)sprite.width, (float)sprite.height};
+        Rectangle dest = {position.x, position.y, (float)sprite.width * scale, (float)sprite.height * scale};
+        Vector2 origin = {sprite.width / 2.0f * scale, sprite.height / 2.0f * scale};
+
+        DrawTexturePro(sprite, source, dest, origin, rotation, tint);
+    }
+
+    /**
+     * Set the position of the sprite.
+     *
+     * @param position The position to set.
+     */
+    void set_position(Vector2 position)
+    {
+        this->position = position;
+    }
+
+    /**
+     * Set the rotation of the sprite.
+     *
+     * @param rotation The rotation to set in degrees.
+     */
+    void set_rotation(float rotation)
+    {
+        this->rotation = rotation;
+    }
+
+    /**
+     * Set the scale of the sprite.
+     *
+     * @param scale The scale to set.
+     */
+    void set_scale(float scale)
+    {
+        this->scale = scale;
+    }
+
+    /**
+     * Set the tint color of the sprite.
+     *
+     * @param tint The tint color to set.
+     */
+    void set_tint(Color tint)
+    {
+        this->tint = tint;
+    }
+
+    /**
+     * Set whether the sprite is active or not.
+     * The sprite will not be drawn if inactive.
+     *
+     * @param active True to make the sprite active, false to deactivate it.
+     */
+    void set_active(bool active)
+    {
+        is_active = active;
+    }
+};
+
+/**
+ * A class for handling frame-based animations.
+ * Depends on TextureService.
+ */
+class Animation
+{
+public:
+    std::vector<Texture2D> frames;
+    float fps = 15.0f;
+    float frame_timer = 0.0f;
+    bool loop = true;
+
+    int current_frame = 0;
+    bool playing = true;
+    bool is_active = true;
+
+    /**
+     * Constructor for Animation.
+     *
+     * @param frames The frames of the animation as Texture2D objects.
+     * @param fps The frames per second of the animation.
+     * @param loop Whether the animation should loop or not.
+     */
+    Animation(const std::vector<Texture2D>& frames, float fps = 15.0f, bool loop = true) :
+        frames(frames),
+        fps(fps),
+        frame_timer(1.0f / fps),
+        loop(loop)
+    {
+    }
+
+    /**
+     * Constructor for Animation that loads frames from filenames.
+     *
+     * @param texture_service The TextureService to load textures from.
+     * @param filenames The filenames of the frames of the animation.
+     * @param fps The frames per second of the animation.
+     * @param loop Whether the animation should loop or not.
+     */
+    Animation(TextureService* texture_service,
+              const std::vector<std::string>& filenames,
+              float fps = 15.0f,
+              bool loop = true) :
+        fps(fps),
+        frame_timer(1.0f / fps),
+        loop(loop)
+    {
+        for (const auto& filename : filenames)
+        {
+            frames.push_back(texture_service->get_texture(filename));
+        }
+    }
+
+    /**
+     * Update the animation.
+     *
+     * @param delta_time The time elapsed since the last frame.
+     */
+    void update(float delta_time)
+    {
+        if (frames.empty())
+        {
+            return;
+        }
+        if (!playing || !is_active)
+        {
+            return;
+        }
+
+        frame_timer -= delta_time;
+        if (frame_timer <= 0.0f)
+        {
+            frame_timer = 1.0f / fps;
+            current_frame++;
+        }
+
+        if (current_frame > frames.size() - 1)
+        {
+            if (loop)
+                current_frame = 0;
+            else
+            {
+                current_frame = (int)frames.size() - 1;
+            }
+        }
+    }
+
+    /**
+     * Draw the animation.
+     *
+     * @param position The position to draw the animation at.
+     * @param rotation The rotation of the animation in degrees.
+     * @param tint The tint color to apply to the animation.
+     */
+    void draw(Vector2 position, float rotation = 0.0f, Color tint = WHITE)
+    {
+        if (!is_active)
+        {
+            return;
+        }
+
+        auto sprite = frames[current_frame];
+        DrawTexturePro(sprite,
+                       {0.0f, 0.0f, static_cast<float>(sprite.width), static_cast<float>(sprite.height)},
+                       {position.x, position.y, static_cast<float>(sprite.width), static_cast<float>(sprite.height)},
+                       {static_cast<float>(sprite.width) / 2.0f, static_cast<float>(sprite.height) / 2.0f},
+                       rotation,
+                       tint);
+    }
+
+    /**
+     * Draw the animation with a specific origin.
+     *
+     * @param position The position to draw the animation at.
+     * @param origin The origin point for rotation and scaling.
+     * @param rotation The rotation of the animation in degrees.
+     * @param scale The scale of the animation.
+     * @param flip_x Whether to flip the animation horizontally.
+     * @param flip_y Whether to flip the animation vertically.
+     * @param tint The tint color to apply to the animation.
+     */
+    void draw(Vector2 position,
+              Vector2 origin,
+              float rotation = 0.0f,
+              float scale = 1.0f,
+              bool flip_x = false,
+              bool flip_y = false,
+              Color tint = WHITE)
+    {
+        if (!is_active)
+        {
+            return;
+        }
+
+        auto sprite = frames[current_frame];
+        DrawTexturePro(sprite,
+                       {0.0f,
+                        0.0f,
+                        static_cast<float>(sprite.width) * (flip_x ? -1.0f : 1.0f),
+                        static_cast<float>(sprite.height) * (flip_y ? -1.0f : 1.0f)},
+                       {position.x,
+                        position.y,
+                        static_cast<float>(sprite.width) * scale,
+                        static_cast<float>(sprite.height) * scale},
+                       origin * scale,
+                       rotation,
+                       tint);
+    }
+
+    /**
+     * Play the animation.
+     */
+    void play()
+    {
+        playing = true;
+    }
+
+    /**
+     * Pause the animation.
+     */
+    void pause()
+    {
+        playing = false;
+    }
+
+    /**
+     * Stop the animation and reset to the first frame.
+     */
+    void stop()
+    {
+        playing = false;
+        frame_timer = 1.0f / fps;
+        current_frame = 0;
+    }
+};
+
+/**
+ * A component for controlling animations.
+ * Depends on TextureService.
+ */
+class AnimationController : public Component
+{
+public:
+    std::unordered_map<std::string, std::unique_ptr<Animation>> animations;
+    Animation* current_animation = nullptr;
+    Vector2 position = {0.0f, 0.0f};
+    float rotation = 0.0f;
+    Vector2 origin = {0.0f, 0.0f};
+    float scale = 1.0f;
+    bool flip_x = false;
+    bool flip_y = false;
+    BodyComponent* body = nullptr;
+
+    AnimationController() = default;
+
+    /**
+     * Constructor for AnimationController that follows a BodyComponent.
+     *
+     * @param body The BodyComponent to follow for position and rotation.
+     */
+    AnimationController(BodyComponent* body) : body(body) {}
+
+    /**
+     * Update the animation controller.
+     *
+     * @param delta_time The time elapsed since the last frame.
+     */
+    void update(float delta_time) override
+    {
+        if (current_animation)
+        {
+            current_animation->update(delta_time);
+        }
+    }
+
+    /**
+     * Draw the current animation.
+     */
+    void draw() override
+    {
+        if (body)
+        {
+            position = body->get_position_pixels();
+            rotation = body->get_rotation();
+        }
+
+        if (current_animation)
+        {
+            current_animation->draw(position, origin, rotation, scale, flip_x, flip_y);
+        }
+    }
+
+    /**
+     * Add an existing animation to the controller.
+     *
+     * @param name The name to give the animation.
+     * @param animation The animation to add.
+     */
+    void add_animation(const std::string& name, std::unique_ptr<Animation> animation)
+    {
+        animations[name] = std::move(animation);
+        if (!current_animation)
+        {
+            current_animation = animations[name].get();
+            auto sprite = current_animation->frames[current_animation->current_frame];
+            origin = {sprite.width / 2.0f, sprite.height / 2.0f};
+        }
+    }
+
+    /**
+     * Create an animation and add it to the controller.
+     *
+     * @param name The name to give the animation.
+     * @param args The arguments to forward to the Animation constructor.
+     * @return A pointer to the added animation.
+     */
+    template <typename... TArgs>
+    Animation* add_animation(const std::string& name, TArgs&&... args)
+    {
+        auto texture_service = owner->scene->get_service<TextureService>();
+        auto new_animation = std::make_unique<Animation>(texture_service, std::forward<TArgs>(args)...);
+        Animation* animation_ptr = new_animation.get();
+        add_animation(name, std::move(new_animation));
+        return animation_ptr;
+    }
+
+    /**
+     * Get an animation by name.
+     *
+     * @param name The name of the animation.
+     * @return A pointer to the animation.
+     */
+    Animation* get_animation(const std::string& name)
+    {
+        return animations[name].get();
+    }
+
+    /**
+     * Play the current animation.
+     */
+    void play()
+    {
+        if (current_animation)
+        {
+            current_animation->play();
+        }
+    }
+
+    /**
+     * Play an animation by name.
+     *
+     * @param name The name of the animation to play.
+     */
+    void play(const std::string& name)
+    {
+        auto it = animations.find(name);
+        if (it != animations.end())
+        {
+            current_animation = it->second.get();
+            current_animation->play();
+            auto sprite = current_animation->frames[current_animation->current_frame];
+        }
+    }
+
+    /**
+     * Pause the current animation.
+     */
+    void pause()
+    {
+        if (current_animation)
+        {
+            current_animation->pause();
+        }
+    }
+
+    /**
+     * Set whether the current animation is playing or paused.
+     *
+     * @param play True to play the animation, false to pause it.
+     */
+    void set_play(bool play)
+    {
+        if (current_animation)
+        {
+            if (play)
+            {
+                current_animation->play();
+            }
+            else
+            {
+                current_animation->pause();
+            }
+        }
+    }
+
+    /**
+     * Stop the current animation.
+     */
+    void stop()
+    {
+        if (current_animation)
+        {
+            current_animation->stop();
+        }
+    }
+
+    /**
+     * Set the position of the animation.
+     *
+     * @param pos The position to set.
+     */
+    void set_position(Vector2 pos)
+    {
+        position = pos;
+    }
+
+    /**
+     * Set the rotation of the animation.
+     *
+     * @param rot The rotation to set in degrees.
+     */
+    void set_rotation(float rot)
+    {
+        rotation = rot;
+    }
+
+    /**
+     * Set the origin of the animation.
+     *
+     * @param orig The origin to set.
+     */
+    void set_origin(Vector2 orig)
+    {
+        origin = orig;
+    }
+
+    /**
+     * Set the scale of the animation.
+     *
+     * @param s The scale to set.
+     */
+    void set_scale(float s)
+    {
+        scale = s;
+    }
+
+    /**
+     * Set whether to flip the animation horizontally.
+     *
+     * @param fx True to flip horizontally, false otherwise.
+     */
+    void set_flip_x(bool fx)
+    {
+        flip_x = fx;
+    }
+
+    /**
+     * Set whether to flip the animation vertically.
+     *
+     * @param fy True to flip vertically, false otherwise.
+     */
+    void set_flip_y(bool fy)
+    {
+        flip_y = fy;
+    }
+};
+
+/**
+ * Parameters for PlatformerMovementComponent.
+ */
+struct PlatformerMovementParams
+{
+    float width = 24.0f; // pixels
+    float height = 40.0f; // pixels
+
+    // Movement
+    float max_speed = 220.0f; // pixels / second
+    float accel = 2000.0f; // pixels / second / second
+    float decel = 2500.0f; // pixels / second / second
+
+    // Gravity / jump
+    float gravity = 1400.0f; // pixels / second / second
+    float jump_speed = 520.0f; // pixels / second
+    float fall_speed = 1200.0f; // pixels / second
+    float jump_cutoff_multiplier = 0.45f; // jump multiplier when the jump button is released early
+
+    // Forgiveness
+    float coyote_time = 0.08f; // seconds
+    float jump_buffer = 0.10f; // seconds
+};
+
+/**
+ * A component for 2D platformer movement.
+ * Depends on PhysicsService and BodyComponent.
+ */
+class PlatformerMovementComponent : public Component
+{
+public:
+    PlatformerMovementParams p;
+    PhysicsService* physics;
+    BodyComponent* body;
+
+    bool grounded = false;
+    bool on_wall_left = false;
+    bool on_wall_right = false;
+    float coyote_timer = 0.0f;
+    float jump_buffer_timer = 0.0f;
+
+    float move_x = 0;
+    bool jump_pressed = false;
+    bool jump_held = false;
+
+    /**
+     * Constructor for PlatformerMovementComponent.
+     *
+     * @param p The movement parameters.
+     */
+    PlatformerMovementComponent(PlatformerMovementParams p) : p(p) {}
+
+    /**
+     * Initialize the movement component.
+     */
+    void init() override
+    {
+        physics = owner->scene->get_service<PhysicsService>();
+        body = owner->get_component<BodyComponent>();
+    }
+
+    /**
+     * Update the movement component.
+     *
+     * @param delta_time The time elapsed since the last frame.
+     */
+    void update(float delta_time) override
+    {
+        if (!b2Body_IsValid(body->id))
+        {
+            return;
+        }
+
+        coyote_timer = std::max(0.0f, coyote_timer - delta_time);
+        jump_buffer_timer = std::max(0.0f, jump_buffer_timer - delta_time);
+
+        if (jump_pressed)
+        {
+            jump_buffer_timer = p.jump_buffer;
+        }
+
+        // Grounded check
+        grounded = false;
+        on_wall_left = false;
+        on_wall_right = false;
+
+        // Convert probe distances to meters
+        float ray_length = physics->convert_to_meters(4.0f);
+
+        float half_width = physics->convert_to_meters(p.width) / 2.0f;
+        float half_height = physics->convert_to_meters(p.height) / 2.0f;
+
+        // Ground: cast down from two points near the feet (left/right)
+        auto pos = body->get_position_meters();
+        b2Vec2 ground_left_start = {pos.x - half_width, pos.y + half_height};
+        b2Vec2 ground_right_start = {pos.x + half_width, pos.y + half_height};
+        b2Vec2 ground_translation = {0, ray_length};
+        const b2WorldId world = physics->world;
+
+        RayHit left_ground_hit = raycast_closest(world, body->id, ground_left_start, ground_translation);
+        RayHit right_ground_hit = raycast_closest(world, body->id, ground_right_start, ground_translation);
+        grounded = left_ground_hit.hit || right_ground_hit.hit;
+
+        // Walls: cast left/right at mid-body height
+        b2Vec2 mid = {pos.x, pos.y};
+        b2Vec2 wall_left_start = {pos.x - half_width, mid.y};
+        b2Vec2 wall_left_translation = {-ray_length, 0};
+        b2Vec2 wall_right_start = {pos.x + half_width, mid.y};
+        b2Vec2 wall_right_translation = {ray_length, 0};
+
+        RayHit left_wall_hit = raycast_closest(world, body->id, wall_left_start, wall_left_translation);
+        RayHit right_wall_hit = raycast_closest(world, body->id, wall_right_start, wall_right_translation);
+
+        on_wall_left = left_wall_hit.hit;
+        on_wall_right = right_wall_hit.hit;
+        if (grounded)
+        {
+            coyote_timer = p.coyote_time;
+        }
+
+        float target_vx = move_x * p.max_speed;
+
+        auto v = body->get_velocity_pixels();
+
+        if (std::fabs(target_vx) > 0.001f)
+        {
+            float a = p.accel;
+            v.x = move_towards(v.x, target_vx, a * delta_time);
+        }
+        else
+        {
+            float a = p.decel;
+            v.x = move_towards(v.x, 0.0f, a * delta_time);
+        }
+
+        // Gravity (custom)
+        v.y += p.gravity * delta_time;
+        v.y = std::max(-p.fall_speed, std::min(p.fall_speed, v.y));
+
+        // Jump
+        const bool can_jump = (grounded || coyote_timer > 0.0f);
+        if (jump_buffer_timer > 0.0f && can_jump)
+        {
+            v.y = -p.jump_speed;
+            jump_buffer_timer = 0.0f;
+            coyote_timer = 0.0f;
+            grounded = false;
+        }
+
+        // Variable jump height: cut upward velocity when jump released
+        if (!jump_held && v.y < 0.0f)
+        {
+            v.y *= p.jump_cutoff_multiplier;
+        }
+
+        // Write velocity back
+        body->set_velocity(v);
+    }
+
+    /**
+     * Calculates a value moved towards a target by a maximum delta.
+     *
+     * @param current The current value.
+     * @param target The target value.
+     * @param max_delta The maximum change that can be applied.
+     * @return The new value after moving towards the target.
+     */
+    static float move_towards(float current, float target, float max_delta)
+    {
+        float delta = target - current;
+        if (std::fabs(delta) <= max_delta)
+            return target;
+        return current + (delta > 0 ? max_delta : -max_delta);
+    }
+
+    /**
+     * Set the input for movement.
+     *
+     * @param horizontal_speed The horizontal speed input (-1.0 to 1.0).
+     * @param jump_pressed Whether the jump button was pressed this frame.
+     * @param jump_held Whether the jump button is currently held down.
+     */
+    void set_input(float horizontal_speed, bool jump_pressed, bool jump_held)
+    {
+        move_x = horizontal_speed;
+        this->jump_pressed = jump_pressed;
+        this->jump_held = jump_held;
+    }
+};
+
+struct TopDownMovementParams
+{
+    float max_speed = 300.0f; // max speed in px/s
+    float accel = 1200.0f; // accel when holding input
+    float friction = 1200.0f; // decel when no input
+    float deadzone = 0.1f; // input deadzone
+};
+
+/**
+ * A component for 2D top-down movement.
+ * Depends on PhysicsService and BodyComponent.
+ *
+ * Movement is controlled by setting a 2D input vector (move_x, move_y),
+ * and this component accelerates/decelerates the body towards a target
+ * velocity using simple acceleration + friction.
+ */
+class TopDownMovementComponent : public Component
+{
+public:
+    TopDownMovementParams p;
+    PhysicsService* physics = nullptr;
+    BodyComponent* body = nullptr;
+
+    // Raw input in [-1, 1] range for each axis.
+    float move_x = 0.0f;
+    float move_y = 0.0f;
+
+    // Store last facing direction for aiming/animation.
+    float facing_dir = 0.0f;
+
+    TopDownMovementComponent(TopDownMovementParams p) : p(p) {}
+
+    void init() override
+    {
+        physics = owner->scene->get_service<PhysicsService>();
+        body = owner->get_component<BodyComponent>();
+    }
+
+    void update(float delta_time) override
+    {
+        if (!b2Body_IsValid(body->id))
+        {
+            return;
+        }
+
+        // Current velocity in pixels/sec (assuming your BodyComponent uses this).
+        Vector2 v = body->get_velocity_pixels();
+
+        // Build desired movement input vector.
+        Vector2 input = {move_x, move_y};
+        float input_len_sq = input.x * input.x + input.y * input.y;
+
+        Vector2 desired_vel = {0.0f, 0.0f};
+
+        // Deadzone.
+        if (input_len_sq > p.deadzone * p.deadzone)
+        {
+            desired_vel.x = input.x * p.max_speed;
+            desired_vel.y = input.y * p.max_speed;
+
+            // Update facing direction.
+            facing_dir = atan2f(input.y, input.x) * RAD2DEG;
+
+            // Accelerate towards desired velocity.
+            v = move_towards_vec(v, desired_vel, p.accel * delta_time);
+        }
+        else
+        {
+            // No input: apply friction to slow down.
+            v = apply_friction(v, p.friction * delta_time);
+        }
+
+        // Clamp to max speed just in case.
+        float speed_sq = v.x * v.x + v.y * v.y;
+        float max_speed_sq = p.max_speed * p.max_speed;
+        if (speed_sq > max_speed_sq)
+        {
+            float speed = std::sqrt(speed_sq);
+            float scale = p.max_speed / speed;
+            v.x *= scale;
+            v.y *= scale;
+        }
+
+        body->set_velocity(v);
+    }
+
+    /**
+     * Move a velocity vector towards a target vector by at most max_delta length.
+     */
+    static Vector2 move_towards_vec(const Vector2& current, const Vector2& target, float max_delta)
+    {
+        Vector2 delta = {target.x - current.x, target.y - current.y};
+        float len = std::sqrt(delta.x * delta.x + delta.y * delta.y);
+        if (len <= max_delta || len < 1e-5f)
+        {
+            return target;
+        }
+        float scale = max_delta / len;
+        return Vector2{current.x + delta.x * scale, current.y + delta.y * scale};
+    }
+
+    /**
+     * Apply friction to a velocity vector (reduce its magnitude).
+     * `friction_delta` is how much speed we remove this frame.
+     */
+    static Vector2 apply_friction(const Vector2& v, float friction_delta)
+    {
+        float speed = std::sqrt(v.x * v.x + v.y * v.y);
+        if (speed < 1e-5f)
+        {
+            return Vector2{0.0f, 0.0f};
+        }
+
+        float new_speed = speed - friction_delta;
+        if (new_speed <= 0.0f)
+        {
+            return Vector2{0.0f, 0.0f};
+        }
+
+        float scale = new_speed / speed;
+        return Vector2{v.x * scale, v.y * scale};
+    }
+
+    /**
+     * Set the input for movement.
+     *
+     * @param horizontal Horizontal input (-1.0 to 1.0).
+     * @param vertical   Vertical input   (-1.0 to 1.0).
+     */
+    void set_input(float horizontal, float vertical)
+    {
+        move_x = horizontal;
+        move_y = vertical;
+    }
+};
diff --git a/py/engine/prefabs/components.py b/py/engine/prefabs/components.py
new file mode 100644
index 0000000..e9db4ba
--- /dev/null
+++ b/py/engine/prefabs/components.py
@@ -0,0 +1,1214 @@
+from __future__ import annotations
+
+import math
+from typing import Any, Dict, List, Optional
+
+from Box2D import (b2Body, b2CircleShape, b2FixtureDef, b2PolygonShape,
+                   b2Vec2)
+import pyray as rl
+
+from engine.framework import Component
+from engine.math_extensions import vec_add, vec_div, vec_len, vec_mul, vec_normalize, vec_sub, v2
+from engine.raycasts import raycast_closest
+from engine.prefabs.managers import FontManager
+from engine.prefabs.services import PhysicsService, SoundService, TextureService
+
+
+class MultiComponent(Component):
+    """Container component that allows multiple components of the same type."""
+    def __init__(self) -> None:
+        """  init  .
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.components: Dict[str, Component] = {}
+
+    def init(self) -> None:
+        """Initialize all contained components.
+
+        Returns:
+            None
+        """
+        for component in self.components.values():
+            component.init()
+
+    def update(self, delta_time: float) -> None:
+        """Update all contained components.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        for component in self.components.values():
+            component.update(delta_time)
+
+    def draw(self) -> None:
+        """Draw all contained components.
+
+        Returns:
+            None
+        """
+        for component in self.components.values():
+            component.draw()
+
+    def add_component(self, name: str, component_or_cls: Any, *args: Any, **kwargs: Any) -> Component:
+        """Add a component under a name.
+
+        Args:
+            name: Component name key.
+            component_or_cls: Component instance or class.
+            *args: Positional args forwarded to constructor.
+            **kwargs: Keyword args forwarded to constructor.
+
+        Returns:
+            The component instance added.
+        """
+        if isinstance(component_or_cls, Component):
+            component = component_or_cls
+        else:
+            component = component_or_cls(*args, **kwargs)
+        component.owner = self.owner
+        self.components[name] = component
+        return component
+
+    def get_component(self, name: str) -> Optional[Component]:
+        """Get a component by name.
+
+        Args:
+            name: Component name key.
+
+        Returns:
+            The component if present, otherwise None.
+        """
+        return self.components.get(name)
+
+
+class TextComponent(Component):
+    """Component for rendering text. Depends on FontManager."""
+    def __init__(self, text: str, font_name: str = "default", font_size: int = 20, color: rl.Color = rl.WHITE) -> None:
+        """  init  .
+        
+        Args:
+            text: Parameter.
+            font_name: Parameter.
+            font_size: Parameter.
+            color: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.font_manager: Optional[FontManager] = None
+        self.text = text
+        self.font_name = font_name
+        self.font_size = font_size
+        self.color = color
+        self.position = v2(0.0, 0.0)
+        self.rotation = 0.0
+
+    def init(self) -> None:
+        """Resolve FontManager from the owning scene.
+
+        Returns:
+            None
+        """
+        if self.owner and self.owner.scene and self.owner.scene.game:
+            self.font_manager = self.owner.scene.game.get_manager(FontManager)
+
+    def draw(self) -> None:
+        """Draw the text if a font is available.
+
+        Returns:
+            None
+        """
+        if not self.font_manager:
+            return
+        rl.draw_text_ex(self.font_manager.get_font(self.font_name),
+                   self.text,
+                   self.position,
+                   float(self.font_size),
+                   1.0,
+                   self.color)
+
+    def set_text(self, text: str) -> None:
+        """Set the displayed text.
+
+        Args:
+            text: New text string.
+
+        Returns:
+            None
+        """
+        self.text = text
+
+    def set_color(self, color: rl.Color) -> None:
+        """Set the text color.
+
+        Args:
+            color: Raylib color.
+
+        Returns:
+            None
+        """
+        self.color = color
+
+    def set_font_size(self, font_size: int) -> None:
+        """Set the font size.
+
+        Args:
+            font_size: New font size.
+
+        Returns:
+            None
+        """
+        self.font_size = font_size
+
+    def set_font(self, font_name: str) -> None:
+        """Set the font by name.
+
+        Args:
+            font_name: Registered font name.
+
+        Returns:
+            None
+        """
+        self.font_name = font_name
+
+    def set_position(self, position: rl.Vector2) -> None:
+        """Set the text position.
+
+        Args:
+            position: Vector2 in pixels.
+
+        Returns:
+            None
+        """
+        self.position = position
+
+    def set_rotation(self, rotation: float) -> None:
+        """Set the text rotation.
+
+        Args:
+            rotation: Rotation in degrees.
+
+        Returns:
+            None
+        """
+        self.rotation = rotation
+
+
+class SoundComponent(Component):
+    """Component for playing sounds. Depends on SoundService."""
+    def __init__(self, filename: str, volume: float = 1.0, pitch: float = 1.0, pan: float = 0.5) -> None:
+        """  init  .
+        
+        Args:
+            filename: Parameter.
+            volume: Parameter.
+            pitch: Parameter.
+            pan: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.filename = filename
+        self.sound = None
+        self.volume = volume
+        self.pitch = pitch
+        self.pan = pan
+
+    def init(self) -> None:
+        """Load the sound from SoundService.
+
+        Returns:
+            None
+        """
+        if self.owner and self.owner.scene:
+            sound_service = self.owner.scene.get_service(SoundService)
+            self.sound = sound_service.get_sound(self.filename)
+
+    def play(self) -> None:
+        """Play the sound.
+
+        Returns:
+            None
+        """
+        if self.sound:
+            rl.play_sound(self.sound)
+
+    def stop(self) -> None:
+        """Stop the sound.
+
+        Returns:
+            None
+        """
+        if self.sound:
+            rl.stop_sound(self.sound)
+
+    def set_volume(self, volume: float) -> None:
+        """Set playback volume.
+
+        Args:
+            volume: Volume scalar.
+
+        Returns:
+            None
+        """
+        self.volume = volume
+        if self.sound:
+            rl.set_sound_volume(self.sound, volume)
+
+    def set_pitch(self, pitch: float) -> None:
+        """Set playback pitch.
+
+        Args:
+            pitch: Pitch scalar.
+
+        Returns:
+            None
+        """
+        self.pitch = pitch
+        if self.sound:
+            rl.set_sound_pitch(self.sound, pitch)
+
+    def set_pan(self, pan: float) -> None:
+        """Set playback pan.
+
+        Args:
+            pan: Pan value from 0.0 (left) to 1.0 (right).
+
+        Returns:
+            None
+        """
+        self.pan = pan
+        if self.sound:
+            rl.set_sound_pan(self.sound, pan)
+
+    def is_playing(self) -> bool:
+        """Check if the sound is currently playing.
+
+        Returns:
+            True if playing, otherwise False.
+        """
+        return bool(self.sound and rl.is_sound_playing(self.sound))
+
+
+class BodyComponent(Component):
+    """Component that owns a Box2D body. Depends on PhysicsService."""
+    def __init__(self, body: Optional[b2Body] = None, build: Optional[Any] = None) -> None:
+        """  init  .
+        
+        Args:
+            body: Parameter.
+            build: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.body = body
+        self.build = build
+        self.physics: Optional[PhysicsService] = None
+
+    def init(self) -> None:
+        """Resolve PhysicsService and build the body if provided.
+
+        Returns:
+            None
+        """
+        if not self.owner or not self.owner.scene:
+            return
+        self.physics = self.owner.scene.get_service(PhysicsService)
+        if self.build:
+            self.build(self)
+
+    def enable(self) -> None:
+        """Enable the body in the physics simulation.
+
+        Returns:
+            None
+        """
+        if self.body:
+            self.body.awake = True
+            self.body.active = True
+
+    def disable(self) -> None:
+        """Disable the body in the physics simulation.
+
+        Returns:
+            None
+        """
+        if self.body:
+            self.body.active = False
+
+    def get_position_meters(self) -> b2Vec2:
+        """Get position in meters.
+
+        Returns:
+            b2Vec2 position in meters.
+        """
+        return self.body.position if self.body else b2Vec2(0.0, 0.0)
+
+    def get_position_pixels(self) -> rl.Vector2:
+        """Get position in pixels.
+
+        Returns:
+            Vector2 position in pixels.
+        """
+        if not self.physics or not self.body:
+            return v2(0.0, 0.0)
+        pos = self.physics.convert_to_pixels(self.body.position)
+        return v2(pos.x, pos.y)
+
+    def set_position(self, pos) -> None:
+        """Set position (meters if b2Vec2, else pixels).
+
+        Args:
+            pos: b2Vec2 in meters or Vector2 in pixels.
+
+        Returns:
+            None
+        """
+        if not self.body:
+            return
+        if isinstance(pos, b2Vec2):
+            self.body.position = pos
+        else:
+            if not self.physics:
+                return
+            self.body.position = self.physics.convert_to_meters(pos)
+
+    def set_rotation(self, degrees: float) -> None:
+        """Set rotation in degrees.
+
+        Args:
+            degrees: Rotation in degrees.
+
+        Returns:
+            None
+        """
+        if self.body:
+            self.body.angle = math.radians(degrees)
+
+    def get_velocity_meters(self) -> b2Vec2:
+        """Get linear velocity in meters/sec.
+
+        Returns:
+            b2Vec2 velocity in meters/sec.
+        """
+        return self.body.linearVelocity if self.body else b2Vec2(0.0, 0.0)
+
+    def get_velocity_pixels(self) -> rl.Vector2:
+        """Get linear velocity in pixels/sec.
+
+        Returns:
+            Vector2 velocity in pixels/sec.
+        """
+        if not self.physics or not self.body:
+            return v2(0.0, 0.0)
+        vel = self.physics.convert_to_pixels(self.body.linearVelocity)
+        return v2(vel.x, vel.y)
+
+    def set_velocity(self, vel) -> None:
+        """Set linear velocity (meters if b2Vec2, else pixels).
+
+        Args:
+            vel: b2Vec2 in meters/sec or Vector2 in pixels/sec.
+
+        Returns:
+            None
+        """
+        if not self.body:
+            return
+        if isinstance(vel, b2Vec2):
+            self.body.linearVelocity = vel
+        else:
+            if not self.physics:
+                return
+            self.body.linearVelocity = self.physics.convert_to_meters(vel)
+
+    def get_rotation(self) -> float:
+        """Get rotation in degrees.
+
+        Returns:
+            Rotation in degrees.
+        """
+        return math.degrees(self.body.angle) if self.body else 0.0
+
+    def get_contacts(self) -> List[b2Body]:
+        """Get bodies currently touching this body.
+
+        Returns:
+            List of bodies in contact.
+        """
+        if not self.body:
+            return []
+        contacts: List[b2Body] = []
+        for edge in self.body.contacts:
+            contact = edge.contact
+            if contact.touching:
+                other = edge.other
+                if other not in contacts:
+                    contacts.append(other)
+        return contacts
+
+    def get_sensor_overlaps(self) -> List[b2Body]:
+        """Get bodies overlapping sensor fixtures on this body.
+
+        Returns:
+            List of bodies overlapping sensor fixtures.
+        """
+        if not self.body:
+            return []
+        contacts: List[b2Body] = []
+        for edge in self.body.contacts:
+            contact = edge.contact
+            if not contact.touching:
+                continue
+            fixture_a = contact.fixtureA
+            fixture_b = contact.fixtureB
+            if fixture_a.body == self.body and fixture_a.sensor:
+                if fixture_b.body not in contacts:
+                    contacts.append(fixture_b.body)
+            elif fixture_b.body == self.body and fixture_b.sensor:
+                if fixture_a.body not in contacts:
+                    contacts.append(fixture_a.body)
+        return contacts
+
+
+class SpriteComponent(Component):
+    """Component for rendering a sprite. Depends on TextureService."""
+    def __init__(self, filename: str, body: Optional[BodyComponent] = None) -> None:
+        """  init  .
+        
+        Args:
+            filename: Parameter.
+            body: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.filename = filename
+        self.body = body
+        self.sprite: Optional[rl.Texture2D] = None
+        self.position = v2(0.0, 0.0)
+        self.rotation = 0.0
+        self.scale = 1.0
+        self.tint = rl.WHITE
+        self.is_active = True
+
+    def init(self) -> None:
+        """Load the sprite texture via TextureService.
+
+        Returns:
+            None
+        """
+        if self.owner and self.owner.scene:
+            texture_service = self.owner.scene.get_service(TextureService)
+            self.sprite = texture_service.get_texture(self.filename)
+
+    def draw(self) -> None:
+        """Draw the sprite if active.
+
+        Returns:
+            None
+        """
+        if not self.is_active or not self.sprite:
+            return
+        if self.body:
+            self.position = self.body.get_position_pixels()
+            self.rotation = self.body.get_rotation()
+        source = rl.Rectangle(0.0, 0.0, float(self.sprite.width), float(self.sprite.height))
+        dest = rl.Rectangle(self.position.x, self.position.y,
+                         float(self.sprite.width) * self.scale,
+                         float(self.sprite.height) * self.scale)
+        origin = v2(float(self.sprite.width) / 2.0 * self.scale,
+                    float(self.sprite.height) / 2.0 * self.scale)
+        rl.draw_texture_pro(self.sprite, source, dest, origin, self.rotation, self.tint)
+
+    def set_position(self, position: rl.Vector2) -> None:
+        """Set the sprite position in pixels.
+
+        Args:
+            position: Vector2 position.
+
+        Returns:
+            None
+        """
+        self.position = position
+
+    def set_rotation(self, rotation: float) -> None:
+        """Set the sprite rotation in degrees.
+
+        Args:
+            rotation: Rotation in degrees.
+
+        Returns:
+            None
+        """
+        self.rotation = rotation
+
+    def set_scale(self, scale: float) -> None:
+        """Set the sprite scale.
+
+        Args:
+            scale: Scale multiplier.
+
+        Returns:
+            None
+        """
+        self.scale = scale
+
+    def set_tint(self, tint: rl.Color) -> None:
+        """Set the sprite tint color.
+
+        Args:
+            tint: Raylib color.
+
+        Returns:
+            None
+        """
+        self.tint = tint
+
+    def set_active(self, active: bool) -> None:
+        """Enable or disable sprite rendering.
+
+        Args:
+            active: True to render, False to hide.
+
+        Returns:
+            None
+        """
+        self.is_active = active
+
+
+class Animation:
+    """Frame-based animation helper."""
+    def __init__(self, frames: List[rl.Texture2D], fps: float = 15.0, loop: bool = True) -> None:
+        """  init  .
+        
+        Args:
+            frames: Parameter.
+            fps: Parameter.
+            loop: Parameter.
+        
+        Returns:
+            None
+        """
+        self.frames = frames
+        self.fps = fps
+        self.frame_timer = 1.0 / fps if fps > 0 else 0.0
+        self.loop = loop
+        self.current_frame = 0
+        self.playing = True
+        self.is_active = True
+
+    @classmethod
+    def from_files(cls, texture_service: TextureService, filenames: List[str], fps: float = 15.0, loop: bool = True):
+        """From files.
+        
+        Args:
+            texture_service: Parameter.
+            filenames: Parameter.
+            fps: Parameter.
+            loop: Parameter.
+        
+        Returns:
+            Result of the operation.
+        """
+        frames = [texture_service.get_texture(name) for name in filenames]
+        return cls(frames, fps, loop)
+
+    def update(self, delta_time: float) -> None:
+        """Advance the animation by delta time.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        if not self.frames or not self.playing or not self.is_active or self.fps <= 0:
+            return
+        self.frame_timer -= delta_time
+        if self.frame_timer <= 0.0:
+            self.frame_timer = 1.0 / self.fps
+            self.current_frame += 1
+        if self.current_frame > len(self.frames) - 1:
+            self.current_frame = 0 if self.loop else len(self.frames) - 1
+
+    def draw(self, position: rl.Vector2, rotation: float = 0.0, tint: rl.Color = rl.WHITE) -> None:
+        """Draw the animation at a position.
+
+        Args:
+            position: Position in pixels.
+            rotation: Rotation in degrees.
+            tint: Color tint.
+
+        Returns:
+            None
+        """
+        if not self.is_active or not self.frames:
+            return
+        sprite = self.frames[self.current_frame]
+        rl.draw_texture_pro(sprite,
+                       rl.Rectangle(0.0, 0.0, float(sprite.width), float(sprite.height)),
+                       rl.Rectangle(position.x, position.y, float(sprite.width), float(sprite.height)),
+                       v2(float(sprite.width) / 2.0, float(sprite.height) / 2.0),
+                       rotation,
+                       tint)
+
+    def draw_with_origin(self, position: rl.Vector2, origin: rl.Vector2, rotation: float = 0.0,
+                         scale: float = 1.0, flip_x: bool = False, flip_y: bool = False,
+                         tint: rl.Color = rl.WHITE) -> None:
+        """Draw the animation with origin, scale, and flip options.
+
+        Args:
+            position: Position in pixels.
+            origin: Origin for rotation/scaling.
+            rotation: Rotation in degrees.
+            scale: Scale multiplier.
+            flip_x: True to flip horizontally.
+            flip_y: True to flip vertically.
+            tint: Color tint.
+
+        Returns:
+            None
+        """
+        if not self.is_active or not self.frames:
+            return
+        sprite = self.frames[self.current_frame]
+        src = rl.Rectangle(0.0, 0.0,
+                        float(sprite.width) * (-1.0 if flip_x else 1.0),
+                        float(sprite.height) * (-1.0 if flip_y else 1.0))
+        dest = rl.Rectangle(position.x, position.y,
+                         float(sprite.width) * scale,
+                         float(sprite.height) * scale)
+        rl.draw_texture_pro(sprite, src, dest, vec_mul(origin, scale), rotation, tint)
+
+    def play(self) -> None:
+        """Start or resume playback.
+
+        Returns:
+            None
+        """
+        self.playing = True
+
+    def pause(self) -> None:
+        """Pause playback.
+
+        Returns:
+            None
+        """
+        self.playing = False
+
+    def stop(self) -> None:
+        """Stop playback and reset to the first frame.
+
+        Returns:
+            None
+        """
+        self.playing = False
+        self.frame_timer = 1.0 / self.fps if self.fps > 0 else 0.0
+        self.current_frame = 0
+
+
+class AnimationController(Component):
+    """Component for controlling animations. Depends on TextureService."""
+    def __init__(self, body: Optional[BodyComponent] = None) -> None:
+        """  init  .
+        
+        Args:
+            body: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.animations: Dict[str, Animation] = {}
+        self.current_animation: Optional[Animation] = None
+        self.position = v2(0.0, 0.0)
+        self.rotation = 0.0
+        self.origin = v2(0.0, 0.0)
+        self.scale = 1.0
+        self.flip_x = False
+        self.flip_y = False
+        self.body = body
+
+    def update(self, delta_time: float) -> None:
+        """Update the current animation.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        if self.current_animation:
+            self.current_animation.update(delta_time)
+
+    def draw(self) -> None:
+        """Draw the current animation.
+
+        Returns:
+            None
+        """
+        if self.body:
+            self.position = self.body.get_position_pixels()
+            self.rotation = self.body.get_rotation()
+        if self.current_animation:
+            self.current_animation.draw_with_origin(self.position, self.origin, self.rotation, self.scale,
+                                                    self.flip_x, self.flip_y)
+
+    def add_animation(self, name: str, animation: Animation) -> None:
+        """Add an Animation to the controller.
+
+        Args:
+            name: Animation name.
+            animation: Animation instance.
+
+        Returns:
+            None
+        """
+        self.animations[name] = animation
+        if not self.current_animation:
+            self.current_animation = animation
+            sprite = animation.frames[animation.current_frame]
+            self.origin = v2(float(sprite.width) / 2.0, float(sprite.height) / 2.0)
+
+    def add_animation_from_files(self, name: str, filenames: List[str], fps: float = 15.0, loop: bool = True) -> Animation:
+        """Create an Animation from files and add it.
+
+        Args:
+            name: Animation name.
+            filenames: List of frame image paths.
+            fps: Frames per second.
+            loop: True to loop.
+
+        Returns:
+            The created Animation.
+        """
+        texture_service = self.owner.scene.get_service(TextureService) if self.owner and self.owner.scene else None
+        if not texture_service:
+            raise RuntimeError("TextureService not available")
+        animation = Animation.from_files(texture_service, filenames, fps, loop)
+        self.add_animation(name, animation)
+        return animation
+
+    def get_animation(self, name: str) -> Optional[Animation]:
+        """Get an animation by name.
+
+        Args:
+            name: Animation name.
+
+        Returns:
+            The Animation or None.
+        """
+        return self.animations.get(name)
+
+    def play(self, name: Optional[str] = None) -> None:
+        """Play the current animation or switch by name then play.
+
+        Args:
+            name: Optional animation name to switch to.
+
+        Returns:
+            None
+        """
+        if name:
+            animation = self.animations.get(name)
+            if animation:
+                self.current_animation = animation
+        if self.current_animation:
+            self.current_animation.play()
+
+    def pause(self) -> None:
+        """Pause the current animation.
+
+        Returns:
+            None
+        """
+        if self.current_animation:
+            self.current_animation.pause()
+
+    def set_play(self, play: bool) -> None:
+        """Set play/pause state for the current animation.
+
+        Args:
+            play: True to play, False to pause.
+
+        Returns:
+            None
+        """
+        if self.current_animation:
+            self.current_animation.play() if play else self.current_animation.pause()
+
+    def stop(self) -> None:
+        """Stop the current animation.
+
+        Returns:
+            None
+        """
+        if self.current_animation:
+            self.current_animation.stop()
+
+    def set_position(self, position: rl.Vector2) -> None:
+        """Set animation draw position.
+
+        Args:
+            position: Vector2 in pixels.
+
+        Returns:
+            None
+        """
+        self.position = position
+
+    def set_rotation(self, rotation: float) -> None:
+        """Set animation rotation in degrees.
+
+        Args:
+            rotation: Rotation in degrees.
+
+        Returns:
+            None
+        """
+        self.rotation = rotation
+
+    def set_origin(self, origin: rl.Vector2) -> None:
+        """Set animation origin point.
+
+        Args:
+            origin: Vector2 origin.
+
+        Returns:
+            None
+        """
+        self.origin = origin
+
+    def set_scale(self, scale: float) -> None:
+        """Set animation scale.
+
+        Args:
+            scale: Scale multiplier.
+
+        Returns:
+            None
+        """
+        self.scale = scale
+
+    def set_flip_x(self, flip: bool) -> None:
+        """Set horizontal flip.
+
+        Args:
+            flip: True to flip horizontally.
+
+        Returns:
+            None
+        """
+        self.flip_x = flip
+
+    def set_flip_y(self, flip: bool) -> None:
+        """Set vertical flip.
+
+        Args:
+            flip: True to flip vertically.
+
+        Returns:
+            None
+        """
+        self.flip_y = flip
+
+
+class PlatformerMovementParams:
+    """Parameter bag for platformer movement."""
+    def __init__(self) -> None:
+        """  init  .
+        
+        Returns:
+            None
+        """
+        self.width = 24.0
+        self.height = 40.0
+        self.max_speed = 220.0
+        self.accel = 2000.0
+        self.decel = 2500.0
+        self.gravity = 1400.0
+        self.jump_speed = 520.0
+        self.fall_speed = 1200.0
+        self.jump_cutoff_multiplier = 0.45
+        self.coyote_time = 0.08
+        self.jump_buffer = 0.10
+
+
+class PlatformerMovementComponent(Component):
+    """Component for 2D platformer movement."""
+    def __init__(self, params: PlatformerMovementParams) -> None:
+        """  init  .
+        
+        Args:
+            params: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.p = params
+        self.physics: Optional[PhysicsService] = None
+        self.body: Optional[BodyComponent] = None
+        self.grounded = False
+        self.on_wall_left = False
+        self.on_wall_right = False
+        self.coyote_timer = 0.0
+        self.jump_buffer_timer = 0.0
+        self.move_x = 0.0
+        self.jump_pressed = False
+        self.jump_held = False
+
+    def init(self) -> None:
+        """Resolve PhysicsService and BodyComponent.
+
+        Returns:
+            None
+        """
+        if not self.owner or not self.owner.scene:
+            return
+        self.physics = self.owner.scene.get_service(PhysicsService)
+        self.body = self.owner.get_component(BodyComponent)
+
+    def update(self, delta_time: float) -> None:
+        """Update movement and apply velocity to the body.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        if not self.physics or not self.body or not self.body.body:
+            return
+        self.coyote_timer = max(0.0, self.coyote_timer - delta_time)
+        self.jump_buffer_timer = max(0.0, self.jump_buffer_timer - delta_time)
+        if self.jump_pressed:
+            self.jump_buffer_timer = self.p.jump_buffer
+
+        self.grounded = False
+        self.on_wall_left = False
+        self.on_wall_right = False
+
+        ray_length = self.physics.convert_length_to_meters(4.0)
+        half_width = self.physics.convert_length_to_meters(self.p.width) / 2.0
+        half_height = self.physics.convert_length_to_meters(self.p.height) / 2.0
+
+        pos = self.body.get_position_meters()
+        ground_left_start = b2Vec2(pos.x - half_width, pos.y + half_height)
+        ground_right_start = b2Vec2(pos.x + half_width, pos.y + half_height)
+        ground_translation = b2Vec2(0.0, ray_length)
+
+        left_ground_hit = raycast_closest(self.physics.world, self.body.body, ground_left_start, ground_translation)
+        right_ground_hit = raycast_closest(self.physics.world, self.body.body, ground_right_start, ground_translation)
+        self.grounded = left_ground_hit.hit or right_ground_hit.hit
+
+        mid = b2Vec2(pos.x, pos.y)
+        wall_left_start = b2Vec2(pos.x - half_width, mid.y)
+        wall_left_translation = b2Vec2(-ray_length, 0.0)
+        wall_right_start = b2Vec2(pos.x + half_width, mid.y)
+        wall_right_translation = b2Vec2(ray_length, 0.0)
+
+        left_wall_hit = raycast_closest(self.physics.world, self.body.body, wall_left_start, wall_left_translation)
+        right_wall_hit = raycast_closest(self.physics.world, self.body.body, wall_right_start, wall_right_translation)
+        self.on_wall_left = left_wall_hit.hit
+        self.on_wall_right = right_wall_hit.hit
+
+        if self.grounded:
+            self.coyote_timer = self.p.coyote_time
+
+        target_vx = self.move_x * self.p.max_speed
+        v = self.body.get_velocity_pixels()
+
+        if abs(target_vx) > 0.001:
+            v.x = self.move_towards(v.x, target_vx, self.p.accel * delta_time)
+        else:
+            v.x = self.move_towards(v.x, 0.0, self.p.decel * delta_time)
+
+        v.y += self.p.gravity * delta_time
+        v.y = max(-self.p.fall_speed, min(self.p.fall_speed, v.y))
+
+        can_jump = self.grounded or self.coyote_timer > 0.0
+        if self.jump_buffer_timer > 0.0 and can_jump:
+            v.y = -self.p.jump_speed
+            self.jump_buffer_timer = 0.0
+            self.coyote_timer = 0.0
+            self.grounded = False
+
+        if not self.jump_held and v.y < 0.0:
+            v.y *= self.p.jump_cutoff_multiplier
+
+        self.body.set_velocity(v)
+
+    @staticmethod
+    def move_towards(current: float, target: float, max_delta: float) -> float:
+        """Move a value toward a target by at most max_delta.
+
+        Args:
+            current: Current value.
+            target: Target value.
+            max_delta: Maximum change allowed.
+
+        Returns:
+            The updated value.
+        """
+        delta = target - current
+        if abs(delta) <= max_delta:
+            return target
+        return current + (max_delta if delta > 0 else -max_delta)
+
+    def set_input(self, horizontal_speed: float, jump_pressed: bool, jump_held: bool) -> None:
+        """Set movement input for this frame.
+
+        Args:
+            horizontal_speed: Horizontal input (-1 to 1).
+            jump_pressed: True if jump pressed this frame.
+            jump_held: True if jump is held.
+
+        Returns:
+            None
+        """
+        self.move_x = horizontal_speed
+        self.jump_pressed = jump_pressed
+        self.jump_held = jump_held
+
+
+class TopDownMovementParams:
+    """Parameter bag for top-down movement."""
+    def __init__(self) -> None:
+        """  init  .
+        
+        Returns:
+            None
+        """
+        self.max_speed = 300.0
+        self.accel = 1200.0
+        self.friction = 1200.0
+        self.deadzone = 0.1
+
+
+class TopDownMovementComponent(Component):
+    """Component for 2D top-down movement."""
+    def __init__(self, params: TopDownMovementParams) -> None:
+        """  init  .
+        
+        Args:
+            params: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.p = params
+        self.physics: Optional[PhysicsService] = None
+        self.body: Optional[BodyComponent] = None
+        self.move_x = 0.0
+        self.move_y = 0.0
+        self.facing_dir = 0.0
+
+    def init(self) -> None:
+        """Resolve PhysicsService and BodyComponent.
+
+        Returns:
+            None
+        """
+        if not self.owner or not self.owner.scene:
+            return
+        self.physics = self.owner.scene.get_service(PhysicsService)
+        self.body = self.owner.get_component(BodyComponent)
+
+    def update(self, delta_time: float) -> None:
+        """Update movement and apply velocity to the body.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        if not self.body or not self.body.body:
+            return
+        v = self.body.get_velocity_pixels()
+        input_vec = v2(self.move_x, self.move_y)
+        input_len_sq = input_vec.x * input_vec.x + input_vec.y * input_vec.y
+        desired = v2(0.0, 0.0)
+
+        if input_len_sq > self.p.deadzone * self.p.deadzone:
+            desired = v2(input_vec.x * self.p.max_speed, input_vec.y * self.p.max_speed)
+            self.facing_dir = math.degrees(math.atan2(input_vec.y, input_vec.x))
+            v = self.move_towards_vec(v, desired, self.p.accel * delta_time)
+        else:
+            v = self.apply_friction(v, self.p.friction * delta_time)
+
+        speed_sq = v.x * v.x + v.y * v.y
+        max_speed_sq = self.p.max_speed * self.p.max_speed
+        if speed_sq > max_speed_sq:
+            speed = math.sqrt(speed_sq)
+            scale = self.p.max_speed / speed
+            v.x *= scale
+            v.y *= scale
+
+        self.body.set_velocity(v)
+
+    @staticmethod
+    def move_towards_vec(current: rl.Vector2, target: rl.Vector2, max_delta: float) -> rl.Vector2:
+        """Move a vector toward a target by at most max_delta.
+
+        Args:
+            current: Current vector.
+            target: Target vector.
+            max_delta: Maximum change length.
+
+        Returns:
+            The updated vector.
+        """
+        delta = v2(target.x - current.x, target.y - current.y)
+        length = math.sqrt(delta.x * delta.x + delta.y * delta.y)
+        if length <= max_delta or length < 1e-5:
+            return target
+        scale = max_delta / length
+        return v2(current.x + delta.x * scale, current.y + delta.y * scale)
+
+    @staticmethod
+    def apply_friction(v: rl.Vector2, friction_delta: float) -> rl.Vector2:
+        """Apply friction to reduce vector magnitude.
+
+        Args:
+            v: Current velocity vector.
+            friction_delta: Speed to subtract this frame.
+
+        Returns:
+            The updated velocity vector.
+        """
+        speed = math.sqrt(v.x * v.x + v.y * v.y)
+        if speed < 1e-5:
+            return v2(0.0, 0.0)
+        new_speed = speed - friction_delta
+        if new_speed <= 0.0:
+            return v2(0.0, 0.0)
+        scale = new_speed / speed
+        return v2(v.x * scale, v.y * scale)
+
+    def set_input(self, horizontal: float, vertical: float) -> None:
+        """Set movement input for this frame.
+
+        Args:
+            horizontal: Horizontal input (-1 to 1).
+            vertical: Vertical input (-1 to 1).
+
+        Returns:
+            None
+        """
+        self.move_x = horizontal
+        self.move_y = vertical
diff --git a/py/engine/prefabs/game_objects.h b/py/engine/prefabs/game_objects.h
new file mode 100644
index 0000000..776ce16
--- /dev/null
+++ b/py/engine/prefabs/game_objects.h
@@ -0,0 +1,619 @@
+#pragma once
+
+#include "engine/framework.h"
+#include "engine/prefabs/components.h"
+#include "engine/prefabs/services.h"
+
+/**
+ * A simple static box.
+ */
+class StaticBox : public GameObject
+{
+public:
+    b2BodyId body = b2_nullBodyId;
+    float x, y, width, height;
+    bool is_visible = true;
+
+    /**
+     * Constructor for StaticBox.
+     *
+     * @param x The center x position in pixels.
+     * @param y The center y position in pixels.
+     * @param width The width of the box in pixels.
+     * @param height The height of the box in pixels.
+     */
+    StaticBox(float x, float y, float width, float height) : x(x), y(y), width(width), height(height) {}
+
+    /**
+     * Constructor for StaticBox that takes Vector2s.
+     *
+     * @param position The center of the box in pixels.
+     * @param size The size of the box in pixels.
+     */
+    StaticBox(Vector2 position, Vector2 size) : x(position.x), y(position.y), width(size.x), height(size.y) {}
+
+    /**
+     * Initialize the StaticBox.
+     */
+    void init() override
+    {
+        auto physics = scene->get_service<PhysicsService>();
+        const float pixels_to_meters = physics->pixels_to_meters;
+        auto world = physics->world;
+
+        b2BodyDef body_def = b2DefaultBodyDef();
+        body_def.type = b2_staticBody;
+        body_def.position = b2Vec2{x * pixels_to_meters, y * pixels_to_meters};
+        body = b2CreateBody(world, &body_def);
+
+        b2Polygon body_polygon = b2MakeBox(width / 2.0f * pixels_to_meters, height / 2.0f * pixels_to_meters);
+        b2ShapeDef box_shape_def = b2DefaultShapeDef();
+        b2CreatePolygonShape(body, &box_shape_def, &body_polygon);
+
+        add_component<BodyComponent>(body);
+    }
+
+    /**
+     * Draw the StaticBox as a blue rectangle.
+     */
+    void draw() override
+    {
+        if (is_visible)
+        {
+            DrawRectangle((int)(x - width / 2.0f), (int)(y - height / 2.0f), (int)width, (int)height, BLUE);
+        }
+    }
+};
+
+/**
+ * A simple dynamic rigid body box.
+ */
+class DynamicBox : public GameObject
+{
+public:
+    b2BodyId body = b2_nullBodyId;
+    float x, y, width, height, rot_deg;
+    PhysicsService* physics;
+
+    /**
+     * Constructor for DynamicBox.
+     *
+     * @param x The center x position in pixels.
+     * @param y The center y position in pixels.
+     * @param width The width of the box in pixels.
+     * @param height The height of the box in pixels.
+     * @param rotation The angle of the box in degrees.
+     */
+    DynamicBox(float x, float y, float width, float height, float rotation = 0) :
+        x(x),
+        y(y),
+        width(width),
+        height(height),
+        rot_deg(rotation)
+    {
+    }
+
+    /**
+     * Constructor for DynamicBox that takes Vector2s.
+     *
+     * @param position The center of the box in pixels.
+     * @param size The size of the box in pixels.
+     * @param rotation The angle of the box in degrees.
+     */
+    DynamicBox(Vector2 position, Vector2 size, float rotation = 0) :
+        x(position.x),
+        y(position.y),
+        width(size.x),
+        height(size.y),
+        rot_deg(rotation)
+    {
+    }
+
+    /**
+     * Initialize the DynamicBody.
+     */
+    void init() override
+    {
+        physics = scene->get_service<PhysicsService>();
+        const float pixels_to_meters = physics->pixels_to_meters;
+        auto world = physics->world;
+
+        b2BodyDef body_def = b2DefaultBodyDef();
+        body_def.type = b2_dynamicBody;
+        body_def.position = b2Vec2{x * pixels_to_meters, y * pixels_to_meters};
+        body_def.rotation = b2MakeRot(rot_deg * DEG2RAD);
+        body = b2CreateBody(world, &body_def);
+
+        b2Polygon body_polygon = b2MakeBox(width / 2.0f * pixels_to_meters, height / 2.0f * pixels_to_meters);
+        b2ShapeDef box_shape_def = b2DefaultShapeDef();
+        b2SurfaceMaterial body_material = b2DefaultSurfaceMaterial();
+        body_material.friction = 0.3f;
+        box_shape_def.density = 1.0f;
+        box_shape_def.material = body_material;
+        b2CreatePolygonShape(body, &box_shape_def, &body_polygon);
+
+        auto body_component = add_component<BodyComponent>(body);
+        add_component<SpriteComponent>("assets/character_green_idle.png", body_component);
+    }
+
+    /**
+     * Draw the DynamicBody as a red rectangle.
+     */
+    void draw() override
+    {
+        float meters_to_pixels = physics->meters_to_pixels;
+        b2Vec2 pos = b2Body_GetPosition(body);
+        b2Rot rot = b2Body_GetRotation(body);
+        float angle = b2Rot_GetAngle(rot) * RAD2DEG;
+
+        DrawRectanglePro({physics->convert_to_pixels(pos.x), physics->convert_to_pixels(pos.y), width, height},
+                         {width / 2.0f, height / 2.0f},
+                         angle,
+                         RED);
+    }
+};
+
+/**
+ * A 2D camera that controls the view of the scene.
+ */
+class CameraObject : public GameObject
+{
+public:
+    Camera2D camera;
+
+    // The target position to follow, in pixels.
+    Vector2 target = {0, 0};
+
+    // The size of the screen.
+    Vector2 size = {0, 0};
+
+    // The size of the level in pixels. The camera will clamp to this size.
+    Vector2 level_size = {0, 0};
+
+    // Tracking speed in pixels per second.
+    Vector2 follow_speed = {1000, 1000};
+
+    // Deadzone bounds in pixels relative to the center.
+    float offset_left = 150.0f;
+    float offset_right = 150.0f;
+    float offset_top = 100.0f;
+    float offset_bottom = 100.0f;
+
+    /**
+     * Constructor for CameraObject.
+     *
+     * @param size The size of the camera view.
+     * @param level_size The size of the level.
+     * @param follow_speed The speed at which the camera follows the target.
+     * @param offset_left The left deadzone offset in pixels.
+     * @param offset_right The right deadzone offset in pixels.
+     * @param offset_top The top deadzone offset in pixels.
+     * @param offset_bottom The bottom deadzone offset in pixels.
+     */
+    CameraObject(Vector2 size,
+                 Vector2 level_size = {0, 0},
+                 Vector2 follow_speed = {1000, 1000},
+                 float offset_left = 70,
+                 float offset_right = 70,
+                 float offset_top = 40,
+                 float offset_bottom = 40) :
+        size(size),
+        level_size(level_size),
+        follow_speed(follow_speed),
+        offset_left(offset_left),
+        offset_right(offset_right),
+        offset_top(offset_top),
+        offset_bottom(offset_bottom)
+    {
+    }
+
+    /**
+     * Initialize the camera.
+     */
+    void init() override
+    {
+        camera.zoom = 1.0f;
+        camera.offset = {size.x / 2.0f, size.y / 2.0f};
+        camera.rotation = 0.0f;
+
+        camera.target = target;
+    }
+
+    /**
+     * Update the camera position based on the target and deadzone.
+     *
+     * @param delta_time The delta time since the last frame.
+     */
+    void update(float delta_time) override
+    {
+        // Desired camera.target after applying deadzone.
+        Vector2 desired = camera.target;
+
+        // Convert deadzone from SCREEN pixels to WORLD pixels (depends on zoom).
+        // Because camera.target is in world units.
+        float inv_zoom = (camera.zoom != 0.0f) ? (1.0f / camera.zoom) : 1.0f;
+
+        float dz_left_w = offset_left * inv_zoom;
+        float dz_right_w = offset_right * inv_zoom;
+        float dz_top_w = offset_top * inv_zoom;
+        float dz_bottom_w = offset_bottom * inv_zoom;
+
+        // Compute target displacement from current camera center (world-space).
+        float dx = target.x - camera.target.x;
+        float dy = target.y - camera.target.y;
+
+        // If target is outside deadzone, shift desired camera center just enough to bring it back.
+        if (dx < -dz_left_w)
+        {
+            desired.x = target.x + dz_left_w;
+        }
+        else if (dx > dz_right_w)
+        {
+            desired.x = target.x - dz_right_w;
+        }
+
+        if (dy < -dz_top_w)
+        {
+            desired.y = target.y + dz_top_w;
+        }
+        else if (dy > dz_bottom_w)
+        {
+            desired.y = target.y - dz_bottom_w;
+        }
+
+        // Apply tracking speed per axis.
+        if (follow_speed.x < 0)
+        {
+            camera.target.x = desired.x;
+        }
+        else
+        {
+            camera.target.x = move_towards(camera.target.x, desired.x, follow_speed.x * delta_time);
+        }
+
+        if (follow_speed.y < 0)
+        {
+            camera.target.y = desired.y;
+        }
+        else
+        {
+            camera.target.y = move_towards(camera.target.y, desired.y, follow_speed.y * delta_time);
+        }
+
+        Vector2 half_view = {size.x / 2.0f * inv_zoom, size.y / 2.0f * inv_zoom};
+        if (level_size.x > size.x)
+        {
+            camera.target.x = std::max(half_view.x, std::min(level_size.x - half_view.x, camera.target.x));
+        }
+        if (level_size.y > size.y)
+        {
+            camera.target.y = std::max(half_view.y, std::min(level_size.y - half_view.y, camera.target.y));
+        }
+    }
+
+    /**
+     * Calculate a value moved towards a target by a maximum delta.
+     *
+     * @param current The current value.
+     * @param target The target value.
+     * @param max_delta The maximum change that can be applied.
+     * @return The new value after moving towards the target.
+     */
+    float move_towards(float current, float target, float max_delta)
+    {
+        float d = target - current;
+        if (d > max_delta)
+            return current + max_delta;
+        if (d < -max_delta)
+            return current - max_delta;
+        return target;
+    }
+
+    /**
+     * Set the target position for the camera to follow.
+     *
+     * @param target The target position in pixels.
+     */
+    void set_target(Vector2 target)
+    {
+        this->target = target;
+    }
+
+    /**
+     * Set the zoom level of the camera.
+     *
+     * @param zoom The zoom level.
+     */
+    void set_zoom(float zoom)
+    {
+        camera.zoom = zoom;
+    }
+
+    /**
+     * Set the rotation angle of the camera.
+     *
+     * @param angle The rotation angle in degrees.
+     */
+    void set_rotation(float angle)
+    {
+        camera.rotation = angle;
+    }
+
+    /**
+     * Begin drawing with the camera.
+     * The rest of the Scene should be drawn between draw_begin() and draw_end().
+     */
+    void draw_begin()
+    {
+        BeginMode2D(camera);
+    }
+
+    /**
+     * End drawing with the camera.
+     */
+    void draw_end()
+    {
+        EndMode2D();
+    }
+
+    /**
+     * Draw the camera's deadzone for debugging.
+     *
+     * @param c The color to draw the deadzone rectangle.
+     */
+    void draw_debug(Color c = {0, 255, 0, 120}) const
+    {
+        float inv_zoom = (camera.zoom != 0.0f) ? (1.0f / camera.zoom) : 1.0f;
+        float dz_left_w = offset_left * inv_zoom;
+        float dz_right_w = offset_right * inv_zoom;
+        float dz_top_w = offset_top * inv_zoom;
+        float dz_bottom_w = offset_bottom * inv_zoom;
+
+        Rectangle r;
+        r.x = camera.target.x - dz_left_w;
+        r.y = camera.target.y - dz_top_w;
+        r.width = dz_left_w + dz_right_w;
+        r.height = dz_top_w + dz_bottom_w;
+
+        DrawRectangleLinesEx(r, 2.0f * inv_zoom, c);
+    }
+
+    /**
+     * Convert screen coordinates to world coordinates.
+     *
+     * @param point The screen coordinates.
+     * @return The corresponding world coordinates.
+     */
+    Vector2 screen_to_world(Vector2 point)
+    {
+        return GetScreenToWorld2D(point, camera);
+    }
+};
+
+/**
+ * A split-screen camera that renders to a texture.
+ */
+class SplitCamera : public CameraObject
+{
+public:
+    RenderTexture2D renderer;
+
+    /**
+     * Constructor for SplitCamera.
+     *
+     * @param size The size of the camera view.
+     * @param level_size The size of the level.
+     * @param follow_speed The speed at which the camera follows the target.
+     * @param offset_left The left deadzone offset in pixels.
+     * @param offset_right The right deadzone offset in pixels.
+     * @param offset_top The top deadzone offset in pixels.
+     * @param offset_bottom The bottom deadzone offset in pixels.
+     */
+    SplitCamera(Vector2 size,
+                Vector2 level_size = {0, 0},
+                Vector2 follow_speed = {1000, 1000},
+                float offset_left = 70,
+                float offset_right = 70,
+                float offset_top = 40,
+                float offset_bottom = 40) :
+        CameraObject(size, level_size, follow_speed, offset_left, offset_right, offset_top, offset_bottom)
+    {
+    }
+
+    ~SplitCamera()
+    {
+        UnloadRenderTexture(renderer);
+    }
+
+    /**
+     * Initialize the SplitCamera.
+     */
+    void init() override
+    {
+        renderer = LoadRenderTexture((int)size.x, (int)size.y);
+        CameraObject::init();
+    }
+
+    /**
+     * Begin drawing to the camera's texture.
+     * The rest of the Scene should be drawn between draw_begin() and draw_end().
+     */
+    void draw_begin()
+    {
+        BeginTextureMode(renderer);
+        ClearBackground(WHITE);
+        BeginMode2D(camera);
+    }
+
+    /**
+     * End drawing to the camera's texture.
+     */
+    void draw_end()
+    {
+        EndMode2D();
+        EndTextureMode();
+    }
+
+    /**
+     * Draw the camera's texture at the specified position.
+     *
+     * @param x The x position to draw the texture.
+     * @param y The y position to draw the texture.
+     */
+    void draw_texture(float x, float y)
+    {
+        DrawTextureRec(renderer.texture,
+                       {0, 0, static_cast<float>(renderer.texture.width), static_cast<float>(-renderer.texture.height)},
+                       {x, y},
+                       WHITE);
+    }
+
+    void draw_texture_pro(float x, float y, float width, float height)
+    {
+        DrawTexturePro(renderer.texture,
+                       {0, 0, static_cast<float>(renderer.texture.width), static_cast<float>(-renderer.texture.height)},
+                       {x, y, width, height},
+                       {0, 0},
+                       0.0f,
+                       WHITE);
+    }
+
+    /**
+     * Convert screen coordinates to world coordinates relative to a draw position.
+     *
+     * @param draw_position The position where the texture is drawn.
+     * @param point The screen coordinates.
+     * @return The corresponding world coordinates.
+     */
+    Vector2 screen_to_world(Vector2 draw_position, Vector2 point)
+    {
+        auto local_point = point - draw_position;
+        return GetScreenToWorld2D(local_point, camera);
+    }
+};
+
+/**
+ * Parameters for the PlatformerCharacter game object.
+ */
+struct CharacterParams
+{
+    // Geometry in pixels
+    float width = 24.0f;
+    float height = 40.0f;
+
+    // Initial position in pixels
+    Vector2 position;
+
+    // Surface behavior
+    float friction = 0.0f;
+    float restitution = 0.0f;
+    float density = 1.0f;
+};
+
+/**
+ * A simple platformer character with movement and animation.
+ */
+class PlatformerCharacter : public GameObject
+{
+public:
+    CharacterParams p;
+    PhysicsService* physics;
+    BodyComponent* body;
+    PlatformerMovementComponent* movement;
+
+    bool grounded = false;
+    bool on_wall_left = false;
+    bool on_wall_right = false;
+    float coyote_timer = 0.0f;
+    float jump_buffer_timer = 0.0f;
+    int gamepad = 0;
+
+    /**
+     * Constructor for PlatformerCharacter.
+     *
+     * @param p The parameters for the character.
+     */
+    PlatformerCharacter(CharacterParams p, int gamepad = 0) : p(p), gamepad(gamepad) {}
+
+    /**
+     * Initialize the PlatformerCharacter.
+     */
+    void init() override
+    {
+        physics = scene->get_service<PhysicsService>();
+
+        body = add_component<BodyComponent>(
+            [=](BodyComponent& b)
+            {
+                b2BodyDef body_def = b2DefaultBodyDef();
+                body_def.type = b2_dynamicBody;
+                body_def.fixedRotation = true;
+                // body_def.isBullet = true;
+                body_def.linearDamping = 0.0f;
+                body_def.angularDamping = 0.0f;
+                body_def.position = physics->convert_to_meters(p.position);
+                body_def.userData = this;
+                b.id = b2CreateBody(physics->world, &body_def);
+
+                b2SurfaceMaterial body_material = b2DefaultSurfaceMaterial();
+                body_material.friction = p.friction;
+                body_material.restitution = p.restitution;
+
+                b2ShapeDef box_shape_def = b2DefaultShapeDef();
+                box_shape_def.density = p.density;
+                box_shape_def.material = body_material;
+
+                // Needed to presolve one-way behavior.
+                box_shape_def.enablePreSolveEvents = true;
+
+                b2Polygon body_polygon = b2MakeRoundedBox(physics->convert_to_meters(p.width / 2.0f),
+                                                          physics->convert_to_meters(p.height / 2.0f),
+                                                          physics->convert_to_meters(0.25));
+                b2CreatePolygonShape(b.id, &box_shape_def, &body_polygon);
+            });
+
+        PlatformerMovementParams mp;
+        mp.width = p.width;
+        mp.height = p.height;
+        movement = add_component<PlatformerMovementComponent>(mp);
+    }
+
+    /**
+     * Update the PlatformerCharacter.
+     */
+    void update(float delta_time) override
+    {
+        float deadzone = 0.1f;
+
+        const bool jump_pressed =
+            IsKeyPressed(KEY_W) || IsGamepadButtonPressed(gamepad, GAMEPAD_BUTTON_RIGHT_FACE_DOWN);
+        const bool jump_held = IsKeyDown(KEY_W) || IsGamepadButtonDown(gamepad, GAMEPAD_BUTTON_RIGHT_FACE_DOWN);
+
+        float move_x = 0.0f;
+        move_x = GetGamepadAxisMovement(gamepad, GAMEPAD_AXIS_LEFT_X);
+        if (fabsf(move_x) < deadzone)
+        {
+            move_x = 0.0f;
+        }
+        if (IsKeyDown(KEY_D) || IsGamepadButtonDown(gamepad, GAMEPAD_BUTTON_LEFT_FACE_RIGHT))
+        {
+            move_x = 1.0f;
+        }
+        else if (IsKeyDown(KEY_A) || IsGamepadButtonDown(gamepad, GAMEPAD_BUTTON_LEFT_FACE_LEFT))
+        {
+            move_x = -1.0f;
+        }
+
+        movement->set_input(move_x, jump_pressed, jump_held);
+    }
+
+    /**
+     * Draw the PlatformerCharacter as a rectangle.
+     */
+    void draw() override
+    {
+        Color color = movement->grounded ? GREEN : BLUE;
+        auto pos = body->get_position_pixels();
+        DrawRectanglePro({pos.x, pos.y, p.width, p.height}, {p.width / 2.0f, p.height / 2.0f}, 0.0f, color);
+    }
+};
diff --git a/py/engine/prefabs/game_objects.py b/py/engine/prefabs/game_objects.py
new file mode 100644
index 0000000..2c96b4f
--- /dev/null
+++ b/py/engine/prefabs/game_objects.py
@@ -0,0 +1,518 @@
+from __future__ import annotations
+
+import math
+from dataclasses import dataclass
+from typing import Optional
+
+from Box2D import b2PolygonShape, b2Vec2
+import pyray as rl
+
+from engine.framework import GameObject
+from engine.math_extensions import v2, vec_sub
+from engine.prefabs.components import BodyComponent, PlatformerMovementComponent, PlatformerMovementParams, SpriteComponent
+from engine.prefabs.services import PhysicsService
+
+
+class StaticBox(GameObject):
+    """Simple static box collider with optional debug drawing."""
+    def __init__(self, x: float, y: float, width: float, height: float) -> None:
+        """  init  .
+        
+        Args:
+            x: Parameter.
+            y: Parameter.
+            width: Parameter.
+            height: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.x = x
+        self.y = y
+        self.width = width
+        self.height = height
+        self.body = None
+        self.is_visible = True
+
+    @classmethod
+    def from_vectors(cls, position: rl.Vector2, size: rl.Vector2):
+        """From vectors.
+        
+        Args:
+            position: Parameter.
+            size: Parameter.
+        
+        Returns:
+            Result of the operation.
+        """
+        return cls(position.x, position.y, size.x, size.y)
+
+    def init(self) -> None:
+        """Initialize the object.
+        
+        Returns:
+            None
+        """
+        physics = self.scene.get_service(PhysicsService)
+        world = physics.world
+        if not world:
+            return
+        self.body = world.CreateStaticBody(position=(self.x * physics.pixels_to_meters, self.y * physics.pixels_to_meters))
+        shape = b2PolygonShape(box=(self.width / 2.0 * physics.pixels_to_meters,
+                                    self.height / 2.0 * physics.pixels_to_meters))
+        self.body.CreateFixture(shape=shape)
+        self.add_component(BodyComponent(self.body))
+
+    def draw(self) -> None:
+        """Draw the object.
+        
+        Returns:
+            None
+        """
+        if self.is_visible:
+            rl.draw_rectangle(int(self.x - self.width / 2.0), int(self.y - self.height / 2.0), int(self.width), int(self.height), rl.Color(0, 121, 241, 255))
+
+
+class DynamicBox(GameObject):
+    """Simple dynamic rigid body box."""
+    def __init__(self, x: float, y: float, width: float, height: float, rotation: float = 0.0) -> None:
+        """  init  .
+        
+        Args:
+            x: Parameter.
+            y: Parameter.
+            width: Parameter.
+            height: Parameter.
+            rotation: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.x = x
+        self.y = y
+        self.width = width
+        self.height = height
+        self.rot_deg = rotation
+        self.physics: Optional[PhysicsService] = None
+        self.body = None
+
+    @classmethod
+    def from_vectors(cls, position: rl.Vector2, size: rl.Vector2, rotation: float = 0.0):
+        """From vectors.
+        
+        Args:
+            position: Parameter.
+            size: Parameter.
+            rotation: Parameter.
+        
+        Returns:
+            Result of the operation.
+        """
+        return cls(position.x, position.y, size.x, size.y, rotation)
+
+    def init(self) -> None:
+        """Initialize the object.
+        
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+        world = self.physics.world
+        if not world:
+            return
+        self.body = world.CreateDynamicBody(position=(self.x * self.physics.pixels_to_meters,
+                                                      self.y * self.physics.pixels_to_meters),
+                                            angle=math.radians(self.rot_deg))
+        shape = b2PolygonShape(box=(self.width / 2.0 * self.physics.pixels_to_meters,
+                                    self.height / 2.0 * self.physics.pixels_to_meters))
+        self.body.CreateFixture(shape=shape, density=1.0, friction=0.3)
+        body_component = self.add_component(BodyComponent(self.body))
+        self.add_component(SpriteComponent("assets/character_green_idle.png", body_component))
+
+    def draw(self) -> None:
+        """Draw the object.
+        
+        Returns:
+            None
+        """
+        if not self.physics or not self.body:
+            return
+        pos = self.body.position
+        angle = math.degrees(self.body.angle)
+        rl.draw_rectangle_pro(rl.Rectangle(self.physics.convert_length_to_pixels(pos.x),
+                                   self.physics.convert_length_to_pixels(pos.y),
+                                   self.width, self.height),
+                         v2(self.width / 2.0, self.height / 2.0),
+                         angle,
+                         rl.Color(230, 41, 55, 255))
+
+
+class CameraObject(GameObject):
+    """2D camera that follows a target with deadzone and clamp."""
+    def __init__(self,
+                 size: rl.Vector2,
+                 level_size: rl.Vector2 = v2(0.0, 0.0),
+                 follow_speed: rl.Vector2 = v2(1000.0, 1000.0),
+                 offset_left: float = 70.0,
+                 offset_right: float = 70.0,
+                 offset_top: float = 40.0,
+                 offset_bottom: float = 40.0) -> None:
+        super().__init__()
+
+        self.camera = rl.Camera2D()
+        self.target = v2(0.0, 0.0)
+        self.size = size
+        self.level_size = level_size
+        self.follow_speed = follow_speed
+        self.offset_left = offset_left
+        self.offset_right = offset_right
+        self.offset_top = offset_top
+        self.offset_bottom = offset_bottom
+
+    def init(self) -> None:
+        """Initialize the object.
+        
+        Returns:
+            None
+        """
+        self.camera.zoom = 1.0
+        self.camera.offset = v2(self.size.x / 2.0, self.size.y / 2.0)
+        self.camera.rotation = 0.0
+        self.camera.target = self.target
+
+    def update(self, delta_time: float) -> None:
+        """Update the object.
+        
+        Args:
+            delta_time: Parameter.
+        
+        Returns:
+            None
+        """
+        desired = self.camera.target
+        inv_zoom = 1.0 / self.camera.zoom if self.camera.zoom != 0.0 else 1.0
+        dz_left_w = self.offset_left * inv_zoom
+        dz_right_w = self.offset_right * inv_zoom
+        dz_top_w = self.offset_top * inv_zoom
+        dz_bottom_w = self.offset_bottom * inv_zoom
+
+        dx = self.target.x - self.camera.target.x
+        dy = self.target.y - self.camera.target.y
+
+        if dx < -dz_left_w:
+            desired.x = self.target.x + dz_left_w
+        elif dx > dz_right_w:
+            desired.x = self.target.x - dz_right_w
+
+        if dy < -dz_top_w:
+            desired.y = self.target.y + dz_top_w
+        elif dy > dz_bottom_w:
+            desired.y = self.target.y - dz_bottom_w
+
+        if self.follow_speed.x < 0:
+            self.camera.target.x = desired.x
+        else:
+            self.camera.target.x = self.move_towards(self.camera.target.x, desired.x, self.follow_speed.x * delta_time)
+
+        if self.follow_speed.y < 0:
+            self.camera.target.y = desired.y
+        else:
+            self.camera.target.y = self.move_towards(self.camera.target.y, desired.y, self.follow_speed.y * delta_time)
+
+        half_view = v2(self.size.x / 2.0 * inv_zoom, self.size.y / 2.0 * inv_zoom)
+        if self.level_size.x > self.size.x:
+            self.camera.target.x = max(half_view.x, min(self.level_size.x - half_view.x, self.camera.target.x))
+        if self.level_size.y > self.size.y:
+            self.camera.target.y = max(half_view.y, min(self.level_size.y - half_view.y, self.camera.target.y))
+
+    @staticmethod
+    def move_towards(current: float, target: float, max_delta: float) -> float:
+        """Move towards.
+        
+        Args:
+            current: Parameter.
+            target: Parameter.
+            max_delta: Parameter.
+        
+        Returns:
+            Result of the operation.
+        """
+        delta = target - current
+        if delta > max_delta:
+            return current + max_delta
+        if delta < -max_delta:
+            return current - max_delta
+        return target
+
+    def set_target(self, target: rl.Vector2) -> None:
+        """Set target.
+        
+        Args:
+            target: Parameter.
+        
+        Returns:
+            None
+        """
+        self.target = target
+
+    def set_zoom(self, zoom: float) -> None:
+        """Set zoom.
+        
+        Args:
+            zoom: Parameter.
+        
+        Returns:
+            None
+        """
+        self.camera.zoom = zoom
+
+    def set_rotation(self, angle: float) -> None:
+        """Set rotation.
+        
+        Args:
+            angle: Parameter.
+        
+        Returns:
+            None
+        """
+        self.camera.rotation = angle
+
+    def draw_begin(self) -> None:
+        """Draw begin.
+        
+        Returns:
+            None
+        """
+        rl.begin_mode_2d(self.camera)
+
+    def draw_end(self) -> None:
+        """Draw end.
+        
+        Returns:
+            None
+        """
+        rl.end_mode_2d()
+
+    def draw_debug(self, color: rl.Color = rl.Color(0, 255, 0, 120)) -> None:
+        """TODO"""
+        inv_zoom = 1.0 / self.camera.zoom if self.camera.zoom != 0.0 else 1.0
+        dz_left_w = self.offset_left * inv_zoom
+        dz_right_w = self.offset_right * inv_zoom
+        dz_top_w = self.offset_top * inv_zoom
+        dz_bottom_w = self.offset_bottom * inv_zoom
+        rect = rl.Rectangle(self.camera.target.x - dz_left_w,
+                         self.camera.target.y - dz_top_w,
+                         dz_left_w + dz_right_w,
+                         dz_top_w + dz_bottom_w)
+        rl.draw_rectangle_lines_ex(rect, 2.0 * inv_zoom, color)
+
+    def screen_to_world(self, point: rl.Vector2) -> rl.Vector2:
+        """Convert screen coordinates to world coordinates.
+        
+        Args:
+            point: Parameter.
+        
+        Returns:
+            Result of the operation.
+        """
+        return rl.get_screen_to_world_2d(point, self.camera)
+
+
+class SplitCamera(CameraObject):
+    """Split-screen camera that renders to a texture."""
+    def __init__(self, size: rl.Vector2, level_size: rl.Vector2 = v2(0.0, 0.0),
+                 follow_speed: rl.Vector2 = v2(1000.0, 1000.0),
+                 offset_left: float = 70.0, offset_right: float = 70.0,
+                 offset_top: float = 40.0, offset_bottom: float = 40.0) -> None:
+        super().__init__(size, level_size, follow_speed, offset_left, offset_right, offset_top, offset_bottom)
+        self.renderer: Optional[rl.RenderTexture] = None
+
+    def init(self) -> None:
+        """Initialize the object.
+        
+        Returns:
+            None
+        """
+        self.renderer = rl.load_render_texture(int(self.size.x), int(self.size.y))
+        super().init()
+
+    def draw_begin(self) -> None:
+        """Draw begin.
+        
+        Returns:
+            None
+        """
+        if not self.renderer:
+            return
+        rl.begin_texture_mode(self.renderer)
+        rl.clear_background(rl.WHITE)
+        rl.begin_mode_2d(self.camera)
+
+    def draw_end(self) -> None:
+        """Draw end.
+        
+        Returns:
+            None
+        """
+        rl.end_mode_2d()
+        rl.end_texture_mode()
+
+    def draw_texture(self, x: float, y: float) -> None:
+        """Draw texture.
+        
+        Args:
+            x: Parameter.
+            y: Parameter.
+        
+        Returns:
+            None
+        """
+        if not self.renderer:
+            return
+        rl.draw_texture_pro(self.renderer.texture,
+                       rl.Rectangle(0.0, 0.0, float(self.renderer.texture.width), -float(self.renderer.texture.height)),
+                       rl.Rectangle(x, y, float(self.renderer.texture.width), float(self.renderer.texture.height)),
+                       v2(0.0, 0.0),
+                       0.0,
+                       rl.WHITE)
+
+    def draw_texture_pro(self, x: float, y: float, width: float, height: float) -> None:
+        """Draw texture pro.
+        
+        Args:
+            x: Parameter.
+            y: Parameter.
+            width: Parameter.
+            height: Parameter.
+        
+        Returns:
+            None
+        """
+        if not self.renderer:
+            return
+        rl.draw_texture_pro(self.renderer.texture,
+                       rl.Rectangle(0.0, 0.0, float(self.renderer.texture.width), -float(self.renderer.texture.height)),
+                       rl.Rectangle(x, y, width, height),
+                       v2(0.0, 0.0),
+                       0.0,
+                       rl.WHITE)
+
+    def screen_to_world_with_offset(self, draw_position: rl.Vector2, point: rl.Vector2) -> rl.Vector2:
+        """Convert screen coordinates to world coordinates.
+        
+        Args:
+            draw_position: Parameter.
+            point: Parameter.
+        
+        Returns:
+            Result of the operation.
+        """
+        local_point = vec_sub(point, draw_position)
+        return rl.get_screen_to_world_2d(local_point, self.camera)
+
+
+@dataclass
+class CharacterParams:
+    """Parameter bag for a platformer character."""
+    width: float = 24.0
+    height: float = 40.0
+    position: rl.Vector2 = v2(0.0, 0.0)
+    friction: float = 0.0
+    restitution: float = 0.0
+    density: float = 1.0
+
+
+class PlatformerCharacter(GameObject):
+    """Simple platformer character with movement."""
+    def __init__(self, params: CharacterParams, gamepad: int = 0) -> None:
+        """  init  .
+        
+        Args:
+            params: Parameter.
+            gamepad: Parameter.
+        
+        Returns:
+            None
+        """
+        super().__init__()
+        self.p = params
+        self.physics: Optional[PhysicsService] = None
+        self.body: Optional[BodyComponent] = None
+        self.movement: Optional[PlatformerMovementComponent] = None
+        self.gamepad = gamepad
+
+    def init(self) -> None:
+        """Initialize the object.
+        
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+            
+            Args:
+                component: Parameter.
+            
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateDynamicBody(position=(self.physics.convert_to_meters(self.p.position).x,
+                                                     self.physics.convert_to_meters(self.p.position).y),
+                                           fixedRotation=True)
+            body.userData = self
+            shape = b2PolygonShape(box=(self.physics.convert_length_to_meters(self.p.width / 2.0),
+                                        self.physics.convert_length_to_meters(self.p.height / 2.0)))
+            body.CreateFixture(shape=shape, density=self.p.density, friction=self.p.friction, restitution=self.p.restitution)
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+        params = PlatformerMovementParams()
+        params.width = self.p.width
+        params.height = self.p.height
+        self.movement = self.add_component(PlatformerMovementComponent(params))
+
+    def update(self, delta_time: float) -> None:
+
+        """Update the object.
+        
+        Args:
+            delta_time: Parameter.
+        
+        Returns:
+            None
+        """
+        deadzone = 0.1
+        jump_pressed = rl.is_key_pressed(rl.KEY_W) or rl.is_gamepad_button_pressed(self.gamepad, rl.GAMEPAD_BUTTON_RIGHT_FACE_DOWN)
+        jump_held = rl.is_key_down(rl.KEY_W) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_RIGHT_FACE_DOWN)
+
+        move_x = rl.get_gamepad_axis_movement(self.gamepad, rl.GAMEPAD_AXIS_LEFT_X)
+        if abs(move_x) < deadzone:
+            move_x = 0.0
+        if rl.is_key_down(rl.KEY_D) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_LEFT_FACE_RIGHT):
+            move_x = 1.0
+        elif rl.is_key_down(rl.KEY_A) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_LEFT_FACE_LEFT):
+            move_x = -1.0
+
+        if self.movement:
+            self.movement.set_input(move_x, jump_pressed, jump_held)
+
+    def draw(self) -> None:
+
+        """Draw the object.
+        
+        Returns:
+            None
+        """
+        if not self.body or not self.movement:
+            return
+        color = rl.GREEN if self.movement.grounded else rl.BLUE
+        pos = self.body.get_position_pixels()
+        rl.draw_rectangle_pro(rl.Rectangle(pos.x, pos.y, self.p.width, self.p.height),
+                         v2(self.p.width / 2.0, self.p.height / 2.0),
+                         0.0,
+                         color)
diff --git a/py/engine/prefabs/includes.h b/py/engine/prefabs/includes.h
new file mode 100644
index 0000000..0bfd025
--- /dev/null
+++ b/py/engine/prefabs/includes.h
@@ -0,0 +1,6 @@
+#pragma once
+
+#include "engine/prefabs/components.h"
+#include "engine/prefabs/game_objects.h"
+#include "engine/prefabs/managers.h"
+#include "engine/prefabs/services.h"
diff --git a/py/engine/prefabs/includes.py b/py/engine/prefabs/includes.py
new file mode 100644
index 0000000..2956c8a
--- /dev/null
+++ b/py/engine/prefabs/includes.py
@@ -0,0 +1,4 @@
+from engine.prefabs.components import *
+from engine.prefabs.game_objects import *
+from engine.prefabs.managers import *
+from engine.prefabs.services import *
diff --git a/py/engine/prefabs/managers.h b/py/engine/prefabs/managers.h
new file mode 100644
index 0000000..ae92645
--- /dev/null
+++ b/py/engine/prefabs/managers.h
@@ -0,0 +1,217 @@
+#pragma once
+
+#include "engine/framework.h"
+
+/**
+ * For when you want multiple of the same manager.
+ */
+template <typename T>
+class MultiManager : public Manager
+{
+public:
+    std::unordered_map<std::string, std::unique_ptr<T>> managers;
+
+    MultiManager() = default;
+
+    /**
+     * Initialize all managers.
+     */
+    void init() override
+    {
+        for (auto& manager : managers)
+        {
+            manager.second->init_manager();
+        }
+        Manager::init();
+    }
+
+    /**
+     * Add a manager to the MultiManager.
+     *
+     * @param name The name to give the manager.
+     * @param manager The manager to add.
+     */
+    void add_manager(std::string name, std::unique_ptr<T> manager)
+    {
+        static_assert(std::is_base_of<Manager, T>::value, "T must derive from Manager");
+        managers[name] = std::move(manager);
+    }
+
+    /**
+     * Create a manager and add it to the MultiManager.
+     *
+     * @param name The name to give the manager.
+     * @param args The arguments to forward to the manager constructor.
+     * @return A pointer to the added manager.
+     */
+    template <typename... TArgs>
+    T* add_manager(std::string name, TArgs&&... args)
+    {
+        static_assert(std::is_base_of<Manager, T>::value, "T must derive from Manager");
+        auto new_manager = std::make_unique<T>(std::forward<TArgs>(args)...);
+        T* manager_ptr = new_manager.get();
+        add_manager(name, std::move(new_manager));
+        return manager_ptr;
+    }
+
+    /**
+     * Get a manager by name.
+     *
+     * @param name The name of the manager.
+     * @return A pointer to the manager.
+     */
+    T* get_manager(std::string name)
+    {
+        return managers[name].get();
+    }
+};
+
+/**
+ * Manager for handling fonts so they are not loaded multiple times.
+ */
+class FontManager : public Manager
+{
+public:
+    std::unordered_map<std::string, Font> fonts;
+
+    /**
+     * Constructor for FontManager.
+     * Loads the default font.
+     */
+    FontManager()
+    {
+        fonts["default"] = GetFontDefault();
+    }
+
+    ~FontManager()
+    {
+        for (auto& pair : fonts)
+        {
+            UnloadFont(pair.second);
+        }
+    }
+
+    /**
+     * Load a font from a file.
+     *
+     * @param name The name to associate with the font.
+     * @param filename The filename of the font to load.
+     * @param size The font size to save the font texture as.
+     *
+     * @return A reference to the loaded font.
+     */
+    Font& load_font(const std::string& name, const std::string& filename, int size = 32)
+    {
+        if (fonts.find(name) != fonts.end())
+        {
+            return fonts[name];
+        }
+
+        Font font = LoadFontEx(filename.c_str(), size, nullptr, 0);
+        fonts[name] = font;
+        return fonts[name];
+    }
+
+    /**
+     * Get a font by name.
+     *
+     * @param name The name of the font.
+     * @return A reference to the font.
+     */
+    Font& get_font(const std::string& name)
+    {
+        return fonts[name];
+    }
+
+    /**
+     * Set the texture filter for a font.
+     *
+     * @param name The name of the font.
+     * @param filter The filter to set.
+     */
+    void set_texture_filter(const std::string& name, int filter)
+    {
+        if (fonts.find(name) != fonts.end())
+        {
+            SetTextureFilter(fonts[name].texture, filter);
+        }
+    }
+};
+
+/**
+ * Manager for handling the application window.
+ */
+class WindowManager : public Manager
+{
+public:
+    int width = 1280;
+    int height = 720;
+    std::string title = "My Game";
+    int target_fps = 60;
+
+    WindowManager(int w, int h, const std::string& t, int fps = 60) : width(w), height(h), title(t), target_fps(fps) {}
+
+    /**
+     * Initialize the window.
+     */
+    void init() override
+    {
+        SetConfigFlags(FLAG_WINDOW_RESIZABLE);
+        InitWindow(width, height, title.c_str());
+        InitAudioDevice();
+        SetTargetFPS(target_fps);
+
+        char* mappings = LoadFileText("assets/gamecontrollerdb.txt");
+        SetGamepadMappings(mappings);
+        Manager::init();
+    }
+
+    /**
+     * Set the window title.
+     *
+     * @param t The new title.
+     */
+    void set_title(const std::string& t)
+    {
+        title = t;
+        SetWindowTitle(title.c_str());
+    }
+
+    /**
+     * Get the window width.
+     *
+     * @return The window width.
+     */
+    float get_width() const
+    {
+        return static_cast<float>(width);
+    }
+
+    /**
+     * Get the window height.
+     */
+    float get_height() const
+    {
+        return static_cast<float>(height);
+    }
+
+    /**
+     * Get the window size.
+     *
+     * @return The window size as a Vector2.
+     */
+    Vector2 get_size() const
+    {
+        return Vector2{(float)width, (float)height};
+    }
+
+    /**
+     * Get the window aspect ratio.
+     *
+     * @return The window aspect ratio.
+     */
+    float get_aspect_ratio() const
+    {
+        return static_cast<float>(width) / static_cast<float>(height);
+    }
+};
\ No newline at end of file
diff --git a/py/engine/prefabs/managers.py b/py/engine/prefabs/managers.py
new file mode 100644
index 0000000..dce3eab
--- /dev/null
+++ b/py/engine/prefabs/managers.py
@@ -0,0 +1,174 @@
+from __future__ import annotations
+
+from typing import Any, Dict, Optional, Type
+import pyray as rl
+
+from engine.framework import Manager
+
+
+class MultiManager(Manager):
+    """Manager container for multiple managers of the same base type."""
+    def __init__(self) -> None:
+        super().__init__()
+        self.managers: Dict[str, Manager] = {}
+
+    def init(self) -> None:
+        """Initialize all contained managers.
+
+        Returns:
+            None
+        """
+        for manager in self.managers.values():
+            manager.init_manager()
+        super().init()
+
+    def add_manager(self, name: str, manager_or_cls: Any, *args: Any, **kwargs: Any) -> Manager:
+        """Add a manager instance or construct one from a class.
+
+        Args:
+            name: Name to register the manager under.
+            manager_or_cls: Manager instance or Manager class.
+            *args: Positional args forwarded to the constructor.
+            **kwargs: Keyword args forwarded to the constructor.
+
+        Returns:
+            The manager instance added.
+        """
+        if isinstance(manager_or_cls, Manager):
+            manager = manager_or_cls
+        else:
+            manager = manager_or_cls(*args, **kwargs)
+        self.managers[name] = manager
+        return manager
+
+    def get_manager(self, name: str) -> Optional[Manager]:
+        """Get a manager by name.
+
+        Args:
+            name: Manager name.
+
+        Returns:
+            The manager instance, or None if missing.
+        """
+        return self.managers.get(name)
+
+
+class FontManager(Manager):
+    """Manager for handling fonts so they are not loaded multiple times."""
+    def __init__(self) -> None:
+        super().__init__()
+        self.fonts: Dict[str, Any] = {"default": rl.get_font_default()}
+
+    def load_font(self, name: str, filename: str, size: int = 32) -> Any:
+        """Load a font from a file (cached by name).
+
+        Args:
+            name: Name to register the font under.
+            filename: Path to the font file.
+            size: Font size used for the texture atlas.
+
+        Returns:
+            The loaded font instance.
+        """
+        if name in self.fonts:
+            return self.fonts[name]
+
+        font = rl.load_font_ex(filename, size, None, 0)
+        self.fonts[name] = font
+        return font
+
+    def get_font(self, name: str) -> Any:
+        """Get a font by name.
+
+        Args:
+            name: Font name.
+
+        Returns:
+            The font instance.
+        """
+        return self.fonts[name]
+
+    def set_texture_filter(self, name: str, texture_filter: int) -> None:
+        """Set the texture filter for a font.
+
+        Args:
+            name: Font name.
+            texture_filter: Raylib texture filter enum value.
+
+        Returns:
+            None
+        """
+        if name in self.fonts:
+            rl.set_texture_filter(self.fonts[name].texture, texture_filter)
+
+
+class WindowManager(Manager):
+    """Manager for handling the application window and audio device."""
+    def __init__(self, width: int = 1280, height: int = 720, title: str = "My Game", fps: int = 60) -> None:
+        super().__init__()
+        self.width = width
+        self.height = height
+        self.title = title
+        self.target_fps = fps
+
+    def init(self) -> None:
+        """Initialize the window and audio device.
+
+        Returns:
+            None
+        """
+        rl.set_config_flags(rl.FLAG_WINDOW_RESIZABLE)
+        rl.init_window(self.width, self.height, self.title)
+        rl.init_audio_device()
+        rl.set_target_fps(self.target_fps)
+        mappings = rl.load_file_text("assets/gamecontrollerdb.txt")
+        if mappings:
+            try:
+                rl.set_gamepad_mappings(mappings)
+            except Exception:
+                print("Failed to set gamepad mappings")
+        super().init()
+
+    def set_title(self, title: str) -> None:
+        """Set the window title.
+
+        Args:
+            title: New title string.
+
+        Returns:
+            None
+        """
+        self.title = title
+        rl.set_window_title(title)
+
+    def get_width(self) -> float:
+        """Get the window width.
+
+        Returns:
+            Window width in pixels.
+        """
+        return float(self.width)
+
+    def get_height(self) -> float:
+        """Get the window height.
+
+        Returns:
+            Window height in pixels.
+        """
+        return float(self.height)
+
+    def get_size(self):
+        """Get the window size as a Vector2.
+
+        Returns:
+            Vector2 containing width and height.
+        """
+        return rl.Vector2(float(self.width), float(self.height))
+
+    def get_aspect_ratio(self) -> float:
+        """Get the window aspect ratio.
+
+        Returns:
+            Width divided by height.
+        """
+        return float(self.width) / float(self.height)
diff --git a/py/engine/prefabs/services.h b/py/engine/prefabs/services.h
new file mode 100644
index 0000000..de72906
--- /dev/null
+++ b/py/engine/prefabs/services.h
@@ -0,0 +1,1159 @@
+#pragma once
+
+#include <LDtkLoader/Project.hpp>
+
+#include "engine/framework.h"
+#include "engine/physics_debug.h"
+#include "engine/raycasts.h"
+
+/**
+ * For when you want multiple of the same service.
+ */
+template <typename T>
+class MultiService : public Service
+{
+public:
+    std::unordered_map<std::string, std::unique_ptr<T>> services;
+
+    MultiService() = default;
+
+    /**
+     * Initialize all services.
+     */
+    void init_service() override
+    {
+        for (auto& service : services)
+        {
+            service.second->init();
+        }
+        Service::init_service();
+    }
+
+    /**
+     * Update all services.
+     */
+    void update(float delta_time) override
+    {
+        for (auto& service : services)
+        {
+            service.second->update();
+        }
+        Service::update(delta_time);
+    }
+
+    /**
+     * Draw all services.
+     */
+    void draw() override
+    {
+        for (auto& service : services)
+        {
+            service.second->draw();
+        }
+    }
+
+    /**
+     * Add a service to the MultiService.
+     *
+     * @param name The name to give the service.
+     * @param service The service to add.
+     */
+    void add_service(std::string name, std::unique_ptr<T> service)
+    {
+        static_assert(std::is_base_of<Service, T>::value, "T must derive from Service");
+        services[name] = std::move(service);
+    }
+
+    /**
+     * Create a service and add it to the MultiService.
+     *
+     * @param name The name to give the service.
+     * @param args The arguments to forward to the service constructor.
+     * @return A pointer to the added service.
+     */
+    template <typename... TArgs>
+    T* add_service(std::string name, TArgs&&... args)
+    {
+        static_assert(std::is_base_of<Service, T>::value, "T must derive from Service");
+        auto new_service = std::make_unique<T>(std::forward<TArgs>(args)...);
+        T* service_ptr = new_service.get();
+        add_service(name, std::move(new_service));
+        return service_ptr;
+    }
+
+    /**
+     * Get a service by name.
+     *
+     * @param name The name of the service.
+     * @return A pointer to the service.
+     */
+    T* get_service(std::string name)
+    {
+        return services[name].get();
+    }
+};
+
+/**
+ * Service for managing textures.
+ * Useful when you don't want to load the same texture multiple times.
+ */
+class TextureService : public Service
+{
+public:
+    std::unordered_map<std::string, Texture2D> textures;
+
+    TextureService() = default;
+    ~TextureService()
+    {
+        for (auto& pair : textures)
+        {
+            UnloadTexture(pair.second);
+        }
+    }
+
+    /**
+     * Get a texture by filename.
+     * Loads the texture if it is not already loaded.
+     *
+     * @param filename The filename of the texture.
+     * @return A reference to the texture.
+     */
+    Texture2D& get_texture(const std::string& filename)
+    {
+        if (textures.find(filename) == textures.end())
+        {
+            Texture2D texture = LoadTexture(filename.c_str());
+            textures[filename] = texture;
+        }
+        return textures[filename];
+    }
+};
+
+/**
+ * Service for managing sounds.
+ * Useful when you don't want to load the same sound multiple times and want to play overlapping sounds.
+ */
+class SoundService : public Service
+{
+public:
+    std::unordered_map<std::string, std::vector<Sound>> sounds;
+
+    SoundService() = default;
+    ~SoundService()
+    {
+        for (auto& pair : sounds)
+        {
+            // The first sound is a real sound.
+            UnloadSound(pair.second[0]);
+            for (int i = 1; i < pair.second.size(); i++)
+            {
+                UnloadSoundAlias(pair.second[i]);
+            }
+        }
+    }
+
+    /**
+     * Get a sound by filename.
+     * Loads the sound if it is not already loaded.
+     * Creates a new alias if the sound is already loaded to allow overlapping sounds.
+     *
+     * @param filename The filename of the sound.
+     * @return A reference to the sound.
+     */
+    Sound& get_sound(const std::string& filename)
+    {
+        if (sounds.find(filename) == sounds.end())
+        {
+            Sound sound = LoadSound(filename.c_str());
+            sounds[filename] = {sound};
+        }
+        else
+        {
+            // Create a new alias to allow overlapping sounds.
+            Sound sound = LoadSoundAlias(sounds[filename][0]);
+            sounds[filename].push_back(sound);
+        }
+        return sounds[filename].back();
+    }
+};
+
+/**
+ * Service for managing the physics world.
+ */
+class PhysicsService : public Service
+{
+public:
+    b2WorldId world = b2_nullWorldId;
+    b2Vec2 gravity = {0.0f, 10.0f};
+    float time_step = 1.0f / 60.0f;
+    int sub_steps = 6;
+    float meters_to_pixels = 30.0f;
+    float pixels_to_meters = 1.0f / meters_to_pixels;
+    PhysicsDebugRenderer debug_draw;
+
+    /**
+     * Constructor for PhysicsService.
+     *
+     * @param gravity The gravity vector for the physics world.
+     * @param time_step The time step for the physics simulation.
+     * @param sub_steps The number of sub-steps for the physics simulation.
+     * @param meters_to_pixels The scale factor from meters to pixels.
+     */
+    PhysicsService(b2Vec2 gravity = b2Vec2{0.0f, 10.0f},
+                   float time_step = 1.0f / 60.0f,
+                   int sub_steps = 6,
+                   float meters_to_pixels = 30.0f) :
+        gravity(gravity),
+        time_step(time_step),
+        sub_steps(sub_steps),
+        meters_to_pixels(meters_to_pixels),
+        pixels_to_meters(1.0f / meters_to_pixels)
+    {
+    }
+
+    ~PhysicsService()
+    {
+        if (b2World_IsValid(world))
+        {
+            b2DestroyWorld(world);
+        }
+    }
+
+    /**
+     * Initialize the physics world.
+     */
+    void init() override
+    {
+        b2WorldDef world_def = b2DefaultWorldDef();
+        world_def.gravity = gravity;
+        world_def.contactHertz = 120;
+        world = b2CreateWorld(&world_def);
+        debug_draw.init(meters_to_pixels);
+    }
+
+    /**
+     * Update the physics world.
+     *
+     * @param delta_time The time elapsed since the last frame.
+     */
+    void update(float delta_time) override
+    {
+        if (!b2World_IsValid(world))
+        {
+            return;
+        }
+        b2World_Step(world, time_step, sub_steps);
+    }
+
+    /**
+     * Draw the physics debug information.
+     */
+    void draw_debug()
+    {
+        debug_draw.draw_debug(world);
+    }
+
+    /**
+     * Convert between pixels and meters.
+     *
+     * @param meters The value in meters.
+     * @return The value in pixels.
+     */
+    Vector2 convert_to_pixels(b2Vec2 meters) const
+    {
+        const auto converted = meters * meters_to_pixels;
+        return {converted.x, converted.y};
+    }
+
+    /**
+     * Convert between pixels and meters.
+     *
+     * @param pixels The value in pixels.
+     * @return The value in meters.
+     */
+    b2Vec2 convert_to_meters(Vector2 pixels) const
+    {
+        const auto converted = pixels * pixels_to_meters;
+        return {converted.x, converted.y};
+    }
+
+    /**
+     * Convert a length from meters to pixels.
+     *
+     * @param meters The length in meters.
+     * @return The length in pixels.
+     */
+    float convert_to_pixels(float meters) const
+    {
+        return meters * meters_to_pixels;
+    }
+
+    /**
+     * Convert a length from pixels to meters.
+     *
+     * @param pixels The length in pixels.
+     * @return The length in meters.
+     */
+    float convert_to_meters(float pixels) const
+    {
+        return pixels * pixels_to_meters;
+    }
+
+    /**
+     * Raycast in pixels.
+     *
+     * @param ignore Box2d body to ignore.
+     * @param from The start point of the ray.
+     * @param to The end point of the ray.
+     * @return A RayHit struct describing the hit.
+     */
+    RayHit raycast(b2BodyId ignore, Vector2 from, Vector2 to)
+    {
+        auto start = convert_to_meters(from);
+        auto translation = convert_to_meters(to - from);
+
+        return raycast_closest(world, ignore, start, translation);
+    }
+
+    /**
+     * Check for circle shape overlaps in pixels.
+     *
+     * @param center The center of the circle.
+     * @param radius The radius of the circle.
+     * @param ignore_body The body to ignore.
+     * @return A vector of body IDs that overlap with the circle.
+     */
+    std::vector<b2BodyId> circle_overlap(Vector2 center, float radius, b2BodyId ignore_body = b2_nullBodyId)
+    {
+        auto center_m = convert_to_meters(center);
+        auto radius_m = convert_to_meters(radius);
+        return circle_hit(world, ignore_body, center_m, radius_m);
+    }
+
+    /**
+     * Check for rectangle shape overlaps in pixels.
+     *
+     * @param rectangle The rectangle to check.
+     * @param rotation The rotation of the rectangle in degrees.
+     * @param ignore_body The body to ignore.
+     * @return A vector of body IDs that overlap with the rectangle.
+     */
+    std::vector<b2BodyId> rectangle_overlap(Rectangle rectangle,
+                                            float rotation = 0.0f,
+                                            b2BodyId ignore_body = b2_nullBodyId)
+    {
+        Vector2 size = {rectangle.width, rectangle.height};
+        Vector2 center = {rectangle.x + size.x / 2.0f, rectangle.y + size.y / 2.0f};
+        auto size_m = convert_to_meters(size);
+        auto center_m = convert_to_meters(center);
+        return rectangle_hit(world, ignore_body, center_m, size_m, rotation);
+    }
+};
+
+/**
+ * Hash for ldtk::IntPoint to be used in unordered_map/set.
+ */
+struct IntPointHash
+{
+    size_t operator()(const ldtk::IntPoint& p) const noexcept
+    {
+        std::size_t h1 = std::hash<int>{}(p.x);
+        std::size_t h2 = std::hash<int>{}(p.y);
+        return h1 ^ (h2 << 1);
+    }
+};
+
+/**
+ * Undirected edge between two IntPoints, stored canonically (a < b).
+ */
+struct Edge
+{
+    ldtk::IntPoint a, b;
+};
+
+/**
+ * Equality operator for Edge.
+ *
+ * @param e1 The first edge.
+ * @param e2 The second edge.
+ * @return True if the edges are equal, false otherwise.
+ */
+static inline bool operator==(const Edge& e1, const Edge& e2)
+{
+    return e1.a == e2.a && e1.b == e2.b;
+}
+
+/**
+ * Hash for Edge to be used in unordered_map/set.
+ */
+struct EdgeHash
+{
+    size_t operator()(const Edge& e) const noexcept
+    {
+        IntPointHash h;
+        std::size_t h1 = h(e.a);
+        std::size_t h2 = h(e.b);
+        return h1 ^ (h2 << 1);
+    }
+};
+
+struct LayerRenderer
+{
+    RenderTexture2D renderer;
+    ldtk::IID layer_iid;
+    bool visible = true;
+};
+
+/**
+ * Service for managing LDtk levels.
+ * Depends on TextureService and PhysicsService.
+ */
+class LevelService : public Service
+{
+public:
+    ldtk::Project project;
+    std::string project_file;
+    std::string level_name;
+    std::vector<std::string> collision_names;
+    std::vector<LayerRenderer> renderers;
+    std::vector<b2BodyId> layer_bodies;
+    float scale = 1.0f;
+    PhysicsService* physics;
+
+    /**
+     * Constructor for LevelService.
+     *
+     * @param project_file The path to the LDtk project file.
+     * @param level_name The name of the level to load.
+     * @param collision_names The names of the layers to create collision bodies for.
+     * @param scale The scale factor for the level.
+     */
+    LevelService(std::string project_file,
+                 std::string level_name,
+                 std::vector<std::string> collision_names,
+                 float scale = 1.0f) :
+        project_file(project_file),
+        level_name(level_name),
+        collision_names(collision_names),
+        scale(scale)
+    {
+    }
+
+    virtual ~LevelService()
+    {
+        for (auto& renderer : renderers)
+        {
+            UnloadRenderTexture(renderer.renderer);
+        }
+
+        for (auto& body : layer_bodies)
+        {
+            if (b2Body_IsValid(body))
+            {
+                b2DestroyBody(body);
+            }
+        }
+    }
+
+    /**
+     * Initialize the level service.
+     * Loads the LDtk project and level, creates textures and collision bodies.
+     */
+    void init() override
+    {
+        if (!FileExists(project_file.c_str()))
+        {
+            TraceLog(LOG_FATAL, "LDtk file not found: %s", project_file.c_str());
+        }
+        project.loadFromFile(project_file);
+        const auto& world = project.getWorld();
+        const auto& levels = world.allLevels();
+
+        bool found = false;
+        for (const auto& level : levels)
+        {
+            if (level.name == level_name)
+            {
+                found = true;
+                break;
+            }
+        }
+        if (!found)
+        {
+            TraceLog(LOG_FATAL, "LDtk level not found: %s", level_name.c_str());
+        }
+
+        physics = scene->get_service<PhysicsService>();
+
+        const auto& level = world.getLevel(level_name);
+        const auto& layers = level.allLayers();
+
+        // Loop through all layers and create textures and collisions bodies.
+        for (auto& layer : layers)
+        {
+            if (!layer.hasTileset())
+            {
+                continue;
+            }
+
+            // Load the texture and the renderer.
+            auto directory = std::string(GetDirectoryPath(project_file.c_str()));
+            auto tileset_file = directory + "/" + layer.getTileset().path;
+            if (!FileExists(tileset_file.c_str()))
+            {
+                TraceLog(LOG_FATAL, "Tileset file not found: %s", tileset_file.c_str());
+            }
+            auto texture_service = scene->get_service<TextureService>();
+            Texture2D texture = texture_service->get_texture(tileset_file);
+            RenderTexture2D renderer = LoadRenderTexture(level.size.x, level.size.y);
+
+            // Draw all the tiles.
+            const auto& tiles_vector = layer.allTiles();
+            BeginTextureMode(renderer);
+            // Clear with transparency so we can render layers on top of each other.
+            ClearBackground({0, 0, 0, 0});
+            for (const auto& tile : tiles_vector)
+            {
+                const auto& position = tile.getPosition();
+                const auto& texture_rect = tile.getTextureRect();
+                Vector2 dest = {
+                    static_cast<float>(position.x),
+                    static_cast<float>(position.y),
+                };
+                Rectangle src = {static_cast<float>(texture_rect.x),
+                                 static_cast<float>(texture_rect.y),
+                                 static_cast<float>(texture_rect.width) * (tile.flipX ? -1.0f : 1.0f),
+                                 static_cast<float>(texture_rect.height) * (tile.flipY ? -1.0f : 1.0f)};
+                DrawTextureRec(texture, src, dest, WHITE);
+            }
+            EndTextureMode();
+            LayerRenderer layer_renderer;
+            layer_renderer.renderer = renderer;
+            layer_renderer.layer_iid = layer.iid;
+            renderers.push_back(layer_renderer);
+
+            // Create bodies.
+            const auto& size = layer.getGridSize();
+
+            auto make_edge = [&](ldtk::IntPoint p0, ldtk::IntPoint p1) -> Edge
+            {
+                if (p1.x < p0.x || (p1.x == p0.x && p1.y < p0.y))
+                    std::swap(p0, p1);
+                return {p0, p1};
+            };
+
+            std::unordered_set<Edge, EdgeHash> edges;
+
+            for (int y = 0; y < size.y; y++)
+            {
+                for (int x = 0; x < size.x; x++)
+                {
+                    if (!is_solid(layer, x, y, size))
+                        continue;
+
+                    // neighbor empty => boundary edge
+                    if (!is_solid(layer, x, y - 1, size))
+                        edges.insert(make_edge({x, y}, {x + 1, y}));
+                    if (!is_solid(layer, x, y + 1, size))
+                        edges.insert(make_edge({x, y + 1}, {x + 1, y + 1}));
+                    if (!is_solid(layer, x - 1, y, size))
+                        edges.insert(make_edge({x, y}, {x, y + 1}));
+                    if (!is_solid(layer, x + 1, y, size))
+                        edges.insert(make_edge({x + 1, y}, {x + 1, y + 1}));
+                }
+            }
+
+            std::unordered_map<ldtk::IntPoint, std::vector<ldtk::IntPoint>, IntPointHash> adj;
+            adj.reserve(edges.size() * 2);
+
+            for (auto& e : edges)
+            {
+                adj[e.a].push_back(e.b);
+                adj[e.b].push_back(e.a);
+            }
+
+            // Helper to remove an undirected edge from the set as we consume it
+            auto erase_edge = [&](ldtk::IntPoint p0, ldtk::IntPoint p1) { edges.erase(make_edge(p0, p1)); };
+
+            // Walk loops
+            std::vector<std::vector<ldtk::IntPoint>> loops;
+
+            while (!edges.empty())
+            {
+                // pick an arbitrary remaining edge
+                Edge startE = *edges.begin();
+                ldtk::IntPoint start = startE.a;
+                ldtk::IntPoint cur = startE.b;
+                ldtk::IntPoint prev = start;
+
+                std::vector<ldtk::IntPoint> poly;
+                poly.push_back(start);
+                poly.push_back(cur);
+                erase_edge(start, cur);
+
+                while (!(cur == start))
+                {
+                    // choose next neighbor that is not prev and still has an edge remaining
+                    const auto& nbs = adj[cur];
+                    ldtk::IntPoint next = prev; // fallback
+
+                    bool found = false;
+                    for (const ldtk::IntPoint& cand : nbs)
+                    {
+                        if (cand == prev)
+                            continue;
+                        if (edges.find(make_edge(cur, cand)) != edges.end())
+                        {
+                            next = cand;
+                            found = true;
+                            break;
+                        }
+                    }
+
+                    if (!found)
+                    {
+                        // Open chain (should be rare for tile boundaries unless the boundary touches the map edge)
+                        break;
+                    }
+
+                    prev = cur;
+                    cur = next;
+                    poly.push_back(cur);
+                    erase_edge(prev, cur);
+
+                    // safety guard to avoid infinite loops on bad topology
+                    if (poly.size() > 100000)
+                        break;
+                }
+
+                // If closed, last vertex == start; Box2D chains usually want NOT duplicated end vertex.
+                if (!poly.empty() && poly.back() == poly.front())
+                {
+                    poly.pop_back();
+                }
+
+                // Only keep valid chains
+                if (poly.size() >= 3)
+                {
+                    // If we're not solid on the right, then we wrapped the wrong way.
+                    if (!loop_has_solid_on_right(poly, layer))
+                    {
+                        std::reverse(poly.begin(), poly.end());
+                    }
+
+                    // Not really necessary but here we reduce the number of points on a line to just the ends.
+                    // std::vector<ldtk::IntPoint> reduced;
+                    // reduced.push_back(poly[0]);
+                    // b2Vec2 original_normal = {0, 0};
+                    // for (int i = 1; i < poly.size(); i++)
+                    // {
+                    //     auto first = poly[i - 1];
+                    //     auto second = poly[i];
+                    //     float length = sqrt((second.x - first.x) * (second.x - first.x) +
+                    //                         (second.y - first.y) * (second.y - first.y));
+                    //     b2Vec2 normal = {(second.x - first.x) / length, (second.y - first.y) / length};
+                    //     if (length == 0)
+                    //     {
+                    //         normal = {0, 0};
+                    //     }
+                    //     if (i == 1)
+                    //     {
+                    //         original_normal = normal;
+                    //     }
+
+                    //     if (normal != original_normal)
+                    //     {
+                    //         reduced.push_back(first);
+                    //         original_normal = normal;
+                    //     }
+                    // }
+                    // reduced.push_back(poly.back());
+                    // loops.push_back(std::move(reduced));
+
+                    loops.push_back(std::move(poly));
+                }
+            }
+
+            b2BodyDef bd = b2DefaultBodyDef();
+            bd.type = b2_staticBody;
+            bd.position = {0, 0};
+            assert(b2World_IsValid(physics->world));
+            b2BodyId layer_body = b2CreateBody(physics->world, &bd);
+
+            for (auto& loop : loops)
+            {
+                std::vector<b2Vec2> verts;
+                verts.reserve(loop.size());
+
+                for (auto& p : loop)
+                {
+                    float xpx = p.x * layer.getCellSize() * scale;
+                    float ypx = p.y * layer.getCellSize() * scale;
+                    verts.push_back(physics->convert_to_meters({xpx, ypx}));
+                }
+
+                std::vector<b2SurfaceMaterial> mats;
+                for (int i = 0; i < verts.size(); i++)
+                {
+                    b2SurfaceMaterial mat = b2DefaultSurfaceMaterial();
+                    mat.friction = 0.1f;
+                    mat.restitution = 0.1f;
+                    mats.push_back(mat);
+                }
+
+                b2ChainDef cd = b2DefaultChainDef();
+                cd.points = verts.data();
+                cd.count = (int)verts.size();
+                cd.materials = mats.data();
+                cd.materialCount = (int)mats.size();
+                cd.isLoop = true;
+                b2CreateChain(layer_body, &cd);
+
+                layer_bodies.push_back(layer_body);
+            }
+        }
+    }
+
+    /**
+     * Draw the level.
+     * Draws all the layer renderers.
+     */
+    void draw() override
+    {
+        // Draw renderers in reverse.
+        for (int i = (int)renderers.size() - 1; i >= 0; i--)
+        {
+            const auto& layer_renderer = renderers[i];
+            if (!layer_renderer.visible)
+            {
+                continue;
+            }
+            const auto& renderer = layer_renderer.renderer;
+            Rectangle src = {0,
+                             0,
+                             static_cast<float>(renderer.texture.width),
+                             -static_cast<float>(renderer.texture.height)};
+            Rectangle dest = {0,
+                              0,
+                              static_cast<float>(renderer.texture.width) * scale,
+                              static_cast<float>(renderer.texture.height) * scale};
+            DrawTexturePro(renderer.texture, src, dest, {0}, .0f, WHITE);
+        }
+    }
+
+    /**
+     * Draw a specific layer by its IID.
+     *
+     * @param layer_id The IID of the layer.
+     */
+    void draw_layer(ldtk::IID layer_id)
+    {
+        for (const auto& layer_renderer : renderers)
+        {
+            if (layer_renderer.layer_iid == layer_id)
+            {
+                const auto& renderer = layer_renderer.renderer;
+                Rectangle src = {0,
+                                 0,
+                                 static_cast<float>(renderer.texture.width),
+                                 -static_cast<float>(renderer.texture.height)};
+                Rectangle dest = {0,
+                                  0,
+                                  static_cast<float>(renderer.texture.width) * scale,
+                                  static_cast<float>(renderer.texture.height) * scale};
+                DrawTexturePro(renderer.texture, src, dest, {0}, .0f, WHITE);
+                return;
+            }
+        }
+    }
+
+    /**
+     * Draw a specific layer by its name.
+     *
+     * @param layer_name The name of the layer.
+     */
+    void draw_layer(std::string layer_name)
+    {
+        const auto& level = get_level();
+        const auto& layer = level.getLayer(layer_name);
+        draw_layer(layer.iid);
+    }
+
+    /**
+     * Check if a cell in the layer is solid.
+     * Used for collision generation.
+     *
+     * @param layer The LDtk layer.
+     * @param x The x coordinate of the cell.
+     * @param y The y coordinate of the cell.
+     * @param size The size of the layer in cells.
+     */
+    bool is_solid(const ldtk::Layer& layer, int x, int y, const ldtk::IntPoint& size)
+    {
+        if (x < 0 || y < 0 || x >= size.x || y >= size.y)
+        {
+            return false;
+        }
+
+        std::string name = layer.getIntGridVal(x, y).name;
+        if (std::find(collision_names.begin(), collision_names.end(), name) != collision_names.end())
+        {
+            return true;
+        }
+        return false;
+    };
+
+    /**
+     * Check if there is solid on the right side of a loop of corners.
+     * Used to determine loop winding.
+     *
+     * @param loop_corners The corners of the loop.
+     * @param layer The LDtk layer.
+     * @return True if there is solid on the right side of the loop, false otherwise.
+     */
+    bool loop_has_solid_on_right(const std::vector<ldtk::IntPoint>& loop_corners, const ldtk::Layer& layer)
+    {
+        const int cell_size = layer.getCellSize();
+
+        // Pick an edge with non-zero length.
+        int n = (int)loop_corners.size();
+        for (int i = 0; i < n; ++i)
+        {
+            ldtk::IntPoint a = loop_corners[i];
+            ldtk::IntPoint b = loop_corners[(i + 1) % n];
+            int dx = b.x - a.x;
+            int dy = b.y - a.y;
+            if (dx == 0 && dy == 0)
+                continue;
+
+            // Convert corner coords to scaled pixel coords.
+            float ax = a.x * cell_size * scale;
+            float ay = a.y * cell_size * scale;
+            float bx = b.x * cell_size * scale;
+            float by = b.y * cell_size * scale;
+
+            // Edge direction.
+            float ex = bx - ax;
+            float ey = by - ay;
+            float len = std::sqrt(ex * ex + ey * ey);
+            if (len < 1e-4f)
+            {
+                continue;
+            }
+            ex /= len;
+            ey /= len;
+
+            // Right normal = (-ey, ex)
+            float rx = -ey;
+            float ry = ex;
+
+            // Midpoint of the edge.
+            float mx = 0.5f * (ax + bx);
+            float my = 0.5f * (ay + by);
+
+            // Sample a point slightly to the right, a quarter cell away.
+            float eps = 0.25f * cell_size * scale;
+            float sx = mx + rx * eps;
+            float sy = my + ry * eps;
+
+            // Map sample pixel to grid cell.
+            int gx = (int)std::floor(sx / (cell_size * scale));
+            int gy = (int)std::floor(sy / (cell_size * scale));
+
+            return is_solid(layer, gx, gy, layer.getGridSize());
+        }
+
+        // Fallback: if degenerate, say false
+        return false;
+    }
+
+    /**
+     * Set the visibility of a layer by its IID.
+     *
+     * @param layer_id The IID of the layer.
+     * @param visible True to make the layer visible, false to hide it.
+     */
+    void set_layer_visibility(ldtk::IID layer_id, bool visible)
+    {
+        for (auto& layer_renderer : renderers)
+        {
+            if (layer_renderer.layer_iid == layer_id)
+            {
+                layer_renderer.visible = visible;
+                return;
+            }
+        }
+    }
+
+    /**
+     * Set the visibility of a layer by its name.
+     *
+     * @param layer_name The name of the layer.
+     * @param visible True to make the layer visible, false to hide it.
+     */
+    void set_layer_visibility(std::string layer_name, bool visible)
+    {
+        const auto& level = get_level();
+        const auto& layer = level.getLayer(layer_name);
+        for (auto& layer_renderer : renderers)
+        {
+            if (layer_renderer.layer_iid == layer.iid)
+            {
+                layer_renderer.visible = visible;
+                return;
+            }
+        }
+    }
+
+    /**
+     * Get the LDtk world.
+     *
+     * @return A reference to the LDtk world.
+     */
+    const ldtk::World& get_world()
+    {
+        return project.getWorld();
+    }
+
+    /**
+     * Get the LDtk level.
+     *
+     * @return A reference to the LDtk level.
+     */
+    const ldtk::Level& get_level()
+    {
+        const auto& world = project.getWorld();
+        return world.getLevel(level_name);
+    }
+
+    /**
+     * Get the level size in pixels.
+     *
+     * @return A Vector2 containing the size of the level.
+     */
+    Vector2 get_size()
+    {
+        const auto& level = get_level();
+        return {level.size.x * scale, level.size.y * scale};
+    }
+
+    /**
+     * Get a layer by its name.
+     *
+     * @param name The name of the layer.
+     * @return A reference to the LDtk layer.
+     */
+    const ldtk::Layer& get_layer_by_name(const std::string& name)
+    {
+        const auto& level = get_level();
+        return level.getLayer(name);
+    }
+
+    /**
+     * Get all entities across all layers in the level.
+     *
+     * @return A vector of LDtk entities.
+     */
+    std::vector<const ldtk::Entity*> get_entities()
+    {
+        if (!is_init)
+        {
+            TraceLog(LOG_ERROR, "LDtk project not loaded.");
+            return {};
+        }
+        const auto& level = get_level();
+        const auto& layers = level.allLayers();
+
+        std::vector<const ldtk::Entity*> entities;
+
+        for (const auto& layer : layers)
+        {
+            const auto& layer_entities = layer.allEntities();
+
+            entities.reserve(entities.size() + layer_entities.size());
+            for (const auto& entity : layer_entities)
+            {
+                entities.push_back(&entity);
+            }
+        }
+
+        return entities;
+    }
+
+    /**
+     * Get all entities across all layers in the level with the given name.
+     *
+     * @param name The name of the entities to get.
+     * @return A vector of LDtk entities.
+     */
+    std::vector<const ldtk::Entity*> get_entities_by_name(const std::string& name)
+    {
+        if (!is_init)
+        {
+            TraceLog(LOG_ERROR, "LDtk project not loaded.");
+            return {};
+        }
+        const auto& level = get_level();
+        const auto& layers = level.allLayers();
+
+        std::vector<const ldtk::Entity*> entities;
+
+        for (const auto& layer : layers)
+        {
+            const auto& layer_entities = layer.getEntitiesByName(name);
+
+            entities.reserve(entities.size() + layer_entities.size());
+            for (const auto& entity : layer_entities)
+            {
+                entities.push_back(&entity.get());
+            }
+        }
+
+        return entities;
+    }
+
+    /**
+     * Get all entities across all layers in the level with the given tag.
+     *
+     * @param tag The tag of the entities to get.
+     * @return A vector of LDtk entities.
+     */
+    std::vector<const ldtk::Entity*> get_entities_by_tag(const std::string& tag)
+    {
+        if (!is_init)
+        {
+            TraceLog(LOG_ERROR, "LDtk project not loaded.");
+            return {};
+        }
+        const auto& level = get_level();
+        const auto& layers = level.allLayers();
+
+        std::vector<const ldtk::Entity*> entities;
+
+        for (const auto& layer : layers)
+        {
+            const auto& layer_entities = layer.getEntitiesByTag(tag);
+
+            entities.reserve(entities.size() + layer_entities.size());
+            for (const auto& entity : layer_entities)
+            {
+                entities.push_back(&entity.get());
+            }
+        }
+
+        return entities;
+    }
+
+    /**
+     * Get the first entity across all layers in the level with the given name.
+     *
+     * @param name The name of the entity to get.
+     * @return A pointer to the LDtk entity, or nullptr if not found.
+     */
+    const ldtk::Entity* get_entity_by_name(const std::string& name)
+    {
+        auto entities = get_entities_by_name(name);
+        if (entities.empty())
+        {
+            return nullptr;
+        }
+
+        return entities[0];
+    }
+
+    /**
+     * Get the first entity across all layers in the level with the given tag.
+     *
+     * @param tag The tag of the entity to get.
+     * @return A pointer to the LDtk entity, or nullptr if not found.
+     */
+    const ldtk::Entity* get_entity_by_tag(const std::string& tag)
+    {
+        auto entities = get_entities_by_tag(tag);
+        if (entities.empty())
+        {
+            return nullptr;
+        }
+
+        return entities[0];
+    }
+
+    /**
+     * Convert a grid point to pixels.
+     *
+     * @param point The grid point to convert.
+     * @return A Vector2 containing the point in pixels.
+     */
+    Vector2 convert_to_pixels(const ldtk::IntPoint& point) const
+    {
+        return {point.x * scale, point.y * scale};
+    }
+
+    /**
+     * Convert a cell point to pixels.
+     *
+     * @param cell_point The cell point to convert.
+     * @param layer The LDtk layer the cell point is in.
+     */
+    Vector2 convert_cells_to_pixels(const ldtk::IntPoint& cell_point, const ldtk::Layer& layer) const
+    {
+        float cell_size = static_cast<float>(layer.getCellSize());
+        return {cell_point.x * cell_size * scale, cell_point.y * cell_size * scale};
+    }
+
+    /**
+     * Convert a grid point to meters.
+     *
+     * @param point The grid point to convert.
+     * @return A b2Vec2 containing the point in meters.
+     */
+    b2Vec2 convert_to_meters(const ldtk::IntPoint& point) const
+    {
+        return physics->convert_to_meters(convert_to_pixels(point));
+    }
+
+    /**
+     * Convert pixels to a grid point.
+     *
+     * @param pixels The pixel position to convert.
+     * @return An IntPoint containing the point in grid coordinates.
+     */
+    ldtk::IntPoint convert_to_grid(const Vector2& pixels) const
+    {
+        return {static_cast<int>(pixels.x / scale), static_cast<int>(pixels.y / scale)};
+    }
+
+    /**
+     * Convert meters to a grid point.
+     *
+     * @param meters The meter position to convert.
+     * @return An IntPoint containing the point in grid coordinates.
+     */
+    ldtk::IntPoint convert_to_grid(const b2Vec2& meters) const
+    {
+        auto pixels = physics->convert_to_pixels(meters);
+        return {static_cast<int>(pixels.x / scale), static_cast<int>(pixels.y / scale)};
+    }
+
+    /**
+     * Get the position of an entity in pixels.
+     *
+     * @param entity The entity to get the position of.
+     * @return A Vector2 containing the position of the entity in pixels.
+     */
+    Vector2 get_entity_position(ldtk::Entity* entity)
+    {
+        return convert_to_pixels(entity->getPosition());
+    }
+
+    /**
+     * Get the size of an entity in pixels.
+     *
+     * @param entity The entity to get the size of.
+     * @return A Vector2 containing the size of the entity in pixels.
+     */
+    Vector2 get_entity_size(ldtk::Entity* entity)
+    {
+        return convert_to_pixels(entity->getSize());
+    }
+};
diff --git a/py/engine/prefabs/services.py b/py/engine/prefabs/services.py
new file mode 100644
index 0000000..5732d28
--- /dev/null
+++ b/py/engine/prefabs/services.py
@@ -0,0 +1,798 @@
+from __future__ import annotations
+
+import json
+import math
+from dataclasses import dataclass
+from typing import Any, Dict, List, Optional
+
+from Box2D import (b2Body, b2CircleShape, b2EdgeShape, b2FixtureDef,
+                   b2PolygonShape, b2Vec2, b2World)
+import pyray as rl
+
+from engine.framework import Service
+from engine.math_extensions import v2
+from engine.physics_debug import PhysicsDebugRenderer
+from engine.raycasts import circle_hit, raycast_closest, rectangle_hit
+from engine.LdtkJson import LdtkJSON, Level, LayerInstance, GridPoint
+
+
+class MultiService(Service):
+    """Service container for multiple services of the same base type.
+
+    Attributes:
+        services: Mapping of service name to instance.
+    """
+    def __init__(self) -> None:
+        super().__init__()
+        self.services: Dict[str, Service] = {}
+
+    def init_service(self) -> None:
+        """Initialize all contained services.
+
+        Returns:
+            None
+        """
+        for service in self.services.values():
+            service.init()
+        super().init_service()
+
+    def update(self, delta_time: float) -> None:
+        """Update all contained services.
+
+        Args:
+            delta_time: Seconds since the last frame.
+
+        Returns:
+            None
+        """
+        for service in self.services.values():
+            service.update(delta_time)
+        super().update(delta_time)
+
+    def draw(self) -> None:
+        """Draw all contained services.
+
+        Returns:
+            None
+        """
+        for service in self.services.values():
+            service.draw()
+
+    def add_service(self, name: str, service_or_cls: Any, *args: Any, **kwargs: Any) -> Service:
+        """Add a service instance or construct one from a class.
+
+        Args:
+            name: Name to register the service under.
+            service_or_cls: A Service instance or Service class.
+            *args: Positional args forwarded to the constructor.
+            **kwargs: Keyword args forwarded to the constructor.
+
+        Returns:
+            The service instance added.
+        """
+        if isinstance(service_or_cls, Service):
+            service = service_or_cls
+        else:
+            service = service_or_cls(*args, **kwargs)
+        self.services[name] = service
+        return service
+
+    def get_service(self, name: str) -> Optional[Service]:
+        """Get a service by name.
+
+        Args:
+            name: Registered name of the service.
+
+        Returns:
+            The service instance, or None if missing.
+        """
+        return self.services.get(name)
+
+
+class TextureService(Service):
+    """Cache textures so they are loaded once.
+
+    Attributes:
+        textures: Mapping of filename to loaded Texture2D.
+    """
+    def __init__(self) -> None:
+        super().__init__()
+        self.textures: Dict[str, rl.Texture2D] = {}
+
+    def get_texture(self, filename: str) -> rl.Texture2D:
+        """Get or load a texture by filename.
+
+        Args:
+            filename: Path to the texture file.
+
+        Returns:
+            The loaded Texture2D.
+        """
+
+        if filename not in self.textures:
+            self.textures[filename] = rl.load_texture(filename)
+        return self.textures[filename]
+
+
+class SoundService(Service):
+    """Cache sounds and create aliases for overlapping playback.
+
+    Attributes:
+        sounds: Mapping of filename to a list of Sound aliases.
+    """
+    def __init__(self) -> None:
+        super().__init__()
+        self.sounds: Dict[str, List[Any]] = {}
+
+    def get_sound(self, filename: str):
+        """Get or load a sound; returns an alias if already loaded.
+
+        Args:
+            filename: Path to the sound file.
+
+        Returns:
+            A Sound instance (original or alias).
+        """
+
+        if filename not in self.sounds:
+            self.sounds[filename] = [rl.load_sound(filename)]
+        else:
+            self.sounds[filename].append(rl.load_sound_alias(self.sounds[filename][0]))
+        return self.sounds[filename][-1]
+
+
+class PhysicsService(Service):
+    """Service that owns the Box2D world and physics configuration."""
+    def __init__(self,
+                 gravity: b2Vec2 = b2Vec2(0.0, 10.0),
+                 time_step: float = 1.0 / 60.0,
+                 sub_steps: int = 6,
+                 meters_to_pixels: float = 30.0) -> None:
+        super().__init__()
+        self.gravity = gravity
+        self.time_step = time_step
+        self.sub_steps = sub_steps
+        self.meters_to_pixels = meters_to_pixels
+        self.pixels_to_meters = 1.0 / meters_to_pixels
+        self.world: Optional[b2World] = None
+        self.debug_draw = PhysicsDebugRenderer(meters_to_pixels=meters_to_pixels)
+
+    def init(self) -> None:
+        """Create the Box2D world.
+
+        Returns:
+            None
+        """
+        self.world = b2World(gravity=self.gravity, doSleep=True)
+        self.world.contactListener = None
+        self.world.renderer = self.debug_draw
+
+    def update(self, delta_time: float) -> None:
+        """Step the physics world.
+
+        Args:
+            delta_time: Seconds since the last frame (unused by fixed-step).
+
+        Returns:
+            None
+        """
+        if not self.world:
+            return
+        self.world.Step(self.time_step, self.sub_steps, self.sub_steps)
+
+    def draw_debug(self) -> None:
+        """Draw debug shapes for the physics world.
+
+        Returns:
+            None
+        """
+        if self.world:
+            self.world.DrawDebugData()
+
+    def convert_to_pixels(self, meters: b2Vec2) -> b2Vec2:
+        """Convert meters to pixels.
+
+        Args:
+            meters: Vector in meters.
+
+        Returns:
+            Vector in pixels.
+        """
+        return b2Vec2(meters.x * self.meters_to_pixels, meters.y * self.meters_to_pixels)
+
+    def convert_to_meters(self, pixels) -> b2Vec2:
+        """Convert pixels to meters.
+
+        Args:
+            pixels: Vector in pixels.
+
+        Returns:
+            Vector in meters.
+        """
+        return b2Vec2(pixels.x * self.pixels_to_meters, pixels.y * self.pixels_to_meters)
+
+    def convert_length_to_pixels(self, meters: float) -> float:
+        """Convert a length in meters to pixels.
+
+        Args:
+            meters: Length in meters.
+
+        Returns:
+            Length in pixels.
+        """
+        return meters * self.meters_to_pixels
+
+    def convert_length_to_meters(self, pixels: float) -> float:
+        """Convert a length in pixels to meters.
+
+        Args:
+            pixels: Length in pixels.
+
+        Returns:
+            Length in meters.
+        """
+        return pixels * self.pixels_to_meters
+
+    def raycast(self, ignore: Optional[b2Body], start, end):
+        """Raycast in pixel units.
+
+        Args:
+            ignore: Body to ignore during raycast.
+            start: Start position in pixels.
+            end: End position in pixels.
+
+        Returns:
+            RayHit if world exists, otherwise None.
+        """
+        if not self.world:
+            return None
+        origin = self.convert_to_meters(start)
+        translation = self.convert_to_meters(v2(end.x - start.x, end.y - start.y))
+        return raycast_closest(self.world, ignore, origin, translation)
+
+    def circle_overlap(self, center, radius: float, ignore_body: Optional[b2Body] = None):
+        """Overlap query for a circle in pixel units.
+
+        Args:
+            center: Center in pixels.
+            radius: Radius in pixels.
+            ignore_body: Optional body to ignore.
+
+        Returns:
+            List of bodies overlapping the circle.
+        """
+        if not self.world:
+            return []
+        center_m = self.convert_to_meters(center)
+        radius_m = self.convert_length_to_meters(radius)
+        return circle_hit(self.world, ignore_body, center_m, radius_m)
+
+    def rectangle_overlap(self, rectangle, rotation: float = 0.0, ignore_body: Optional[b2Body] = None):
+        """Overlap query for a rectangle in pixel units.
+
+        Args:
+            rectangle: Rectangle in pixels.
+            rotation: Rotation in radians.
+            ignore_body: Optional body to ignore.
+
+        Returns:
+            List of bodies overlapping the rectangle.
+        """
+        if not self.world:
+            return []
+        size = v2(rectangle.width, rectangle.height)
+        center = v2(rectangle.x + size.x / 2.0, rectangle.y + size.y / 2.0)
+        size_m = self.convert_to_meters(size)
+        center_m = self.convert_to_meters(center)
+        return rectangle_hit(self.world, ignore_body, center_m, size_m, rotation)
+
+
+@dataclass(frozen=True)
+class IntPoint:
+    x: int
+    y: int
+
+
+class LdtkEntity:
+    """Thin wrapper around an LDtk entity instance."""
+    def __init__(self, entity) -> None:
+        self.entity = entity
+
+    def getPosition(self) -> IntPoint:
+        """Get entity position in pixels.
+
+        Returns:
+            IntPoint for the entity position.
+        """
+        return IntPoint(self.entity.px[0], self.entity.px[1])
+
+    def getSize(self) -> IntPoint:
+        """Get entity size in pixels.
+
+        Returns:
+            IntPoint for the entity size.
+        """
+        return IntPoint(self.entity.width, self.entity.height)
+
+    def getField(self, name: str) -> Optional[Any]:
+        """Get a field value by name.
+
+        Args:
+            name: Field identifier.
+
+        Returns:
+            Field value, converted for point fields when possible.
+        """
+        for field in self.entity.field_instances:
+            if field.identifier == name:
+                value = field.value
+                if isinstance(value, dict) and "cx" in value and "cy" in value:
+                    return IntPoint(int(value["cx"]), int(value["cy"]))
+                return value
+        return None
+
+
+@dataclass
+class LayerRenderer:
+    renderer: rl.RenderTexture
+    layer_iid: str
+    visible: bool = True
+
+
+class LevelService(Service):
+    """Service for loading and drawing LDtk levels and collisions.
+
+    Attributes:
+        project: Parsed LDtk project.
+        level: Active Level instance.
+        renderers: Render textures per layer.
+        layer_bodies: Physics bodies used for collision.
+        physics: PhysicsService reference.
+    """
+    def __init__(self,
+                 project_file: str,
+                 level_name: str,
+                 collision_names: List[str],
+                 scale: float = 1.0) -> None:
+        super().__init__()
+        self.project_file = project_file
+        self.level_name = level_name
+        self.collision_names = collision_names
+        self.scale = scale
+        self.project: Optional[LdtkJSON] = None
+        self.level: Optional[Level] = None
+        self.renderers: List[LayerRenderer] = []
+        self.layer_bodies: List[b2Body] = []
+        self.physics: Optional[PhysicsService] = None
+        self.layer_defs_by_uid: Dict[int, Any] = {}
+
+    def init(self) -> None:
+        """Load the LDtk project, build renderers and collision bodies.
+
+        Returns:
+            None
+        """
+        if not rl.file_exists(self.project_file):
+            print(f"LDtk file not found: {self.project_file}")
+            raise RuntimeError("LDtk file not found")
+
+        with open(self.project_file, "r", encoding="utf-8") as handle:
+            project_data = json.load(handle)
+        self.project = LdtkJSON.from_dict(project_data)
+
+        level = None
+        for candidate in self.project.levels:
+            if candidate.identifier == self.level_name:
+                level = candidate
+                break
+        if level is None:
+            print(f"LDtk level not found: {self.level_name}")
+            raise RuntimeError("LDtk level not found")
+
+        if level.layer_instances is None and level.external_rel_path:
+            external_path = self._resolve_external_level_path(level.external_rel_path)
+            with open(external_path, "r", encoding="utf-8") as handle:
+                external_data = json.load(handle)
+            level = Level.from_dict(external_data)
+
+        self.level = level
+        self.layer_defs_by_uid = {layer.uid: layer for layer in self.project.defs.layers}
+
+        self.physics = self.scene.get_service(PhysicsService) if self.scene else None
+        if not self.physics:
+            print("PhysicsService required for LevelService")
+            raise RuntimeError("PhysicsService required")
+
+        texture_service = self.scene.get_service(TextureService)
+        for layer in self.level.layer_instances or []:
+            if layer.tileset_rel_path:
+                tileset_path = self._resolve_tileset_path(layer.tileset_rel_path)
+                texture = texture_service.get_texture(tileset_path)
+                renderer = rl.load_render_texture(self.level.px_wid, self.level.px_hei)
+                self._render_layer_tiles(layer, texture, renderer)
+                self.renderers.append(LayerRenderer(renderer=renderer, layer_iid=layer.iid, visible=layer.visible))
+
+            if layer.type == "IntGrid" and self.collision_names:
+                self._build_collision_for_layer(layer)
+
+    def _resolve_tileset_path(self, rel_path: str) -> str:
+        """Resolve a tileset path relative to the project file.
+
+        Args:
+            rel_path: Relative tileset path from the LDtk project.
+
+        Returns:
+            Absolute or normalized tileset path.
+        """
+        import os
+
+        directory = os.path.dirname(self.project_file)
+        return os.path.join(directory, rel_path).replace("\\", "/")
+
+    def _resolve_external_level_path(self, rel_path: str) -> str:
+        """Resolve an external level path relative to the project file.
+
+        Args:
+            rel_path: Relative level path from the LDtk project.
+
+        Returns:
+            Absolute or normalized level path.
+        """
+        import os
+
+        directory = os.path.dirname(self.project_file)
+        return os.path.join(directory, rel_path).replace("\\", "/")
+
+    def _render_layer_tiles(self, layer: LayerInstance, texture: rl.Texture2D, renderer: rl.RenderTexture) -> None:
+        """Render the tiles for a layer to a render texture.
+
+        Args:
+            layer: Layer instance to render.
+            texture: Tileset texture.
+            renderer: Render texture target.
+
+        Returns:
+            None
+        """
+        rl.begin_texture_mode(renderer)
+        rl.clear_background(rl.Color(0, 0, 0, 0))
+
+        tile_size = layer.grid_size
+        tiles = list(layer.grid_tiles) + list(layer.auto_layer_tiles)
+        for tile in tiles:
+            src_x, src_y = tile.src[0], tile.src[1]
+            flip_x = (tile.f & 1) != 0
+            flip_y = (tile.f & 2) != 0
+            src = rl.Rectangle(float(src_x), float(src_y),
+                            float(tile_size) * (-1.0 if flip_x else 1.0),
+                            float(tile_size) * (-1.0 if flip_y else 1.0))
+            dest = v2(float(tile.px[0] + layer.px_total_offset_x), float(tile.px[1] + layer.px_total_offset_y))
+            rl.draw_texture_rec(texture, src, dest, rl.WHITE)
+
+        rl.end_texture_mode()
+
+    def _intgrid_value_name(self, layer: LayerInstance, value: int) -> Optional[str]:
+        """Map an IntGrid value to its identifier string.
+
+        Args:
+            layer: Layer instance with IntGrid definitions.
+            value: Raw IntGrid value.
+
+        Returns:
+            Identifier string or None if empty/unknown.
+        """
+        if value == 0:
+            return None
+        layer_def = self.layer_defs_by_uid.get(layer.layer_def_uid)
+        if not layer_def:
+            return None
+        for def_value in layer_def.int_grid_values:
+            if def_value.value == value:
+                return def_value.identifier
+        return None
+
+    def _build_collision_for_layer(self, layer: LayerInstance) -> None:
+        """Create boundary colliders for a collision layer.
+
+        Args:
+            layer: Layer instance to build colliders for.
+
+        Returns:
+            None
+        """
+        if not self.physics or not self.physics.world:
+            return
+        world = self.physics.world
+        body = world.CreateStaticBody(position=(0, 0))
+        grid_w = layer.c_wid
+        grid_h = layer.c_hei
+        cell_size = float(layer.grid_size) * self.scale
+        # Build boundary edges into chain shapes to avoid internal collisions.
+        def is_solid(cx: int, cy: int) -> bool:
+            if cx < 0 or cy < 0 or cx >= grid_w or cy >= grid_h:
+                return False
+            idx = cy * grid_w + cx
+            value = layer.int_grid_csv[idx] if idx < len(layer.int_grid_csv) else 0
+            name = self._intgrid_value_name(layer, value)
+            return bool(name and name in self.collision_names)
+
+        def make_edge(a, b):
+            return (a, b) if a <= b else (b, a)
+
+        edges = set()
+        for y in range(grid_h):
+            for x in range(grid_w):
+                if not is_solid(x, y):
+                    continue
+                if not is_solid(x, y - 1):
+                    edges.add(make_edge((x, y), (x + 1, y)))
+                if not is_solid(x, y + 1):
+                    edges.add(make_edge((x, y + 1), (x + 1, y + 1)))
+                if not is_solid(x - 1, y):
+                    edges.add(make_edge((x, y), (x, y + 1)))
+                if not is_solid(x + 1, y):
+                    edges.add(make_edge((x + 1, y), (x + 1, y + 1)))
+
+        adj: Dict[tuple, List[tuple]] = {}
+        for a, b in edges:
+            adj.setdefault(a, []).append(b)
+            adj.setdefault(b, []).append(a)
+
+        def erase_edge(a, b):
+            edges.discard(make_edge(a, b))
+
+        loops: List[List[tuple]] = []
+        while edges:
+            start_a, start_b = next(iter(edges))
+            start = start_a
+            cur = start_b
+            prev = start
+            poly = [start, cur]
+            erase_edge(start, cur)
+
+            while cur != start:
+                next_pt = None
+                for cand in adj.get(cur, []):
+                    if cand == prev:
+                        continue
+                    if make_edge(cur, cand) in edges:
+                        next_pt = cand
+                        break
+                if next_pt is None:
+                    break
+                prev, cur = cur, next_pt
+                poly.append(cur)
+                erase_edge(prev, cur)
+                if len(poly) > 100000:
+                    break
+
+            if poly and poly[0] == poly[-1]:
+                poly.pop()
+            if len(poly) >= 3:
+                loops.append(poly)
+
+        for loop in loops:
+            verts = []
+            for cx, cy in loop:
+                x_px = cx * cell_size
+                y_px = cy * cell_size
+                verts.append(self.physics.convert_to_meters(v2(x_px, y_px)))
+            count = len(verts)
+            if count < 2:
+                continue
+            for i in range(count):
+                v1 = verts[i]
+                v2p = verts[(i + 1) % count]
+                edge = b2EdgeShape(vertices=[(float(v1.x), float(v1.y)), (float(v2p.x), float(v2p.y))])
+                body.CreateFixture(shape=edge, friction=0.1, restitution=0.1)
+        self.layer_bodies.append(body)
+
+    def draw(self) -> None:
+        """Draw all visible layer renderers in reverse order.
+
+        Returns:
+            None
+        """
+        for renderer in reversed(self.renderers):
+            if not renderer.visible:
+                continue
+            texture = renderer.renderer.texture
+            src = rl.Rectangle(0.0, 0.0, float(texture.width), -float(texture.height))
+            dest = rl.Rectangle(0.0, 0.0, float(texture.width) * self.scale, float(texture.height) * self.scale)
+            rl.draw_texture_pro(texture, src, dest, v2(0.0, 0.0), 0.0, rl.WHITE)
+
+    def draw_layer(self, layer_id_or_name: str) -> None:
+        """Draw a specific layer by IID or identifier.
+
+        Args:
+            layer_id_or_name: Layer IID or identifier.
+
+        Returns:
+            None
+        """
+        if not self.level:
+            return
+        layer = None
+        for layer_inst in self.level.layer_instances or []:
+            if layer_inst.iid == layer_id_or_name or layer_inst.identifier == layer_id_or_name:
+                layer = layer_inst
+                break
+        if not layer:
+            return
+        for renderer in self.renderers:
+            if renderer.layer_iid == layer.iid:
+                texture = renderer.renderer.texture
+                src = rl.Rectangle(0.0, 0.0, float(texture.width), -float(texture.height))
+                dest = rl.Rectangle(0.0, 0.0, float(texture.width) * self.scale, float(texture.height) * self.scale)
+                rl.draw_texture_pro(texture, src, dest, v2(0.0, 0.0), 0.0, rl.WHITE)
+                return
+
+    def set_layer_visibility(self, layer_id_or_name: str, visible: bool) -> None:
+        """Set a layer's visibility by IID or identifier.
+
+        Args:
+            layer_id_or_name: Layer IID or identifier.
+            visible: True to show the layer, False to hide it.
+
+        Returns:
+            None
+        """
+        if not self.level:
+            return
+        for layer_inst in self.level.layer_instances or []:
+            if layer_inst.iid == layer_id_or_name or layer_inst.identifier == layer_id_or_name:
+                for renderer in self.renderers:
+                    if renderer.layer_iid == layer_inst.iid:
+                        renderer.visible = visible
+                        return
+
+    def get_layer_by_name(self, name: str) -> Optional[LayerInstance]:
+        """Get a layer instance by name.
+
+        Args:
+            name: Layer identifier.
+
+        Returns:
+            The LayerInstance or None.
+        """
+        if not self.level:
+            return None
+        for layer in self.level.layer_instances or []:
+            if layer.identifier == name:
+                return layer
+        return None
+
+    def get_entities(self) -> List[LdtkEntity]:
+        """Get all entities across all layers.
+
+        Returns:
+            List of LdtkEntity wrappers.
+        """
+        if not self.level:
+            print("LDtk project not loaded.")
+            return []
+        entities: List[LdtkEntity] = []
+        for layer in self.level.layer_instances or []:
+            if layer.type != "Entities":
+                continue
+            for entity in layer.entity_instances:
+                entities.append(LdtkEntity(entity))
+        return entities
+
+    def get_entities_by_name(self, name: str) -> List[LdtkEntity]:
+        """Get all entities by name across all layers.
+
+        Args:
+            name: Entity identifier.
+
+        Returns:
+            List of matching entities.
+        """
+        return [entity for entity in self.get_entities() if entity.entity.identifier == name]
+
+    def get_entities_by_tag(self, tag: str) -> List[LdtkEntity]:
+        """Get all entities by tag across all layers.
+
+        Args:
+            tag: Tag string.
+
+        Returns:
+            List of matching entities.
+        """
+        return [entity for entity in self.get_entities() if tag in entity.entity.tags]
+
+    def get_entity_by_name(self, name: str) -> Optional[LdtkEntity]:
+        """Get the first entity by name.
+
+        Args:
+            name: Entity identifier.
+
+        Returns:
+            The first matching entity, or None.
+        """
+        entities = self.get_entities_by_name(name)
+        return entities[0] if entities else None
+
+    def get_entity_by_tag(self, tag: str) -> Optional[LdtkEntity]:
+        """Get the first entity by tag.
+
+        Args:
+            tag: Tag string.
+
+        Returns:
+            The first matching entity, or None.
+        """
+        entities = self.get_entities_by_tag(tag)
+        return entities[0] if entities else None
+
+    def convert_to_pixels(self, point: IntPoint) -> Any:
+        """Convert grid point to pixels.
+
+        Args:
+            point: Grid point.
+
+        Returns:
+            Vector2 in pixels.
+        """
+        return v2(point.x * self.scale, point.y * self.scale)
+
+    def convert_cells_to_pixels(self, cell_point: IntPoint, layer: LayerInstance):
+        """Convert cell coordinates to pixels.
+
+        Args:
+            cell_point: Cell coordinates.
+            layer: Layer instance for cell size.
+
+        Returns:
+            Vector2 in pixels.
+        """
+        cell_size = float(layer.grid_size)
+        return v2(cell_point.x * cell_size * self.scale, cell_point.y * cell_size * self.scale)
+
+    def convert_to_meters(self, point: IntPoint):
+        """Convert grid point to meters.
+
+        Args:
+            point: Grid point.
+
+        Returns:
+            b2Vec2 in meters.
+        """
+        if not self.physics:
+            return b2Vec2(0.0, 0.0)
+        return self.physics.convert_to_meters(self.convert_to_pixels(point))
+
+    def convert_to_grid(self, pixels) -> IntPoint:
+        """Convert pixels to grid coordinates.
+
+        Args:
+            pixels: Vector2 in pixels.
+
+        Returns:
+            IntPoint grid coordinate.
+        """
+        return IntPoint(int(pixels.x / self.scale), int(pixels.y / self.scale))
+
+    def convert_to_grid_meters(self, meters) -> IntPoint:
+        """Convert meters to grid coordinates.
+
+        Args:
+            meters: b2Vec2 in meters.
+
+        Returns:
+            IntPoint grid coordinate.
+        """
+        if not self.physics:
+            return IntPoint(0, 0)
+        pixels = self.physics.convert_to_pixels(meters)
+        return IntPoint(int(pixels.x / self.scale), int(pixels.y / self.scale))
+
+    def get_size(self):
+        """Get level size in pixels.
+
+        Returns:
+            Vector2 containing level width and height in pixels.
+        """
+        if not self.level:
+            return v2(0.0, 0.0)
+        return v2(float(self.level.px_wid) * self.scale, float(self.level.px_hei) * self.scale)
diff --git a/py/engine/raycasts.py b/py/engine/raycasts.py
new file mode 100644
index 0000000..960a659
--- /dev/null
+++ b/py/engine/raycasts.py
@@ -0,0 +1,189 @@
+from __future__ import annotations
+
+from dataclasses import dataclass
+from typing import List, Optional
+
+from Box2D import (b2AABB, b2Body, b2CircleShape, b2PolygonShape, b2QueryCallback,
+                   b2RayCastCallback, b2Transform, b2Vec2, b2TestOverlap)
+
+
+@dataclass
+class RayHit:
+    """Raycast hit data.
+
+    Attributes:
+        hit: True if the ray hit something.
+        body: The body hit, if any.
+        fraction: Fraction along the ray where the hit occurred.
+        distance: Distance along the ray in world units.
+        point: World-space hit point.
+        normal: World-space hit normal.
+    """
+    hit: bool = False
+    body: Optional[b2Body] = None
+    fraction: float = 1.0
+    distance: float = 0.0
+    point: b2Vec2 = b2Vec2(0.0, 0.0)
+    normal: b2Vec2 = b2Vec2(0.0, 0.0)
+
+
+class _RayCastClosest(b2RayCastCallback):
+    def __init__(self, ignore_body: Optional[b2Body], translation: b2Vec2, result: RayHit) -> None:
+        super().__init__()
+        self.ignore_body = ignore_body
+        self.translation = translation
+        self.result = result
+
+    def ReportFixture(self, fixture, point, normal, fraction):  # noqa: N802
+        if self.ignore_body is not None and fixture.body == self.ignore_body:
+            return 1.0
+        if fraction < self.result.fraction:
+            self.result.hit = True
+            self.result.fraction = fraction
+            self.result.distance = self.translation.length * fraction
+            self.result.point = point
+            self.result.normal = normal
+            self.result.body = fixture.body
+        return fraction
+
+
+def raycast_closest(world, ignore_body: Optional[b2Body], origin: b2Vec2, translation: b2Vec2) -> RayHit:
+    """Cast a ray and return the closest hit.
+
+    Args:
+        world: Box2D world to query.
+        ignore_body: Optional body to ignore.
+        origin: Ray start in world units.
+        translation: Ray delta in world units.
+
+    Returns:
+        RayHit data for the closest hit (or empty hit if none).
+    """
+    result = RayHit()
+    callback = _RayCastClosest(ignore_body, translation, result)
+    world.RayCast(callback, origin, origin + translation)
+    return result
+
+
+def raycast_all(world, ignore_body: Optional[b2Body], origin: b2Vec2, translation: b2Vec2) -> List[RayHit]:
+    """Cast a ray and return all hits.
+
+    Args:
+        world: Box2D world to query.
+        ignore_body: Optional body to ignore.
+        origin: Ray start in world units.
+        translation: Ray delta in world units.
+
+    Returns:
+        List of RayHit results.
+    """
+    hits: List[RayHit] = []
+
+    class _RayCastAll(b2RayCastCallback):
+        def __init__(self, ignore: Optional[b2Body], translation_vec: b2Vec2) -> None:
+            super().__init__()
+            self.ignore = ignore
+            self.translation_vec = translation_vec
+
+        def ReportFixture(self, fixture, point, normal, fraction):  # noqa: N802
+            if self.ignore is not None and fixture.body == self.ignore:
+                return 1.0
+            hit = RayHit(True, fixture.body, fraction, self.translation_vec.length * fraction, point, normal)
+            hits.append(hit)
+            return fraction
+
+    world.RayCast(_RayCastAll(ignore_body, translation), origin, origin + translation)
+    return hits
+
+
+def _aabb_for_circle(center: b2Vec2, radius: float) -> b2AABB:
+    lower = b2Vec2(center.x - radius, center.y - radius)
+    upper = b2Vec2(center.x + radius, center.y + radius)
+    return b2AABB(lowerBound=lower, upperBound=upper)
+
+
+def _aabb_for_box(center: b2Vec2, half_w: float, half_h: float, angle: float) -> b2AABB:
+    # Conservative AABB for rotated box
+    import math
+
+    cos_a = abs(math.cos(angle))
+    sin_a = abs(math.sin(angle))
+    extent_x = half_w * cos_a + half_h * sin_a
+    extent_y = half_w * sin_a + half_h * cos_a
+    lower = b2Vec2(center.x - extent_x, center.y - extent_y)
+    upper = b2Vec2(center.x + extent_x, center.y + extent_y)
+    return b2AABB(lowerBound=lower, upperBound=upper)
+
+
+def shape_hit(world, ignore_body: Optional[b2Body], shape, transform: b2Transform) -> List[b2Body]:
+    """Query overlaps for a shape and return hit bodies.
+
+    Args:
+        world: Box2D world to query.
+        ignore_body: Optional body to ignore.
+        shape: Box2D shape to test.
+        transform: Transform for the shape.
+
+    Returns:
+        List of bodies overlapping the shape.
+    """
+    aabb = shape.getAABB(transform, 0)
+    hits: List[b2Body] = []
+
+    class _QueryCallback(b2QueryCallback):
+        def __init__(self, ignore: Optional[b2Body]) -> None:
+            super().__init__()
+            self.ignore = ignore
+
+        def ReportFixture(self, fixture):  # noqa: N802
+            body = fixture.body
+            if self.ignore is not None and body == self.ignore:
+                return True
+            if b2TestOverlap(shape, 0, fixture.shape, 0, transform, fixture.body.transform):
+                if body not in hits:
+                    hits.append(body)
+            return True
+
+    world.QueryAABB(_QueryCallback(ignore_body), aabb)
+    return hits
+
+
+def circle_hit(world, ignore_body: Optional[b2Body], center: b2Vec2, radius: float) -> List[b2Body]:
+    """Check for circle overlaps in the world.
+
+    Args:
+        world: Box2D world to query.
+        ignore_body: Optional body to ignore.
+        center: Circle center in world units.
+        radius: Circle radius in world units.
+
+    Returns:
+        List of bodies overlapping the circle.
+    """
+    shape = b2CircleShape(radius=radius, pos=b2Vec2(0.0, 0.0))
+    transform = b2Transform()
+    transform.position = center
+    transform.angle = 0.0
+    return shape_hit(world, ignore_body, shape, transform)
+
+
+def rectangle_hit(world, ignore_body: Optional[b2Body], center: b2Vec2, size: b2Vec2, rotation: float = 0.0) -> List[b2Body]:
+    """Check for rectangle overlaps in the world.
+
+    Args:
+        world: Box2D world to query.
+        ignore_body: Optional body to ignore.
+        center: Rectangle center in world units.
+        size: Rectangle size in world units.
+        rotation: Rotation in radians.
+
+    Returns:
+        List of bodies overlapping the rectangle.
+    """
+    half_w = size.x / 2.0
+    half_h = size.y / 2.0
+    shape = b2PolygonShape(box=(half_w, half_h))
+    transform = b2Transform()
+    transform.position = center
+    transform.angle = rotation
+    return shape_hit(world, ignore_body, shape, transform)
diff --git a/py/main.py b/py/main.py
new file mode 100644
index 0000000..c510bb2
--- /dev/null
+++ b/py/main.py
@@ -0,0 +1,39 @@
+import pyray as rl
+
+from engine.framework import Game
+from engine.prefabs.managers import FontManager, WindowManager
+from samples.collecting_game import CollectingScene
+from samples.fighting_game import FightingScene
+from samples.zombie_game import ZombieScene
+from samples.title_screen import TitleScreen
+
+
+game = Game()
+
+
+def update() -> None:
+    delta_time = rl.get_frame_time()
+    game.update(delta_time)
+
+
+def main() -> int:
+    game.add_manager(WindowManager, 1280, 720, "Game Jam Kit")
+    font_manager = game.add_manager(FontManager)
+    game.init()
+
+    font_manager.load_font("Roboto", "assets/fonts/Roboto.ttf", 64)
+    font_manager.load_font("Tiny5", "assets/fonts/Tiny5.ttf", 64)
+    font_manager.set_texture_filter("Roboto", 4)
+
+    game.add_scene("title", TitleScreen)
+    game.add_scene("fighting", FightingScene)
+    game.add_scene("collecting", CollectingScene)
+    game.add_scene("zombie", ZombieScene)
+
+    while not rl.window_should_close():
+        update()
+    return 0
+
+
+if __name__ == "__main__":
+    raise SystemExit(main())
diff --git a/py/requirements.txt b/py/requirements.txt
new file mode 100644
index 0000000..0c37b71
--- /dev/null
+++ b/py/requirements.txt
@@ -0,0 +1,2 @@
+raylib
+Box2D
diff --git a/py/samples/__init__.py b/py/samples/__init__.py
new file mode 100644
index 0000000..8b13789
--- /dev/null
+++ b/py/samples/__init__.py
@@ -0,0 +1 @@
+
diff --git a/py/samples/__pycache__/__init__.cpython-313.pyc b/py/samples/__pycache__/__init__.cpython-313.pyc
new file mode 100644
index 0000000..0e6372c
Binary files /dev/null and b/py/samples/__pycache__/__init__.cpython-313.pyc differ
diff --git a/py/samples/__pycache__/collecting_game.cpython-313.pyc b/py/samples/__pycache__/collecting_game.cpython-313.pyc
new file mode 100644
index 0000000..75ffe96
Binary files /dev/null and b/py/samples/__pycache__/collecting_game.cpython-313.pyc differ
diff --git a/py/samples/__pycache__/fighting_game.cpython-313.pyc b/py/samples/__pycache__/fighting_game.cpython-313.pyc
new file mode 100644
index 0000000..50df3b2
Binary files /dev/null and b/py/samples/__pycache__/fighting_game.cpython-313.pyc differ
diff --git a/py/samples/__pycache__/title_screen.cpython-313.pyc b/py/samples/__pycache__/title_screen.cpython-313.pyc
new file mode 100644
index 0000000..79bd742
Binary files /dev/null and b/py/samples/__pycache__/title_screen.cpython-313.pyc differ
diff --git a/py/samples/__pycache__/zombie_game.cpython-313.pyc b/py/samples/__pycache__/zombie_game.cpython-313.pyc
new file mode 100644
index 0000000..2fe831c
Binary files /dev/null and b/py/samples/__pycache__/zombie_game.cpython-313.pyc differ
diff --git a/py/samples/collecting_game.py b/py/samples/collecting_game.py
new file mode 100644
index 0000000..24f3518
--- /dev/null
+++ b/py/samples/collecting_game.py
@@ -0,0 +1,495 @@
+"""Demonstration of split screen cameras and sensor-based item collection."""
+
+from __future__ import annotations
+
+import math
+from typing import List
+
+from Box2D import b2CircleShape, b2PolygonShape
+import pyray as rl
+
+from engine.framework import GameObject, Scene
+from engine.math_extensions import vec_div, vec_mul, vec_normalize, vec_sub, v2
+from engine.prefabs.components import (AnimationController, BodyComponent, MultiComponent,
+                                       PlatformerMovementComponent, PlatformerMovementParams,
+                                       SoundComponent)
+from engine.prefabs.game_objects import CharacterParams, SplitCamera
+from engine.prefabs.managers import FontManager, WindowManager
+from engine.prefabs.services import LevelService, PhysicsService, SoundService, TextureService
+
+
+class CollectingCharacter(GameObject):
+    """Basic collecting character.
+
+    Shows how to build a physics body, route input into a movement
+component, and drive animations/sounds from gameplay events."""
+    def __init__(self, params: CharacterParams, player_number: int = 1) -> None:
+        """Create a player-controlled collector.
+
+        Args:
+            params: Character sizing and physics parameters.
+            player_number: 1-based index used to map input/skins.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.p = params
+        self.player_number = player_number
+        self.gamepad = player_number - 1
+        self.width = params.width
+        self.height = params.height
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.level: LevelService = None  # type: ignore[assignment]
+        self.body: BodyComponent = None  # type: ignore[assignment]
+        self.movement: PlatformerMovementComponent = None  # type: ignore[assignment]
+        self.animation: AnimationController = None  # type: ignore[assignment]
+        self.sounds: MultiComponent = None  # type: ignore[assignment]
+        self.jump_sound: SoundComponent = None  # type: ignore[assignment]
+        self.die_sound: SoundComponent = None  # type: ignore[assignment]
+        self.score = 0
+
+    def init(self) -> None:
+        """Initialize physics, movement, sounds, and animations.
+
+        Services are resolved here (not during update) so missing services are
+        discovered early and per-frame overhead is avoided.
+
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+
+            Args:
+                component: Parameter.
+
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateDynamicBody(position=(self.physics.convert_to_meters(self.p.position).x,
+                                                     self.physics.convert_to_meters(self.p.position).y),
+                                           fixedRotation=True,
+                                           bullet=True)
+            body.userData = self
+            shape = b2PolygonShape(box=(self.physics.convert_length_to_meters(self.p.width / 2.0),
+                                        self.physics.convert_length_to_meters(self.p.height / 2.0)))
+            body.CreateFixture(shape=shape, density=self.p.density, friction=self.p.friction,
+                               restitution=self.p.restitution)
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+
+        movement_params = PlatformerMovementParams()
+        movement_params.width = self.p.width
+        movement_params.height = self.p.height
+        self.movement = self.add_component(PlatformerMovementComponent(movement_params))
+
+        self.level = self.scene.get_service(LevelService)
+
+        self.sounds = self.add_component(MultiComponent())
+        self.jump_sound = self.sounds.add_component("jump", SoundComponent, "assets/sounds/jump.wav")
+        self.die_sound = self.sounds.add_component("die", SoundComponent, "assets/sounds/die.wav")
+
+        self.animation = self.add_component(AnimationController(self.body))
+        if self.player_number == 1:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/pixel_platformer/characters/green_1.png",
+                                                    "assets/pixel_platformer/characters/green_2.png"],
+                                                   10.0)
+        elif self.player_number == 2:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/pixel_platformer/characters/blue_1.png",
+                                                    "assets/pixel_platformer/characters/blue_2.png"],
+                                                   10.0)
+        elif self.player_number == 3:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/pixel_platformer/characters/pink_1.png",
+                                                    "assets/pixel_platformer/characters/pink_2.png"],
+                                                   10.0)
+        elif self.player_number == 4:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/pixel_platformer/characters/yellow_1.png",
+                                                    "assets/pixel_platformer/characters/yellow_2.png"],
+                                                   10.0)
+
+    def update(self, delta_time: float) -> None:
+        """Handle input and drive movement/animation.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        deadzone = 0.1
+        jump_pressed = rl.is_key_pressed(rl.KEY_W) or rl.is_gamepad_button_pressed(self.gamepad, rl.GAMEPAD_BUTTON_RIGHT_FACE_DOWN)
+        jump_held = rl.is_key_down(rl.KEY_W) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_RIGHT_FACE_DOWN)
+
+        move_x = rl.get_gamepad_axis_movement(self.gamepad, rl.GAMEPAD_AXIS_LEFT_X)
+        if abs(move_x) < deadzone:
+            move_x = 0.0
+        if rl.is_key_down(rl.KEY_D) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_LEFT_FACE_RIGHT):
+            move_x = 1.0
+        elif rl.is_key_down(rl.KEY_A) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_LEFT_FACE_LEFT):
+            move_x = -1.0
+
+        self.movement.set_input(move_x, jump_pressed, jump_held)
+        if self.movement.grounded and jump_pressed:
+            self.jump_sound.play()
+
+        if abs(self.movement.move_x) > 0.1:
+            self.animation.play("run")
+            self.animation.flip_x = self.movement.move_x > 0.0
+        else:
+            self.animation.pause()
+
+    def die(self) -> None:
+        """Respawn the character at the start position.
+
+        Returns:
+            None
+        """
+        self.body.set_position(self.p.position)
+        self.body.set_velocity(v2(0.0, 0.0))
+        self.die_sound.play()
+
+
+class EnemyType:
+    Bat = 0
+    DrillHead = 1
+    BlockHead = 2
+
+
+class Enemy(GameObject):
+    """Enemy that patrols between two points using a kinematic body."""
+    def __init__(self, enemy_type: int, start: rl.Vector2, end: rl.Vector2) -> None:
+        """Configure the patrol endpoints and enemy type.
+
+        Args:
+            enemy_type: EnemyType constant selecting animation and behavior.
+            start: Starting world position in pixels.
+            end: Ending world position in pixels.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.start = start
+        self.end = end
+        self.type = enemy_type
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.body: BodyComponent = None  # type: ignore[assignment]
+        self.animation: AnimationController = None  # type: ignore[assignment]
+        self.radius = 12.0
+
+    def init_object(self) -> None:
+        """Create a sensor body, setup animation, and start movement.
+
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+
+            Args:
+                component: Parameter.
+
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateKinematicBody(position=(self.physics.convert_to_meters(self.start).x,
+                                                       self.physics.convert_to_meters(self.start).y))
+            body.userData = self
+            shape = b2CircleShape(radius=self.physics.convert_length_to_meters(self.radius))
+            body.CreateFixture(shape=shape, density=1.0, isSensor=True)
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+
+        self.animation = self.add_component(AnimationController(self.body))
+        if self.type == EnemyType.Bat:
+            self.animation.add_animation_from_files("move",
+                                                   ["assets/pixel_platformer/enemies/bat_1.png",
+                                                    "assets/pixel_platformer/enemies/bat_2.png",
+                                                    "assets/pixel_platformer/enemies/bat_3.png"],
+                                                   5.0)
+        elif self.type == EnemyType.DrillHead:
+            self.animation.add_animation_from_files("move",
+                                                   ["assets/pixel_platformer/enemies/drill_head_1.png",
+                                                    "assets/pixel_platformer/enemies/drill_head_2.png"],
+                                                   5.0)
+        elif self.type == EnemyType.BlockHead:
+            self.animation.add_animation_from_files("move",
+                                                   ["assets/pixel_platformer/enemies/block_head_1.png",
+                                                    "assets/pixel_platformer/enemies/block_head_2.png"],
+                                                   5.0)
+        self.animation.play("move")
+
+        super().init_object()
+
+        to_end = vec_normalize(vec_sub(self.end, self.body.get_position_pixels()))
+        self.body.set_velocity(vec_mul(to_end, 50.0))
+
+    def update(self, delta_time: float) -> None:
+        """Move between endpoints and detect sensor hits on players.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        pos = self.body.get_position_pixels()
+        if math.dist((self.end.x, self.end.y), (pos.x, pos.y)) <= self.radius * 2.0:
+            to_start = vec_normalize(vec_sub(self.start, pos))
+            self.body.set_velocity(vec_mul(to_start, 50.0))
+        elif math.dist((self.start.x, self.start.y), (pos.x, pos.y)) <= self.radius * 2.0:
+            to_end = vec_normalize(vec_sub(self.end, pos))
+            self.body.set_velocity(vec_mul(to_end, 50.0))
+
+        for contact_body in self.body.get_sensor_overlaps():
+            user_data = contact_body.userData
+            if user_data and user_data.has_tag("character"):
+                user_data.die()
+
+        velocity = self.body.get_velocity_pixels()
+        self.animation.flip_x = velocity.x > 0.0
+
+
+class Coin(GameObject):
+    """Collectible coin using a sensor body."""
+    def __init__(self, position: rl.Vector2) -> None:
+        """Store the coin spawn position.
+
+        Args:
+            position: World position in pixels.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.position = position
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.body: BodyComponent = None  # type: ignore[assignment]
+        self.animation: AnimationController = None  # type: ignore[assignment]
+        self.collect_sound: SoundComponent = None  # type: ignore[assignment]
+
+    def init(self) -> None:
+        """Create the sensor body, animation, and pickup sound.
+
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+
+            Args:
+                component: Parameter.
+
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateStaticBody(position=(self.physics.convert_to_meters(self.position).x,
+                                                    self.physics.convert_to_meters(self.position).y))
+            body.userData = self
+            shape = b2CircleShape(radius=self.physics.convert_length_to_meters(8.0))
+            body.CreateFixture(shape=shape, density=1.0, isSensor=True)
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+        self.animation = self.add_component(AnimationController(self.body))
+        self.animation.add_animation_from_files("spin",
+                                               ["assets/pixel_platformer/items/coin_1.png",
+                                                "assets/pixel_platformer/items/coin_2.png"],
+                                               5.0)
+        self.animation.play("spin")
+        self.collect_sound = self.add_component(SoundComponent("assets/sounds/coin.wav"))
+
+    def update(self, delta_time: float) -> None:
+        """Check sensor overlaps and award score on pickup.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        for contact_body in self.body.get_sensor_overlaps():
+            user_data = contact_body.userData
+            if user_data and user_data.has_tag("character"):
+                self.collect_sound.play()
+                self.is_active = False
+                self.body.disable()
+                user_data.score += 1
+                break
+
+
+class CollectingScene(Scene):
+    """Scene demonstrating split-screen cameras and collectible items."""
+    def __init__(self) -> None:
+        """Set up scene containers and cached services.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.window_manager: WindowManager = None  # type: ignore[assignment]
+        self.font_manager: FontManager = None  # type: ignore[assignment]
+        self.characters: List[CollectingCharacter] = []
+        self.level: LevelService = None  # type: ignore[assignment]
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.cameras: List[SplitCamera] = []
+        self.screen_size = v2(0.0, 0.0)
+        self.scale = 2.5
+
+    def init_services(self) -> None:
+        """Register services required by the scene.
+
+        Returns:
+            None
+        """
+        self.add_service(TextureService)
+        self.add_service(SoundService)
+        self.physics = self.add_service(PhysicsService)
+        collision_names = ["walls", "clouds", "trees"]
+        self.level = self.add_service(LevelService, "assets/levels/collecting.ldtk", "Level", collision_names)
+
+    def init(self) -> None:
+        """Create characters, enemies, coins, and cameras.
+
+        Returns:
+            None
+        """
+        self.window_manager = self.game.get_manager(WindowManager)
+        self.font_manager = self.game.get_manager(FontManager)
+
+        entities_layer = self.level.get_layer_by_name("Entities")
+        player_entities = self.level.get_entities_by_name("Start")
+        for i, player_entity in enumerate(player_entities[:4]):
+            params = CharacterParams()
+            params.position = self.level.convert_to_pixels(player_entity.getPosition())
+            params.width = 16
+            params.height = 24
+            character = self.add_game_object(CollectingCharacter(params, i + 1))
+            character.add_tag("character")
+            self.characters.append(character)
+
+        for bat_entity in self.level.get_entities_by_name("Bat"):
+            start_pos = self.level.convert_to_pixels(bat_entity.getPosition())
+            end_point = bat_entity.getField("end")
+            end_pos = self.level.convert_cells_to_pixels(end_point, entities_layer)
+            enemy = self.add_game_object(Enemy(EnemyType.Bat, start_pos, end_pos))
+            enemy.add_tag("enemy")
+
+        for drill_entity in self.level.get_entities_by_name("DrillHead"):
+            start_pos = self.level.convert_to_pixels(drill_entity.getPosition())
+            end_point = drill_entity.getField("end")
+            end_pos = self.level.convert_cells_to_pixels(end_point, entities_layer)
+            enemy = self.add_game_object(Enemy(EnemyType.DrillHead, start_pos, end_pos))
+            enemy.add_tag("enemy")
+
+        for block_entity in self.level.get_entities_by_name("BlockHead"):
+            start_pos = self.level.convert_to_pixels(block_entity.getPosition())
+            end_point = block_entity.getField("end")
+            end_pos = self.level.convert_cells_to_pixels(end_point, entities_layer)
+            enemy = self.add_game_object(Enemy(EnemyType.BlockHead, start_pos, end_pos))
+            enemy.add_tag("enemy")
+
+        for coin_entity in self.level.get_entities_by_name("Coin"):
+            coin_pos = self.level.convert_to_pixels(coin_entity.getPosition())
+            coin = self.add_game_object(Coin(coin_pos))
+            coin.add_tag("coin")
+
+        self.screen_size = v2(self.window_manager.get_width(), self.window_manager.get_height())
+        for _ in self.characters:
+            cam = self.add_game_object(SplitCamera(vec_div(self.screen_size, self.scale), self.level.get_size()))
+            self.cameras.append(cam)
+
+    def update(self, delta_time: float) -> None:
+        """Update camera targets and handle window resizing.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        for idx, camera in enumerate(self.cameras):
+            camera.target = self.characters[idx].body.get_position_pixels()
+
+        new_screen_size = v2(float(rl.get_screen_width()), float(rl.get_screen_height()))
+        if new_screen_size.x != self.screen_size.x or new_screen_size.y != self.screen_size.y:
+            self.screen_size = new_screen_size
+            screen_scale = self.window_manager.get_width() / self.screen_size.x
+            for camera in self.cameras:
+                camera.size = vec_mul(vec_div(self.screen_size, self.scale), screen_scale)
+                camera.camera.offset = v2(camera.size.x / 2.0, camera.size.y / 2.0)
+                if camera.renderer:
+                    rl.unload_render_texture(camera.renderer)
+                camera.renderer = rl.load_render_texture(int(camera.size.x), int(camera.size.y))
+
+        # Trigger scene change on Enter key or gamepad start button.
+        if rl.is_key_pressed(rl.KEY_ENTER) or rl.is_gamepad_button_pressed(0, rl.GAMEPAD_BUTTON_MIDDLE_RIGHT):
+            self.game.go_to_scene_next()
+
+    def draw_scene(self) -> None:
+        """Render the scene once per camera and composite the split view.
+
+        Returns:
+            None
+        """
+        for camera in self.cameras:
+            camera.draw_begin()
+            super().draw_scene()
+            camera.draw_end()
+
+        rl.clear_background(rl.MAGENTA)
+        for i, camera in enumerate(self.cameras):
+            if i == 0:
+                camera.draw_texture_pro(0, 0, self.screen_size.x / 2.0, self.screen_size.y / 2.0)
+                rl.draw_text_ex(self.font_manager.get_font("Tiny5"),
+                           f"Score: {self.characters[0].score}",
+                           v2(20.0, 20.0),
+                           40.0,
+                           2.0,
+                           rl.BLACK)
+            elif i == 1:
+                camera.draw_texture_pro(self.screen_size.x / 2.0, 0, self.screen_size.x / 2.0, self.screen_size.y / 2.0)
+                rl.draw_text_ex(self.font_manager.get_font("Tiny5"),
+                           f"Score: {self.characters[1].score}",
+                           v2(self.screen_size.x / 2.0 + 20.0, 20.0),
+                           40.0,
+                           2.0,
+                           rl.BLACK)
+            elif i == 2:
+                camera.draw_texture_pro(0, self.screen_size.y / 2.0, self.screen_size.x / 2.0, self.screen_size.y / 2.0)
+                rl.draw_text_ex(self.font_manager.get_font("Tiny5"),
+                           f"Score: {self.characters[2].score}",
+                           v2(20.0, self.screen_size.y / 2.0 + 20.0),
+                           40.0,
+                           2.0,
+                           rl.BLACK)
+            elif i == 3:
+                camera.draw_texture_pro(self.screen_size.x / 2.0,
+                                        self.screen_size.y / 2.0,
+                                        self.screen_size.x / 2.0,
+                                        self.screen_size.y / 2.0)
+                rl.draw_text_ex(self.font_manager.get_font("Tiny5"),
+                           f"Score: {self.characters[3].score}",
+                           v2(self.screen_size.x / 2.0 + 20.0, self.screen_size.y / 2.0 + 20.0),
+                           40.0,
+                           2.0,
+                           rl.BLACK)
+
+        rl.draw_line_ex(v2(self.screen_size.x / 2.0, 0), v2(self.screen_size.x / 2.0, self.screen_size.y), 4.0, rl.Color(130, 130, 130, 255))
+        rl.draw_line_ex(v2(0, self.screen_size.y / 2.0), v2(self.screen_size.x, self.screen_size.y / 2.0), 4.0, rl.Color(130, 130, 130, 255))
diff --git a/py/samples/fighting_game.py b/py/samples/fighting_game.py
new file mode 100644
index 0000000..cda1d19
--- /dev/null
+++ b/py/samples/fighting_game.py
@@ -0,0 +1,452 @@
+"""Demonstration of a shared camera and basic fighting mechanics.
+
+Shows LDtk level setup, one-way platforms, and simple combat interactions."""
+
+from __future__ import annotations
+
+import math
+from typing import List
+
+from Box2D import b2ContactListener, b2PolygonShape, b2Vec2
+import pyray as rl
+
+from engine.framework import GameObject, Scene
+from engine.math_extensions import vec_add, vec_div, vec_mul, vec_sub, v2
+from engine.prefabs.components import (AnimationController, BodyComponent, MultiComponent,
+                                       PlatformerMovementComponent, PlatformerMovementParams,
+                                       SoundComponent)
+from engine.prefabs.game_objects import CameraObject, CharacterParams, StaticBox
+from engine.prefabs.services import LevelService, PhysicsService, SoundService, TextureService
+
+
+class FightingCharacter(GameObject):
+    """Basic fighting character with attacks and one-way platform logic."""
+    def __init__(self, params: CharacterParams, player_number: int = 1) -> None:
+        """Create a player-controlled fighter.
+
+        Args:
+            params: Character sizing and physics parameters.
+            player_number: 1-based index used to map input/skins.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.p = params
+        self.player_number = player_number
+        self.gamepad = player_number - 1
+        self.width = params.width
+        self.height = params.height
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.level: LevelService = None  # type: ignore[assignment]
+        self.body: BodyComponent = None  # type: ignore[assignment]
+        self.movement: PlatformerMovementComponent = None  # type: ignore[assignment]
+        self.animation: AnimationController = None  # type: ignore[assignment]
+        self.sounds: MultiComponent = None  # type: ignore[assignment]
+        self.jump_sound: SoundComponent = None  # type: ignore[assignment]
+        self.hit_sound: SoundComponent = None  # type: ignore[assignment]
+        self.die_sound: SoundComponent = None  # type: ignore[assignment]
+        self.fall_through = False
+        self.fall_through_timer = 0.0
+        self.fall_through_duration = 0.2
+        self.attack_display_timer = 0.0
+        self.attack_display_duration = 0.1
+        self.attack = False
+
+    def init(self) -> None:
+        """Initialize body, movement, sounds, and animations.
+
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+
+            Args:
+                component: Parameter.
+
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateDynamicBody(position=(self.physics.convert_to_meters(self.p.position).x,
+                                                     self.physics.convert_to_meters(self.p.position).y),
+                                           fixedRotation=True,
+                                           bullet=True)
+            shape = b2PolygonShape(box=(self.physics.convert_length_to_meters(self.p.width / 2.0),
+                                        self.physics.convert_length_to_meters(self.p.height / 2.0)))
+            body.CreateFixture(shape=shape, density=self.p.density, friction=self.p.friction,
+                               restitution=self.p.restitution)
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+
+        movement_params = PlatformerMovementParams()
+        movement_params.width = self.p.width
+        movement_params.height = self.p.height
+        self.movement = self.add_component(PlatformerMovementComponent(movement_params))
+
+        self.level = self.scene.get_service(LevelService)
+
+        self.sounds = self.add_component(MultiComponent())
+        self.jump_sound = self.sounds.add_component("jump", SoundComponent, "assets/sounds/jump.wav")
+        self.hit_sound = self.sounds.add_component("hit", SoundComponent, "assets/sounds/hit.wav")
+        self.die_sound = self.sounds.add_component("die", SoundComponent, "assets/sounds/die.wav")
+
+        self.animation = self.add_component(AnimationController(self.body))
+        if self.player_number == 1:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/sunnyland/fox/run-1.png",
+                                                    "assets/sunnyland/fox/run-2.png",
+                                                    "assets/sunnyland/fox/run-3.png",
+                                                    "assets/sunnyland/fox/run-4.png",
+                                                    "assets/sunnyland/fox/run-5.png",
+                                                    "assets/sunnyland/fox/run-6.png"],
+                                                   10.0)
+            self.animation.add_animation_from_files("idle",
+                                                   ["assets/sunnyland/fox/idle-1.png",
+                                                    "assets/sunnyland/fox/idle-2.png",
+                                                    "assets/sunnyland/fox/idle-3.png",
+                                                    "assets/sunnyland/fox/idle-4.png"],
+                                                   5.0)
+            self.animation.add_animation_from_files("jump", ["assets/sunnyland/fox/jump-1.png"], 0.0)
+            self.animation.add_animation_from_files("fall", ["assets/sunnyland/fox/jump-2.png"], 0.0)
+            self.animation.origin.y += 4
+        elif self.player_number == 2:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/sunnyland/bunny/run-1.png",
+                                                    "assets/sunnyland/bunny/run-2.png",
+                                                    "assets/sunnyland/bunny/run-3.png",
+                                                    "assets/sunnyland/bunny/run-4.png",
+                                                    "assets/sunnyland/bunny/run-5.png",
+                                                    "assets/sunnyland/bunny/run-6.png"],
+                                                   10.0)
+            self.animation.add_animation_from_files("idle",
+                                                   ["assets/sunnyland/bunny/idle-1.png",
+                                                    "assets/sunnyland/bunny/idle-2.png",
+                                                    "assets/sunnyland/bunny/idle-3.png",
+                                                    "assets/sunnyland/bunny/idle-4.png"],
+                                                   10.0)
+            self.animation.add_animation_from_files("jump", ["assets/sunnyland/bunny/jump-1.png"], 0.0)
+            self.animation.add_animation_from_files("fall", ["assets/sunnyland/bunny/jump-2.png"], 0.0)
+            self.animation.origin.y += 8
+        elif self.player_number == 3:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/sunnyland/squirrel/run-1.png",
+                                                    "assets/sunnyland/squirrel/run-2.png",
+                                                    "assets/sunnyland/squirrel/run-3.png",
+                                                    "assets/sunnyland/squirrel/run-4.png",
+                                                    "assets/sunnyland/squirrel/run-5.png",
+                                                    "assets/sunnyland/squirrel/run-6.png"],
+                                                   10.0)
+            self.animation.add_animation_from_files("idle",
+                                                   ["assets/sunnyland/squirrel/idle-1.png",
+                                                    "assets/sunnyland/squirrel/idle-2.png",
+                                                    "assets/sunnyland/squirrel/idle-3.png",
+                                                    "assets/sunnyland/squirrel/idle-4.png",
+                                                    "assets/sunnyland/squirrel/idle-5.png",
+                                                    "assets/sunnyland/squirrel/idle-6.png",
+                                                    "assets/sunnyland/squirrel/idle-7.png",
+                                                    "assets/sunnyland/squirrel/idle-8.png"],
+                                                   8.0)
+            self.animation.add_animation_from_files("jump",
+                                                   ["assets/sunnyland/squirrel/jump-1.png",
+                                                    "assets/sunnyland/squirrel/jump-2.png",
+                                                    "assets/sunnyland/squirrel/jump-3.png",
+                                                    "assets/sunnyland/squirrel/jump-4.png"],
+                                                   15.0)
+            self.animation.origin.y += 7
+        elif self.player_number == 4:
+            self.animation.add_animation_from_files("run",
+                                                   ["assets/sunnyland/imp/run-1.png",
+                                                    "assets/sunnyland/imp/run-2.png",
+                                                    "assets/sunnyland/imp/run-3.png",
+                                                    "assets/sunnyland/imp/run-4.png",
+                                                    "assets/sunnyland/imp/run-5.png",
+                                                    "assets/sunnyland/imp/run-6.png",
+                                                    "assets/sunnyland/imp/run-7.png",
+                                                    "assets/sunnyland/imp/run-8.png"],
+                                                   10.0)
+            self.animation.add_animation_from_files("idle",
+                                                   ["assets/sunnyland/imp/idle-1.png",
+                                                    "assets/sunnyland/imp/idle-2.png",
+                                                    "assets/sunnyland/imp/idle-3.png",
+                                                    "assets/sunnyland/imp/idle-4.png"],
+                                                   10.0)
+            self.animation.add_animation_from_files("jump", ["assets/sunnyland/imp/jump-1.png"], 0.0)
+            self.animation.add_animation_from_files("fall", ["assets/sunnyland/imp/jump-4.png"], 0.0)
+            self.animation.origin.y += 10
+
+    def update(self, delta_time: float) -> None:
+        """Handle input, jumping, attacks, and respawn logic.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        deadzone = 0.1
+        jump_pressed = rl.is_key_pressed(rl.KEY_W) or rl.is_gamepad_button_pressed(self.gamepad, rl.GAMEPAD_BUTTON_RIGHT_FACE_DOWN)
+        jump_held = rl.is_key_down(rl.KEY_W) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_RIGHT_FACE_DOWN)
+
+        move_x = rl.get_gamepad_axis_movement(self.gamepad, rl.GAMEPAD_AXIS_LEFT_X)
+        if abs(move_x) < deadzone:
+            move_x = 0.0
+        if rl.is_key_down(rl.KEY_D) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_LEFT_FACE_RIGHT):
+            move_x = 1.0
+        elif rl.is_key_down(rl.KEY_A) or rl.is_gamepad_button_down(self.gamepad, rl.GAMEPAD_BUTTON_LEFT_FACE_LEFT):
+            move_x = -1.0
+
+        self.movement.set_input(move_x, jump_pressed, jump_held)
+
+        if self.movement.grounded and jump_pressed:
+            self.jump_sound.play()
+
+        if abs(self.movement.move_x) > 0.1:
+            self.animation.play("run")
+            self.animation.flip_x = self.movement.move_x < 0.0
+        else:
+            self.animation.play("idle")
+
+        if not self.movement.grounded:
+            if self.player_number != 3:
+                if self.body.get_velocity_meters().y < 0.0:
+                    self.animation.play("jump")
+                else:
+                    self.animation.play("fall")
+            else:
+                self.animation.play("jump")
+
+        move_y = rl.get_gamepad_axis_movement(self.gamepad, rl.GAMEPAD_AXIS_LEFT_Y)
+        if rl.is_key_pressed(rl.KEY_S) or rl.is_gamepad_button_pressed(self.gamepad, rl.GAMEPAD_BUTTON_LEFT_FACE_DOWN) or move_y > 0.5:
+            self.fall_through = True
+            self.fall_through_timer = self.fall_through_duration
+
+        if self.fall_through_timer > 0.0:
+            self.fall_through_timer = max(0.0, self.fall_through_timer - delta_time)
+            if self.fall_through_timer == 0.0:
+                self.fall_through = False
+
+        if rl.is_key_pressed(rl.KEY_SPACE) or rl.is_gamepad_button_pressed(self.gamepad, rl.GAMEPAD_BUTTON_RIGHT_FACE_RIGHT):
+            self.attack = True
+            self.attack_display_timer = self.attack_display_duration
+            position = self.body.get_position_pixels()
+            position.x += (self.width / 2.0 + 8.0) * (-1.0 if self.animation.flip_x else 1.0)
+            bodies = self.physics.circle_overlap(position, 8.0, self.body.body)
+            for other_body in bodies:
+                if other_body == self.body.body:
+                    continue
+                impulse = b2Vec2(-10.0 if self.animation.flip_x else 10.0, -10.0)
+                other_body.ApplyLinearImpulse(impulse=impulse, point=other_body.worldCenter, wake=True)
+                self.hit_sound.play()
+
+        if self.attack_display_timer > 0.0:
+            self.attack_display_timer = max(0.0, self.attack_display_timer - delta_time)
+            if self.attack_display_timer == 0.0:
+                self.attack = False
+
+        if self.body.get_position_pixels().y > self.level.get_size().y + 200.0:
+            self.body.set_position(self.p.position)
+            self.body.set_velocity(v2(0.0, 0.0))
+            self.die_sound.play()
+
+    def draw(self) -> None:
+        """Draw attack indicator (animations are drawn by controller).
+
+        Returns:
+            None
+        """
+        if self.attack:
+            position = self.body.get_position_pixels()
+            position.x += (self.width / 2.0 + 8.0) * (-1.0 if self.animation.flip_x else 1.0)
+            rl.draw_circle_v(position, 8.0, rl.Color(230, 41, 55, 128))
+
+    def pre_solve(self, body_a, body_b, contact, platforms: List[StaticBox]) -> bool:
+        """Custom pre-solve for one-way platforms.
+
+        Args:
+            body_a: First body in the contact.
+            body_b: Second body in the contact.
+            contact: Box2D contact instance.
+            platforms: List of one-way platform StaticBox objects.
+
+        Returns:
+            True to enable contact, False to disable it.
+        """
+        normal = contact.worldManifold.normal
+        other = None
+        sign = 0.0
+        if body_a == self.body.body:
+            sign = 1.0
+            other = body_b
+        elif body_b == self.body.body:
+            sign = -1.0
+            other = body_a
+        if sign * normal.y < 0.5:
+            return False
+        if self.fall_through:
+            for platform in platforms:
+                if other == platform.body:
+                    return False
+        return True
+
+
+class FightingContactListener(b2ContactListener):
+    """Routes Box2D PreSolve callbacks to the owning character."""
+    def __init__(self, scene: "FightingScene") -> None:
+        """Capture the scene so contacts can be filtered.
+
+        Args:
+            scene: Scene containing fighters and one-way platforms.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.scene = scene
+
+    def PreSolve(self, contact, old_manifold):
+        """Dispatch pre-solve handling to the matching character.
+
+        Args:
+            contact: Box2D contact.
+            old_manifold: Previous contact manifold.
+
+        Returns:
+            None
+        """
+        body_a = contact.fixtureA.body
+        body_b = contact.fixtureB.body
+        for character in self.scene.characters:
+            if body_a == character.body.body or body_b == character.body.body:
+                enabled = character.pre_solve(body_a, body_b, contact, self.scene.platforms)
+                contact.enabled = enabled
+                return
+
+
+class FightingScene(Scene):
+    """Scene demonstrating shared camera and arena combat."""
+    def __init__(self) -> None:
+        """Initialize scene storage for platforms, fighters, and services.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.platforms: List[StaticBox] = []
+        self.characters: List[FightingCharacter] = []
+        self.level: LevelService = None  # type: ignore[assignment]
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.camera: CameraObject = None  # type: ignore[assignment]
+        self.renderer = None
+        self.render_rect = None
+
+    def init_services(self) -> None:
+        """Register services required by the scene.
+
+        Returns:
+            None
+        """
+        self.add_service(TextureService)
+        self.add_service(SoundService)
+        self.physics = self.add_service(PhysicsService)
+        collision_names = ["walls"]
+        self.level = self.add_service(LevelService, "assets/levels/fighting.ldtk", "Stage", collision_names)
+
+    def init(self) -> None:
+        """Create platforms, players, camera, and render target.
+
+        Returns:
+            None
+        """
+        platform_entities = self.level.get_entities_by_name("One_way_platform")
+        for platform_entity in platform_entities:
+            position = self.level.convert_to_pixels(platform_entity.getPosition())
+            size = self.level.convert_to_pixels(platform_entity.getSize())
+            platform = self.add_game_object(StaticBox.from_vectors(vec_add(position, vec_div(size, 2.0)), size))
+            platform.is_visible = False
+            platform.add_tag("platform")
+            self.platforms.append(platform)
+
+        if self.physics.world:
+            self.physics.world.contactListener = FightingContactListener(self)
+
+        player_entities = self.level.get_entities_by_name("Start")
+        for i, player_entity in enumerate(player_entities[:4]):
+            params = CharacterParams()
+            params.position = self.level.convert_to_pixels(player_entity.getPosition())
+            params.width = 16
+            params.height = 24
+            character = self.add_game_object(FightingCharacter(params, i + 1))
+            character.add_tag("character")
+            self.characters.append(character)
+
+        self.camera = self.add_game_object(CameraObject(self.level.get_size(), v2(0.0, 0.0), v2(300.0, 300.0), 0.0, 0.0, 0.0, 0.0))
+        self.camera.target = vec_div(self.level.get_size(), 2.0)
+
+        self.level.set_layer_visibility("Background", False)
+        self.renderer = rl.load_render_texture(int(self.level.get_size().x), int(self.level.get_size().y))
+
+    def update(self, delta_time: float) -> None:
+        """Update camera framing and compute render placement.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        avg_position = v2(0.0, 0.0)
+        min_point = v2(float("inf"), float("inf"))
+        max_point = v2(float("-inf"), float("-inf"))
+        for character in self.characters:
+            char_pos = character.body.get_position_pixels()
+            avg_position = vec_add(avg_position, char_pos)
+            min_point.x = min(min_point.x, char_pos.x)
+            min_point.y = min(min_point.y, char_pos.y)
+            max_point.x = max(max_point.x, char_pos.x)
+            max_point.y = max(max_point.y, char_pos.y)
+        avg_position = vec_div(avg_position, float(len(self.characters)))
+        self.camera.target = avg_position
+        self.camera.target.x = math.floor(self.camera.target.x)
+        self.camera.target.y = math.floor(self.camera.target.y)
+
+        distance = math.sqrt((max_point.x - min_point.x) ** 2 + (max_point.y - min_point.y) ** 2)
+        level_diag = math.sqrt(self.level.get_size().x ** 2 + self.level.get_size().y ** 2)
+        zoom = level_diag / (distance + 400.0)
+        zoom = max(0.5, min(2.0, zoom))
+        self.camera.camera.zoom += (zoom - self.camera.camera.zoom) * min(1.0, delta_time * 5.0)
+
+        aspect_ratio = self.level.get_size().x / self.level.get_size().y
+        render_scale = rl.get_screen_height() / self.level.get_size().y
+        render_size = v2(self.level.get_size().y * render_scale * aspect_ratio, self.level.get_size().y * render_scale)
+        pos = vec_div(vec_sub(v2(float(rl.get_screen_width()), float(rl.get_screen_height())), render_size), 2.0)
+        self.render_rect = rl.Rectangle(pos.x, pos.y, render_size.x, render_size.y)
+
+        # Trigger scene change on Enter key or gamepad start button.
+        if rl.is_key_pressed(rl.KEY_ENTER) or rl.is_gamepad_button_pressed(0, rl.GAMEPAD_BUTTON_MIDDLE_RIGHT):
+            self.game.go_to_scene_next()
+
+    def draw_scene(self) -> None:
+        """Render the world to a texture and draw it centered.
+
+        Returns:
+            None
+        """
+        rl.begin_texture_mode(self.renderer)
+        rl.clear_background(rl.MAGENTA)
+        self.level.draw_layer("Background")
+        self.camera.draw_begin()
+        super().draw_scene()
+        self.camera.draw_end()
+        rl.end_texture_mode()
+
+        rl.draw_texture_pro(self.renderer.texture,
+                       rl.Rectangle(0.0, 0.0, float(self.renderer.texture.width), -float(self.renderer.texture.height)),
+                       self.render_rect,
+                       v2(0.0, 0.0),
+                       0.0,
+                       rl.Color(255, 255, 255, 255))
diff --git a/py/samples/title_screen.py b/py/samples/title_screen.py
new file mode 100644
index 0000000..4ab5c6b
--- /dev/null
+++ b/py/samples/title_screen.py
@@ -0,0 +1,47 @@
+import pyray as rl
+
+from engine.math_extensions import v2
+from engine.framework import Scene
+from engine.prefabs.includes import FontManager
+
+
+class TitleScreen(Scene):
+    def __init__(self):
+        super().__init__()
+        self.font = None
+        self.title = "Game Jam Kit"
+
+    def init(self):
+        font_manager = self.game.get_manager(FontManager)
+        self.font = font_manager.get_font("Roboto")
+
+    def update(self, delta_time):
+        # Trigger scene change on Enter key or gamepad start button.
+        if rl.is_key_pressed(rl.KEY_ENTER) or rl.is_gamepad_button_pressed(0, rl.GAMEPAD_BUTTON_MIDDLE_RIGHT):
+            self.game.go_to_scene_next()
+
+    def draw(self):
+        width = rl.get_screen_width()
+        height = rl.get_screen_height()
+        title_text_size = rl.measure_text_ex(self.font, self.title, 64, 0)
+
+        subtitle = "Press Start or Enter to Switch Scenes"
+        subtitle_text_size = rl.measure_text_ex(self.font, subtitle, 32, 0)
+
+        rl.clear_background(rl.SKYBLUE)
+        rl.draw_text_ex(
+            self.font,
+            self.title,
+            v2((width - title_text_size.x) / 2, (height - title_text_size.y - 100) / 2),
+            64,
+            1,
+            rl.WHITE,
+        )
+        rl.draw_text_ex(
+            self.font,
+            subtitle,
+            v2((width - subtitle_text_size.x) / 2, (height - subtitle_text_size.y + 100) / 2),
+            32,
+            1,
+            rl.WHITE,
+        )
diff --git a/py/samples/zombie_game.py b/py/samples/zombie_game.py
new file mode 100644
index 0000000..662a6a4
--- /dev/null
+++ b/py/samples/zombie_game.py
@@ -0,0 +1,467 @@
+"""Demonstration of a top-down shooter with light masking."""
+
+from __future__ import annotations
+
+import math
+from typing import List
+
+from Box2D import b2CircleShape, b2Vec2
+import pyray as rl
+
+from engine.framework import GameObject, Scene
+from engine.math_extensions import vec_add, vec_mul, vec_sub, v2
+from engine.prefabs.components import (BodyComponent, MultiComponent, SoundComponent,
+                                       SpriteComponent, TopDownMovementComponent,
+                                       TopDownMovementParams)
+from engine.prefabs.managers import FontManager
+from engine.prefabs.services import LevelService, PhysicsService, SoundService, TextureService
+
+RLGL_SRC_ALPHA = 0x0302
+RLGL_MIN = 0x8007
+
+
+class Bullet(GameObject):
+    """Projectile fired by a player character."""
+    def __init__(self) -> None:
+        """Prepare bullet component references and cached services.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.body: BodyComponent = None  # type: ignore[assignment]
+        self.sprite: SpriteComponent = None  # type: ignore[assignment]
+        self.hit_sound: SoundComponent = None  # type: ignore[assignment]
+        self.speed = 800.0
+
+    def init(self) -> None:
+        """Create the bullet body, sprite, and hit sound.
+
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+
+            Args:
+                component: Parameter.
+
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateDynamicBody(position=(self.physics.convert_to_meters(v2(-1000.0, -1000.0)).x,
+                                                     self.physics.convert_to_meters(v2(-1000.0, -1000.0)).y),
+                                           bullet=True)
+            body.userData = self
+            shape = b2CircleShape(radius=self.physics.convert_length_to_meters(8.0))
+            body.CreateFixture(shape=shape, density=0.25, friction=0.0, restitution=0.0)
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+        self.sprite = self.add_component(SpriteComponent("assets/zombie_shooter/bullet.png", self.body))
+        self.hit_sound = self.add_component(SoundComponent("assets/sounds/hit.wav"))
+
+    def update(self, delta_time: float) -> None:
+        """Handle collisions and deactivate on impact.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        for contact_body in self.body.get_contacts():
+            self.is_active = False
+            self.body.set_position(v2(-1000.0, -1000.0))
+            self.body.set_velocity(v2(0.0, 0.0))
+            other = contact_body.userData
+            if other and other.has_tag("zombie"):
+                self.hit_sound.play()
+                other.is_active = False
+                zombie_body = other.get_component(BodyComponent)
+                if zombie_body:
+                    zombie_body.set_position(v2(-1000.0, -1000.0))
+                    zombie_body.set_velocity(v2(0.0, 0.0))
+                    zombie_body.disable()
+                zombie_sprite = other.get_component(SpriteComponent)
+                if zombie_sprite:
+                    zombie_sprite.set_position(v2(-1000.0, -1000.0))
+                break
+
+
+class TopDownCharacter(GameObject):
+    """Top-down character controlled by player input."""
+    def __init__(self, position: rl.Vector2, bullets: List["Bullet"], player_num: int) -> None:
+        """Store spawn data, shared bullet pool, and player index.
+
+        Args:
+            position: Spawn position in pixels.
+            bullets: Shared list of Bullet objects to reuse.
+            player_num: Index used for controls and UI.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.position = position
+        self.bullets = bullets
+        self.player_num = player_num
+        self.health = 10
+        self.contact_timer = 1.0
+        self.contact_cooldown = 0.3
+        self.body: BodyComponent = None  # type: ignore[assignment]
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.sprite: SpriteComponent = None  # type: ignore[assignment]
+        self.movement: TopDownMovementComponent = None  # type: ignore[assignment]
+        self.sounds: MultiComponent = None  # type: ignore[assignment]
+        self.shoot_sound: SoundComponent = None  # type: ignore[assignment]
+
+    def init(self) -> None:
+        """Create body, movement, sounds, and sprite.
+
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+
+            Args:
+                component: Parameter.
+
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateDynamicBody(position=(self.physics.convert_to_meters(self.position).x,
+                                                     self.physics.convert_to_meters(self.position).y),
+                                           fixedRotation=True)
+            body.userData = self
+            shape = b2CircleShape(radius=self.physics.convert_length_to_meters(16.0))
+            body.CreateFixture(shape=shape, density=1.0)
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+
+        params = TopDownMovementParams()
+        params.accel = 5000.0
+        params.friction = 5000.0
+        params.max_speed = 350.0
+        self.movement = self.add_component(TopDownMovementComponent(params))
+
+        self.sounds = self.add_component(MultiComponent())
+        self.shoot_sound = self.sounds.add_component("shoot", SoundComponent, "assets/sounds/shoot.wav")
+
+        self.sprite = self.add_component(SpriteComponent(f"assets/zombie_shooter/player_{self.player_num + 1}.png"))
+
+    def update(self, delta_time: float) -> None:
+        """Handle movement, shooting, and damage over time.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        move = v2(0.0, 0.0)
+        move = v2(rl.get_gamepad_axis_movement(self.player_num, rl.GAMEPAD_AXIS_LEFT_X),
+                  rl.get_gamepad_axis_movement(self.player_num, rl.GAMEPAD_AXIS_LEFT_Y))
+
+        if rl.is_key_down(rl.KEY_W) or rl.is_gamepad_button_down(self.player_num, rl.GAMEPAD_BUTTON_LEFT_FACE_UP):
+            move.y -= 1.0
+        if rl.is_key_down(rl.KEY_S) or rl.is_gamepad_button_down(self.player_num, rl.GAMEPAD_BUTTON_LEFT_FACE_DOWN):
+            move.y += 1.0
+        if rl.is_key_down(rl.KEY_A) or rl.is_gamepad_button_down(self.player_num, rl.GAMEPAD_BUTTON_LEFT_FACE_LEFT):
+            move.x -= 1.0
+        if rl.is_key_down(rl.KEY_D) or rl.is_gamepad_button_down(self.player_num, rl.GAMEPAD_BUTTON_LEFT_FACE_RIGHT):
+            move.x += 1.0
+
+        self.movement.set_input(move.x, move.y)
+        self.sprite.set_position(self.body.get_position_pixels())
+        self.sprite.set_rotation(self.movement.facing_dir)
+
+        if rl.is_key_pressed(rl.KEY_SPACE) or rl.is_gamepad_button_pressed(self.player_num, rl.GAMEPAD_BUTTON_RIGHT_FACE_RIGHT):
+            for bullet in self.bullets:
+                if not bullet.is_active:
+                    self.shoot_sound.play()
+                    char_pos = self.body.get_position_pixels()
+                    shoot_dir = v2(math.cos(math.radians(self.movement.facing_dir)),
+                                   math.sin(math.radians(self.movement.facing_dir)))
+                    bullet_start = v2(char_pos.x + shoot_dir.x * 48.0, char_pos.y + shoot_dir.y * 48.0)
+                    bullet.body.set_position(bullet_start)
+                    bullet.body.set_rotation(self.movement.facing_dir + 90.0)
+                    bullet.body.set_velocity(v2(shoot_dir.x * bullet.speed, shoot_dir.y * bullet.speed))
+                    bullet.is_active = True
+                    break
+
+        for contact_body in self.body.get_contacts():
+            other = contact_body.userData
+            if other and other.has_tag("zombie"):
+                if self.contact_timer > 0.0:
+                    self.contact_timer -= delta_time
+                if self.contact_timer <= 0.0:
+                    self.health -= 1
+                    self.contact_timer = self.contact_cooldown
+                    if self.health <= 0:
+                        self.is_active = False
+                        self.body.set_position(v2(-1000.0, -1000.0))
+                        self.body.set_velocity(v2(0.0, 0.0))
+
+
+class Zombie(GameObject):
+    """Enemy that chases the closest player."""
+    def __init__(self, players: List[TopDownCharacter]) -> None:
+        """Store the list of players to chase.
+
+        Args:
+            players: Player characters to target.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.players = players
+        self.body: BodyComponent = None  # type: ignore[assignment]
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.sprite: SpriteComponent = None  # type: ignore[assignment]
+        self.movement: TopDownMovementComponent = None  # type: ignore[assignment]
+
+    def init(self) -> None:
+        """Create body, movement, and sprite (starts inactive).
+
+        Returns:
+            None
+        """
+        self.physics = self.scene.get_service(PhysicsService)
+
+        def build_body(component: BodyComponent):
+            """Build body.
+
+            Args:
+                component: Parameter.
+
+            Returns:
+                Result of the operation.
+            """
+            world = self.physics.world
+            body = world.CreateDynamicBody(position=(self.physics.convert_to_meters(v2(-1000.0, -1000.0)).x,
+                                                     self.physics.convert_to_meters(v2(-1000.0, -1000.0)).y),
+                                           fixedRotation=True)
+            body.userData = self
+            shape = b2CircleShape(radius=self.physics.convert_length_to_meters(16.0))
+            body.CreateFixture(shape=shape, density=1.0)
+            body.active = False
+            component.body = body
+
+        self.body = self.add_component(BodyComponent(build=build_body))
+
+        params = TopDownMovementParams()
+        params.accel = 5000.0
+        params.friction = 5000.0
+        params.max_speed = 100.0
+        self.movement = self.add_component(TopDownMovementComponent(params))
+
+        self.sprite = self.add_component(SpriteComponent("assets/zombie_shooter/zombie.png"))
+
+    def update(self, delta_time: float) -> None:
+        """Move toward the closest player and update sprite.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        closest_pos = v2(0.0, 0.0)
+        closest_dist_sq = float("inf")
+        for player in self.players:
+            player_pos = player.body.get_position_pixels()
+            to_player = vec_sub(player_pos, self.body.get_position_pixels())
+            dist_sq = to_player.x * to_player.x + to_player.y * to_player.y
+            if dist_sq < closest_dist_sq:
+                closest_dist_sq = dist_sq
+                closest_pos = player_pos
+        to_closest = vec_sub(closest_pos, self.body.get_position_pixels())
+        length = math.sqrt(to_closest.x * to_closest.x + to_closest.y * to_closest.y)
+        if length > 0.0:
+            to_closest.x /= length
+            to_closest.y /= length
+        self.movement.set_input(to_closest.x, to_closest.y)
+        self.sprite.set_position(self.body.get_position_pixels())
+        self.sprite.set_rotation(self.movement.facing_dir)
+
+
+class Spawner(GameObject):
+    """Spawner that activates zombies from a pool."""
+    def __init__(self, position: rl.Vector2, size: rl.Vector2, zombies: List[Zombie]) -> None:
+        """Configure spawn region and zombie pool.
+
+        Args:
+            position: Center of the spawn rectangle in pixels.
+            size: Size of the spawn rectangle in pixels.
+            zombies: Pool of zombie objects to activate.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.spawn_timer = 0.0
+        self.spawn_interval = 1.0
+        self.position = vec_sub(position, vec_mul(size, 0.5))
+        self.size = size
+        self.zombie_pool = zombies
+
+    def update(self, delta_time: float) -> None:
+        """Spawn zombies at an interval within a rectangle.
+
+        Args:
+            delta_time: Seconds since last frame.
+
+        Returns:
+            None
+        """
+        self.spawn_timer -= delta_time
+        if self.spawn_timer <= 0.0:
+            self.spawn_timer = self.spawn_interval
+            x = self.position.x + float(rl.get_random_value(0, int(self.size.x)))
+            y = self.position.y + float(rl.get_random_value(0, int(self.size.y)))
+            spawn_pos = v2(x, y)
+            for zombie in self.zombie_pool:
+                if not zombie.is_active:
+                    zombie.body.set_position(spawn_pos)
+                    zombie.is_active = True
+                    zombie.body.enable()
+                    return
+
+
+class ZombieScene(Scene):
+    """Scene for the zombie shooter game."""
+    def __init__(self) -> None:
+        """Initialize scene storage for services, actors, and render targets.
+
+        Returns:
+            None
+        """
+        super().__init__()
+        self.font_manager: FontManager = None  # type: ignore[assignment]
+        self.physics: PhysicsService = None  # type: ignore[assignment]
+        self.level: LevelService = None  # type: ignore[assignment]
+        self.renderer: rl.RenderTexture = None  # type: ignore[assignment]
+        self.light_map: rl.RenderTexture = None  # type: ignore[assignment]
+        self.light_texture: rl.Texture2D = None  # type: ignore[assignment]
+        self.bullets: List[Bullet] = []
+        self.characters: List[TopDownCharacter] = []
+        self.zombies: List[Zombie] = []
+
+    def init_services(self) -> None:
+        """Register services required by the scene.
+
+        Returns:
+            None
+        """
+        self.add_service(TextureService)
+        self.add_service(SoundService)
+        self.physics = self.add_service(PhysicsService, b2Vec2(0.0, 0.0))
+        collision_names = ["walls", "obstacles"]
+        self.level = self.add_service(LevelService, "assets/levels/top_down.ldtk", "Level", collision_names)
+        self.font_manager = self.game.get_manager(FontManager)
+
+    def init(self) -> None:
+        """Create pools, characters, spawner, and render textures.
+
+        Returns:
+            None
+        """
+        for _ in range(100):
+            bullet = self.add_game_object(Bullet())
+            bullet.is_active = False
+            self.bullets.append(bullet)
+
+        player_entities = self.level.get_entities_by_name("Start")
+        for i, player_entity in enumerate(player_entities[:4]):
+            position = self.level.convert_to_pixels(player_entity.getPosition())
+            character = self.add_game_object(TopDownCharacter(position, self.bullets, i))
+            character.add_tag("player")
+            self.characters.append(character)
+
+        for _ in range(100):
+            zombie = self.add_game_object(Zombie(self.characters))
+            zombie.is_active = False
+            zombie.add_tag("zombie")
+            self.zombies.append(zombie)
+
+        spawn_entity = self.level.get_entities_by_name("Spawn")[0]
+        spawn_position = self.level.convert_to_pixels(spawn_entity.getPosition())
+        spawn_size = self.level.convert_to_pixels(spawn_entity.getSize())
+        self.add_game_object(Spawner(spawn_position, spawn_size, self.zombies))
+
+        self.level.set_layer_visibility("Foreground", False)
+
+        self.renderer = rl.load_render_texture(int(self.level.get_size().x), int(self.level.get_size().y))
+        self.light_map = rl.load_render_texture(int(self.level.get_size().x), int(self.level.get_size().y))
+        self.light_texture = self.get_service(TextureService).get_texture("assets/zombie_shooter/light.png")
+
+    def update(self, delta_time: float) -> None:
+        # Trigger scene change on Enter key or gamepad start button.
+        if rl.is_key_pressed(rl.KEY_ENTER) or rl.is_gamepad_button_pressed(0, rl.GAMEPAD_BUTTON_MIDDLE_RIGHT):
+            self.game.go_to_scene_next()
+
+    def draw_scene(self) -> None:
+        """Build light mask and render the final frame.
+
+        Returns:
+            None
+        """
+
+        """Draw the scene.
+
+        Returns:
+            None
+        """
+        rl.begin_texture_mode(self.light_map)
+        rl.clear_background(rl.BLACK)
+        rl.rl_set_blend_factors(RLGL_SRC_ALPHA, RLGL_SRC_ALPHA, RLGL_MIN)
+        rl.rl_set_blend_mode(rl.BLEND_CUSTOM)
+
+        for i in range(min(4, len(self.characters))):
+            pos = self.characters[i].body.get_position_pixels()
+            rl.draw_texture(self.light_texture,
+                        int(pos.x - self.light_texture.width / 2),
+                        int(pos.y - self.light_texture.height / 2),
+                        rl.WHITE)
+
+        rl.rl_draw_render_batch_active()
+        rl.rl_set_blend_mode(rl.BLEND_ALPHA)
+        rl.end_texture_mode()
+
+        rl.begin_texture_mode(self.renderer)
+        rl.clear_background(rl.Color(255, 0, 255, 255))
+        super().draw_scene()
+        self.level.draw_layer("Foreground")
+        rl.draw_texture_pro(self.light_map.texture,
+                       rl.Rectangle(0.0, 0.0, float(self.light_map.texture.width), -float(self.light_map.texture.height)),
+                       rl.Rectangle(0.0, 0.0, float(self.light_map.texture.width), float(self.light_map.texture.height)),
+                       v2(0.0, 0.0),
+                       0.0,
+                       rl.color_alpha(rl.WHITE, 0.92))
+        rl.draw_rectangle(10, 10, 210, 210, rl.color_alpha(rl.WHITE, 0.3))
+        health_lines = [f"Health: {char.health}" for char in self.characters[:4]]
+        rl.draw_text_ex(self.font_manager.get_font("Roboto"),
+                   "\n".join(health_lines),
+                   v2(20.0, 20.0),
+                   45.0,
+                   1.0,
+                   rl.Color(230, 41, 55, 255))
+        rl.end_texture_mode()
+
+        rl.draw_texture_pro(self.renderer.texture,
+                       rl.Rectangle(0.0, 0.0, float(self.renderer.texture.width), -float(self.renderer.texture.height)),
+                       rl.Rectangle(0.0, 0.0, float(rl.get_screen_width()), float(rl.get_screen_height())),
+                       v2(0.0, 0.0),
+                       0.0,
+                       rl.WHITE)